部署到git

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php

@@ -0,0 +1,31 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+
+class ErrorHandlerTest extends \PHPUnit_Framework_TestCase
+{
+    public function testHandleError()
+    {
+        $logger = new Logger('test', array($handler = new TestHandler));
+        $errHandler = new ErrorHandler($logger);
+
+        $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false);
+        trigger_error('Foo', E_USER_ERROR);
+        $this->assertCount(1, $handler->getRecords());
+        $this->assertTrue($handler->hasErrorRecords());
+        trigger_error('Foo', E_USER_NOTICE);
+        $this->assertCount(2, $handler->getRecords());
+        $this->assertTrue($handler->hasEmergencyRecords());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php

@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testDefaultFormat()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                array(
+                    'message' => 'log',
+                    'context' => array('from' => 'logger'),
+                    'extra' => array('ip' => '127.0.0.1'),
+                ),
+                'unknown',
+                'error',
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::CRITICAL,
+            'level_name' => 'CRITICAL',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                array(
+                    'message' => 'log',
+                    'context' => array('from' => 'logger'),
+                    'extra' => array('ip' => '127.0.0.1'),
+                ),
+                'test : 14',
+                'error',
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::format
+     */
+    public function testFormatWithoutContext()
+    {
+        $formatter = new ChromePHPFormatter();
+        $record = array(
+            'level' => Logger::DEBUG,
+            'level_name' => 'DEBUG',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'meh',
+                'log',
+                'unknown',
+                'log',
+            ),
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch
+     */
+    public function testBatchFormatThrowException()
+    {
+        $formatter = new ChromePHPFormatter();
+        $records = array(
+            array(
+                'level' => Logger::INFO,
+                'level_name' => 'INFO',
+                'channel' => 'meh',
+                'context' => array(),
+                'datetime' => new \DateTime("@0"),
+                'extra' => array(),
+                'message' => 'log',
+            ),
+            array(
+                'level' => Logger::WARNING,
+                'level_name' => 'WARNING',
+                'channel' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime("@0"),
+                'extra' => array(),
+                'message' => 'log2',
+            ),
+        );
+
+        $this->assertEquals(
+            array(
+                array(
+                    'meh',
+                    'log',
+                    'unknown',
+                    'info',
+                ),
+                array(
+                    'foo',
+                    'log2',
+                    'unknown',
+                    'warn',
+                ),
+            ),
+            $formatter->formatBatch($records)
+        );
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php

@@ -0,0 +1,79 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists("Elastica\Document")) {
+            $this->markTestSkipped("ruflin/elastica not installed");
+        }
+    }
+
+    /**
+     * @covers Monolog\Formatter\ElasticaFormatter::__construct
+     * @covers Monolog\Formatter\ElasticaFormatter::format
+     * @covers Monolog\Formatter\ElasticaFormatter::getDocument
+     */
+    public function testFormat()
+    {
+        // test log message
+        $msg = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        // expected values
+        $expected = $msg;
+        $expected['datetime'] = '1970-01-01T00:00:00.000000+00:00';
+        $expected['context'] = array(
+            'class' => '[object] (stdClass: {})',
+            'foo' => 7,
+            0 => 'bar',
+        );
+
+        // format log message
+        $formatter = new ElasticaFormatter('my_index', 'doc_type');
+        $doc = $formatter->format($msg);
+        $this->assertInstanceOf('Elastica\Document', $doc);
+
+        // Document parameters
+        $params = $doc->getParams();
+        $this->assertEquals('my_index', $params['_index']);
+        $this->assertEquals('doc_type', $params['_type']);
+
+        // Document data values
+        $data = $doc->getData();
+        foreach (array_keys($expected) as $key) {
+            $this->assertEquals($expected[$key], $data[$key]);
+        }
+    }
+
+    /**
+     * @covers Monolog\Formatter\ElasticaFormatter::getIndex
+     * @covers Monolog\Formatter\ElasticaFormatter::getType
+     */
+    public function testGetters()
+    {
+        $formatter = new ElasticaFormatter('my_index', 'doc_type');
+        $this->assertEquals('my_index', $formatter->getIndex());
+        $this->assertEquals('doc_type', $formatter->getType());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php

@@ -0,0 +1,55 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FlowdockFormatterTest extends TestCase
+{
+    /**
+     * @covers Monolog\Formatter\FlowdockFormatter::format
+     */
+    public function testFormat()
+    {
+        $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+        $record = $this->getRecord();
+
+        $expected = array(
+            'source' => 'test_source',
+            'from_address' => 'source@test.com',
+            'subject' => 'in test_source: WARNING - test',
+            'content' => 'test',
+            'tags' => array('#logs', '#warning', '#test'),
+            'project' => 'test_source',
+        );
+        $formatted = $formatter->format($record);
+
+        $this->assertEquals($expected, $formatted['flowdock']);
+    }
+
+    /**
+     * @ covers Monolog\Formatter\FlowdockFormatter::formatBatch
+     */
+    public function testFormatBatch()
+    {
+        $formatter = new FlowdockFormatter('test_source', 'source@test.com');
+        $records = array(
+            $this->getRecord(Logger::WARNING),
+            $this->getRecord(Logger::DEBUG),
+        );
+        $formatted = $formatter->formatBatch($records);
+
+        $this->assertArrayHasKey('flowdock', $formatted[0]);
+        $this->assertArrayHasKey('flowdock', $formatted[1]);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/FluentdFormatterTest.php

@@ -0,0 +1,62 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FluentdFormatterTest extends TestCase
+{
+    /**
+     * @covers Monolog\Formatter\FluentdFormatter::__construct
+     * @covers Monolog\Formatter\FluentdFormatter::isUsingLevelsInTag
+     */
+    public function testConstruct()
+    {
+        $formatter = new FluentdFormatter();
+        $this->assertEquals(false, $formatter->isUsingLevelsInTag());
+        $formatter = new FluentdFormatter(false);
+        $this->assertEquals(false, $formatter->isUsingLevelsInTag());
+        $formatter = new FluentdFormatter(true);
+        $this->assertEquals(true, $formatter->isUsingLevelsInTag());
+    }
+
+    /**
+     * @covers Monolog\Formatter\FluentdFormatter::format
+     */
+    public function testFormat()
+    {
+        $record = $this->getRecord(Logger::WARNING);
+        $record['datetime'] = new \DateTime("@0");
+
+        $formatter = new FluentdFormatter();
+        $this->assertEquals(
+            '["test",0,{"message":"test","context":[],"extra":[],"level":300,"level_name":"WARNING"}]',
+            $formatter->format($record)
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\FluentdFormatter::format
+     */
+    public function testFormatWithTag()
+    {
+        $record = $this->getRecord(Logger::ERROR);
+        $record['datetime'] = new \DateTime("@0");
+
+        $formatter = new FluentdFormatter(true);
+        $this->assertEquals(
+            '["test.error",0,{"message":"test","context":[],"extra":[]}]',
+            $formatter->format($record)
+        );
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php

@@ -0,0 +1,258 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('\Gelf\Message')) {
+            $this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed");
+        }
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testDefaultFormatter()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals(0, $message->getTimestamp());
+        $this->assertEquals('log', $message->getShortMessage());
+        $this->assertEquals('meh', $message->getFacility());
+        $this->assertEquals(null, $message->getLine());
+        $this->assertEquals(null, $message->getFile());
+        $this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel());
+        $this->assertNotEmpty($message->getHost());
+
+        $formatter = new GelfMessageFormatter('mysystem');
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals('mysystem', $message->getHost());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+        $this->assertEquals('test', $message->getFile());
+        $this->assertEquals(14, $message->getLine());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     * @expectedException InvalidArgumentException
+     */
+    public function testFormatInvalidFails()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+        );
+
+        $formatter->format($record);
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithContext()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_ctxt_from', $message_array);
+        $this->assertEquals('logger', $message_array['_ctxt_from']);
+
+        // Test with extraPrefix
+        $formatter = new GelfMessageFormatter(null, null, 'CTX');
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_CTXfrom', $message_array);
+        $this->assertEquals('logger', $message_array['_CTXfrom']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithContextContainingException()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger', 'exception' => array(
+                'class' => '\Exception',
+                'file'  => '/some/file/in/dir.php:56',
+                'trace' => array('/some/file/1.php:23', '/some/file/2.php:3'),
+            )),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $this->assertEquals("/some/file/in/dir.php", $message->getFile());
+        $this->assertEquals("56", $message->getLine());
+    }
+
+    /**
+     * @covers Monolog\Formatter\GelfMessageFormatter::format
+     */
+    public function testFormatWithExtra()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log',
+        );
+
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_key', $message_array);
+        $this->assertEquals('pair', $message_array['_key']);
+
+        // Test with extraPrefix
+        $formatter = new GelfMessageFormatter(null, 'EXT');
+        $message = $formatter->format($record);
+
+        $this->assertInstanceOf('Gelf\Message', $message);
+
+        $message_array = $message->toArray();
+
+        $this->assertArrayHasKey('_EXTkey', $message_array);
+        $this->assertEquals('pair', $message_array['_EXTkey']);
+    }
+
+    public function testFormatWithLargeData()
+    {
+        $formatter = new GelfMessageFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('exception' => str_repeat(' ', 32767)),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => str_repeat(' ', 32767)),
+            'message' => 'log'
+        );
+        $message = $formatter->format($record);
+        $messageArray = $message->toArray();
+
+        // 200 for padding + metadata
+        $length = 200;
+
+        foreach ($messageArray as $key => $value) {
+            if (!in_array($key, array('level', 'timestamp'))) {
+                $length += strlen($value);
+            }
+        }
+
+        $this->assertLessThanOrEqual(65792, $length, 'The message length is no longer than the maximum allowed length');
+    }
+
+    public function testFormatWithUnlimitedLength()
+    {
+        $formatter = new GelfMessageFormatter('LONG_SYSTEM_NAME', null, 'ctxt_', PHP_INT_MAX);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('exception' => str_repeat(' ', 32767 * 2)),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => str_repeat(' ', 32767 * 2)),
+            'message' => 'log'
+        );
+        $message = $formatter->format($record);
+        $messageArray = $message->toArray();
+
+        // 200 for padding + metadata
+        $length = 200;
+
+        foreach ($messageArray as $key => $value) {
+            if (!in_array($key, array('level', 'timestamp'))) {
+                $length += strlen($value);
+            }
+        }
+
+        $this->assertGreaterThanOrEqual(131289, $length, 'The message should not be truncated');
+    }
+
+    private function isLegacy()
+    {
+        return interface_exists('\Gelf\IMessagePublisher');
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php

@@ -0,0 +1,219 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class JsonFormatterTest extends TestCase
+{
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::__construct
+     * @covers Monolog\Formatter\JsonFormatter::getBatchMode
+     * @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines
+     */
+    public function testConstruct()
+    {
+        $formatter = new JsonFormatter();
+        $this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+        $this->assertEquals(true, $formatter->isAppendingNewlines());
+        $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false);
+        $this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+        $this->assertEquals(false, $formatter->isAppendingNewlines());
+    }
+
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::format
+     */
+    public function testFormat()
+    {
+        $formatter = new JsonFormatter();
+        $record = $this->getRecord();
+        $this->assertEquals(json_encode($record)."\n", $formatter->format($record));
+
+        $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false);
+        $record = $this->getRecord();
+        $this->assertEquals(json_encode($record), $formatter->format($record));
+    }
+
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::formatBatch
+     * @covers Monolog\Formatter\JsonFormatter::formatBatchJson
+     */
+    public function testFormatBatch()
+    {
+        $formatter = new JsonFormatter();
+        $records = array(
+            $this->getRecord(Logger::WARNING),
+            $this->getRecord(Logger::DEBUG),
+        );
+        $this->assertEquals(json_encode($records), $formatter->formatBatch($records));
+    }
+
+    /**
+     * @covers Monolog\Formatter\JsonFormatter::formatBatch
+     * @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines
+     */
+    public function testFormatBatchNewlines()
+    {
+        $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES);
+        $records = $expected = array(
+            $this->getRecord(Logger::WARNING),
+            $this->getRecord(Logger::DEBUG),
+        );
+        array_walk($expected, function (&$value, $key) {
+            $value = json_encode($value);
+        });
+        $this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records));
+    }
+
+    public function testDefFormatWithException()
+    {
+        $formatter = new JsonFormatter();
+        $exception = new \RuntimeException('Foo');
+        $formattedException = $this->formatException($exception);
+
+        $message = $this->formatRecordWithExceptionInContext($formatter, $exception);
+
+        $this->assertContextContainsFormattedException($formattedException, $message);
+    }
+
+    public function testDefFormatWithPreviousException()
+    {
+        $formatter = new JsonFormatter();
+        $exception = new \RuntimeException('Foo', 0, new \LogicException('Wut?'));
+        $formattedPrevException = $this->formatException($exception->getPrevious());
+        $formattedException = $this->formatException($exception, $formattedPrevException);
+
+        $message = $this->formatRecordWithExceptionInContext($formatter, $exception);
+
+        $this->assertContextContainsFormattedException($formattedException, $message);
+    }
+
+    public function testDefFormatWithThrowable()
+    {
+        if (!class_exists('Error') || !is_subclass_of('Error', 'Throwable')) {
+            $this->markTestSkipped('Requires PHP >=7');
+        }
+
+        $formatter = new JsonFormatter();
+        $throwable = new \Error('Foo');
+        $formattedThrowable = $this->formatException($throwable);
+
+        $message = $this->formatRecordWithExceptionInContext($formatter, $throwable);
+
+        $this->assertContextContainsFormattedException($formattedThrowable, $message);
+    }
+
+    /**
+     * @param string $expected
+     * @param string $actual
+     *
+     * @internal param string $exception
+     */
+    private function assertContextContainsFormattedException($expected, $actual)
+    {
+        $this->assertEquals(
+            '{"level_name":"CRITICAL","channel":"core","context":{"exception":'.$expected.'},"datetime":null,"extra":[],"message":"foobar"}'."\n",
+            $actual
+        );
+    }
+
+    /**
+     * @param JsonFormatter $formatter
+     * @param \Exception|\Throwable $exception
+     *
+     * @return string
+     */
+    private function formatRecordWithExceptionInContext(JsonFormatter $formatter, $exception)
+    {
+        $message = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'core',
+            'context' => array('exception' => $exception),
+            'datetime' => null,
+            'extra' => array(),
+            'message' => 'foobar',
+        ));
+        return $message;
+    }
+
+    /**
+     * @param \Exception|\Throwable $exception
+     *
+     * @return string
+     */
+    private function formatExceptionFilePathWithLine($exception)
+    {
+        $options = 0;
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            $options = JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE;
+        }
+        $path = substr(json_encode($exception->getFile(), $options), 1, -1);
+        return $path . ':' . $exception->getLine();
+    }
+
+    /**
+     * @param \Exception|\Throwable $exception
+     *
+     * @param null|string $previous
+     *
+     * @return string
+     */
+    private function formatException($exception, $previous = null)
+    {
+        $formattedException =
+            '{"class":"' . get_class($exception) .
+            '","message":"' . $exception->getMessage() .
+            '","code":' . $exception->getCode() .
+            ',"file":"' . $this->formatExceptionFilePathWithLine($exception) .
+            ($previous ? '","previous":' . $previous : '"') .
+            '}';
+        return $formattedException;
+    }
+
+    public function testNormalizeHandleLargeArraysWithExactly1000Items()
+    {
+        $formatter = new NormalizerFormatter();
+        $largeArray = range(1, 1000);
+
+        $res = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'test',
+            'message' => 'bar',
+            'context' => array($largeArray),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+        ));
+
+        $this->assertCount(1000, $res['context'][0]);
+        $this->assertArrayNotHasKey('...', $res['context'][0]);
+    }
+
+    public function testNormalizeHandleLargeArrays()
+    {
+        $formatter = new NormalizerFormatter();
+        $largeArray = range(1, 2000);
+
+        $res = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'test',
+            'message' => 'bar',
+            'context' => array($largeArray),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+        ));
+
+        $this->assertCount(1001, $res['context'][0]);
+        $this->assertEquals('Over 1000 items (2000 total), aborting normalization', $res['context'][0]['...']);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php

@@ -0,0 +1,222 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\LineFormatter
+ */
+class LineFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function testDefFormatWithString()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'WARNING',
+            'channel' => 'log',
+            'context' => array(),
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array(),
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+    }
+
+    public function testDefFormatWithArrayContext()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+                'bool' => false,
+                'null' => null,
+            ),
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message);
+    }
+
+    public function testDefFormatExtras()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message);
+    }
+
+    public function testFormatExtras()
+    {
+        $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test'),
+            'message' => 'log',
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message);
+    }
+
+    public function testContextAndExtraOptionallyNotShownIfEmpty()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d', false, true);
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'message' => 'log',
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log  '."\n", $message);
+    }
+
+    public function testContextAndExtraReplacement()
+    {
+        $formatter = new LineFormatter('%context.foo% => %extra.foo%');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('foo' => 'bar'),
+            'datetime' => new \DateTime,
+            'extra' => array('foo' => 'xbar'),
+            'message' => 'log',
+        ));
+        $this->assertEquals('bar => xbar', $message);
+    }
+
+    public function testDefFormatWithObject()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime,
+            'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+            'message' => 'foobar',
+        ));
+
+        $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: bar)","baz":[],"res":"[resource] (stream)"}'."\n", $message);
+    }
+
+    public function testDefFormatWithException()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'core',
+            'context' => array('exception' => new \RuntimeException('Foo')),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'message' => 'foobar',
+        ));
+
+        $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+        $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__ - 8).')"} []'."\n", $message);
+    }
+
+    public function testDefFormatWithPreviousException()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $previous = new \LogicException('Wut?');
+        $message = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'core',
+            'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+            'message' => 'foobar',
+        ));
+
+        $path = str_replace('\\/', '/', json_encode(__FILE__));
+
+        $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__ - 8).', LogicException(code: 0): Wut? at '.substr($path, 1, -1).':'.(__LINE__ - 12).')"} []'."\n", $message);
+    }
+
+    public function testBatchFormat()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->formatBatch(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+        ));
+        $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message);
+    }
+
+    public function testFormatShouldStripInlineLineBreaks()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d');
+        $message = $formatter->format(
+            array(
+                'message' => "foo\nbar",
+                'context' => array(),
+                'extra' => array(),
+            )
+        );
+
+        $this->assertRegExp('/foo bar/', $message);
+    }
+
+    public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet()
+    {
+        $formatter = new LineFormatter(null, 'Y-m-d', true);
+        $message = $formatter->format(
+            array(
+                'message' => "foo\nbar",
+                'context' => array(),
+                'extra' => array(),
+            )
+        );
+
+        $this->assertRegExp('/foo\nbar/', $message);
+    }
+}
+
+class TestFoo
+{
+    public $foo = 'foo';
+}
+
+class TestBar
+{
+    public function __toString()
+    {
+        return 'bar';
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php

@@ -0,0 +1,40 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\TestCase;
+
+class LogglyFormatterTest extends TestCase
+{
+    /**
+     * @covers Monolog\Formatter\LogglyFormatter::__construct
+     */
+    public function testConstruct()
+    {
+        $formatter = new LogglyFormatter();
+        $this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode());
+        $formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON);
+        $this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode());
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogglyFormatter::format
+     */
+    public function testFormat()
+    {
+        $formatter = new LogglyFormatter();
+        $record = $this->getRecord();
+        $formatted_decoded = json_decode($formatter->format($record), true);
+        $this->assertArrayHasKey("timestamp", $formatted_decoded);
+        $this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php

@@ -0,0 +1,333 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class LogstashFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function tearDown()
+    {
+        \PHPUnit_Framework_Error_Warning::$enabled = true;
+
+        return parent::tearDown();
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testDefaultFormatter()
+    {
+        $formatter = new LogstashFormatter('test', 'hostname');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+        $this->assertEquals('log', $message['@message']);
+        $this->assertEquals('meh', $message['@fields']['channel']);
+        $this->assertContains('meh', $message['@tags']);
+        $this->assertEquals(Logger::ERROR, $message['@fields']['level']);
+        $this->assertEquals('test', $message['@type']);
+        $this->assertEquals('hostname', $message['@source']);
+
+        $formatter = new LogstashFormatter('mysystem');
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('mysystem', $message['@type']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $formatter = new LogstashFormatter('test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('test', $message['@fields']['file']);
+        $this->assertEquals(14, $message['@fields']['line']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithContext()
+    {
+        $formatter = new LogstashFormatter('test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('ctxt_from', $message_array);
+        $this->assertEquals('logger', $message_array['ctxt_from']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, null, 'CTX');
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('CTXfrom', $message_array);
+        $this->assertEquals('logger', $message_array['CTXfrom']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithExtra()
+    {
+        $formatter = new LogstashFormatter('test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('key', $message_array);
+        $this->assertEquals('pair', $message_array['key']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, 'EXT');
+        $message = json_decode($formatter->format($record), true);
+
+        $message_array = $message['@fields'];
+
+        $this->assertArrayHasKey('EXTkey', $message_array);
+        $this->assertEquals('pair', $message_array['EXTkey']);
+    }
+
+    public function testFormatWithApplicationName()
+    {
+        $formatter = new LogstashFormatter('app', 'test');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('@type', $message);
+        $this->assertEquals('app', $message['@type']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testDefaultFormatterV1()
+    {
+        $formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+        $this->assertEquals("1", $message['@version']);
+        $this->assertEquals('log', $message['message']);
+        $this->assertEquals('meh', $message['channel']);
+        $this->assertEquals('ERROR', $message['level']);
+        $this->assertEquals('test', $message['type']);
+        $this->assertEquals('hostname', $message['host']);
+
+        $formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1);
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('mysystem', $message['type']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithFileAndLineV1()
+    {
+        $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals('test', $message['file']);
+        $this->assertEquals(14, $message['line']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithContextV1()
+    {
+        $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('ctxt_from', $message);
+        $this->assertEquals('logger', $message['ctxt_from']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1);
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('CTXfrom', $message);
+        $this->assertEquals('logger', $message['CTXfrom']);
+    }
+
+    /**
+     * @covers Monolog\Formatter\LogstashFormatter::format
+     */
+    public function testFormatWithExtraV1()
+    {
+        $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('key', $message);
+        $this->assertEquals('pair', $message['key']);
+
+        // Test with extraPrefix
+        $formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1);
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('EXTkey', $message);
+        $this->assertEquals('pair', $message['EXTkey']);
+    }
+
+    public function testFormatWithApplicationNameV1()
+    {
+        $formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1);
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('key' => 'pair'),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertArrayHasKey('type', $message);
+        $this->assertEquals('app', $message['type']);
+    }
+
+    public function testFormatWithLatin9Data()
+    {
+        if (version_compare(PHP_VERSION, '5.5.0', '<')) {
+            // Ignore the warning that will be emitted by PHP <5.5.0
+            \PHPUnit_Framework_Error_Warning::$enabled = false;
+        }
+        $formatter = new LogstashFormatter('test', 'hostname');
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => '¯\_(ツ)_/¯',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(
+                'user_agent' => "\xD6WN; FBCR/OrangeEspa\xF1a; Vers\xE3o/4.0; F\xE4rist",
+            ),
+            'message' => 'log',
+        );
+
+        $message = json_decode($formatter->format($record), true);
+
+        $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']);
+        $this->assertEquals('log', $message['@message']);
+        $this->assertEquals('¯\_(ツ)_/¯', $message['@fields']['channel']);
+        $this->assertContains('¯\_(ツ)_/¯', $message['@tags']);
+        $this->assertEquals(Logger::ERROR, $message['@fields']['level']);
+        $this->assertEquals('test', $message['@type']);
+        $this->assertEquals('hostname', $message['@source']);
+        if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
+            $this->assertEquals('ÖWN; FBCR/OrangeEspaña; Versão/4.0; Färist', $message['@fields']['user_agent']);
+        } else {
+            // PHP <5.5 does not return false for an element encoding failure,
+            // instead it emits a warning (possibly) and nulls the value.
+            $this->assertEquals(null, $message['@fields']['user_agent']);
+        }
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php

@@ -0,0 +1,262 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+/**
+ * @author Florian Plattner <me@florianplattner.de>
+ */
+class MongoDBFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('MongoDate')) {
+            $this->markTestSkipped('mongo extension not installed');
+        }
+    }
+
+    public function constructArgumentProvider()
+    {
+        return array(
+            array(1, true, 1, true),
+            array(0, false, 0, false),
+        );
+    }
+
+    /**
+     * @param $traceDepth
+     * @param $traceAsString
+     * @param $expectedTraceDepth
+     * @param $expectedTraceAsString
+     *
+     * @dataProvider constructArgumentProvider
+     */
+    public function testConstruct($traceDepth, $traceAsString, $expectedTraceDepth, $expectedTraceAsString)
+    {
+        $formatter = new MongoDBFormatter($traceDepth, $traceAsString);
+
+        $reflTrace = new \ReflectionProperty($formatter, 'exceptionTraceAsString');
+        $reflTrace->setAccessible(true);
+        $this->assertEquals($expectedTraceAsString, $reflTrace->getValue($formatter));
+
+        $reflDepth = new\ReflectionProperty($formatter, 'maxNestingLevel');
+        $reflDepth->setAccessible(true);
+        $this->assertEquals($expectedTraceDepth, $reflDepth->getValue($formatter));
+    }
+
+    public function testSimpleFormat()
+    {
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter();
+        $formattedRecord = $formatter->format($record);
+
+        $this->assertCount(7, $formattedRecord);
+        $this->assertEquals('some log message', $formattedRecord['message']);
+        $this->assertEquals(array(), $formattedRecord['context']);
+        $this->assertEquals(Logger::WARNING, $formattedRecord['level']);
+        $this->assertEquals(Logger::getLevelName(Logger::WARNING), $formattedRecord['level_name']);
+        $this->assertEquals('test', $formattedRecord['channel']);
+        $this->assertInstanceOf('\MongoDate', $formattedRecord['datetime']);
+        $this->assertEquals('0.00000000 1391212800', $formattedRecord['datetime']->__toString());
+        $this->assertEquals(array(), $formattedRecord['extra']);
+    }
+
+    public function testRecursiveFormat()
+    {
+        $someObject = new \stdClass();
+        $someObject->foo = 'something';
+        $someObject->bar = 'stuff';
+
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'stuff' => new \DateTime('2014-02-01 02:31:33'),
+                'some_object' => $someObject,
+                'context_string' => 'some string',
+                'context_int' => 123456,
+                'except' => new \Exception('exception message', 987),
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter();
+        $formattedRecord = $formatter->format($record);
+
+        $this->assertCount(5, $formattedRecord['context']);
+        $this->assertInstanceOf('\MongoDate', $formattedRecord['context']['stuff']);
+        $this->assertEquals('0.00000000 1391221893', $formattedRecord['context']['stuff']->__toString());
+        $this->assertEquals(
+            array(
+                'foo' => 'something',
+                'bar' => 'stuff',
+                'class' => 'stdClass',
+            ),
+            $formattedRecord['context']['some_object']
+        );
+        $this->assertEquals('some string', $formattedRecord['context']['context_string']);
+        $this->assertEquals(123456, $formattedRecord['context']['context_int']);
+
+        $this->assertCount(5, $formattedRecord['context']['except']);
+        $this->assertEquals('exception message', $formattedRecord['context']['except']['message']);
+        $this->assertEquals(987, $formattedRecord['context']['except']['code']);
+        $this->assertInternalType('string', $formattedRecord['context']['except']['file']);
+        $this->assertInternalType('integer', $formattedRecord['context']['except']['code']);
+        $this->assertInternalType('string', $formattedRecord['context']['except']['trace']);
+        $this->assertEquals('Exception', $formattedRecord['context']['except']['class']);
+    }
+
+    public function testFormatDepthArray()
+    {
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'nest2' => array(
+                    'property' => 'anything',
+                    'nest3' => array(
+                        'nest4' => 'value',
+                        'property' => 'nothing',
+                    ),
+                ),
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter(2);
+        $formattedResult = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'nest2' => array(
+                    'property' => 'anything',
+                    'nest3' => '[...]',
+                ),
+            ),
+            $formattedResult['context']
+        );
+    }
+
+    public function testFormatDepthArrayInfiniteNesting()
+    {
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'nest2' => array(
+                    'property' => 'something',
+                    'nest3' => array(
+                        'property' => 'anything',
+                        'nest4' => array(
+                            'property' => 'nothing',
+                        ),
+                    ),
+                ),
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter(0);
+        $formattedResult = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'nest2' => array(
+                    'property' => 'something',
+                    'nest3' => array(
+                        'property' => 'anything',
+                        'nest4' => array(
+                            'property' => 'nothing',
+                        ),
+                    ),
+                ),
+            ),
+            $formattedResult['context']
+        );
+    }
+
+    public function testFormatDepthObjects()
+    {
+        $someObject = new \stdClass();
+        $someObject->property = 'anything';
+        $someObject->nest3 = new \stdClass();
+        $someObject->nest3->property = 'nothing';
+        $someObject->nest3->nest4 = 'invisible';
+
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'nest2' => $someObject,
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter(2, true);
+        $formattedResult = $formatter->format($record);
+
+        $this->assertEquals(
+            array(
+                'nest2' => array(
+                    'property' => 'anything',
+                    'nest3' => '[...]',
+                    'class' => 'stdClass',
+                ),
+            ),
+            $formattedResult['context']
+        );
+    }
+
+    public function testFormatDepthException()
+    {
+        $record = array(
+            'message' => 'some log message',
+            'context' => array(
+                'nest2' => new \Exception('exception message', 987),
+            ),
+            'level' => Logger::WARNING,
+            'level_name' => Logger::getLevelName(Logger::WARNING),
+            'channel' => 'test',
+            'datetime' => new \DateTime('2014-02-01 00:00:00'),
+            'extra' => array(),
+        );
+
+        $formatter = new MongoDBFormatter(2, false);
+        $formattedRecord = $formatter->format($record);
+
+        $this->assertEquals('exception message', $formattedRecord['context']['nest2']['message']);
+        $this->assertEquals(987, $formattedRecord['context']['nest2']['code']);
+        $this->assertEquals('[...]', $formattedRecord['context']['nest2']['trace']);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php

@@ -0,0 +1,481 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+/**
+ * @covers Monolog\Formatter\NormalizerFormatter
+ */
+class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    public function tearDown()
+    {
+        \PHPUnit_Framework_Error_Warning::$enabled = true;
+
+        return parent::tearDown();
+    }
+
+    public function testFormat()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $formatted = $formatter->format(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => new \DateTime,
+            'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+                'inf' => INF,
+                '-inf' => -INF,
+                'nan' => acos(4),
+            ),
+        ));
+
+        $this->assertEquals(array(
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'message' => 'foo',
+            'datetime' => date('Y-m-d'),
+            'extra' => array(
+                'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})',
+                'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: bar)',
+                'baz' => array(),
+                'res' => '[resource] (stream)',
+            ),
+            'context' => array(
+                'foo' => 'bar',
+                'baz' => 'qux',
+                'inf' => 'INF',
+                '-inf' => '-INF',
+                'nan' => 'NaN',
+            ),
+        ), $formatted);
+    }
+
+    public function testFormatExceptions()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $e = new \LogicException('bar');
+        $e2 = new \RuntimeException('foo', 0, $e);
+        $formatted = $formatter->format(array(
+            'exception' => $e2,
+        ));
+
+        $this->assertGreaterThan(5, count($formatted['exception']['trace']));
+        $this->assertTrue(isset($formatted['exception']['previous']));
+        unset($formatted['exception']['trace'], $formatted['exception']['previous']);
+
+        $this->assertEquals(array(
+            'exception' => array(
+                'class'   => get_class($e2),
+                'message' => $e2->getMessage(),
+                'code'    => $e2->getCode(),
+                'file'    => $e2->getFile().':'.$e2->getLine(),
+            ),
+        ), $formatted);
+    }
+
+    public function testFormatSoapFaultException()
+    {
+        if (!class_exists('SoapFault')) {
+            $this->markTestSkipped('Requires the soap extension');
+        }
+
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $e = new \SoapFault('foo', 'bar', 'hello', 'world');
+        $formatted = $formatter->format(array(
+            'exception' => $e,
+        ));
+
+        unset($formatted['exception']['trace']);
+
+        $this->assertEquals(array(
+            'exception' => array(
+                'class' => 'SoapFault',
+                'message' => 'bar',
+                'code' => 0,
+                'file' => $e->getFile().':'.$e->getLine(),
+                'faultcode' => 'foo',
+                'faultactor' => 'hello',
+                'detail' => 'world',
+            ),
+        ), $formatted);
+    }
+
+    public function testFormatToStringExceptionHandle()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $this->setExpectedException('RuntimeException', 'Could not convert to string');
+        $formatter->format(array(
+            'myObject' => new TestToStringError(),
+        ));
+    }
+
+    public function testBatchFormat()
+    {
+        $formatter = new NormalizerFormatter('Y-m-d');
+        $formatted = $formatter->formatBatch(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => new \DateTime,
+                'extra' => array(),
+            ),
+        ));
+        $this->assertEquals(array(
+            array(
+                'level_name' => 'CRITICAL',
+                'channel' => 'test',
+                'message' => 'bar',
+                'context' => array(),
+                'datetime' => date('Y-m-d'),
+                'extra' => array(),
+            ),
+            array(
+                'level_name' => 'WARNING',
+                'channel' => 'log',
+                'message' => 'foo',
+                'context' => array(),
+                'datetime' => date('Y-m-d'),
+                'extra' => array(),
+            ),
+        ), $formatted);
+    }
+
+    /**
+     * Test issue #137
+     */
+    public function testIgnoresRecursiveObjectReferences()
+    {
+        // set up the recursion
+        $foo = new \stdClass();
+        $bar = new \stdClass();
+
+        $foo->bar = $bar;
+        $bar->foo = $foo;
+
+        // set an error handler to assert that the error is not raised anymore
+        $that = $this;
+        set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+            if (error_reporting() & $level) {
+                restore_error_handler();
+                $that->fail("$message should not be raised");
+            }
+        });
+
+        $formatter = new NormalizerFormatter();
+        $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+        $reflMethod->setAccessible(true);
+        $res = $reflMethod->invoke($formatter, array($foo, $bar), true);
+
+        restore_error_handler();
+
+        $this->assertEquals(@json_encode(array($foo, $bar)), $res);
+    }
+
+    public function testCanNormalizeReferences()
+    {
+        $formatter = new NormalizerFormatter();
+        $x = array('foo' => 'bar');
+        $y = array('x' => &$x);
+        $x['y'] = &$y;
+        $formatter->format($y);
+    }
+
+    public function testIgnoresInvalidTypes()
+    {
+        // set up the recursion
+        $resource = fopen(__FILE__, 'r');
+
+        // set an error handler to assert that the error is not raised anymore
+        $that = $this;
+        set_error_handler(function ($level, $message, $file, $line, $context) use ($that) {
+            if (error_reporting() & $level) {
+                restore_error_handler();
+                $that->fail("$message should not be raised");
+            }
+        });
+
+        $formatter = new NormalizerFormatter();
+        $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+        $reflMethod->setAccessible(true);
+        $res = $reflMethod->invoke($formatter, array($resource), true);
+
+        restore_error_handler();
+
+        $this->assertEquals(@json_encode(array($resource)), $res);
+    }
+
+    public function testNormalizeHandleLargeArraysWithExactly1000Items()
+    {
+        $formatter = new NormalizerFormatter();
+        $largeArray = range(1, 1000);
+
+        $res = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'test',
+            'message' => 'bar',
+            'context' => array($largeArray),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+        ));
+
+        $this->assertCount(1000, $res['context'][0]);
+        $this->assertArrayNotHasKey('...', $res['context'][0]);
+    }
+
+    public function testNormalizeHandleLargeArrays()
+    {
+        $formatter = new NormalizerFormatter();
+        $largeArray = range(1, 2000);
+
+        $res = $formatter->format(array(
+            'level_name' => 'CRITICAL',
+            'channel' => 'test',
+            'message' => 'bar',
+            'context' => array($largeArray),
+            'datetime' => new \DateTime,
+            'extra' => array(),
+        ));
+
+        $this->assertCount(1001, $res['context'][0]);
+        $this->assertEquals('Over 1000 items (2000 total), aborting normalization', $res['context'][0]['...']);
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testThrowsOnInvalidEncoding()
+    {
+        if (version_compare(PHP_VERSION, '5.5.0', '<')) {
+            // Ignore the warning that will be emitted by PHP <5.5.0
+            \PHPUnit_Framework_Error_Warning::$enabled = false;
+        }
+        $formatter = new NormalizerFormatter();
+        $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+        $reflMethod->setAccessible(true);
+
+        // send an invalid unicode sequence as a object that can't be cleaned
+        $record = new \stdClass;
+        $record->message = "\xB1\x31";
+        $res = $reflMethod->invoke($formatter, $record);
+        if (PHP_VERSION_ID < 50500 && $res === '{"message":null}') {
+            throw new \RuntimeException('PHP 5.3/5.4 throw a warning and null the value instead of returning false entirely');
+        }
+    }
+
+    public function testConvertsInvalidEncodingAsLatin9()
+    {
+        if (version_compare(PHP_VERSION, '5.5.0', '<')) {
+            // Ignore the warning that will be emitted by PHP <5.5.0
+            \PHPUnit_Framework_Error_Warning::$enabled = false;
+        }
+        $formatter = new NormalizerFormatter();
+        $reflMethod = new \ReflectionMethod($formatter, 'toJson');
+        $reflMethod->setAccessible(true);
+
+        $res = $reflMethod->invoke($formatter, array('message' => "\xA4\xA6\xA8\xB4\xB8\xBC\xBD\xBE"));
+
+        if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
+            $this->assertSame('{"message":"€ŠšŽžŒœŸ"}', $res);
+        } else {
+            // PHP <5.5 does not return false for an element encoding failure,
+            // instead it emits a warning (possibly) and nulls the value.
+            $this->assertSame('{"message":null}', $res);
+        }
+    }
+
+    /**
+     * @param mixed $in     Input
+     * @param mixed $expect Expected output
+     * @covers Monolog\Formatter\NormalizerFormatter::detectAndCleanUtf8
+     * @dataProvider providesDetectAndCleanUtf8
+     */
+    public function testDetectAndCleanUtf8($in, $expect)
+    {
+        $formatter = new NormalizerFormatter();
+        $formatter->detectAndCleanUtf8($in);
+        $this->assertSame($expect, $in);
+    }
+
+    public function providesDetectAndCleanUtf8()
+    {
+        $obj = new \stdClass;
+
+        return array(
+            'null' => array(null, null),
+            'int' => array(123, 123),
+            'float' => array(123.45, 123.45),
+            'bool false' => array(false, false),
+            'bool true' => array(true, true),
+            'ascii string' => array('abcdef', 'abcdef'),
+            'latin9 string' => array("\xB1\x31\xA4\xA6\xA8\xB4\xB8\xBC\xBD\xBE\xFF", '±1€ŠšŽžŒœŸÿ'),
+            'unicode string' => array('¤¦¨´¸¼½¾€ŠšŽžŒœŸ', '¤¦¨´¸¼½¾€ŠšŽžŒœŸ'),
+            'empty array' => array(array(), array()),
+            'array' => array(array('abcdef'), array('abcdef')),
+            'object' => array($obj, $obj),
+        );
+    }
+
+    /**
+     * @param int    $code
+     * @param string $msg
+     * @dataProvider providesHandleJsonErrorFailure
+     */
+    public function testHandleJsonErrorFailure($code, $msg)
+    {
+        $formatter = new NormalizerFormatter();
+        $reflMethod = new \ReflectionMethod($formatter, 'handleJsonError');
+        $reflMethod->setAccessible(true);
+
+        $this->setExpectedException('RuntimeException', $msg);
+        $reflMethod->invoke($formatter, $code, 'faked');
+    }
+
+    public function providesHandleJsonErrorFailure()
+    {
+        return array(
+            'depth' => array(JSON_ERROR_DEPTH, 'Maximum stack depth exceeded'),
+            'state' => array(JSON_ERROR_STATE_MISMATCH, 'Underflow or the modes mismatch'),
+            'ctrl' => array(JSON_ERROR_CTRL_CHAR, 'Unexpected control character found'),
+            'default' => array(-1, 'Unknown error'),
+        );
+    }
+
+    public function testExceptionTraceWithArgs()
+    {
+        if (defined('HHVM_VERSION')) {
+            $this->markTestSkipped('Not supported in HHVM since it detects errors differently');
+        }
+
+        // This happens i.e. in React promises or Guzzle streams where stream wrappers are registered
+        // and no file or line are included in the trace because it's treated as internal function
+        set_error_handler(function ($errno, $errstr, $errfile, $errline) {
+            throw new \ErrorException($errstr, 0, $errno, $errfile, $errline);
+        });
+
+        try {
+            // This will contain $resource and $wrappedResource as arguments in the trace item
+            $resource = fopen('php://memory', 'rw+');
+            fwrite($resource, 'test_resource');
+            $wrappedResource = new TestFooNorm;
+            $wrappedResource->foo = $resource;
+            // Just do something stupid with a resource/wrapped resource as argument
+            array_keys($wrappedResource);
+        } catch (\Exception $e) {
+            restore_error_handler();
+        }
+
+        $formatter = new NormalizerFormatter();
+        $record = array('context' => array('exception' => $e));
+        $result = $formatter->format($record);
+
+        $this->assertRegExp(
+            '%"resource":"\[resource\] \(stream\)"%',
+            $result['context']['exception']['trace'][0]
+        );
+
+        if (version_compare(PHP_VERSION, '5.5.0', '>=')) {
+            $pattern = '%"wrappedResource":"\[object\] \(Monolog\\\\\\\\Formatter\\\\\\\\TestFooNorm: \)"%';
+        } else {
+            $pattern = '%\\\\"foo\\\\":null%';
+        }
+
+        // Tests that the wrapped resource is ignored while encoding, only works for PHP <= 5.4
+        $this->assertRegExp(
+            $pattern,
+            $result['context']['exception']['trace'][0]
+        );
+    }
+
+    public function testExceptionTraceDoesNotLeakCallUserFuncArgs()
+    {
+        try {
+            $arg = new TestInfoLeak;
+            call_user_func(array($this, 'throwHelper'), $arg, $dt = new \DateTime());
+        } catch (\Exception $e) {
+        }
+
+        $formatter = new NormalizerFormatter();
+        $record = array('context' => array('exception' => $e));
+        $result = $formatter->format($record);
+
+        $this->assertSame(
+            '{"function":"throwHelper","class":"Monolog\\\\Formatter\\\\NormalizerFormatterTest","type":"->","args":["[object] (Monolog\\\\Formatter\\\\TestInfoLeak)","'.$dt->format('Y-m-d H:i:s').'"]}',
+            $result['context']['exception']['trace'][0]
+        );
+    }
+
+    private function throwHelper($arg)
+    {
+        throw new \RuntimeException('Thrown');
+    }
+}
+
+class TestFooNorm
+{
+    public $foo = 'foo';
+}
+
+class TestBarNorm
+{
+    public function __toString()
+    {
+        return 'bar';
+    }
+}
+
+class TestStreamFoo
+{
+    public $foo;
+    public $resource;
+
+    public function __construct($resource)
+    {
+        $this->resource = $resource;
+        $this->foo = 'BAR';
+    }
+
+    public function __toString()
+    {
+        fseek($this->resource, 0);
+
+        return $this->foo . ' - ' . (string) stream_get_contents($this->resource);
+    }
+}
+
+class TestToStringError
+{
+    public function __toString()
+    {
+        throw new \RuntimeException('Could not convert to string');
+    }
+}
+
+class TestInfoLeak
+{
+    public function __toString()
+    {
+        return 'Sensitive information';
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php

@@ -0,0 +1,110 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+class ScalarFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    private $formatter;
+
+    public function setUp()
+    {
+        $this->formatter = new ScalarFormatter();
+    }
+
+    public function buildTrace(\Exception $e)
+    {
+        $data = array();
+        $trace = $e->getTrace();
+        foreach ($trace as $frame) {
+            if (isset($frame['file'])) {
+                $data[] = $frame['file'].':'.$frame['line'];
+            } else {
+                $data[] = json_encode($frame);
+            }
+        }
+
+        return $data;
+    }
+
+    public function encodeJson($data)
+    {
+        if (version_compare(PHP_VERSION, '5.4.0', '>=')) {
+            return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE);
+        }
+
+        return json_encode($data);
+    }
+
+    public function testFormat()
+    {
+        $exception = new \Exception('foo');
+        $formatted = $this->formatter->format(array(
+            'foo' => 'string',
+            'bar' => 1,
+            'baz' => false,
+            'bam' => array(1, 2, 3),
+            'bat' => array('foo' => 'bar'),
+            'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'),
+            'ban' => $exception,
+        ));
+
+        $this->assertSame(array(
+            'foo' => 'string',
+            'bar' => 1,
+            'baz' => false,
+            'bam' => $this->encodeJson(array(1, 2, 3)),
+            'bat' => $this->encodeJson(array('foo' => 'bar')),
+            'bap' => '1970-01-01 00:00:00',
+            'ban' => $this->encodeJson(array(
+                'class'   => get_class($exception),
+                'message' => $exception->getMessage(),
+                'code'    => $exception->getCode(),
+                'file'    => $exception->getFile() . ':' . $exception->getLine(),
+                'trace'   => $this->buildTrace($exception),
+            )),
+        ), $formatted);
+    }
+
+    public function testFormatWithErrorContext()
+    {
+        $context = array('file' => 'foo', 'line' => 1);
+        $formatted = $this->formatter->format(array(
+            'context' => $context,
+        ));
+
+        $this->assertSame(array(
+            'context' => $this->encodeJson($context),
+        ), $formatted);
+    }
+
+    public function testFormatWithExceptionContext()
+    {
+        $exception = new \Exception('foo');
+        $formatted = $this->formatter->format(array(
+            'context' => array(
+                'exception' => $exception,
+            ),
+        ));
+
+        $this->assertSame(array(
+            'context' => $this->encodeJson(array(
+                'exception' => array(
+                    'class'   => get_class($exception),
+                    'message' => $exception->getMessage(),
+                    'code'    => $exception->getCode(),
+                    'file'    => $exception->getFile() . ':' . $exception->getLine(),
+                    'trace'   => $this->buildTrace($exception),
+                ),
+            )),
+        ), $formatted);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php

@@ -0,0 +1,142 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Formatter;
+
+use Monolog\Logger;
+
+class WildfireFormatterTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testDefaultFormat()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1'),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},'
+                .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testFormatWithFileAndLine()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('from' => 'logger'),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},'
+                .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testFormatWithoutContext()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|',
+            $message
+        );
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::formatBatch
+     * @expectedException BadMethodCallException
+     */
+    public function testBatchFormatThrowException()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array(),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $wildfire->formatBatch(array($record));
+    }
+
+    /**
+     * @covers Monolog\Formatter\WildfireFormatter::format
+     */
+    public function testTableFormat()
+    {
+        $wildfire = new WildfireFormatter();
+        $record = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'table-channel',
+            'context' => array(
+            WildfireFormatter::TABLE => array(
+                    array('col1', 'col2', 'col3'),
+                    array('val1', 'val2', 'val3'),
+                    array('foo1', 'foo2', 'foo3'),
+                    array('bar1', 'bar2', 'bar3'),
+                ),
+            ),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'table-message',
+        );
+
+        $message = $wildfire->format($record);
+
+        $this->assertEquals(
+            '171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|',
+            $message
+        );
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php

@@ -0,0 +1,115 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\WebProcessor;
+
+class AbstractHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\AbstractHandler::__construct
+     * @covers Monolog\Handler\AbstractHandler::getLevel
+     * @covers Monolog\Handler\AbstractHandler::setLevel
+     * @covers Monolog\Handler\AbstractHandler::getBubble
+     * @covers Monolog\Handler\AbstractHandler::setBubble
+     * @covers Monolog\Handler\AbstractHandler::getFormatter
+     * @covers Monolog\Handler\AbstractHandler::setFormatter
+     */
+    public function testConstructAndGetSet()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+        $this->assertEquals(Logger::WARNING, $handler->getLevel());
+        $this->assertEquals(false, $handler->getBubble());
+
+        $handler->setLevel(Logger::ERROR);
+        $handler->setBubble(true);
+        $handler->setFormatter($formatter = new LineFormatter);
+        $this->assertEquals(Logger::ERROR, $handler->getLevel());
+        $this->assertEquals(true, $handler->getBubble());
+        $this->assertSame($formatter, $handler->getFormatter());
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $handler->expects($this->exactly(2))
+            ->method('handle');
+        $handler->handleBatch(array($this->getRecord(), $this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false));
+        $this->assertTrue($handler->isHandling($this->getRecord()));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::__construct
+     */
+    public function testHandlesPsrStyleLevels()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+        $handler->setLevel('debug');
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::getFormatter
+     * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter
+     */
+    public function testGetFormatterInitializesDefault()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter());
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::pushProcessor
+     * @covers Monolog\Handler\AbstractHandler::popProcessor
+     * @expectedException LogicException
+     */
+    public function testPushPopProcessor()
+    {
+        $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+        $processor1 = new WebProcessor;
+        $processor2 = new WebProcessor;
+
+        $logger->pushProcessor($processor1);
+        $logger->pushProcessor($processor2);
+
+        $this->assertEquals($processor2, $logger->popProcessor());
+        $this->assertEquals($processor1, $logger->popProcessor());
+        $logger->popProcessor();
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractHandler::pushProcessor
+     * @expectedException InvalidArgumentException
+     */
+    public function testPushProcessorWithNonCallable()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler');
+
+        $handler->pushProcessor(new \stdClass());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php

@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Processor\WebProcessor;
+
+class AbstractProcessingHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleLowerLevelMessage()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleBubbling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true));
+        $this->assertFalse($handler->handle($this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleNotBubbling()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false));
+        $this->assertTrue($handler->handle($this->getRecord()));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::handle
+     */
+    public function testHandleIsFalseWhenNotHandled()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false));
+        $this->assertTrue($handler->handle($this->getRecord()));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\AbstractProcessingHandler::processRecord
+     */
+    public function testProcessRecord()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler');
+        $handler->pushProcessor(new WebProcessor(array(
+            'REQUEST_URI' => '',
+            'REQUEST_METHOD' => '',
+            'REMOTE_ADDR' => '',
+            'SERVER_NAME' => '',
+            'UNIQUE_ID' => '',
+        )));
+        $handledRecord = null;
+        $handler->expects($this->once())
+            ->method('write')
+            ->will($this->returnCallback(function ($record) use (&$handledRecord) {
+                $handledRecord = $record;
+            }))
+        ;
+        $handler->handle($this->getRecord());
+        $this->assertEquals(6, count($handledRecord['extra']));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php

@@ -0,0 +1,136 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use PhpAmqpLib\Message\AMQPMessage;
+use PhpAmqpLib\Connection\AMQPConnection;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class AmqpHandlerTest extends TestCase
+{
+    public function testHandleAmqpExt()
+    {
+        if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) {
+            $this->markTestSkipped("amqp-php not installed");
+        }
+
+        if (!class_exists('AMQPChannel')) {
+            $this->markTestSkipped("Please update AMQP to version >= 1.0");
+        }
+
+        $messages = array();
+
+        $exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false);
+        $exchange->expects($this->once())
+            ->method('setName')
+            ->with('log')
+        ;
+        $exchange->expects($this->any())
+            ->method('publish')
+            ->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) {
+                $messages[] = array($message, $routing_key, $flags, $attributes);
+            }))
+        ;
+
+        $handler = new AmqpHandler($exchange, 'log');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            array(
+                'message' => 'test',
+                'context' => array(
+                    'data' => array(),
+                    'foo' => 34,
+                ),
+                'level' => 300,
+                'level_name' => 'WARNING',
+                'channel' => 'test',
+                'extra' => array(),
+            ),
+            'warn.test',
+            0,
+            array(
+                'delivery_mode' => 2,
+                'content_type' => 'application/json',
+            ),
+        );
+
+        $handler->handle($record);
+
+        $this->assertCount(1, $messages);
+        $messages[0][0] = json_decode($messages[0][0], true);
+        unset($messages[0][0]['datetime']);
+        $this->assertEquals($expected, $messages[0]);
+    }
+
+    public function testHandlePhpAmqpLib()
+    {
+        if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) {
+            $this->markTestSkipped("php-amqplib not installed");
+        }
+
+        $messages = array();
+
+        $exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false);
+
+        $exchange->expects($this->any())
+            ->method('basic_publish')
+            ->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) {
+                $messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket);
+            }))
+        ;
+
+        $handler = new AmqpHandler($exchange, 'log');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            array(
+                'message' => 'test',
+                'context' => array(
+                    'data' => array(),
+                    'foo' => 34,
+                ),
+                'level' => 300,
+                'level_name' => 'WARNING',
+                'channel' => 'test',
+                'extra' => array(),
+            ),
+            'log',
+            'warn.test',
+            false,
+            false,
+            null,
+            array(
+                'delivery_mode' => 2,
+                'content_type' => 'application/json',
+            ),
+        );
+
+        $handler->handle($record);
+
+        $this->assertCount(1, $messages);
+
+        /* @var $msg AMQPMessage */
+        $msg = $messages[0][0];
+        $messages[0][0] = json_decode($msg->body, true);
+        $messages[0][] = $msg->get_properties();
+        unset($messages[0][0]['datetime']);
+
+        $this->assertEquals($expected, $messages[0]);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php

@@ -0,0 +1,130 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\BrowserConsoleHandlerTest
+ */
+class BrowserConsoleHandlerTest extends TestCase
+{
+    protected function setUp()
+    {
+        BrowserConsoleHandler::resetStatic();
+    }
+
+    protected function generateScript()
+    {
+        $reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript');
+        $reflMethod->setAccessible(true);
+
+        return $reflMethod->invoke(null);
+    }
+
+    public function testStyling()
+    {
+        $handler = new BrowserConsoleHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+
+        $handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}'));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%cfoo%cbar%c", "font-weight: normal", "color: red", "font-weight: normal");
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+
+    public function testEscaping()
+    {
+        $handler = new BrowserConsoleHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+
+        $handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}"));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%c[foo] %c\"bar\\n[baz]\"%c", "font-weight: normal", "color: red", "font-weight: normal");
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+
+    public function testAutolabel()
+    {
+        $handler = new BrowserConsoleHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+
+        $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
+        $handler->handle($this->getRecord(Logger::DEBUG, '[[bar]]{macro: autolabel}'));
+        $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}'));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
+c.log("%c%cbar%c", "font-weight: normal", "background-color: green; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
+c.log("%c%cfoo%c", "font-weight: normal", "background-color: blue; color: white; border-radius: 3px; padding: 0 2px 0 2px", "font-weight: normal");
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+
+    public function testContext()
+    {
+        $handler = new BrowserConsoleHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+
+        $handler->handle($this->getRecord(Logger::DEBUG, 'test', array('foo' => 'bar')));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.groupCollapsed("%ctest", "font-weight: normal");
+c.log("%c%s", "font-weight: bold", "Context");
+c.log("%s: %o", "foo", "bar");
+c.groupEnd();
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler1 = new BrowserConsoleHandler();
+        $handler1->setFormatter($this->getIdentityFormatter());
+
+        $handler2 = new BrowserConsoleHandler();
+        $handler2->setFormatter($this->getIdentityFormatter());
+
+        $handler1->handle($this->getRecord(Logger::DEBUG, 'test1'));
+        $handler2->handle($this->getRecord(Logger::DEBUG, 'test2'));
+        $handler1->handle($this->getRecord(Logger::DEBUG, 'test3'));
+        $handler2->handle($this->getRecord(Logger::DEBUG, 'test4'));
+
+        $expected = <<<EOF
+(function (c) {if (c && c.groupCollapsed) {
+c.log("%ctest1", "font-weight: normal");
+c.log("%ctest2", "font-weight: normal");
+c.log("%ctest3", "font-weight: normal");
+c.log("%ctest4", "font-weight: normal");
+}})(console);
+EOF;
+
+        $this->assertEquals($expected, $this->generateScript());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php

@@ -0,0 +1,158 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class BufferHandlerTest extends TestCase
+{
+    private $shutdownCheckHandler;
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::__construct
+     * @covers Monolog\Handler\BufferHandler::handle
+     * @covers Monolog\Handler\BufferHandler::close
+     */
+    public function testHandleBuffers()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->close();
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 2);
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::close
+     * @covers Monolog\Handler\BufferHandler::flush
+     */
+    public function testPropagatesRecordsAtEndOfRequest()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->shutdownCheckHandler = $test;
+        register_shutdown_function(array($this, 'checkPropagation'));
+    }
+
+    public function checkPropagation()
+    {
+        if (!$this->shutdownCheckHandler->hasWarningRecords() || !$this->shutdownCheckHandler->hasDebugRecords()) {
+            echo '!!! BufferHandlerTest::testPropagatesRecordsAtEndOfRequest failed to verify that the messages have been propagated' . PHP_EOL;
+            exit(1);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleBufferLimit()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 2);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleBufferLimitWithFlushOnOverflow()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 3, Logger::DEBUG, true, true);
+
+        // send two records
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertCount(0, $test->getRecords());
+
+        // overflow
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertCount(3, $test->getRecords());
+
+        // should buffer again
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertCount(3, $test->getRecords());
+
+        $handler->close();
+        $this->assertCount(5, $test->getRecords());
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleLevel()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 0, Logger::INFO);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::flush
+     */
+    public function testFlush()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test, 0);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->flush();
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\BufferHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new BufferHandler($test);
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->flush();
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php

@@ -0,0 +1,156 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\ChromePHPHandler
+ */
+class ChromePHPHandlerTest extends TestCase
+{
+    protected function setUp()
+    {
+        TestChromePHPHandler::resetStatic();
+        $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; Chrome/1.0';
+    }
+
+    /**
+     * @dataProvider agentsProvider
+     */
+    public function testHeaders($agent)
+    {
+        $_SERVER['HTTP_USER_AGENT'] = $agent;
+
+        $handler = new TestChromePHPHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-ChromeLogger-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    'test',
+                    'test',
+                ),
+                'request_uri' => '',
+            )))),
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public static function agentsProvider()
+    {
+        return array(
+            array('Monolog Test; Chrome/1.0'),
+            array('Mozilla/5.0 (X11; Ubuntu; Linux x86_64; rv:52.0) Gecko/20100101 Firefox/52.0'),
+            array('Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) Ubuntu Chromium/56.0.2924.76 Chrome/56.0.2924.76 Safari/537.36'),
+            array('Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) HeadlessChrome Safari/537.36'),
+        );
+    }
+
+    public function testHeadersOverflow()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150 * 1024)));
+
+        // overflow chrome headers limit
+        $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100 * 1024)));
+
+        $expected = array(
+            'X-ChromeLogger-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    array(
+                        'test',
+                        'test',
+                        'unknown',
+                        'log',
+                    ),
+                    array(
+                        'test',
+                        str_repeat('a', 150 * 1024),
+                        'unknown',
+                        'warn',
+                    ),
+                    array(
+                        'monolog',
+                        'Incomplete logs, chrome header size limit reached',
+                        'unknown',
+                        'warn',
+                    ),
+                ),
+                'request_uri' => '',
+            )))),
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler = new TestChromePHPHandler();
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $handler2 = new TestChromePHPHandler();
+        $handler2->setFormatter($this->getIdentityFormatter());
+        $handler2->handle($this->getRecord(Logger::DEBUG));
+        $handler2->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-ChromeLogger-Data'   => base64_encode(utf8_encode(json_encode(array(
+                'version' => ChromePHPHandler::VERSION,
+                'columns' => array('label', 'log', 'backtrace', 'type'),
+                'rows' => array(
+                    'test',
+                    'test',
+                    'test',
+                    'test',
+                ),
+                'request_uri' => '',
+            )))),
+        );
+
+        $this->assertEquals($expected, $handler2->getHeaders());
+    }
+}
+
+class TestChromePHPHandler extends ChromePHPHandler
+{
+    protected $headers = array();
+
+    public static function resetStatic()
+    {
+        self::$initialized = false;
+        self::$overflowed = false;
+        self::$sendHeaders = true;
+        self::$json['rows'] = array();
+    }
+
+    protected function sendHeader($header, $content)
+    {
+        $this->headers[$header] = $content;
+    }
+
+    public function getHeaders()
+    {
+        return $this->headers;
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php

@@ -0,0 +1,31 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class CouchDBHandlerTest extends TestCase
+{
+    public function testHandle()
+    {
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $handler = new CouchDBHandler();
+
+        try {
+            $handler->handle($record);
+        } catch (\RuntimeException $e) {
+            $this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984');
+        }
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DeduplicationHandlerTest.php

@@ -0,0 +1,165 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class DeduplicationHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\DeduplicationHandler::flush
+     */
+    public function testFlushPassthruIfAllRecordsUnderTrigger()
+    {
+        $test = new TestHandler();
+        @unlink(sys_get_temp_dir().'/monolog_dedup.log');
+        $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+
+        $handler->flush();
+
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\DeduplicationHandler::flush
+     * @covers Monolog\Handler\DeduplicationHandler::appendRecord
+     */
+    public function testFlushPassthruIfEmptyLog()
+    {
+        $test = new TestHandler();
+        @unlink(sys_get_temp_dir().'/monolog_dedup.log');
+        $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+        $handler->handle($this->getRecord(Logger::ERROR, 'Foo:bar'));
+        $handler->handle($this->getRecord(Logger::CRITICAL, "Foo\nbar"));
+
+        $handler->flush();
+
+        $this->assertTrue($test->hasErrorRecords());
+        $this->assertTrue($test->hasCriticalRecords());
+        $this->assertFalse($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\DeduplicationHandler::flush
+     * @covers Monolog\Handler\DeduplicationHandler::appendRecord
+     * @covers Monolog\Handler\DeduplicationHandler::isDuplicate
+     * @depends testFlushPassthruIfEmptyLog
+     */
+    public function testFlushSkipsIfLogExists()
+    {
+        $test = new TestHandler();
+        $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+        $handler->handle($this->getRecord(Logger::ERROR, 'Foo:bar'));
+        $handler->handle($this->getRecord(Logger::CRITICAL, "Foo\nbar"));
+
+        $handler->flush();
+
+        $this->assertFalse($test->hasErrorRecords());
+        $this->assertFalse($test->hasCriticalRecords());
+        $this->assertFalse($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\DeduplicationHandler::flush
+     * @covers Monolog\Handler\DeduplicationHandler::appendRecord
+     * @covers Monolog\Handler\DeduplicationHandler::isDuplicate
+     * @depends testFlushPassthruIfEmptyLog
+     */
+    public function testFlushPassthruIfLogTooOld()
+    {
+        $test = new TestHandler();
+        $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+        $record = $this->getRecord(Logger::ERROR);
+        $record['datetime']->modify('+62seconds');
+        $handler->handle($record);
+        $record = $this->getRecord(Logger::CRITICAL);
+        $record['datetime']->modify('+62seconds');
+        $handler->handle($record);
+
+        $handler->flush();
+
+        $this->assertTrue($test->hasErrorRecords());
+        $this->assertTrue($test->hasCriticalRecords());
+        $this->assertFalse($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\DeduplicationHandler::flush
+     * @covers Monolog\Handler\DeduplicationHandler::appendRecord
+     * @covers Monolog\Handler\DeduplicationHandler::isDuplicate
+     * @covers Monolog\Handler\DeduplicationHandler::collectLogs
+     */
+    public function testGcOldLogs()
+    {
+        $test = new TestHandler();
+        @unlink(sys_get_temp_dir().'/monolog_dedup.log');
+        $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0);
+
+        // handle two records from yesterday, and one recent
+        $record = $this->getRecord(Logger::ERROR);
+        $record['datetime']->modify('-1day -10seconds');
+        $handler->handle($record);
+        $record2 = $this->getRecord(Logger::CRITICAL);
+        $record2['datetime']->modify('-1day -10seconds');
+        $handler->handle($record2);
+        $record3 = $this->getRecord(Logger::CRITICAL);
+        $record3['datetime']->modify('-30seconds');
+        $handler->handle($record3);
+
+        // log is written as none of them are duplicate
+        $handler->flush();
+        $this->assertSame(
+            $record['datetime']->getTimestamp() . ":ERROR:test\n" .
+            $record2['datetime']->getTimestamp() . ":CRITICAL:test\n" .
+            $record3['datetime']->getTimestamp() . ":CRITICAL:test\n",
+            file_get_contents(sys_get_temp_dir() . '/monolog_dedup.log')
+        );
+        $this->assertTrue($test->hasErrorRecords());
+        $this->assertTrue($test->hasCriticalRecords());
+        $this->assertFalse($test->hasWarningRecords());
+
+        // clear test handler
+        $test->clear();
+        $this->assertFalse($test->hasErrorRecords());
+        $this->assertFalse($test->hasCriticalRecords());
+
+        // log new records, duplicate log gets GC'd at the end of this flush call
+        $handler->handle($record = $this->getRecord(Logger::ERROR));
+        $handler->handle($record2 = $this->getRecord(Logger::CRITICAL));
+        $handler->flush();
+
+        // log should now contain the new errors and the previous one that was recent enough
+        $this->assertSame(
+            $record3['datetime']->getTimestamp() . ":CRITICAL:test\n" .
+            $record['datetime']->getTimestamp() . ":ERROR:test\n" .
+            $record2['datetime']->getTimestamp() . ":CRITICAL:test\n",
+            file_get_contents(sys_get_temp_dir() . '/monolog_dedup.log')
+        );
+        $this->assertTrue($test->hasErrorRecords());
+        $this->assertTrue($test->hasCriticalRecords());
+        $this->assertFalse($test->hasWarningRecords());
+    }
+
+    public static function tearDownAfterClass()
+    {
+        @unlink(sys_get_temp_dir().'/monolog_dedup.log');
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php

@@ -0,0 +1,52 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class DoctrineCouchDBHandlerTest extends TestCase
+{
+    protected function setup()
+    {
+        if (!class_exists('Doctrine\CouchDB\CouchDBClient')) {
+            $this->markTestSkipped('The "doctrine/couchdb" package is not installed');
+        }
+    }
+
+    public function testHandle()
+    {
+        $client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient')
+            ->setMethods(array('postDocument'))
+            ->disableOriginalConstructor()
+            ->getMock();
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            'message' => 'test',
+            'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+            'level' => Logger::WARNING,
+            'level_name' => 'WARNING',
+            'channel' => 'test',
+            'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+            'extra' => array(),
+        );
+
+        $client->expects($this->once())
+            ->method('postDocument')
+            ->with($expected);
+
+        $handler = new DoctrineCouchDBHandler($client);
+        $handler->handle($record);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php

@@ -0,0 +1,82 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class DynamoDbHandlerTest extends TestCase
+{
+    private $client;
+
+    public function setUp()
+    {
+        if (!class_exists('Aws\DynamoDb\DynamoDbClient')) {
+            $this->markTestSkipped('aws/aws-sdk-php not installed');
+        }
+
+        $this->client = $this->getMockBuilder('Aws\DynamoDb\DynamoDbClient')
+            ->setMethods(array('formatAttributes', '__call'))
+            ->disableOriginalConstructor()->getMock();
+    }
+
+    public function testConstruct()
+    {
+        $this->assertInstanceOf('Monolog\Handler\DynamoDbHandler', new DynamoDbHandler($this->client, 'foo'));
+    }
+
+    public function testInterface()
+    {
+        $this->assertInstanceOf('Monolog\Handler\HandlerInterface', new DynamoDbHandler($this->client, 'foo'));
+    }
+
+    public function testGetFormatter()
+    {
+        $handler = new DynamoDbHandler($this->client, 'foo');
+        $this->assertInstanceOf('Monolog\Formatter\ScalarFormatter', $handler->getFormatter());
+    }
+
+    public function testHandle()
+    {
+        $record = $this->getRecord();
+        $formatter = $this->getMock('Monolog\Formatter\FormatterInterface');
+        $formatted = array('foo' => 1, 'bar' => 2);
+        $handler = new DynamoDbHandler($this->client, 'foo');
+        $handler->setFormatter($formatter);
+
+        $isV3 = defined('Aws\Sdk::VERSION') && version_compare(\Aws\Sdk::VERSION, '3.0', '>=');
+        if ($isV3) {
+            $expFormatted = array('foo' => array('N' => 1), 'bar' => array('N' => 2));
+        } else {
+            $expFormatted = $formatted;
+        }
+
+        $formatter
+             ->expects($this->once())
+             ->method('format')
+             ->with($record)
+             ->will($this->returnValue($formatted));
+        $this->client
+             ->expects($isV3 ? $this->never() : $this->once())
+             ->method('formatAttributes')
+             ->with($this->isType('array'))
+             ->will($this->returnValue($formatted));
+        $this->client
+             ->expects($this->once())
+             ->method('__call')
+             ->with('putItem', array(array(
+                 'TableName' => 'foo',
+                 'Item' => $expFormatted,
+             )));
+
+        $handler->handle($record);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php

@@ -0,0 +1,239 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\ElasticaFormatter;
+use Monolog\Formatter\NormalizerFormatter;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Elastica\Client;
+use Elastica\Request;
+use Elastica\Response;
+
+class ElasticSearchHandlerTest extends TestCase
+{
+    /**
+     * @var Client mock
+     */
+    protected $client;
+
+    /**
+     * @var array Default handler options
+     */
+    protected $options = array(
+        'index' => 'my_index',
+        'type'  => 'doc_type',
+    );
+
+    public function setUp()
+    {
+        // Elastica lib required
+        if (!class_exists("Elastica\Client")) {
+            $this->markTestSkipped("ruflin/elastica not installed");
+        }
+
+        // base mock Elastica Client object
+        $this->client = $this->getMockBuilder('Elastica\Client')
+            ->setMethods(array('addDocuments'))
+            ->disableOriginalConstructor()
+            ->getMock();
+    }
+
+    /**
+     * @covers Monolog\Handler\ElasticSearchHandler::write
+     * @covers Monolog\Handler\ElasticSearchHandler::handleBatch
+     * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+     * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
+     */
+    public function testHandle()
+    {
+        // log message
+        $msg = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        // format expected result
+        $formatter = new ElasticaFormatter($this->options['index'], $this->options['type']);
+        $expected = array($formatter->format($msg));
+
+        // setup ES client mock
+        $this->client->expects($this->any())
+            ->method('addDocuments')
+            ->with($expected);
+
+        // perform tests
+        $handler = new ElasticSearchHandler($this->client, $this->options);
+        $handler->handle($msg);
+        $handler->handleBatch(array($msg));
+    }
+
+    /**
+     * @covers Monolog\Handler\ElasticSearchHandler::setFormatter
+     */
+    public function testSetFormatter()
+    {
+        $handler = new ElasticSearchHandler($this->client);
+        $formatter = new ElasticaFormatter('index_new', 'type_new');
+        $handler->setFormatter($formatter);
+        $this->assertInstanceOf('Monolog\Formatter\ElasticaFormatter', $handler->getFormatter());
+        $this->assertEquals('index_new', $handler->getFormatter()->getIndex());
+        $this->assertEquals('type_new', $handler->getFormatter()->getType());
+    }
+
+    /**
+     * @covers                   Monolog\Handler\ElasticSearchHandler::setFormatter
+     * @expectedException        InvalidArgumentException
+     * @expectedExceptionMessage ElasticSearchHandler is only compatible with ElasticaFormatter
+     */
+    public function testSetFormatterInvalid()
+    {
+        $handler = new ElasticSearchHandler($this->client);
+        $formatter = new NormalizerFormatter();
+        $handler->setFormatter($formatter);
+    }
+
+    /**
+     * @covers Monolog\Handler\ElasticSearchHandler::__construct
+     * @covers Monolog\Handler\ElasticSearchHandler::getOptions
+     */
+    public function testOptions()
+    {
+        $expected = array(
+            'index' => $this->options['index'],
+            'type' => $this->options['type'],
+            'ignore_error' => false,
+        );
+        $handler = new ElasticSearchHandler($this->client, $this->options);
+        $this->assertEquals($expected, $handler->getOptions());
+    }
+
+    /**
+     * @covers       Monolog\Handler\ElasticSearchHandler::bulkSend
+     * @dataProvider providerTestConnectionErrors
+     */
+    public function testConnectionErrors($ignore, $expectedError)
+    {
+        $clientOpts = array('host' => '127.0.0.1', 'port' => 1);
+        $client = new Client($clientOpts);
+        $handlerOpts = array('ignore_error' => $ignore);
+        $handler = new ElasticSearchHandler($client, $handlerOpts);
+
+        if ($expectedError) {
+            $this->setExpectedException($expectedError[0], $expectedError[1]);
+            $handler->handle($this->getRecord());
+        } else {
+            $this->assertFalse($handler->handle($this->getRecord()));
+        }
+    }
+
+    /**
+     * @return array
+     */
+    public function providerTestConnectionErrors()
+    {
+        return array(
+            array(false, array('RuntimeException', 'Error sending messages to Elasticsearch')),
+            array(true, false),
+        );
+    }
+
+    /**
+     * Integration test using localhost Elastic Search server
+     *
+     * @covers Monolog\Handler\ElasticSearchHandler::__construct
+     * @covers Monolog\Handler\ElasticSearchHandler::handleBatch
+     * @covers Monolog\Handler\ElasticSearchHandler::bulkSend
+     * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter
+     */
+    public function testHandleIntegration()
+    {
+        $msg = array(
+            'level' => Logger::ERROR,
+            'level_name' => 'ERROR',
+            'channel' => 'meh',
+            'context' => array('foo' => 7, 'bar', 'class' => new \stdClass),
+            'datetime' => new \DateTime("@0"),
+            'extra' => array(),
+            'message' => 'log',
+        );
+
+        $expected = $msg;
+        $expected['datetime'] = $msg['datetime']->format(\DateTime::ISO8601);
+        $expected['context'] = array(
+            'class' => '[object] (stdClass: {})',
+            'foo' => 7,
+            0 => 'bar',
+        );
+
+        $client = new Client();
+        $handler = new ElasticSearchHandler($client, $this->options);
+        try {
+            $handler->handleBatch(array($msg));
+        } catch (\RuntimeException $e) {
+            $this->markTestSkipped("Cannot connect to Elastic Search server on localhost");
+        }
+
+        // check document id from ES server response
+        $documentId = $this->getCreatedDocId($client->getLastResponse());
+        $this->assertNotEmpty($documentId, 'No elastic document id received');
+
+        // retrieve document source from ES and validate
+        $document = $this->getDocSourceFromElastic(
+            $client,
+            $this->options['index'],
+            $this->options['type'],
+            $documentId
+        );
+        $this->assertEquals($expected, $document);
+
+        // remove test index from ES
+        $client->request("/{$this->options['index']}", Request::DELETE);
+    }
+
+    /**
+     * Return last created document id from ES response
+     * @param  Response    $response Elastica Response object
+     * @return string|null
+     */
+    protected function getCreatedDocId(Response $response)
+    {
+        $data = $response->getData();
+        if (!empty($data['items'][0]['create']['_id'])) {
+            return $data['items'][0]['create']['_id'];
+        }
+    }
+
+    /**
+     * Retrieve document by id from Elasticsearch
+     * @param  Client $client     Elastica client
+     * @param  string $index
+     * @param  string $type
+     * @param  string $documentId
+     * @return array
+     */
+    protected function getDocSourceFromElastic(Client $client, $index, $type, $documentId)
+    {
+        $resp = $client->request("/{$index}/{$type}/{$documentId}", Request::GET);
+        $data = $resp->getData();
+        if (!empty($data['_source'])) {
+            return $data['_source'];
+        }
+
+        return array();
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php

@@ -0,0 +1,66 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+function error_log()
+{
+    $GLOBALS['error_log'][] = func_get_args();
+}
+
+class ErrorLogHandlerTest extends TestCase
+{
+    protected function setUp()
+    {
+        $GLOBALS['error_log'] = array();
+    }
+
+    /**
+     * @covers Monolog\Handler\ErrorLogHandler::__construct
+     * @expectedException InvalidArgumentException
+     * @expectedExceptionMessage The given message type "42" is not supported
+     */
+    public function testShouldNotAcceptAnInvalidTypeOnContructor()
+    {
+        new ErrorLogHandler(42);
+    }
+
+    /**
+     * @covers Monolog\Handler\ErrorLogHandler::write
+     */
+    public function testShouldLogMessagesUsingErrorLogFuncion()
+    {
+        $type = ErrorLogHandler::OPERATING_SYSTEM;
+        $handler = new ErrorLogHandler($type);
+        $handler->setFormatter(new LineFormatter('%channel%.%level_name%: %message% %context% %extra%', null, true));
+        $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+
+        $this->assertSame("test.ERROR: Foo\nBar\r\n\r\nBaz [] []", $GLOBALS['error_log'][0][0]);
+        $this->assertSame($GLOBALS['error_log'][0][1], $type);
+
+        $handler = new ErrorLogHandler($type, Logger::DEBUG, true, true);
+        $handler->setFormatter(new LineFormatter(null, null, true));
+        $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+
+        $this->assertStringMatchesFormat('[%s] test.ERROR: Foo', $GLOBALS['error_log'][1][0]);
+        $this->assertSame($GLOBALS['error_log'][1][1], $type);
+
+        $this->assertStringMatchesFormat('Bar', $GLOBALS['error_log'][2][0]);
+        $this->assertSame($GLOBALS['error_log'][2][1], $type);
+
+        $this->assertStringMatchesFormat('Baz [] []', $GLOBALS['error_log'][3][0]);
+        $this->assertSame($GLOBALS['error_log'][3][1], $type);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php

@@ -0,0 +1,170 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class FilterHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\FilterHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::INFO)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::NOTICE)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::WARNING)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::ERROR)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::CRITICAL)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::ALERT)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::EMERGENCY)));
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     * @covers Monolog\Handler\FilterHandler::setAcceptedLevels
+     * @covers Monolog\Handler\FilterHandler::isHandling
+     */
+    public function testHandleProcessOnlyNeededLevels()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE);
+
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::NOTICE));
+        $this->assertTrue($test->hasNoticeRecords());
+
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertFalse($test->hasWarningRecords());
+        $handler->handle($this->getRecord(Logger::ERROR));
+        $this->assertFalse($test->hasErrorRecords());
+        $handler->handle($this->getRecord(Logger::CRITICAL));
+        $this->assertFalse($test->hasCriticalRecords());
+        $handler->handle($this->getRecord(Logger::ALERT));
+        $this->assertFalse($test->hasAlertRecords());
+        $handler->handle($this->getRecord(Logger::EMERGENCY));
+        $this->assertFalse($test->hasEmergencyRecords());
+
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test, array(Logger::INFO, Logger::ERROR));
+
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::NOTICE));
+        $this->assertFalse($test->hasNoticeRecords());
+        $handler->handle($this->getRecord(Logger::ERROR));
+        $this->assertTrue($test->hasErrorRecords());
+        $handler->handle($this->getRecord(Logger::CRITICAL));
+        $this->assertFalse($test->hasCriticalRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::setAcceptedLevels
+     * @covers Monolog\Handler\FilterHandler::getAcceptedLevels
+     */
+    public function testAcceptedLevelApi()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test);
+
+        $levels = array(Logger::INFO, Logger::ERROR);
+        $handler->setAcceptedLevels($levels);
+        $this->assertSame($levels, $handler->getAcceptedLevels());
+
+        $handler->setAcceptedLevels(array('info', 'error'));
+        $this->assertSame($levels, $handler->getAcceptedLevels());
+
+        $levels = array(Logger::CRITICAL, Logger::ALERT, Logger::EMERGENCY);
+        $handler->setAcceptedLevels(Logger::CRITICAL, Logger::EMERGENCY);
+        $this->assertSame($levels, $handler->getAcceptedLevels());
+
+        $handler->setAcceptedLevels('critical', 'emergency');
+        $this->assertSame($levels, $handler->getAcceptedLevels());
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler($test, Logger::DEBUG, Logger::EMERGENCY);
+        $handler->pushProcessor(
+            function ($record) {
+                $record['extra']['foo'] = true;
+
+                return $record;
+            }
+        );
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     */
+    public function testHandleRespectsBubble()
+    {
+        $test = new TestHandler();
+
+        $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, false);
+        $this->assertTrue($handler->handle($this->getRecord(Logger::INFO)));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
+
+        $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, true);
+        $this->assertFalse($handler->handle($this->getRecord(Logger::INFO)));
+        $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING)));
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     */
+    public function testHandleWithCallback()
+    {
+        $test    = new TestHandler();
+        $handler = new FilterHandler(
+            function ($record, $handler) use ($test) {
+                return $test;
+            }, Logger::INFO, Logger::NOTICE, false
+        );
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertTrue($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FilterHandler::handle
+     * @expectedException \RuntimeException
+     */
+    public function testHandleWithBadCallbackThrowsException()
+    {
+        $handler = new FilterHandler(
+            function ($record, $handler) {
+                return 'foo';
+            }
+        );
+        $handler->handle($this->getRecord(Logger::WARNING));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php

@@ -0,0 +1,279 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy;
+use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy;
+use Psr\Log\LogLevel;
+
+class FingersCrossedHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::activate
+     */
+    public function testHandleBuffers()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->close();
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 3);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::activate
+     */
+    public function testHandleStopsBufferingAfterTrigger()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::activate
+     * @covers Monolog\Handler\FingersCrossedHandler::reset
+     */
+    public function testHandleResetBufferingAfterReset()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test);
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->reset();
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::activate
+     */
+    public function testHandleResetBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->close();
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::activate
+     */
+    public function testHandleBufferLimit()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::WARNING, 2);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertFalse($test->hasDebugRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::activate
+     */
+    public function testHandleWithCallback()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler(function ($record, $handler) use ($test) {
+                    return $test;
+                });
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertFalse($test->hasInfoRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasInfoRecords());
+        $this->assertTrue(count($test->getRecords()) === 3);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::activate
+     * @expectedException RuntimeException
+     */
+    public function testHandleWithBadCallbackThrowsException()
+    {
+        $handler = new FingersCrossedHandler(function ($record, $handler) {
+                    return 'foo';
+                });
+        $handler->handle($this->getRecord(Logger::WARNING));
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::isHandling
+     */
+    public function testIsHandlingAlways()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::ERROR);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
+     */
+    public function testErrorLevelActivationStrategy()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated
+     */
+    public function testErrorLevelActivationStrategyWithPsrLevel()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning'));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::__construct
+     * @covers Monolog\Handler\FingersCrossedHandler::activate
+     */
+    public function testOverrideActivationStrategy()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning'));
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $this->assertFalse($test->hasDebugRecords());
+        $handler->activate();
+        $this->assertTrue($test->hasDebugRecords());
+        $handler->handle($this->getRecord(Logger::INFO));
+        $this->assertTrue($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
+     */
+    public function testChannelLevelActivationStrategy()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG)));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertFalse($test->hasWarningRecords());
+        $record = $this->getRecord(Logger::DEBUG);
+        $record['channel'] = 'othertest';
+        $handler->handle($record);
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct
+     * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated
+     */
+    public function testChannelLevelActivationStrategyWithPsrLevels()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy('error', array('othertest' => 'debug')));
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertFalse($test->hasWarningRecords());
+        $record = $this->getRecord(Logger::DEBUG);
+        $record['channel'] = 'othertest';
+        $handler->handle($record);
+        $this->assertTrue($test->hasDebugRecords());
+        $this->assertTrue($test->hasWarningRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::handle
+     * @covers Monolog\Handler\FingersCrossedHandler::activate
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, Logger::INFO);
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::close
+     */
+    public function testPassthruOnClose()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, Logger::INFO);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->close();
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertTrue($test->hasInfoRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\FingersCrossedHandler::close
+     */
+    public function testPsrLevelPassthruOnClose()
+    {
+        $test = new TestHandler();
+        $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, LogLevel::INFO);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        $handler->close();
+        $this->assertFalse($test->hasDebugRecords());
+        $this->assertTrue($test->hasInfoRecords());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php

@@ -0,0 +1,96 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\FirePHPHandler
+ */
+class FirePHPHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        TestFirePHPHandler::resetStatic();
+        $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; FirePHP/1.0';
+    }
+
+    public function testHeaders()
+    {
+        $handler = new TestFirePHPHandler;
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-Wf-Protocol-1'    => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+            'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+            'X-Wf-1-Plugin-1'    => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+            'X-Wf-1-1-1-1'       => 'test',
+            'X-Wf-1-1-1-2'       => 'test',
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+    }
+
+    public function testConcurrentHandlers()
+    {
+        $handler = new TestFirePHPHandler;
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::WARNING));
+
+        $handler2 = new TestFirePHPHandler;
+        $handler2->setFormatter($this->getIdentityFormatter());
+        $handler2->handle($this->getRecord(Logger::DEBUG));
+        $handler2->handle($this->getRecord(Logger::WARNING));
+
+        $expected = array(
+            'X-Wf-Protocol-1'    => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2',
+            'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1',
+            'X-Wf-1-Plugin-1'    => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3',
+            'X-Wf-1-1-1-1'       => 'test',
+            'X-Wf-1-1-1-2'       => 'test',
+        );
+
+        $expected2 = array(
+            'X-Wf-1-1-1-3'       => 'test',
+            'X-Wf-1-1-1-4'       => 'test',
+        );
+
+        $this->assertEquals($expected, $handler->getHeaders());
+        $this->assertEquals($expected2, $handler2->getHeaders());
+    }
+}
+
+class TestFirePHPHandler extends FirePHPHandler
+{
+    protected $headers = array();
+
+    public static function resetStatic()
+    {
+        self::$initialized = false;
+        self::$sendHeaders = true;
+        self::$messageIndex = 1;
+    }
+
+    protected function sendHeader($header, $content)
+    {
+        $this->headers[$header] = $content;
+    }
+
+    public function getHeaders()
+    {
+        return $this->headers;
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php

@@ -0,0 +1,85 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\Logger;
+use Monolog\TestCase;
+
+/**
+ * @coversDefaultClass \Monolog\Handler\FleepHookHandler
+ */
+class FleepHookHandlerTest extends TestCase
+{
+    /**
+     * Default token to use in tests
+     */
+    const TOKEN = '123abc';
+
+    /**
+     * @var FleepHookHandler
+     */
+    private $handler;
+
+    public function setUp()
+    {
+        parent::setUp();
+
+        if (!extension_loaded('openssl')) {
+            $this->markTestSkipped('This test requires openssl extension to run');
+        }
+
+        // Create instances of the handler and logger for convenience
+        $this->handler = new FleepHookHandler(self::TOKEN);
+    }
+
+    /**
+     * @covers ::__construct
+     */
+    public function testConstructorSetsExpectedDefaults()
+    {
+        $this->assertEquals(Logger::DEBUG, $this->handler->getLevel());
+        $this->assertEquals(true, $this->handler->getBubble());
+    }
+
+    /**
+     * @covers ::getDefaultFormatter
+     */
+    public function testHandlerUsesLineFormatterWhichIgnoresEmptyArrays()
+    {
+        $record = array(
+            'message' => 'msg',
+            'context' => array(),
+            'level' => Logger::DEBUG,
+            'level_name' => Logger::getLevelName(Logger::DEBUG),
+            'channel' => 'channel',
+            'datetime' => new \DateTime(),
+            'extra' => array(),
+        );
+
+        $expectedFormatter = new LineFormatter(null, null, true, true);
+        $expected = $expectedFormatter->format($record);
+
+        $handlerFormatter = $this->handler->getFormatter();
+        $actual = $handlerFormatter->format($record);
+
+        $this->assertEquals($expected, $actual, 'Empty context and extra arrays should not be rendered');
+    }
+
+    /**
+     * @covers ::__construct
+     */
+    public function testConnectionStringisConstructedCorrectly()
+    {
+        $this->assertEquals('ssl://' . FleepHookHandler::FLEEP_HOST . ':443', $this->handler->getConnectionString());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php

@@ -0,0 +1,88 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\FlowdockFormatter;
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Dominik Liebler <liebler.dominik@gmail.com>
+ * @see    https://www.hipchat.com/docs/api
+ */
+class FlowdockHandlerTest extends TestCase
+{
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @var FlowdockHandler
+     */
+    private $handler;
+
+    public function setUp()
+    {
+        if (!extension_loaded('openssl')) {
+            $this->markTestSkipped('This test requires openssl to run');
+        }
+    }
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/v1\/messages\/team_inbox\/.* HTTP\/1.1\\r\\nHost: api.flowdock.com\\r\\nContent-Type: application\/json\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    /**
+     * @depends testWriteHeader
+     */
+    public function testWriteContent($content)
+    {
+        $this->assertRegexp('/"source":"test_source"/', $content);
+        $this->assertRegexp('/"from_address":"source@test\.com"/', $content);
+    }
+
+    private function createHandler($token = 'myToken')
+    {
+        $constructorArgs = array($token, Logger::DEBUG);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\FlowdockHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter(new FlowdockFormatter('test_source', 'source@test.com'));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php

@@ -0,0 +1,95 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\Message;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerLegacyTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('Gelf\MessagePublisher') || !class_exists('Gelf\Message')) {
+            $this->markTestSkipped("mlehner/gelf-php not installed");
+        }
+
+        require_once __DIR__ . '/GelfMockMessagePublisher.php';
+    }
+
+    /**
+     * @covers Monolog\Handler\GelfHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new GelfHandler($this->getMessagePublisher());
+        $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+    }
+
+    protected function getHandler($messagePublisher)
+    {
+        $handler = new GelfHandler($messagePublisher);
+
+        return $handler;
+    }
+
+    protected function getMessagePublisher()
+    {
+        return new GelfMockMessagePublisher('localhost');
+    }
+
+    public function testDebug()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+        $handler->handle($record);
+
+        $this->assertEquals(7, $messagePublisher->lastMessage->getLevel());
+        $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+        $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+        $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+    }
+
+    public function testWarning()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $handler->handle($record);
+
+        $this->assertEquals(4, $messagePublisher->lastMessage->getLevel());
+        $this->assertEquals('test', $messagePublisher->lastMessage->getFacility());
+        $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage());
+        $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage());
+    }
+
+    public function testInjectedGelfMessageFormatter()
+    {
+        $messagePublisher = $this->getMessagePublisher();
+        $handler = $this->getHandler($messagePublisher);
+
+        $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $record['extra']['blarg'] = 'yep';
+        $record['context']['from'] = 'logger';
+        $handler->handle($record);
+
+        $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost());
+        $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray());
+        $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php

@@ -0,0 +1,117 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\Message;
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\GelfMessageFormatter;
+
+class GelfHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('Gelf\Publisher') || !class_exists('Gelf\Message')) {
+            $this->markTestSkipped("graylog2/gelf-php not installed");
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GelfHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new GelfHandler($this->getMessagePublisher());
+        $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler);
+    }
+
+    protected function getHandler($messagePublisher)
+    {
+        $handler = new GelfHandler($messagePublisher);
+
+        return $handler;
+    }
+
+    protected function getMessagePublisher()
+    {
+        return $this->getMock('Gelf\Publisher', array('publish'), array(), '', false);
+    }
+
+    public function testDebug()
+    {
+        $record = $this->getRecord(Logger::DEBUG, "A test debug message");
+        $expectedMessage = new Message();
+        $expectedMessage
+            ->setLevel(7)
+            ->setFacility("test")
+            ->setShortMessage($record['message'])
+            ->setTimestamp($record['datetime'])
+        ;
+
+        $messagePublisher = $this->getMessagePublisher();
+        $messagePublisher->expects($this->once())
+            ->method('publish')
+            ->with($expectedMessage);
+
+        $handler = $this->getHandler($messagePublisher);
+
+        $handler->handle($record);
+    }
+
+    public function testWarning()
+    {
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $expectedMessage = new Message();
+        $expectedMessage
+            ->setLevel(4)
+            ->setFacility("test")
+            ->setShortMessage($record['message'])
+            ->setTimestamp($record['datetime'])
+        ;
+
+        $messagePublisher = $this->getMessagePublisher();
+        $messagePublisher->expects($this->once())
+            ->method('publish')
+            ->with($expectedMessage);
+
+        $handler = $this->getHandler($messagePublisher);
+
+        $handler->handle($record);
+    }
+
+    public function testInjectedGelfMessageFormatter()
+    {
+        $record = $this->getRecord(Logger::WARNING, "A test warning message");
+        $record['extra']['blarg'] = 'yep';
+        $record['context']['from'] = 'logger';
+
+        $expectedMessage = new Message();
+        $expectedMessage
+            ->setLevel(4)
+            ->setFacility("test")
+            ->setHost("mysystem")
+            ->setShortMessage($record['message'])
+            ->setTimestamp($record['datetime'])
+            ->setAdditional("EXTblarg", 'yep')
+            ->setAdditional("CTXfrom", 'logger')
+        ;
+
+        $messagePublisher = $this->getMessagePublisher();
+        $messagePublisher->expects($this->once())
+            ->method('publish')
+            ->with($expectedMessage);
+
+        $handler = $this->getHandler($messagePublisher);
+        $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX'));
+        $handler->handle($record);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php

@@ -0,0 +1,25 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Gelf\MessagePublisher;
+use Gelf\Message;
+
+class GelfMockMessagePublisher extends MessagePublisher
+{
+    public function publish(Message $message)
+    {
+        $this->lastMessage = $message;
+    }
+
+    public $lastMessage = null;
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php

@@ -0,0 +1,112 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class GroupHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\GroupHandler::__construct
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorOnlyTakesHandler()
+    {
+        new GroupHandler(array(new TestHandler(), "foo"));
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::__construct
+     * @covers Monolog\Handler\GroupHandler::handle
+     */
+    public function testHandle()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new GroupHandler($testHandlers);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new GroupHandler($testHandlers);
+        $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+        $handler = new GroupHandler($testHandlers);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new GroupHandler(array($test));
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+
+    /**
+     * @covers Monolog\Handler\GroupHandler::handle
+     */
+    public function testHandleBatchUsesProcessors()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new GroupHandler($testHandlers);
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+            $records = $test->getRecords();
+            $this->assertTrue($records[0]['extra']['foo']);
+            $this->assertTrue($records[1]['extra']['foo']);
+        }
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/HandlerWrapperTest.php

@@ -0,0 +1,130 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @author Alexey Karapetov <alexey@karapetov.com>
+ */
+class HandlerWrapperTest extends TestCase
+{
+    /**
+     * @var HandlerWrapper
+     */
+    private $wrapper;
+
+    private $handler;
+
+    public function setUp()
+    {
+        parent::setUp();
+        $this->handler = $this->getMock('Monolog\\Handler\\HandlerInterface');
+        $this->wrapper = new HandlerWrapper($this->handler);
+    }
+
+    /**
+     * @return array
+     */
+    public function trueFalseDataProvider()
+    {
+        return array(
+            array(true),
+            array(false),
+        );
+    }
+
+    /**
+     * @param $result
+     * @dataProvider trueFalseDataProvider
+     */
+    public function testIsHandling($result)
+    {
+        $record = $this->getRecord();
+        $this->handler->expects($this->once())
+            ->method('isHandling')
+            ->with($record)
+            ->willReturn($result);
+
+        $this->assertEquals($result, $this->wrapper->isHandling($record));
+    }
+
+    /**
+     * @param $result
+     * @dataProvider trueFalseDataProvider
+     */
+    public function testHandle($result)
+    {
+        $record = $this->getRecord();
+        $this->handler->expects($this->once())
+            ->method('handle')
+            ->with($record)
+            ->willReturn($result);
+
+        $this->assertEquals($result, $this->wrapper->handle($record));
+    }
+
+    /**
+     * @param $result
+     * @dataProvider trueFalseDataProvider
+     */
+    public function testHandleBatch($result)
+    {
+        $records = $this->getMultipleRecords();
+        $this->handler->expects($this->once())
+            ->method('handleBatch')
+            ->with($records)
+            ->willReturn($result);
+
+        $this->assertEquals($result, $this->wrapper->handleBatch($records));
+    }
+
+    public function testPushProcessor()
+    {
+        $processor = function () {};
+        $this->handler->expects($this->once())
+            ->method('pushProcessor')
+            ->with($processor);
+
+        $this->assertEquals($this->wrapper, $this->wrapper->pushProcessor($processor));
+    }
+
+    public function testPopProcessor()
+    {
+        $processor = function () {};
+        $this->handler->expects($this->once())
+            ->method('popProcessor')
+            ->willReturn($processor);
+
+        $this->assertEquals($processor, $this->wrapper->popProcessor());
+    }
+
+    public function testSetFormatter()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $this->handler->expects($this->once())
+            ->method('setFormatter')
+            ->with($formatter);
+
+        $this->assertEquals($this->wrapper, $this->wrapper->setFormatter($formatter));
+    }
+
+    public function testGetFormatter()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $this->handler->expects($this->once())
+            ->method('getFormatter')
+            ->willReturn($formatter);
+
+        $this->assertEquals($formatter, $this->wrapper->getFormatter());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php

@@ -0,0 +1,279 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Rafael Dohms <rafael@doh.ms>
+ * @see    https://www.hipchat.com/docs/api
+ */
+class HipChatHandlerTest extends TestCase
+{
+    private $res;
+    /** @var  HipChatHandler */
+    private $handler;
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    public function testWriteCustomHostHeader()
+    {
+        $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar');
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    public function testWriteV2()
+    {
+        $this->createHandler('myToken', 'room1', 'Monolog', false, 'hipchat.foo.bar', 'v2');
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    public function testWriteV2Notify()
+    {
+        $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar', 'v2');
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    public function testRoomSpaces()
+    {
+        $this->createHandler('myToken', 'room name', 'Monolog', false, 'hipchat.foo.bar', 'v2');
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/v2\/room\/room%20name\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    /**
+     * @depends testWriteHeader
+     */
+    public function testWriteContent($content)
+    {
+        $this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content);
+    }
+
+    public function testWriteContentV1WithoutName()
+    {
+        $this->createHandler('myToken', 'room1', null, false, 'hipchat.foo.bar', 'v1');
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=$/', $content);
+
+        return $content;
+    }
+
+    /**
+     * @depends testWriteCustomHostHeader
+     */
+    public function testWriteContentNotify($content)
+    {
+        $this->assertRegexp('/notify=1&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content);
+    }
+
+    /**
+     * @depends testWriteV2
+     */
+    public function testWriteContentV2($content)
+    {
+        $this->assertRegexp('/notify=false&message=test1&message_format=text&color=red&from=Monolog$/', $content);
+    }
+
+    /**
+     * @depends testWriteV2Notify
+     */
+    public function testWriteContentV2Notify($content)
+    {
+        $this->assertRegexp('/notify=true&message=test1&message_format=text&color=red&from=Monolog$/', $content);
+    }
+
+    public function testWriteContentV2WithoutName()
+    {
+        $this->createHandler('myToken', 'room1', null, false, 'hipchat.foo.bar', 'v2');
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/notify=false&message=test1&message_format=text&color=red$/', $content);
+
+        return $content;
+    }
+
+    public function testWriteWithComplexMessage()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+    }
+
+    public function testWriteTruncatesLongMessage()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, str_repeat('abcde', 2000)));
+        fseek($this->res, 0);
+        $content = fread($this->res, 12000);
+
+        $this->assertRegexp('/message='.str_repeat('abcde', 1900).'\+%5Btruncated%5D/', $content);
+    }
+
+    /**
+     * @dataProvider provideLevelColors
+     */
+    public function testWriteWithErrorLevelsAndColors($level, $expectedColor)
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/color='.$expectedColor.'/', $content);
+    }
+
+    public function provideLevelColors()
+    {
+        return array(
+            array(Logger::DEBUG,    'gray'),
+            array(Logger::INFO,     'green'),
+            array(Logger::WARNING,  'yellow'),
+            array(Logger::ERROR,    'red'),
+            array(Logger::CRITICAL, 'red'),
+            array(Logger::ALERT,    'red'),
+            array(Logger::EMERGENCY,'red'),
+            array(Logger::NOTICE,   'green'),
+        );
+    }
+
+    /**
+     * @dataProvider provideBatchRecords
+     */
+    public function testHandleBatch($records, $expectedColor)
+    {
+        $this->createHandler();
+
+        $this->handler->handleBatch($records);
+
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/color='.$expectedColor.'/', $content);
+    }
+
+    public function provideBatchRecords()
+    {
+        return array(
+            array(
+                array(
+                    array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
+                    array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+                    array('level' => Logger::CRITICAL, 'message' => 'Everything is broken!', 'level_name' => 'critical', 'datetime' => new \DateTime()),
+                ),
+                'red',
+            ),
+            array(
+                array(
+                    array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()),
+                    array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+                ),
+                'yellow',
+            ),
+            array(
+                array(
+                    array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
+                    array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()),
+                ),
+                'green',
+            ),
+            array(
+                array(
+                    array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()),
+                ),
+                'gray',
+            ),
+        );
+    }
+
+    private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false, $host = 'api.hipchat.com', $version = 'v1')
+    {
+        $constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG, true, true, 'text', $host, $version);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\HipChatHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testCreateWithTooLongName()
+    {
+        $hipChatHandler = new HipChatHandler('token', 'room', 'SixteenCharsHere');
+    }
+
+    public function testCreateWithTooLongNameV2()
+    {
+        // creating a handler with too long of a name but using the v2 api doesn't matter.
+        $hipChatHandler = new HipChatHandler('token', 'room', 'SixteenCharsHere', false, Logger::CRITICAL, true, true, 'test', 'api.hipchat.com', 'v2');
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/InsightOpsHandlerTest.php

@@ -0,0 +1,80 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+ namespace Monolog\Handler;
+ 
+ use Monolog\TestCase;
+ use Monolog\Logger;
+
+/**
+ * @author Robert Kaufmann III <rok3@rok3.me>
+ * @author Gabriel Machado <gabriel.ms1@hotmail.com>
+ */
+class InsightOpsHandlerTest extends TestCase
+{
+    /**
+     * @var resource
+     */
+    private $resource;
+
+    /**
+     * @var LogEntriesHandler
+     */
+    private $handler;
+
+    public function testWriteContent()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test'));
+
+        fseek($this->resource, 0);
+        $content = fread($this->resource, 1024);
+
+        $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content);
+    }
+
+    public function testWriteBatchContent()
+    {
+        $this->createHandler();
+        $this->handler->handleBatch($this->getMultipleRecords());
+
+        fseek($this->resource, 0);
+        $content = fread($this->resource, 1024);
+
+        $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content);
+    }
+
+    private function createHandler()
+    {
+        $useSSL = extension_loaded('openssl');
+        $args = array('testToken', 'us', $useSSL, Logger::DEBUG, true);
+        $this->resource = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\InsightOpsHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $args
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->resource));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php

@@ -0,0 +1,84 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Robert Kaufmann III <rok3@rok3.me>
+ */
+class LogEntriesHandlerTest extends TestCase
+{
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @var LogEntriesHandler
+     */
+    private $handler;
+
+    public function testWriteContent()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test'));
+
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content);
+    }
+
+    public function testWriteBatchContent()
+    {
+        $records = array(
+            $this->getRecord(),
+            $this->getRecord(),
+            $this->getRecord(),
+        );
+        $this->createHandler();
+        $this->handler->handleBatch($records);
+
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content);
+    }
+
+    private function createHandler()
+    {
+        $useSSL = extension_loaded('openssl');
+        $args = array('testToken', $useSSL, Logger::DEBUG, true);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\LogEntriesHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $args
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php

@@ -0,0 +1,75 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class MailHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\MailHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->once())
+            ->method('formatBatch'); // Each record is formatted
+
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+        $handler->expects($this->once())
+            ->method('send');
+        $handler->expects($this->never())
+            ->method('write'); // write is for individual records
+
+        $handler->setFormatter($formatter);
+
+        $handler->handleBatch($this->getMultipleRecords());
+    }
+
+    /**
+     * @covers Monolog\Handler\MailHandler::handleBatch
+     */
+    public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel()
+    {
+        $records = array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+        );
+
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+        $handler->expects($this->never())
+            ->method('send');
+        $handler->setLevel(Logger::ERROR);
+
+        $handler->handleBatch($records);
+    }
+
+    /**
+     * @covers Monolog\Handler\MailHandler::write
+     */
+    public function testHandle()
+    {
+        $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler');
+
+        $record = $this->getRecord();
+        $records = array($record);
+        $records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n";
+
+        $handler->expects($this->once())
+            ->method('send')
+            ->with($records[0]['formatted'], $records);
+
+        $handler->handle($record);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php

@@ -0,0 +1,27 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Raven_Client;
+
+class MockRavenClient extends Raven_Client
+{
+    public function capture($data, $stack, $vars = null)
+    {
+        $data = array_merge($this->get_user_data(), $data);
+        $this->lastData = $data;
+        $this->lastStack = $stack;
+    }
+
+    public $lastData;
+    public $lastStack;
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php

@@ -0,0 +1,65 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class MongoDBHandlerTest extends TestCase
+{
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorShouldThrowExceptionForInvalidMongo()
+    {
+        new MongoDBHandler(new \stdClass(), 'DB', 'Collection');
+    }
+
+    public function testHandle()
+    {
+        $mongo = $this->getMock('Mongo', array('selectCollection'), array(), '', false);
+        $collection = $this->getMock('stdClass', array('save'));
+
+        $mongo->expects($this->once())
+            ->method('selectCollection')
+            ->with('DB', 'Collection')
+            ->will($this->returnValue($collection));
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $expected = array(
+            'message' => 'test',
+            'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34),
+            'level' => Logger::WARNING,
+            'level_name' => 'WARNING',
+            'channel' => 'test',
+            'datetime' => $record['datetime']->format('Y-m-d H:i:s'),
+            'extra' => array(),
+        );
+
+        $collection->expects($this->once())
+            ->method('save')
+            ->with($expected);
+
+        $handler = new MongoDBHandler($mongo, 'DB', 'Collection');
+        $handler->handle($record);
+    }
+}
+
+if (!class_exists('Mongo')) {
+    class Mongo
+    {
+        public function selectCollection()
+        {
+        }
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php

@@ -0,0 +1,111 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use InvalidArgumentException;
+
+function mail($to, $subject, $message, $additional_headers = null, $additional_parameters = null)
+{
+    $GLOBALS['mail'][] = func_get_args();
+}
+
+class NativeMailerHandlerTest extends TestCase
+{
+    protected function setUp()
+    {
+        $GLOBALS['mail'] = array();
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorHeaderInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org");
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterHeaderInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org");
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterArrayHeaderInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org"));
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterContentTypeInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->setContentType("text/html\r\nFrom: faked@attacker.org");
+    }
+
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testSetterEncodingInjection()
+    {
+        $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org');
+        $mailer->setEncoding("utf-8\r\nFrom: faked@attacker.org");
+    }
+
+    public function testSend()
+    {
+        $to = 'spammer@example.org';
+        $subject = 'dear victim';
+        $from = 'receiver@example.org';
+
+        $mailer = new NativeMailerHandler($to, $subject, $from);
+        $mailer->handleBatch(array());
+
+        // batch is empty, nothing sent
+        $this->assertEmpty($GLOBALS['mail']);
+
+        // non-empty batch
+        $mailer->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+        $this->assertNotEmpty($GLOBALS['mail']);
+        $this->assertInternalType('array', $GLOBALS['mail']);
+        $this->assertArrayHasKey('0', $GLOBALS['mail']);
+        $params = $GLOBALS['mail'][0];
+        $this->assertCount(5, $params);
+        $this->assertSame($to, $params[0]);
+        $this->assertSame($subject, $params[1]);
+        $this->assertStringEndsWith(" test.ERROR: Foo Bar  Baz [] []\n", $params[2]);
+        $this->assertSame("From: $from\r\nContent-type: text/plain; charset=utf-8\r\n", $params[3]);
+        $this->assertSame('', $params[4]);
+    }
+
+    public function testMessageSubjectFormatting()
+    {
+        $mailer = new NativeMailerHandler('to@example.org', 'Alert: %level_name% %message%', 'from@example.org');
+        $mailer->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz"));
+        $this->assertNotEmpty($GLOBALS['mail']);
+        $this->assertInternalType('array', $GLOBALS['mail']);
+        $this->assertArrayHasKey('0', $GLOBALS['mail']);
+        $params = $GLOBALS['mail'][0];
+        $this->assertCount(5, $params);
+        $this->assertSame('Alert: ERROR Foo Bar  Baz', $params[1]);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php

@@ -0,0 +1,200 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Formatter\LineFormatter;
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class NewRelicHandlerTest extends TestCase
+{
+    public static $appname;
+    public static $customParameters;
+    public static $transactionName;
+
+    public function setUp()
+    {
+        self::$appname = null;
+        self::$customParameters = array();
+        self::$transactionName = null;
+    }
+
+    /**
+     * @expectedException Monolog\Handler\MissingExtensionException
+     */
+    public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded()
+    {
+        $handler = new StubNewRelicHandlerWithoutExtension();
+        $handler->handle($this->getRecord(Logger::ERROR));
+    }
+
+    public function testThehandlerCanHandleTheRecord()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR));
+    }
+
+    public function testThehandlerCanAddContextParamsToTheNewRelicTrace()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')));
+        $this->assertEquals(array('context_a' => 'b'), self::$customParameters);
+    }
+
+    public function testThehandlerCanAddExplodedContextParamsToTheNewRelicTrace()
+    {
+        $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
+        $handler->handle($this->getRecord(
+            Logger::ERROR,
+            'log message',
+            array('a' => array('key1' => 'value1', 'key2' => 'value2'))
+        ));
+        $this->assertEquals(
+            array('context_a_key1' => 'value1', 'context_a_key2' => 'value2'),
+            self::$customParameters
+        );
+    }
+
+    public function testThehandlerCanAddExtraParamsToTheNewRelicTrace()
+    {
+        $record = $this->getRecord(Logger::ERROR, 'log message');
+        $record['extra'] = array('c' => 'd');
+
+        $handler = new StubNewRelicHandler();
+        $handler->handle($record);
+
+        $this->assertEquals(array('extra_c' => 'd'), self::$customParameters);
+    }
+
+    public function testThehandlerCanAddExplodedExtraParamsToTheNewRelicTrace()
+    {
+        $record = $this->getRecord(Logger::ERROR, 'log message');
+        $record['extra'] = array('c' => array('key1' => 'value1', 'key2' => 'value2'));
+
+        $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true);
+        $handler->handle($record);
+
+        $this->assertEquals(
+            array('extra_c_key1' => 'value1', 'extra_c_key2' => 'value2'),
+            self::$customParameters
+        );
+    }
+
+    public function testThehandlerCanAddExtraContextAndParamsToTheNewRelicTrace()
+    {
+        $record = $this->getRecord(Logger::ERROR, 'log message', array('a' => 'b'));
+        $record['extra'] = array('c' => 'd');
+
+        $handler = new StubNewRelicHandler();
+        $handler->handle($record);
+
+        $expected = array(
+            'context_a' => 'b',
+            'extra_c' => 'd',
+        );
+
+        $this->assertEquals($expected, self::$customParameters);
+    }
+
+    public function testThehandlerCanHandleTheRecordsFormattedUsingTheLineFormatter()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->setFormatter(new LineFormatter());
+        $handler->handle($this->getRecord(Logger::ERROR));
+    }
+
+    public function testTheAppNameIsNullByDefault()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals(null, self::$appname);
+    }
+
+    public function testTheAppNameCanBeInjectedFromtheConstructor()
+    {
+        $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals('myAppName', self::$appname);
+    }
+
+    public function testTheAppNameCanBeOverriddenFromEachLog()
+    {
+        $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName')));
+
+        $this->assertEquals('logAppName', self::$appname);
+    }
+
+    public function testTheTransactionNameIsNullByDefault()
+    {
+        $handler = new StubNewRelicHandler();
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals(null, self::$transactionName);
+    }
+
+    public function testTheTransactionNameCanBeInjectedFromTheConstructor()
+    {
+        $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message'));
+
+        $this->assertEquals('myTransaction', self::$transactionName);
+    }
+
+    public function testTheTransactionNameCanBeOverriddenFromEachLog()
+    {
+        $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction');
+        $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('transaction_name' => 'logTransactName')));
+
+        $this->assertEquals('logTransactName', self::$transactionName);
+    }
+}
+
+class StubNewRelicHandlerWithoutExtension extends NewRelicHandler
+{
+    protected function isNewRelicEnabled()
+    {
+        return false;
+    }
+}
+
+class StubNewRelicHandler extends NewRelicHandler
+{
+    protected function isNewRelicEnabled()
+    {
+        return true;
+    }
+}
+
+function newrelic_notice_error()
+{
+    return true;
+}
+
+function newrelic_set_appname($appname)
+{
+    return NewRelicHandlerTest::$appname = $appname;
+}
+
+function newrelic_name_transaction($transactionName)
+{
+    return NewRelicHandlerTest::$transactionName = $transactionName;
+}
+
+function newrelic_add_custom_parameter($key, $value)
+{
+    NewRelicHandlerTest::$customParameters[$key] = $value;
+
+    return true;
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php

@@ -0,0 +1,33 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\NullHandler::handle
+ */
+class NullHandlerTest extends TestCase
+{
+    public function testHandle()
+    {
+        $handler = new NullHandler();
+        $this->assertTrue($handler->handle($this->getRecord()));
+    }
+
+    public function testHandleLowerLevelRecord()
+    {
+        $handler = new NullHandler(Logger::WARNING);
+        $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG)));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php

@@ -0,0 +1,273 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Exception;
+use Monolog\ErrorHandler;
+use Monolog\Logger;
+use Monolog\TestCase;
+use PhpConsole\Connector;
+use PhpConsole\Dispatcher\Debug as DebugDispatcher;
+use PhpConsole\Dispatcher\Errors as ErrorDispatcher;
+use PhpConsole\Handler;
+use PHPUnit_Framework_MockObject_MockObject;
+
+/**
+ * @covers Monolog\Handler\PHPConsoleHandler
+ * @author Sergey Barbushin https://www.linkedin.com/in/barbushin
+ */
+class PHPConsoleHandlerTest extends TestCase
+{
+    /** @var  Connector|PHPUnit_Framework_MockObject_MockObject */
+    protected $connector;
+    /** @var  DebugDispatcher|PHPUnit_Framework_MockObject_MockObject */
+    protected $debugDispatcher;
+    /** @var  ErrorDispatcher|PHPUnit_Framework_MockObject_MockObject */
+    protected $errorDispatcher;
+
+    protected function setUp()
+    {
+        if (!class_exists('PhpConsole\Connector')) {
+            $this->markTestSkipped('PHP Console library not found. See https://github.com/barbushin/php-console#installation');
+        }
+        $this->connector = $this->initConnectorMock();
+
+        $this->debugDispatcher = $this->initDebugDispatcherMock($this->connector);
+        $this->connector->setDebugDispatcher($this->debugDispatcher);
+
+        $this->errorDispatcher = $this->initErrorDispatcherMock($this->connector);
+        $this->connector->setErrorsDispatcher($this->errorDispatcher);
+    }
+
+    protected function initDebugDispatcherMock(Connector $connector)
+    {
+        return $this->getMockBuilder('PhpConsole\Dispatcher\Debug')
+            ->disableOriginalConstructor()
+            ->setMethods(array('dispatchDebug'))
+            ->setConstructorArgs(array($connector, $connector->getDumper()))
+            ->getMock();
+    }
+
+    protected function initErrorDispatcherMock(Connector $connector)
+    {
+        return $this->getMockBuilder('PhpConsole\Dispatcher\Errors')
+            ->disableOriginalConstructor()
+            ->setMethods(array('dispatchError', 'dispatchException'))
+            ->setConstructorArgs(array($connector, $connector->getDumper()))
+            ->getMock();
+    }
+
+    protected function initConnectorMock()
+    {
+        $connector = $this->getMockBuilder('PhpConsole\Connector')
+            ->disableOriginalConstructor()
+            ->setMethods(array(
+                'sendMessage',
+                'onShutDown',
+                'isActiveClient',
+                'setSourcesBasePath',
+                'setServerEncoding',
+                'setPassword',
+                'enableSslOnlyMode',
+                'setAllowedIpMasks',
+                'setHeadersLimit',
+                'startEvalRequestsListener',
+            ))
+            ->getMock();
+
+        $connector->expects($this->any())
+            ->method('isActiveClient')
+            ->will($this->returnValue(true));
+
+        return $connector;
+    }
+
+    protected function getHandlerDefaultOption($name)
+    {
+        $handler = new PHPConsoleHandler(array(), $this->connector);
+        $options = $handler->getOptions();
+
+        return $options[$name];
+    }
+
+    protected function initLogger($handlerOptions = array(), $level = Logger::DEBUG)
+    {
+        return new Logger('test', array(
+            new PHPConsoleHandler($handlerOptions, $this->connector, $level),
+        ));
+    }
+
+    public function testInitWithDefaultConnector()
+    {
+        $handler = new PHPConsoleHandler();
+        $this->assertEquals(spl_object_hash(Connector::getInstance()), spl_object_hash($handler->getConnector()));
+    }
+
+    public function testInitWithCustomConnector()
+    {
+        $handler = new PHPConsoleHandler(array(), $this->connector);
+        $this->assertEquals(spl_object_hash($this->connector), spl_object_hash($handler->getConnector()));
+    }
+
+    public function testDebug()
+    {
+        $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with($this->equalTo('test'));
+        $this->initLogger()->addDebug('test');
+    }
+
+    public function testDebugContextInMessage()
+    {
+        $message = 'test';
+        $tag = 'tag';
+        $context = array($tag, 'custom' => mt_rand());
+        $expectedMessage = $message . ' ' . json_encode(array_slice($context, 1));
+        $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with(
+            $this->equalTo($expectedMessage),
+            $this->equalTo($tag)
+        );
+        $this->initLogger()->addDebug($message, $context);
+    }
+
+    public function testDebugTags($tagsContextKeys = null)
+    {
+        $expectedTags = mt_rand();
+        $logger = $this->initLogger($tagsContextKeys ? array('debugTagsKeysInContext' => $tagsContextKeys) : array());
+        if (!$tagsContextKeys) {
+            $tagsContextKeys = $this->getHandlerDefaultOption('debugTagsKeysInContext');
+        }
+        foreach ($tagsContextKeys as $key) {
+            $debugDispatcher = $this->initDebugDispatcherMock($this->connector);
+            $debugDispatcher->expects($this->once())->method('dispatchDebug')->with(
+                $this->anything(),
+                $this->equalTo($expectedTags)
+            );
+            $this->connector->setDebugDispatcher($debugDispatcher);
+            $logger->addDebug('test', array($key => $expectedTags));
+        }
+    }
+
+    public function testError($classesPartialsTraceIgnore = null)
+    {
+        $code = E_USER_NOTICE;
+        $message = 'message';
+        $file = __FILE__;
+        $line = __LINE__;
+        $this->errorDispatcher->expects($this->once())->method('dispatchError')->with(
+            $this->equalTo($code),
+            $this->equalTo($message),
+            $this->equalTo($file),
+            $this->equalTo($line),
+            $classesPartialsTraceIgnore ?: $this->equalTo($this->getHandlerDefaultOption('classesPartialsTraceIgnore'))
+        );
+        $errorHandler = ErrorHandler::register($this->initLogger($classesPartialsTraceIgnore ? array('classesPartialsTraceIgnore' => $classesPartialsTraceIgnore) : array()), false);
+        $errorHandler->registerErrorHandler(array(), false, E_USER_WARNING);
+        $errorHandler->handleError($code, $message, $file, $line);
+    }
+
+    public function testException()
+    {
+        $e = new Exception();
+        $this->errorDispatcher->expects($this->once())->method('dispatchException')->with(
+            $this->equalTo($e)
+        );
+        $handler = $this->initLogger();
+        $handler->log(
+            \Psr\Log\LogLevel::ERROR,
+            sprintf('Uncaught Exception %s: "%s" at %s line %s', get_class($e), $e->getMessage(), $e->getFile(), $e->getLine()),
+            array('exception' => $e)
+        );
+    }
+
+    /**
+     * @expectedException Exception
+     */
+    public function testWrongOptionsThrowsException()
+    {
+        new PHPConsoleHandler(array('xxx' => 1));
+    }
+
+    public function testOptionEnabled()
+    {
+        $this->debugDispatcher->expects($this->never())->method('dispatchDebug');
+        $this->initLogger(array('enabled' => false))->addDebug('test');
+    }
+
+    public function testOptionClassesPartialsTraceIgnore()
+    {
+        $this->testError(array('Class', 'Namespace\\'));
+    }
+
+    public function testOptionDebugTagsKeysInContext()
+    {
+        $this->testDebugTags(array('key1', 'key2'));
+    }
+
+    public function testOptionUseOwnErrorsAndExceptionsHandler()
+    {
+        $this->initLogger(array('useOwnErrorsHandler' => true, 'useOwnExceptionsHandler' => true));
+        $this->assertEquals(array(Handler::getInstance(), 'handleError'), set_error_handler(function () {
+        }));
+        $this->assertEquals(array(Handler::getInstance(), 'handleException'), set_exception_handler(function () {
+        }));
+    }
+
+    public static function provideConnectorMethodsOptionsSets()
+    {
+        return array(
+            array('sourcesBasePath', 'setSourcesBasePath', __DIR__),
+            array('serverEncoding', 'setServerEncoding', 'cp1251'),
+            array('password', 'setPassword', '******'),
+            array('enableSslOnlyMode', 'enableSslOnlyMode', true, false),
+            array('ipMasks', 'setAllowedIpMasks', array('127.0.0.*')),
+            array('headersLimit', 'setHeadersLimit', 2500),
+            array('enableEvalListener', 'startEvalRequestsListener', true, false),
+        );
+    }
+
+    /**
+     * @dataProvider provideConnectorMethodsOptionsSets
+     */
+    public function testOptionCallsConnectorMethod($option, $method, $value, $isArgument = true)
+    {
+        $expectCall = $this->connector->expects($this->once())->method($method);
+        if ($isArgument) {
+            $expectCall->with($value);
+        }
+        new PHPConsoleHandler(array($option => $value), $this->connector);
+    }
+
+    public function testOptionDetectDumpTraceAndSource()
+    {
+        new PHPConsoleHandler(array('detectDumpTraceAndSource' => true), $this->connector);
+        $this->assertTrue($this->connector->getDebugDispatcher()->detectTraceAndSource);
+    }
+
+    public static function provideDumperOptionsValues()
+    {
+        return array(
+            array('dumperLevelLimit', 'levelLimit', 1001),
+            array('dumperItemsCountLimit', 'itemsCountLimit', 1002),
+            array('dumperItemSizeLimit', 'itemSizeLimit', 1003),
+            array('dumperDumpSizeLimit', 'dumpSizeLimit', 1004),
+            array('dumperDetectCallbacks', 'detectCallbacks', true),
+        );
+    }
+
+    /**
+     * @dataProvider provideDumperOptionsValues
+     */
+    public function testDumperOptions($option, $dumperProperty, $value)
+    {
+        new PHPConsoleHandler(array($option => $value), $this->connector);
+        $this->assertEquals($value, $this->connector->getDumper()->$dumperProperty);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php

@@ -0,0 +1,50 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\PsrHandler::handle
+ */
+class PsrHandlerTest extends TestCase
+{
+    public function logLevelProvider()
+    {
+        $levels = array();
+        $monologLogger = new Logger('');
+
+        foreach ($monologLogger->getLevels() as $levelName => $level) {
+            $levels[] = array($levelName, $level);
+        }
+
+        return $levels;
+    }
+
+    /**
+     * @dataProvider logLevelProvider
+     */
+    public function testHandlesAllLevels($levelName, $level)
+    {
+        $message = 'Hello, world! ' . $level;
+        $context = array('foo' => 'bar', 'level' => $level);
+
+        $psrLogger = $this->getMock('Psr\Log\NullLogger');
+        $psrLogger->expects($this->once())
+            ->method('log')
+            ->with(strtolower($levelName), $message, $context);
+
+        $handler = new PsrHandler($psrLogger);
+        $handler->handle(array('level' => $level, 'level_name' => $levelName, 'message' => $message, 'context' => $context));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php

@@ -0,0 +1,141 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * Almost all examples (expected header, titles, messages) taken from
+ * https://www.pushover.net/api
+ * @author Sebastian Göttschkes <sebastian.goettschkes@googlemail.com>
+ * @see https://www.pushover.net/api
+ */
+class PushoverHandlerTest extends TestCase
+{
+    private $res;
+    private $handler;
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+
+        return $content;
+    }
+
+    /**
+     * @depends testWriteHeader
+     */
+    public function testWriteContent($content)
+    {
+        $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}$/', $content);
+    }
+
+    public function testWriteWithComplexTitle()
+    {
+        $this->createHandler('myToken', 'myUser', 'Backup finished - SQL1');
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content);
+    }
+
+    public function testWriteWithComplexMessage()
+    {
+        $this->createHandler();
+        $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content);
+    }
+
+    public function testWriteWithTooLongMessage()
+    {
+        $message = str_pad('test', 520, 'a');
+        $this->createHandler();
+        $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, $message));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $expectedMessage = substr($message, 0, 505);
+
+        $this->assertRegexp('/message=' . $expectedMessage . '&title/', $content);
+    }
+
+    public function testWriteWithHighPriority()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}&priority=1$/', $content);
+    }
+
+    public function testWriteWithEmergencyPriority()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+    }
+
+    public function testWriteToMultipleUsers()
+    {
+        $this->createHandler('myToken', array('userA', 'userB'));
+        $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content);
+        $this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog&timestamp=\d{10}&priority=2&retry=30&expire=25200$/', $content);
+    }
+
+    private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog')
+    {
+        $constructorArgs = array($token, $user, $title);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\PushoverHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php

@@ -0,0 +1,255 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+class RavenHandlerTest extends TestCase
+{
+    public function setUp()
+    {
+        if (!class_exists('Raven_Client')) {
+            $this->markTestSkipped('raven/raven not installed');
+        }
+
+        require_once __DIR__ . '/MockRavenClient.php';
+    }
+
+    /**
+     * @covers Monolog\Handler\RavenHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new RavenHandler($this->getRavenClient());
+        $this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler);
+    }
+
+    protected function getHandler($ravenClient)
+    {
+        $handler = new RavenHandler($ravenClient);
+
+        return $handler;
+    }
+
+    protected function getRavenClient()
+    {
+        $dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1';
+
+        return new MockRavenClient($dsn);
+    }
+
+    public function testDebug()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $record = $this->getRecord(Logger::DEBUG, 'A test debug message');
+        $handler->handle($record);
+
+        $this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']);
+        $this->assertContains($record['message'], $ravenClient->lastData['message']);
+    }
+
+    public function testWarning()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $record = $this->getRecord(Logger::WARNING, 'A test warning message');
+        $handler->handle($record);
+
+        $this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']);
+        $this->assertContains($record['message'], $ravenClient->lastData['message']);
+    }
+
+    public function testTag()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $tags = array(1, 2, 'foo');
+        $record = $this->getRecord(Logger::INFO, 'test', array('tags' => $tags));
+        $handler->handle($record);
+
+        $this->assertEquals($tags, $ravenClient->lastData['tags']);
+    }
+
+    public function testExtraParameters()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $checksum = '098f6bcd4621d373cade4e832627b4f6';
+        $release = '05a671c66aefea124cc08b76ea6d30bb';
+        $eventId = '31423';
+        $record = $this->getRecord(Logger::INFO, 'test', array('checksum' => $checksum, 'release' => $release, 'event_id' => $eventId));
+        $handler->handle($record);
+
+        $this->assertEquals($checksum, $ravenClient->lastData['checksum']);
+        $this->assertEquals($release, $ravenClient->lastData['release']);
+        $this->assertEquals($eventId, $ravenClient->lastData['event_id']);
+    }
+
+    public function testFingerprint()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $fingerprint = array('{{ default }}', 'other value');
+        $record = $this->getRecord(Logger::INFO, 'test', array('fingerprint' => $fingerprint));
+        $handler->handle($record);
+
+        $this->assertEquals($fingerprint, $ravenClient->lastData['fingerprint']);
+    }
+
+    public function testUserContext()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $recordWithNoContext = $this->getRecord(Logger::INFO, 'test with default user context');
+        // set user context 'externally'
+
+        $user = array(
+            'id' => '123',
+            'email' => 'test@test.com',
+        );
+
+        $recordWithContext = $this->getRecord(Logger::INFO, 'test', array('user' => $user));
+
+        $ravenClient->user_context(array('id' => 'test_user_id'));
+        // handle context
+        $handler->handle($recordWithContext);
+        $this->assertEquals($user, $ravenClient->lastData['user']);
+
+        // check to see if its reset
+        $handler->handle($recordWithNoContext);
+        $this->assertInternalType('array', $ravenClient->context->user);
+        $this->assertSame('test_user_id', $ravenClient->context->user['id']);
+
+        // handle with null context
+        $ravenClient->user_context(null);
+        $handler->handle($recordWithContext);
+        $this->assertEquals($user, $ravenClient->lastData['user']);
+
+        // check to see if its reset
+        $handler->handle($recordWithNoContext);
+        $this->assertNull($ravenClient->context->user);
+    }
+
+    public function testException()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        try {
+            $this->methodThatThrowsAnException();
+        } catch (\Exception $e) {
+            $record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e));
+            $handler->handle($record);
+        }
+
+        $this->assertEquals($record['message'], $ravenClient->lastData['message']);
+    }
+
+    public function testHandleBatch()
+    {
+        $records = $this->getMultipleRecords();
+        $records[] = $this->getRecord(Logger::WARNING, 'warning');
+        $records[] = $this->getRecord(Logger::WARNING, 'warning');
+
+        $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $logFormatter->expects($this->once())->method('formatBatch');
+
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) {
+            return $record['level'] == 400;
+        }));
+
+        $handler = $this->getHandler($this->getRavenClient());
+        $handler->setBatchFormatter($logFormatter);
+        $handler->setFormatter($formatter);
+        $handler->handleBatch($records);
+    }
+
+    public function testHandleBatchDoNothingIfRecordsAreBelowLevel()
+    {
+        $records = array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+        );
+
+        $handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient()));
+        $handler->expects($this->never())->method('handle');
+        $handler->setLevel(Logger::ERROR);
+        $handler->handleBatch($records);
+    }
+
+    public function testHandleBatchPicksProperMessage()
+    {
+        $records = array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information 1'),
+            $this->getRecord(Logger::ERROR, 'error 1'),
+            $this->getRecord(Logger::WARNING, 'warning'),
+            $this->getRecord(Logger::ERROR, 'error 2'),
+            $this->getRecord(Logger::INFO, 'information 2'),
+        );
+
+        $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $logFormatter->expects($this->once())->method('formatBatch');
+
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) use ($records) {
+            return $record['message'] == 'error 1';
+        }));
+
+        $handler = $this->getHandler($this->getRavenClient());
+        $handler->setBatchFormatter($logFormatter);
+        $handler->setFormatter($formatter);
+        $handler->handleBatch($records);
+    }
+
+    public function testGetSetBatchFormatter()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+
+        $handler->setBatchFormatter($formatter = new LineFormatter());
+        $this->assertSame($formatter, $handler->getBatchFormatter());
+    }
+
+    public function testRelease()
+    {
+        $ravenClient = $this->getRavenClient();
+        $handler = $this->getHandler($ravenClient);
+        $release = 'v42.42.42';
+        $handler->setRelease($release);
+        $record = $this->getRecord(Logger::INFO, 'test');
+        $handler->handle($record);
+        $this->assertEquals($release, $ravenClient->lastData['release']);
+
+        $localRelease = 'v41.41.41';
+        $record = $this->getRecord(Logger::INFO, 'test', array('release' => $localRelease));
+        $handler->handle($record);
+        $this->assertEquals($localRelease, $ravenClient->lastData['release']);
+    }
+
+    private function methodThatThrowsAnException()
+    {
+        throw new \Exception('This is an exception');
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php

@@ -0,0 +1,127 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+
+class RedisHandlerTest extends TestCase
+{
+    /**
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorShouldThrowExceptionForInvalidRedis()
+    {
+        new RedisHandler(new \stdClass(), 'key');
+    }
+
+    public function testConstructorShouldWorkWithPredis()
+    {
+        $redis = $this->getMock('Predis\Client');
+        $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+    }
+
+    public function testConstructorShouldWorkWithRedis()
+    {
+        $redis = $this->getMock('Redis');
+        $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key'));
+    }
+
+    public function testPredisHandle()
+    {
+        $redis = $this->getMock('Predis\Client', array('rpush'));
+
+        // Predis\Client uses rpush
+        $redis->expects($this->once())
+            ->method('rpush')
+            ->with('key', 'test');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $handler = new RedisHandler($redis, 'key');
+        $handler->setFormatter(new LineFormatter("%message%"));
+        $handler->handle($record);
+    }
+
+    public function testRedisHandle()
+    {
+        $redis = $this->getMock('Redis', array('rpush'));
+
+        // Redis uses rPush
+        $redis->expects($this->once())
+            ->method('rPush')
+            ->with('key', 'test');
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $handler = new RedisHandler($redis, 'key');
+        $handler->setFormatter(new LineFormatter("%message%"));
+        $handler->handle($record);
+    }
+
+    public function testRedisHandleCapped()
+    {
+        $redis = $this->getMock('Redis', array('multi', 'rpush', 'ltrim', 'exec'));
+
+        // Redis uses multi
+        $redis->expects($this->once())
+            ->method('multi')
+            ->will($this->returnSelf());
+
+        $redis->expects($this->once())
+            ->method('rpush')
+            ->will($this->returnSelf());
+
+        $redis->expects($this->once())
+            ->method('ltrim')
+            ->will($this->returnSelf());
+
+        $redis->expects($this->once())
+            ->method('exec')
+            ->will($this->returnSelf());
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $handler = new RedisHandler($redis, 'key', Logger::DEBUG, true, 10);
+        $handler->setFormatter(new LineFormatter("%message%"));
+        $handler->handle($record);
+    }
+
+    public function testPredisHandleCapped()
+    {
+        $redis = $this->getMock('Predis\Client', array('transaction'));
+
+        $redisTransaction = $this->getMock('Predis\Client', array('rpush', 'ltrim'));
+
+        $redisTransaction->expects($this->once())
+            ->method('rpush')
+            ->will($this->returnSelf());
+
+        $redisTransaction->expects($this->once())
+            ->method('ltrim')
+            ->will($this->returnSelf());
+
+        // Redis uses multi
+        $redis->expects($this->once())
+            ->method('transaction')
+            ->will($this->returnCallback(function ($cb) use ($redisTransaction) {
+                $cb($redisTransaction);
+            }));
+
+        $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34));
+
+        $handler = new RedisHandler($redis, 'key', Logger::DEBUG, true, 10);
+        $handler->setFormatter(new LineFormatter("%message%"));
+        $handler->handle($record);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RollbarHandlerTest.php

@@ -0,0 +1,84 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Exception;
+use Monolog\TestCase;
+use Monolog\Logger;
+use PHPUnit_Framework_MockObject_MockObject as MockObject;
+
+/**
+ * @author Erik Johansson <erik.pm.johansson@gmail.com>
+ * @see    https://rollbar.com/docs/notifier/rollbar-php/
+ *
+ * @coversDefaultClass Monolog\Handler\RollbarHandler
+ */
+class RollbarHandlerTest extends TestCase
+{
+    /**
+     * @var MockObject
+     */
+    private $rollbarNotifier;
+
+    /**
+     * @var array
+     */
+    public $reportedExceptionArguments = null;
+
+    protected function setUp()
+    {
+        parent::setUp();
+
+        $this->setupRollbarNotifierMock();
+    }
+
+    /**
+     * When reporting exceptions to Rollbar the
+     * level has to be set in the payload data
+     */
+    public function testExceptionLogLevel()
+    {
+        $handler = $this->createHandler();
+
+        $handler->handle($this->createExceptionRecord(Logger::DEBUG));
+
+        $this->assertEquals('debug', $this->reportedExceptionArguments['payload']['level']);
+    }
+
+    private function setupRollbarNotifierMock()
+    {
+        $this->rollbarNotifier = $this->getMockBuilder('RollbarNotifier')
+            ->setMethods(array('report_message', 'report_exception', 'flush'))
+            ->getMock();
+
+        $that = $this;
+
+        $this->rollbarNotifier
+            ->expects($this->any())
+            ->method('report_exception')
+            ->willReturnCallback(function ($exception, $context, $payload) use ($that) {
+                $that->reportedExceptionArguments = compact('exception', 'context', 'payload');
+            });
+    }
+
+    private function createHandler()
+    {
+        return new RollbarHandler($this->rollbarNotifier, Logger::DEBUG);
+    }
+
+    private function createExceptionRecord($level = Logger::DEBUG, $message = 'test', $exception = null)
+    {
+        return $this->getRecord($level, $message, array(
+            'exception' => $exception ?: new Exception()
+        ));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php

@@ -0,0 +1,245 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use PHPUnit_Framework_Error_Deprecated;
+
+/**
+ * @covers Monolog\Handler\RotatingFileHandler
+ */
+class RotatingFileHandlerTest extends TestCase
+{
+    /**
+     * This var should be private but then the anonymous function
+     * in the `setUp` method won't be able to set it. `$this` cant't
+     * be used in the anonymous function in `setUp` because PHP 5.3
+     * does not support it.
+     */
+    public $lastError;
+
+    public function setUp()
+    {
+        $dir = __DIR__.'/Fixtures';
+        chmod($dir, 0777);
+        if (!is_writable($dir)) {
+            $this->markTestSkipped($dir.' must be writable to test the RotatingFileHandler.');
+        }
+        $this->lastError = null;
+        $self = $this;
+        // workaround with &$self used for PHP 5.3
+        set_error_handler(function($code, $message) use (&$self) {
+            $self->lastError = array(
+                'code' => $code,
+                'message' => $message,
+            );
+        });
+    }
+
+    private function assertErrorWasTriggered($code, $message)
+    {
+        if (empty($this->lastError)) {
+            $this->fail(
+                sprintf(
+                    'Failed asserting that error with code `%d` and message `%s` was triggered',
+                    $code,
+                    $message
+                )
+            );
+        }
+        $this->assertEquals($code, $this->lastError['code'], sprintf('Expected an error with code %d to be triggered, got `%s` instead', $code, $this->lastError['code']));
+        $this->assertEquals($message, $this->lastError['message'], sprintf('Expected an error with message `%d` to be triggered, got `%s` instead', $message, $this->lastError['message']));
+    }
+
+    public function testRotationCreatesNewFile()
+    {
+        touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot');
+
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+        $this->assertTrue(file_exists($log));
+        $this->assertEquals('test', file_get_contents($log));
+    }
+
+    /**
+     * @dataProvider rotationTests
+     */
+    public function testRotation($createFile, $dateFormat, $timeCallback)
+    {
+        touch($old1 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-1)).'.rot');
+        touch($old2 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-2)).'.rot');
+        touch($old3 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-3)).'.rot');
+        touch($old4 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-4)).'.rot');
+
+        $log = __DIR__.'/Fixtures/foo-'.date($dateFormat).'.rot';
+
+        if ($createFile) {
+            touch($log);
+        }
+
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->setFilenameFormat('{filename}-{date}', $dateFormat);
+        $handler->handle($this->getRecord());
+
+        $handler->close();
+
+        $this->assertTrue(file_exists($log));
+        $this->assertTrue(file_exists($old1));
+        $this->assertEquals($createFile, file_exists($old2));
+        $this->assertEquals($createFile, file_exists($old3));
+        $this->assertEquals($createFile, file_exists($old4));
+        $this->assertEquals('test', file_get_contents($log));
+    }
+
+    public function rotationTests()
+    {
+        $now = time();
+        $dayCallback = function($ago) use ($now) {
+            return $now + 86400 * $ago;
+        };
+        $monthCallback = function($ago) {
+            return gmmktime(0, 0, 0, date('n') + $ago, 1, date('Y'));
+        };
+        $yearCallback = function($ago) {
+            return gmmktime(0, 0, 0, 1, 1, date('Y') + $ago);
+        };
+
+        return array(
+            'Rotation is triggered when the file of the current day is not present'
+                => array(true, RotatingFileHandler::FILE_PER_DAY, $dayCallback),
+            'Rotation is not triggered when the file of the current day is already present'
+                => array(false, RotatingFileHandler::FILE_PER_DAY, $dayCallback),
+
+            'Rotation is triggered when the file of the current month is not present'
+                => array(true, RotatingFileHandler::FILE_PER_MONTH, $monthCallback),
+            'Rotation is not triggered when the file of the current month is already present'
+                => array(false, RotatingFileHandler::FILE_PER_MONTH, $monthCallback),
+
+            'Rotation is triggered when the file of the current year is not present'
+                => array(true, RotatingFileHandler::FILE_PER_YEAR, $yearCallback),
+            'Rotation is not triggered when the file of the current year is already present'
+                => array(false, RotatingFileHandler::FILE_PER_YEAR, $yearCallback),
+        );
+    }
+
+    /**
+     * @dataProvider dateFormatProvider
+     */
+    public function testAllowOnlyFixedDefinedDateFormats($dateFormat, $valid)
+    {
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
+        $handler->setFilenameFormat('{filename}-{date}', $dateFormat);
+        if (!$valid) {
+            $this->assertErrorWasTriggered(
+                E_USER_DEPRECATED,
+                'Invalid date format - format must be one of RotatingFileHandler::FILE_PER_DAY ("Y-m-d"), '.
+                'RotatingFileHandler::FILE_PER_MONTH ("Y-m") or RotatingFileHandler::FILE_PER_YEAR ("Y"), '.
+                'or you can set one of the date formats using slashes, underscores and/or dots instead of dashes.'
+            );
+        }
+    }
+
+    public function dateFormatProvider()
+    {
+        return array(
+            array(RotatingFileHandler::FILE_PER_DAY, true),
+            array(RotatingFileHandler::FILE_PER_MONTH, true),
+            array(RotatingFileHandler::FILE_PER_YEAR, true),
+            array('m-d-Y', false),
+            array('Y-m-d-h-i', false)
+        );
+    }
+
+    /**
+     * @dataProvider filenameFormatProvider
+     */
+    public function testDisallowFilenameFormatsWithoutDate($filenameFormat, $valid)
+    {
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
+        $handler->setFilenameFormat($filenameFormat, RotatingFileHandler::FILE_PER_DAY);
+        if (!$valid) {
+            $this->assertErrorWasTriggered(
+                E_USER_DEPRECATED,
+                'Invalid filename format - format should contain at least `{date}`, because otherwise rotating is impossible.'
+            );
+        }
+    }
+
+    public function filenameFormatProvider()
+    {
+        return array(
+            array('{filename}', false),
+            array('{filename}-{date}', true),
+            array('{date}', true),
+            array('foobar-{date}', true),
+            array('foo-{date}-bar', true),
+            array('{date}-foobar', true),
+            array('foobar', false),
+        );
+    }
+
+    /**
+     * @dataProvider rotationWhenSimilarFilesExistTests
+     */
+    public function testRotationWhenSimilarFileNamesExist($dateFormat)
+    {
+        touch($old1 = __DIR__.'/Fixtures/foo-foo-'.date($dateFormat).'.rot');
+        touch($old2 = __DIR__.'/Fixtures/foo-bar-'.date($dateFormat).'.rot');
+
+        $log = __DIR__.'/Fixtures/foo-'.date($dateFormat).'.rot';
+
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2);
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->setFilenameFormat('{filename}-{date}', $dateFormat);
+        $handler->handle($this->getRecord());
+        $handler->close();
+
+        $this->assertTrue(file_exists($log));
+    }
+
+    public function rotationWhenSimilarFilesExistTests()
+    {
+
+        return array(
+            'Rotation is triggered when the file of the current day is not present but similar exists'
+                => array(RotatingFileHandler::FILE_PER_DAY),
+
+            'Rotation is triggered when the file of the current month is not present but similar exists'
+                => array(RotatingFileHandler::FILE_PER_MONTH),
+
+            'Rotation is triggered when the file of the current year is not present but similar exists'
+                => array(RotatingFileHandler::FILE_PER_YEAR),
+        );
+    }
+
+    public function testReuseCurrentFile()
+    {
+        $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot';
+        file_put_contents($log, "foo");
+        $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot');
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord());
+        $this->assertEquals('footest', file_get_contents($log));
+    }
+
+    public function tearDown()
+    {
+        foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) {
+            unlink($file);
+        }
+        restore_error_handler();
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php

@@ -0,0 +1,33 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @covers Monolog\Handler\SamplingHandler::handle
+ */
+class SamplingHandlerTest extends TestCase
+{
+    public function testHandle()
+    {
+        $testHandler = new TestHandler();
+        $handler = new SamplingHandler($testHandler, 2);
+        for ($i = 0; $i < 10000; $i++) {
+            $handler->handle($this->getRecord());
+        }
+        $count = count($testHandler->getRecords());
+        // $count should be half of 10k, so between 4k and 6k
+        $this->assertLessThan(6000, $count);
+        $this->assertGreaterThan(4000, $count);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/Slack/SlackRecordTest.php

@@ -0,0 +1,395 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler\Slack;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+/**
+ * @coversDefaultClass Monolog\Handler\Slack\SlackRecord
+ */
+class SlackRecordTest extends TestCase
+{
+    private $jsonPrettyPrintFlag;
+
+    protected function setUp()
+    {
+        $this->jsonPrettyPrintFlag = defined('JSON_PRETTY_PRINT') ? JSON_PRETTY_PRINT : 128;
+    }
+
+    public function dataGetAttachmentColor()
+    {
+        return array(
+            array(Logger::DEBUG, SlackRecord::COLOR_DEFAULT),
+            array(Logger::INFO, SlackRecord::COLOR_GOOD),
+            array(Logger::NOTICE, SlackRecord::COLOR_GOOD),
+            array(Logger::WARNING, SlackRecord::COLOR_WARNING),
+            array(Logger::ERROR, SlackRecord::COLOR_DANGER),
+            array(Logger::CRITICAL, SlackRecord::COLOR_DANGER),
+            array(Logger::ALERT, SlackRecord::COLOR_DANGER),
+            array(Logger::EMERGENCY, SlackRecord::COLOR_DANGER),
+        );
+    }
+
+    /**
+     * @dataProvider dataGetAttachmentColor
+     * @param  int $logLevel
+     * @param  string $expectedColour RGB hex color or name of Slack color
+     * @covers ::getAttachmentColor
+     */
+    public function testGetAttachmentColor($logLevel, $expectedColour)
+    {
+        $slackRecord = new SlackRecord();
+        $this->assertSame(
+            $expectedColour,
+            $slackRecord->getAttachmentColor($logLevel)
+        );
+    }
+
+    public function testAddsChannel()
+    {
+        $channel = '#test';
+        $record = new SlackRecord($channel);
+        $data = $record->getSlackData($this->getRecord());
+
+        $this->assertArrayHasKey('channel', $data);
+        $this->assertSame($channel, $data['channel']);
+    }
+
+    public function testNoUsernameByDefault()
+    {
+        $record = new SlackRecord();
+        $data = $record->getSlackData($this->getRecord());
+
+        $this->assertArrayNotHasKey('username', $data);
+    }
+
+    /**
+     * @return array
+     */
+    public function dataStringify()
+    {
+        $jsonPrettyPrintFlag = defined('JSON_PRETTY_PRINT') ? JSON_PRETTY_PRINT : 128;
+
+        $multipleDimensions = array(array(1, 2));
+        $numericKeys = array('library' => 'monolog');
+        $singleDimension = array(1, 'Hello', 'Jordi');
+
+        return array(
+            array(array(), '[]'),
+            array($multipleDimensions, json_encode($multipleDimensions, $jsonPrettyPrintFlag)),
+            array($numericKeys, json_encode($numericKeys, $jsonPrettyPrintFlag)),
+            array($singleDimension, json_encode($singleDimension))
+        );
+    }
+
+    /**
+     * @dataProvider dataStringify
+     */
+    public function testStringify($fields, $expectedResult)
+    {
+        $slackRecord = new SlackRecord(
+            '#test',
+            'test',
+            true,
+            null,
+            true,
+            true
+        );
+
+        $this->assertSame($expectedResult, $slackRecord->stringify($fields));
+    }
+
+    public function testAddsCustomUsername()
+    {
+        $username = 'Monolog bot';
+        $record = new SlackRecord(null, $username);
+        $data = $record->getSlackData($this->getRecord());
+
+        $this->assertArrayHasKey('username', $data);
+        $this->assertSame($username, $data['username']);
+    }
+
+    public function testNoIcon()
+    {
+        $record = new SlackRecord();
+        $data = $record->getSlackData($this->getRecord());
+
+        $this->assertArrayNotHasKey('icon_emoji', $data);
+    }
+
+    public function testAddsIcon()
+    {
+        $record = $this->getRecord();
+        $slackRecord = new SlackRecord(null, null, false, 'ghost');
+        $data = $slackRecord->getSlackData($record);
+
+        $slackRecord2 = new SlackRecord(null, null, false, 'http://github.com/Seldaek/monolog');
+        $data2 = $slackRecord2->getSlackData($record);
+
+        $this->assertArrayHasKey('icon_emoji', $data);
+        $this->assertSame(':ghost:', $data['icon_emoji']);
+        $this->assertArrayHasKey('icon_url', $data2);
+        $this->assertSame('http://github.com/Seldaek/monolog', $data2['icon_url']);
+    }
+
+    public function testAttachmentsNotPresentIfNoAttachment()
+    {
+        $record = new SlackRecord(null, null, false);
+        $data = $record->getSlackData($this->getRecord());
+
+        $this->assertArrayNotHasKey('attachments', $data);
+    }
+
+    public function testAddsOneAttachment()
+    {
+        $record = new SlackRecord();
+        $data = $record->getSlackData($this->getRecord());
+
+        $this->assertArrayHasKey('attachments', $data);
+        $this->assertArrayHasKey(0, $data['attachments']);
+        $this->assertInternalType('array', $data['attachments'][0]);
+    }
+
+    public function testTextEqualsMessageIfNoAttachment()
+    {
+        $message = 'Test message';
+        $record = new SlackRecord(null, null, false);
+        $data = $record->getSlackData($this->getRecord(Logger::WARNING, $message));
+
+        $this->assertArrayHasKey('text', $data);
+        $this->assertSame($message, $data['text']);
+    }
+
+    public function testTextEqualsFormatterOutput()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter
+            ->expects($this->any())
+            ->method('format')
+            ->will($this->returnCallback(function ($record) { return $record['message'] . 'test'; }));
+
+        $formatter2 = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter2
+            ->expects($this->any())
+            ->method('format')
+            ->will($this->returnCallback(function ($record) { return $record['message'] . 'test1'; }));
+
+        $message = 'Test message';
+        $record = new SlackRecord(null, null, false, null, false, false, array(), $formatter);
+        $data = $record->getSlackData($this->getRecord(Logger::WARNING, $message));
+
+        $this->assertArrayHasKey('text', $data);
+        $this->assertSame($message . 'test', $data['text']);
+
+        $record->setFormatter($formatter2);
+        $data = $record->getSlackData($this->getRecord(Logger::WARNING, $message));
+
+        $this->assertArrayHasKey('text', $data);
+        $this->assertSame($message . 'test1', $data['text']);
+    }
+
+    public function testAddsFallbackAndTextToAttachment()
+    {
+        $message = 'Test message';
+        $record = new SlackRecord(null);
+        $data = $record->getSlackData($this->getRecord(Logger::WARNING, $message));
+
+        $this->assertSame($message, $data['attachments'][0]['text']);
+        $this->assertSame($message, $data['attachments'][0]['fallback']);
+    }
+
+    public function testMapsLevelToColorAttachmentColor()
+    {
+        $record = new SlackRecord(null);
+        $errorLoggerRecord = $this->getRecord(Logger::ERROR);
+        $emergencyLoggerRecord = $this->getRecord(Logger::EMERGENCY);
+        $warningLoggerRecord = $this->getRecord(Logger::WARNING);
+        $infoLoggerRecord = $this->getRecord(Logger::INFO);
+        $debugLoggerRecord = $this->getRecord(Logger::DEBUG);
+
+        $data = $record->getSlackData($errorLoggerRecord);
+        $this->assertSame(SlackRecord::COLOR_DANGER, $data['attachments'][0]['color']);
+
+        $data = $record->getSlackData($emergencyLoggerRecord);
+        $this->assertSame(SlackRecord::COLOR_DANGER, $data['attachments'][0]['color']);
+
+        $data = $record->getSlackData($warningLoggerRecord);
+        $this->assertSame(SlackRecord::COLOR_WARNING, $data['attachments'][0]['color']);
+
+        $data = $record->getSlackData($infoLoggerRecord);
+        $this->assertSame(SlackRecord::COLOR_GOOD, $data['attachments'][0]['color']);
+
+        $data = $record->getSlackData($debugLoggerRecord);
+        $this->assertSame(SlackRecord::COLOR_DEFAULT, $data['attachments'][0]['color']);
+    }
+
+    public function testAddsShortAttachmentWithoutContextAndExtra()
+    {
+        $level = Logger::ERROR;
+        $levelName = Logger::getLevelName($level);
+        $record = new SlackRecord(null, null, true, null, true);
+        $data = $record->getSlackData($this->getRecord($level, 'test', array('test' => 1)));
+
+        $attachment = $data['attachments'][0];
+        $this->assertArrayHasKey('title', $attachment);
+        $this->assertArrayHasKey('fields', $attachment);
+        $this->assertSame($levelName, $attachment['title']);
+        $this->assertSame(array(), $attachment['fields']);
+    }
+
+    public function testAddsShortAttachmentWithContextAndExtra()
+    {
+        $level = Logger::ERROR;
+        $levelName = Logger::getLevelName($level);
+        $context = array('test' => 1);
+        $extra = array('tags' => array('web'));
+        $record = new SlackRecord(null, null, true, null, true, true);
+        $loggerRecord = $this->getRecord($level, 'test', $context);
+        $loggerRecord['extra'] = $extra;
+        $data = $record->getSlackData($loggerRecord);
+
+        $attachment = $data['attachments'][0];
+        $this->assertArrayHasKey('title', $attachment);
+        $this->assertArrayHasKey('fields', $attachment);
+        $this->assertCount(2, $attachment['fields']);
+        $this->assertSame($levelName, $attachment['title']);
+        $this->assertSame(
+            array(
+                array(
+                    'title' => 'Extra',
+                    'value' => sprintf('```%s```', json_encode($extra, $this->jsonPrettyPrintFlag)),
+                    'short' => false
+                ),
+                array(
+                    'title' => 'Context',
+                    'value' => sprintf('```%s```', json_encode($context, $this->jsonPrettyPrintFlag)),
+                    'short' => false
+                )
+            ),
+            $attachment['fields']
+        );
+    }
+
+    public function testAddsLongAttachmentWithoutContextAndExtra()
+    {
+        $level = Logger::ERROR;
+        $levelName = Logger::getLevelName($level);
+        $record = new SlackRecord(null, null, true, null);
+        $data = $record->getSlackData($this->getRecord($level, 'test', array('test' => 1)));
+
+        $attachment = $data['attachments'][0];
+        $this->assertArrayHasKey('title', $attachment);
+        $this->assertArrayHasKey('fields', $attachment);
+        $this->assertCount(1, $attachment['fields']);
+        $this->assertSame('Message', $attachment['title']);
+        $this->assertSame(
+            array(array(
+                'title' => 'Level',
+                'value' => $levelName,
+                'short' => false
+            )),
+            $attachment['fields']
+        );
+    }
+
+    public function testAddsLongAttachmentWithContextAndExtra()
+    {
+        $level = Logger::ERROR;
+        $levelName = Logger::getLevelName($level);
+        $context = array('test' => 1);
+        $extra = array('tags' => array('web'));
+        $record = new SlackRecord(null, null, true, null, false, true);
+        $loggerRecord = $this->getRecord($level, 'test', $context);
+        $loggerRecord['extra'] = $extra;
+        $data = $record->getSlackData($loggerRecord);
+
+        $expectedFields = array(
+            array(
+                'title' => 'Level',
+                'value' => $levelName,
+                'short' => false,
+            ),
+            array(
+                'title' => 'Tags',
+                'value' => sprintf('```%s```', json_encode($extra['tags'])),
+                'short' => false
+            ),
+            array(
+                'title' => 'Test',
+                'value' => $context['test'],
+                'short' => false
+            )
+        );
+
+        $attachment = $data['attachments'][0];
+        $this->assertArrayHasKey('title', $attachment);
+        $this->assertArrayHasKey('fields', $attachment);
+        $this->assertCount(3, $attachment['fields']);
+        $this->assertSame('Message', $attachment['title']);
+        $this->assertSame(
+            $expectedFields,
+            $attachment['fields']
+        );
+    }
+
+    public function testAddsTimestampToAttachment()
+    {
+        $record = $this->getRecord();
+        $slackRecord = new SlackRecord();
+        $data = $slackRecord->getSlackData($this->getRecord());
+
+        $attachment = $data['attachments'][0];
+        $this->assertArrayHasKey('ts', $attachment);
+        $this->assertSame($record['datetime']->getTimestamp(), $attachment['ts']);
+    }
+
+    public function testContextHasException()
+    {
+        $record = $this->getRecord(Logger::CRITICAL, 'This is a critical message.', array('exception' => new \Exception()));
+        $slackRecord = new SlackRecord(null, null, true, null, false, true);
+        $data = $slackRecord->getSlackData($record);
+        $this->assertInternalType('string', $data['attachments'][0]['fields'][1]['value']);
+    }
+
+    public function testExcludeExtraAndContextFields()
+    {
+        $record = $this->getRecord(
+            Logger::WARNING,
+            'test',
+            array('info' => array('library' => 'monolog', 'author' => 'Jordi'))
+        );
+        $record['extra'] = array('tags' => array('web', 'cli'));
+
+        $slackRecord = new SlackRecord(null, null, true, null, false, true, array('context.info.library', 'extra.tags.1'));
+        $data = $slackRecord->getSlackData($record);
+        $attachment = $data['attachments'][0];
+
+        $expected = array(
+            array(
+                'title' => 'Info',
+                'value' => sprintf('```%s```', json_encode(array('author' => 'Jordi'), $this->jsonPrettyPrintFlag)),
+                'short' => false
+            ),
+            array(
+                'title' => 'Tags',
+                'value' => sprintf('```%s```', json_encode(array('web'))),
+                'short' => false
+            ),
+        );
+
+        foreach ($expected as $field) {
+            $this->assertNotFalse(array_search($field, $attachment['fields']));
+            break;
+        }
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php

@@ -0,0 +1,155 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Handler\Slack\SlackRecord;
+
+/**
+ * @author Greg Kedzierski <greg@gregkedzierski.com>
+ * @see    https://api.slack.com/
+ */
+class SlackHandlerTest extends TestCase
+{
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @var SlackHandler
+     */
+    private $handler;
+
+    public function setUp()
+    {
+        if (!extension_loaded('openssl')) {
+            $this->markTestSkipped('This test requires openssl to run');
+        }
+    }
+
+    public function testWriteHeader()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/POST \/api\/chat.postMessage HTTP\/1.1\\r\\nHost: slack.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content);
+    }
+
+    public function testWriteContent()
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegExp('/username=Monolog/', $content);
+        $this->assertRegExp('/channel=channel1/', $content);
+        $this->assertRegExp('/token=myToken/', $content);
+        $this->assertRegExp('/attachments/', $content);
+    }
+
+    public function testWriteContentUsesFormatterIfProvided()
+    {
+        $this->createHandler('myToken', 'channel1', 'Monolog', false);
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->createHandler('myToken', 'channel1', 'Monolog', false);
+        $this->handler->setFormatter(new LineFormatter('foo--%message%'));
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test2'));
+        fseek($this->res, 0);
+        $content2 = fread($this->res, 1024);
+
+        $this->assertRegexp('/text=test1/', $content);
+        $this->assertRegexp('/text=foo--test2/', $content2);
+    }
+
+    public function testWriteContentWithEmoji()
+    {
+        $this->createHandler('myToken', 'channel1', 'Monolog', true, 'alien');
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/icon_emoji=%3Aalien%3A/', $content);
+    }
+
+    /**
+     * @dataProvider provideLevelColors
+     */
+    public function testWriteContentWithColors($level, $expectedColor)
+    {
+        $this->createHandler();
+        $this->handler->handle($this->getRecord($level, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/%22color%22%3A%22'.$expectedColor.'/', $content);
+    }
+
+    public function testWriteContentWithPlainTextMessage()
+    {
+        $this->createHandler('myToken', 'channel1', 'Monolog', false);
+        $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1'));
+        fseek($this->res, 0);
+        $content = fread($this->res, 1024);
+
+        $this->assertRegexp('/text=test1/', $content);
+    }
+
+    public function provideLevelColors()
+    {
+        return array(
+            array(Logger::DEBUG,    urlencode(SlackRecord::COLOR_DEFAULT)),
+            array(Logger::INFO,     SlackRecord::COLOR_GOOD),
+            array(Logger::NOTICE,   SlackRecord::COLOR_GOOD),
+            array(Logger::WARNING,  SlackRecord::COLOR_WARNING),
+            array(Logger::ERROR,    SlackRecord::COLOR_DANGER),
+            array(Logger::CRITICAL, SlackRecord::COLOR_DANGER),
+            array(Logger::ALERT,    SlackRecord::COLOR_DANGER),
+            array(Logger::EMERGENCY,SlackRecord::COLOR_DANGER),
+        );
+    }
+
+    private function createHandler($token = 'myToken', $channel = 'channel1', $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $useShortAttachment = false, $includeExtra = false)
+    {
+        $constructorArgs = array($token, $channel, $username, $useAttachment, $iconEmoji, Logger::DEBUG, true, $useShortAttachment, $includeExtra);
+        $this->res = fopen('php://memory', 'a');
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\SlackHandler',
+            array('fsockopen', 'streamSetTimeout', 'closeSocket'),
+            $constructorArgs
+        );
+
+        $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString');
+        $reflectionProperty->setAccessible(true);
+        $reflectionProperty->setValue($this->handler, 'localhost:1234');
+
+        $this->handler->expects($this->any())
+            ->method('fsockopen')
+            ->will($this->returnValue($this->res));
+        $this->handler->expects($this->any())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(true));
+        $this->handler->expects($this->any())
+            ->method('closeSocket')
+            ->will($this->returnValue(true));
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackWebhookHandlerTest.php

@@ -0,0 +1,107 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Handler\Slack\SlackRecord;
+
+/**
+ * @author Haralan Dobrev <hkdobrev@gmail.com>
+ * @see    https://api.slack.com/incoming-webhooks
+ * @coversDefaultClass Monolog\Handler\SlackWebhookHandler
+ */
+class SlackWebhookHandlerTest extends TestCase
+{
+    const WEBHOOK_URL = 'https://hooks.slack.com/services/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E';
+
+    /**
+     * @covers ::__construct
+     * @covers ::getSlackRecord
+     */
+    public function testConstructorMinimal()
+    {
+        $handler = new SlackWebhookHandler(self::WEBHOOK_URL);
+        $record = $this->getRecord();
+        $slackRecord = $handler->getSlackRecord();
+        $this->assertInstanceOf('Monolog\Handler\Slack\SlackRecord', $slackRecord);
+        $this->assertEquals(array(
+            'attachments' => array(
+                array(
+                    'fallback' => 'test',
+                    'text' => 'test',
+                    'color' => SlackRecord::COLOR_WARNING,
+                    'fields' => array(
+                        array(
+                            'title' => 'Level',
+                            'value' => 'WARNING',
+                            'short' => false,
+                        ),
+                    ),
+                    'title' => 'Message',
+                    'mrkdwn_in' => array('fields'),
+                    'ts' => $record['datetime']->getTimestamp(),
+                ),
+            ),
+        ), $slackRecord->getSlackData($record));
+    }
+
+    /**
+     * @covers ::__construct
+     * @covers ::getSlackRecord
+     */
+    public function testConstructorFull()
+    {
+        $handler = new SlackWebhookHandler(
+            self::WEBHOOK_URL,
+            'test-channel',
+            'test-username',
+            false,
+            ':ghost:',
+            false,
+            false,
+            Logger::DEBUG,
+            false
+        );
+
+        $slackRecord = $handler->getSlackRecord();
+        $this->assertInstanceOf('Monolog\Handler\Slack\SlackRecord', $slackRecord);
+        $this->assertEquals(array(
+            'username' => 'test-username',
+            'text' => 'test',
+            'channel' => 'test-channel',
+            'icon_emoji' => ':ghost:',
+        ), $slackRecord->getSlackData($this->getRecord()));
+    }
+
+    /**
+     * @covers ::getFormatter
+     */
+    public function testGetFormatter()
+    {
+        $handler = new SlackWebhookHandler(self::WEBHOOK_URL);
+        $formatter = $handler->getFormatter();
+        $this->assertInstanceOf('Monolog\Formatter\FormatterInterface', $formatter);
+    }
+
+    /**
+     * @covers ::setFormatter
+     */
+    public function testSetFormatter()
+    {
+        $handler = new SlackWebhookHandler(self::WEBHOOK_URL);
+        $formatter = new LineFormatter();
+        $handler->setFormatter($formatter);
+        $this->assertSame($formatter, $handler->getFormatter());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackbotHandlerTest.php

@@ -0,0 +1,47 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Haralan Dobrev <hkdobrev@gmail.com>
+ * @see    https://slack.com/apps/A0F81R8ET-slackbot
+ * @coversDefaultClass Monolog\Handler\SlackbotHandler
+ */
+class SlackbotHandlerTest extends TestCase
+{
+    /**
+     * @covers ::__construct
+     */
+    public function testConstructorMinimal()
+    {
+        $handler = new SlackbotHandler('test-team', 'test-token', 'test-channel');
+        $this->assertInstanceOf('Monolog\Handler\AbstractProcessingHandler', $handler);
+    }
+
+    /**
+     * @covers ::__construct
+     */
+    public function testConstructorFull()
+    {
+        $handler = new SlackbotHandler(
+            'test-team',
+            'test-token',
+            'test-channel',
+            Logger::DEBUG,
+            false
+        );
+        $this->assertInstanceOf('Monolog\Handler\AbstractProcessingHandler', $handler);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php

@@ -0,0 +1,335 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @author Pablo de Leon Belloc <pablolb@gmail.com>
+ */
+class SocketHandlerTest extends TestCase
+{
+    /**
+     * @var Monolog\Handler\SocketHandler
+     */
+    private $handler;
+
+    /**
+     * @var resource
+     */
+    private $res;
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testInvalidHostname()
+    {
+        $this->createHandler('garbage://here');
+        $this->writeRecord('data');
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     */
+    public function testBadConnectionTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setConnectionTimeout(-1);
+    }
+
+    public function testSetConnectionTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setConnectionTimeout(10.1);
+        $this->assertEquals(10.1, $this->handler->getConnectionTimeout());
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     */
+    public function testBadTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setTimeout(-1);
+    }
+
+    public function testSetTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setTimeout(10.25);
+        $this->assertEquals(10.25, $this->handler->getTimeout());
+    }
+
+    public function testSetWritingTimeout()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setWritingTimeout(10.25);
+        $this->assertEquals(10.25, $this->handler->getWritingTimeout());
+    }
+
+    public function testSetChunkSize()
+    {
+        $this->createHandler('localhost:1234');
+        $this->handler->setChunkSize(1025);
+        $this->assertEquals(1025, $this->handler->getChunkSize());
+    }
+
+    public function testSetConnectionString()
+    {
+        $this->createHandler('tcp://localhost:9090');
+        $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownOnFsockopenError()
+    {
+        $this->setMockHandler(array('fsockopen'));
+        $this->handler->expects($this->once())
+            ->method('fsockopen')
+            ->will($this->returnValue(false));
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownOnPfsockopenError()
+    {
+        $this->setMockHandler(array('pfsockopen'));
+        $this->handler->expects($this->once())
+            ->method('pfsockopen')
+            ->will($this->returnValue(false));
+        $this->handler->setPersistent(true);
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownIfCannotSetTimeout()
+    {
+        $this->setMockHandler(array('streamSetTimeout'));
+        $this->handler->expects($this->once())
+            ->method('streamSetTimeout')
+            ->will($this->returnValue(false));
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testExceptionIsThrownIfCannotSetChunkSize()
+    {
+        $this->setMockHandler(array('streamSetChunkSize'));
+        $this->handler->setChunkSize(8192);
+        $this->handler->expects($this->once())
+            ->method('streamSetChunkSize')
+            ->will($this->returnValue(false));
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsOnIfFwriteReturnsFalse()
+    {
+        $this->setMockHandler(array('fwrite'));
+
+        $callback = function ($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => false,
+            );
+
+            return $map[$arg];
+        };
+
+        $this->handler->expects($this->exactly(2))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsIfStreamTimesOut()
+    {
+        $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+        $callback = function ($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => 5,
+            );
+
+            return $map[$arg];
+        };
+
+        $this->handler->expects($this->exactly(1))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+        $this->handler->expects($this->exactly(1))
+            ->method('streamGetMetadata')
+            ->will($this->returnValue(array('timed_out' => true)));
+
+        $this->writeRecord('Hello world');
+    }
+
+    /**
+     * @expectedException RuntimeException
+     */
+    public function testWriteFailsOnIncompleteWrite()
+    {
+        $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+        $res = $this->res;
+        $callback = function ($string) use ($res) {
+            fclose($res);
+
+            return strlen('Hello');
+        };
+
+        $this->handler->expects($this->exactly(1))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+        $this->handler->expects($this->exactly(1))
+            ->method('streamGetMetadata')
+            ->will($this->returnValue(array('timed_out' => false)));
+
+        $this->writeRecord('Hello world');
+    }
+
+    public function testWriteWithMemoryFile()
+    {
+        $this->setMockHandler();
+        $this->writeRecord('test1');
+        $this->writeRecord('test2');
+        $this->writeRecord('test3');
+        fseek($this->res, 0);
+        $this->assertEquals('test1test2test3', fread($this->res, 1024));
+    }
+
+    public function testWriteWithMock()
+    {
+        $this->setMockHandler(array('fwrite'));
+
+        $callback = function ($arg) {
+            $map = array(
+                'Hello world' => 6,
+                'world' => 5,
+            );
+
+            return $map[$arg];
+        };
+
+        $this->handler->expects($this->exactly(2))
+            ->method('fwrite')
+            ->will($this->returnCallback($callback));
+
+        $this->writeRecord('Hello world');
+    }
+
+    public function testClose()
+    {
+        $this->setMockHandler();
+        $this->writeRecord('Hello world');
+        $this->assertInternalType('resource', $this->res);
+        $this->handler->close();
+        $this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler");
+    }
+
+    public function testCloseDoesNotClosePersistentSocket()
+    {
+        $this->setMockHandler();
+        $this->handler->setPersistent(true);
+        $this->writeRecord('Hello world');
+        $this->assertTrue(is_resource($this->res));
+        $this->handler->close();
+        $this->assertTrue(is_resource($this->res));
+    }
+
+    /**
+     * @expectedException \RuntimeException
+     */
+    public function testAvoidInfiniteLoopWhenNoDataIsWrittenForAWritingTimeoutSeconds()
+    {
+        $this->setMockHandler(array('fwrite', 'streamGetMetadata'));
+
+        $this->handler->expects($this->any())
+            ->method('fwrite')
+            ->will($this->returnValue(0));
+
+        $this->handler->expects($this->any())
+            ->method('streamGetMetadata')
+            ->will($this->returnValue(array('timed_out' => false)));
+
+        $this->handler->setWritingTimeout(1);
+
+        $this->writeRecord('Hello world');
+    }
+
+    private function createHandler($connectionString)
+    {
+        $this->handler = new SocketHandler($connectionString);
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+
+    private function writeRecord($string)
+    {
+        $this->handler->handle($this->getRecord(Logger::WARNING, $string));
+    }
+
+    private function setMockHandler(array $methods = array())
+    {
+        $this->res = fopen('php://memory', 'a');
+
+        $defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout');
+        $newMethods = array_diff($methods, $defaultMethods);
+
+        $finalMethods = array_merge($defaultMethods, $newMethods);
+
+        $this->handler = $this->getMock(
+            '\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234')
+        );
+
+        if (!in_array('fsockopen', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('fsockopen')
+                ->will($this->returnValue($this->res));
+        }
+
+        if (!in_array('pfsockopen', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('pfsockopen')
+                ->will($this->returnValue($this->res));
+        }
+
+        if (!in_array('streamSetTimeout', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('streamSetTimeout')
+                ->will($this->returnValue(true));
+        }
+
+        if (!in_array('streamSetChunkSize', $methods)) {
+            $this->handler->expects($this->any())
+                ->method('streamSetChunkSize')
+                ->will($this->returnValue(8192));
+        }
+
+        $this->handler->setFormatter($this->getIdentityFormatter());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php

@@ -0,0 +1,184 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class StreamHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWrite()
+    {
+        $handle = fopen('php://memory', 'a+');
+        $handler = new StreamHandler($handle);
+        $handler->setFormatter($this->getIdentityFormatter());
+        $handler->handle($this->getRecord(Logger::WARNING, 'test'));
+        $handler->handle($this->getRecord(Logger::WARNING, 'test2'));
+        $handler->handle($this->getRecord(Logger::WARNING, 'test3'));
+        fseek($handle, 0);
+        $this->assertEquals('testtest2test3', fread($handle, 100));
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::close
+     */
+    public function testCloseKeepsExternalHandlersOpen()
+    {
+        $handle = fopen('php://memory', 'a+');
+        $handler = new StreamHandler($handle);
+        $this->assertTrue(is_resource($handle));
+        $handler->close();
+        $this->assertTrue(is_resource($handle));
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::close
+     */
+    public function testClose()
+    {
+        $handler = new StreamHandler('php://memory');
+        $handler->handle($this->getRecord(Logger::WARNING, 'test'));
+        $streamProp = new \ReflectionProperty('Monolog\Handler\StreamHandler', 'stream');
+        $streamProp->setAccessible(true);
+        $handle = $streamProp->getValue($handler);
+
+        $this->assertTrue(is_resource($handle));
+        $handler->close();
+        $this->assertFalse(is_resource($handle));
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteCreatesTheStreamResource()
+    {
+        $handler = new StreamHandler('php://memory');
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteLocking()
+    {
+        $temp = sys_get_temp_dir() . DIRECTORY_SEPARATOR . 'monolog_locked_log';
+        $handler = new StreamHandler($temp, Logger::DEBUG, true, null, true);
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException LogicException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteMissingResource()
+    {
+        $handler = new StreamHandler(null);
+        $handler->handle($this->getRecord());
+    }
+
+    public function invalidArgumentProvider()
+    {
+        return array(
+            array(1),
+            array(array()),
+            array(array('bogus://url')),
+        );
+    }
+
+    /**
+     * @dataProvider invalidArgumentProvider
+     * @expectedException InvalidArgumentException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     */
+    public function testWriteInvalidArgument($invalidArgument)
+    {
+        $handler = new StreamHandler($invalidArgument);
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteInvalidResource()
+    {
+        $handler = new StreamHandler('bogus://url');
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteNonExistingResource()
+    {
+        $handler = new StreamHandler('ftp://foo/bar/baz/'.rand(0, 10000));
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteNonExistingPath()
+    {
+        $handler = new StreamHandler(sys_get_temp_dir().'/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteNonExistingFileResource()
+    {
+        $handler = new StreamHandler('file://'.sys_get_temp_dir().'/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException Exception
+     * @expectedExceptionMessageRegExp /There is no existing directory at/
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteNonExistingAndNotCreatablePath()
+    {
+        if (defined('PHP_WINDOWS_VERSION_BUILD')) {
+            $this->markTestSkipped('Permissions checks can not run on windows');
+        }
+        $handler = new StreamHandler('/foo/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
+        $handler->handle($this->getRecord());
+    }
+
+    /**
+     * @expectedException Exception
+     * @expectedExceptionMessageRegExp /There is no existing directory at/
+     * @covers Monolog\Handler\StreamHandler::__construct
+     * @covers Monolog\Handler\StreamHandler::write
+     */
+    public function testWriteNonExistingAndNotCreatableFileResource()
+    {
+        if (defined('PHP_WINDOWS_VERSION_BUILD')) {
+            $this->markTestSkipped('Permissions checks can not run on windows');
+        }
+        $handler = new StreamHandler('file:///foo/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000));
+        $handler->handle($this->getRecord());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php

@@ -0,0 +1,113 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+
+class SwiftMailerHandlerTest extends TestCase
+{
+    /** @var \Swift_Mailer|\PHPUnit_Framework_MockObject_MockObject */
+    private $mailer;
+
+    public function setUp()
+    {
+        $this->mailer = $this
+            ->getMockBuilder('Swift_Mailer')
+            ->disableOriginalConstructor()
+            ->getMock();
+    }
+
+    public function testMessageCreationIsLazyWhenUsingCallback()
+    {
+        $this->mailer->expects($this->never())
+            ->method('send');
+
+        $callback = function () {
+            throw new \RuntimeException('Swift_Message creation callback should not have been called in this test');
+        };
+        $handler = new SwiftMailerHandler($this->mailer, $callback);
+
+        $records = array(
+            $this->getRecord(Logger::DEBUG),
+            $this->getRecord(Logger::INFO),
+        );
+        $handler->handleBatch($records);
+    }
+
+    public function testMessageCanBeCustomizedGivenLoggedData()
+    {
+        // Wire Mailer to expect a specific Swift_Message with a customized Subject
+        $expectedMessage = new \Swift_Message();
+        $this->mailer->expects($this->once())
+            ->method('send')
+            ->with($this->callback(function ($value) use ($expectedMessage) {
+                return $value instanceof \Swift_Message
+                    && $value->getSubject() === 'Emergency'
+                    && $value === $expectedMessage;
+            }));
+
+        // Callback dynamically changes subject based on number of logged records
+        $callback = function ($content, array $records) use ($expectedMessage) {
+            $subject = count($records) > 0 ? 'Emergency' : 'Normal';
+            $expectedMessage->setSubject($subject);
+
+            return $expectedMessage;
+        };
+        $handler = new SwiftMailerHandler($this->mailer, $callback);
+
+        // Logging 1 record makes this an Emergency
+        $records = array(
+            $this->getRecord(Logger::EMERGENCY),
+        );
+        $handler->handleBatch($records);
+    }
+
+    public function testMessageSubjectFormatting()
+    {
+        // Wire Mailer to expect a specific Swift_Message with a customized Subject
+        $messageTemplate = new \Swift_Message();
+        $messageTemplate->setSubject('Alert: %level_name% %message%');
+        $receivedMessage = null;
+
+        $this->mailer->expects($this->once())
+            ->method('send')
+            ->with($this->callback(function ($value) use (&$receivedMessage) {
+                $receivedMessage = $value;
+                return true;
+            }));
+
+        $handler = new SwiftMailerHandler($this->mailer, $messageTemplate);
+
+        $records = array(
+            $this->getRecord(Logger::EMERGENCY),
+        );
+        $handler->handleBatch($records);
+
+        $this->assertEquals('Alert: EMERGENCY test', $receivedMessage->getSubject());
+    }
+
+    public function testMessageHaveUniqueId()
+    {
+        $messageTemplate = new \Swift_Message();
+        $handler = new SwiftMailerHandler($this->mailer, $messageTemplate);
+
+        $method = new \ReflectionMethod('Monolog\Handler\SwiftMailerHandler', 'buildMessage');
+        $method->setAccessible(true);
+        $method->invokeArgs($handler, array($messageTemplate, array()));
+
+        $builtMessage1 = $method->invoke($handler, $messageTemplate, array());
+        $builtMessage2 = $method->invoke($handler, $messageTemplate, array());
+
+        $this->assertFalse($builtMessage1->getId() === $builtMessage2->getId(), 'Two different messages have the same id');
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php

@@ -0,0 +1,44 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\Logger;
+
+class SyslogHandlerTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Handler\SyslogHandler::__construct
+     */
+    public function testConstruct()
+    {
+        $handler = new SyslogHandler('test');
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', LOG_USER);
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', 'user');
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+
+        $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR);
+        $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler);
+    }
+
+    /**
+     * @covers Monolog\Handler\SyslogHandler::__construct
+     */
+    public function testConstructInvalidFacility()
+    {
+        $this->setExpectedException('UnexpectedValueException');
+        $handler = new SyslogHandler('test', 'unknown');
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php

@@ -0,0 +1,76 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+/**
+ * @requires extension sockets
+ */
+class SyslogUdpHandlerTest extends TestCase
+{
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testWeValidateFacilities()
+    {
+        $handler = new SyslogUdpHandler("ip", null, "invalidFacility");
+    }
+
+    public function testWeSplitIntoLines()
+    {
+        $time = '2014-01-07T12:34';
+        $pid = getmypid();
+        $host = gethostname();
+
+        $handler = $this->getMockBuilder('\Monolog\Handler\SyslogUdpHandler')
+            ->setConstructorArgs(array("127.0.0.1", 514, "authpriv"))
+            ->setMethods(array('getDateTime'))
+            ->getMock();
+
+        $handler->method('getDateTime')
+            ->willReturn($time);
+
+        $handler->setFormatter(new \Monolog\Formatter\ChromePHPFormatter());
+
+        $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol'));
+        $socket->expects($this->at(0))
+            ->method('write')
+            ->with("lol", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 $time $host php $pid - - ");
+        $socket->expects($this->at(1))
+            ->method('write')
+            ->with("hej", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 $time $host php $pid - - ");
+
+        $handler->setSocket($socket);
+
+        $handler->handle($this->getRecordWithMessage("hej\nlol"));
+    }
+
+    public function testSplitWorksOnEmptyMsg()
+    {
+        $handler = new SyslogUdpHandler("127.0.0.1", 514, "authpriv");
+        $handler->setFormatter($this->getIdentityFormatter());
+
+        $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol'));
+        $socket->expects($this->never())
+            ->method('write');
+
+        $handler->setSocket($socket);
+
+        $handler->handle($this->getRecordWithMessage(null));
+    }
+
+    protected function getRecordWithMessage($msg)
+    {
+        return array('message' => $msg, 'level' => \Monolog\Logger::WARNING, 'context' => null, 'extra' => array(), 'channel' => 'lol');
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php

@@ -0,0 +1,116 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+/**
+ * @covers Monolog\Handler\TestHandler
+ */
+class TestHandlerTest extends TestCase
+{
+    /**
+     * @dataProvider methodProvider
+     */
+    public function testHandler($method, $level)
+    {
+        $handler = new TestHandler;
+        $record = $this->getRecord($level, 'test'.$method);
+        $this->assertFalse($handler->hasRecords($level));
+        $this->assertFalse($handler->hasRecord($record, $level));
+        $this->assertFalse($handler->{'has'.$method}($record), 'has'.$method);
+        $this->assertFalse($handler->{'has'.$method.'ThatContains'}('test'), 'has'.$method.'ThatContains');
+        $this->assertFalse($handler->{'has'.$method.'ThatPasses'}(function ($rec) {
+            return true;
+        }), 'has'.$method.'ThatPasses');
+        $this->assertFalse($handler->{'has'.$method.'ThatMatches'}('/test\w+/'));
+        $this->assertFalse($handler->{'has'.$method.'Records'}(), 'has'.$method.'Records');
+        $handler->handle($record);
+
+        $this->assertFalse($handler->{'has'.$method}('bar'), 'has'.$method);
+        $this->assertTrue($handler->hasRecords($level));
+        $this->assertTrue($handler->hasRecord($record, $level));
+        $this->assertTrue($handler->{'has'.$method}($record), 'has'.$method);
+        $this->assertTrue($handler->{'has'.$method}('test'.$method), 'has'.$method);
+        $this->assertTrue($handler->{'has'.$method.'ThatContains'}('test'), 'has'.$method.'ThatContains');
+        $this->assertTrue($handler->{'has'.$method.'ThatPasses'}(function ($rec) {
+            return true;
+        }), 'has'.$method.'ThatPasses');
+        $this->assertTrue($handler->{'has'.$method.'ThatMatches'}('/test\w+/'));
+        $this->assertTrue($handler->{'has'.$method.'Records'}(), 'has'.$method.'Records');
+
+        $records = $handler->getRecords();
+        unset($records[0]['formatted']);
+        $this->assertEquals(array($record), $records);
+    }
+
+    public function testHandlerAssertEmptyContext() {
+        $handler = new TestHandler;
+        $record  = $this->getRecord(Logger::WARNING, 'test', array());
+        $this->assertFalse($handler->hasWarning(array(
+            'message' => 'test',
+            'context' => array(),
+        )));
+
+        $handler->handle($record);
+
+        $this->assertTrue($handler->hasWarning(array(
+            'message' => 'test',
+            'context' => array(),
+        )));
+        $this->assertFalse($handler->hasWarning(array(
+            'message' => 'test',
+            'context' => array(
+                'foo' => 'bar'
+            ),
+        )));
+    }
+
+    public function testHandlerAssertNonEmptyContext() {
+        $handler = new TestHandler;
+        $record  = $this->getRecord(Logger::WARNING, 'test', array('foo' => 'bar'));
+        $this->assertFalse($handler->hasWarning(array(
+            'message' => 'test',
+            'context' => array(
+                'foo' => 'bar'
+            ),
+        )));
+
+        $handler->handle($record);
+
+        $this->assertTrue($handler->hasWarning(array(
+            'message' => 'test',
+            'context' => array(
+                'foo' => 'bar'
+            ),
+        )));
+        $this->assertFalse($handler->hasWarning(array(
+            'message' => 'test',
+            'context' => array(),
+        )));
+    }
+
+    public function methodProvider()
+    {
+        return array(
+            array('Emergency', Logger::EMERGENCY),
+            array('Alert'    , Logger::ALERT),
+            array('Critical' , Logger::CRITICAL),
+            array('Error'    , Logger::ERROR),
+            array('Warning'  , Logger::WARNING),
+            array('Info'     , Logger::INFO),
+            array('Notice'   , Logger::NOTICE),
+            array('Debug'    , Logger::DEBUG),
+        );
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php

@@ -0,0 +1,64 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Handler\SyslogUdp\UdpSocket;
+
+/**
+ * @requires extension sockets
+ */
+class UdpSocketTest extends TestCase
+{
+    public function testWeDoNotTruncateShortMessages()
+    {
+        $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
+
+        $socket->expects($this->at(0))
+            ->method('send')
+            ->with("HEADER: The quick brown fox jumps over the lazy dog");
+
+        $socket->write("The quick brown fox jumps over the lazy dog", "HEADER: ");
+    }
+
+    public function testLongMessagesAreTruncated()
+    {
+        $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol'));
+
+        $truncatedString = str_repeat("derp", 16254).'d';
+
+        $socket->expects($this->exactly(1))
+            ->method('send')
+            ->with("HEADER" . $truncatedString);
+
+        $longString = str_repeat("derp", 20000);
+
+        $socket->write($longString, "HEADER");
+    }
+
+    public function testDoubleCloseDoesNotError()
+    {
+        $socket = new UdpSocket('127.0.0.1', 514);
+        $socket->close();
+        $socket->close();
+    }
+
+    /**
+     * @expectedException LogicException
+     */
+    public function testWriteAfterCloseErrors()
+    {
+        $socket = new UdpSocket('127.0.0.1', 514);
+        $socket->close();
+        $socket->write('foo', "HEADER");
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php

@@ -0,0 +1,144 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+use Monolog\Logger;
+
+class WhatFailureGroupHandlerTest extends TestCase
+{
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::__construct
+     * @expectedException InvalidArgumentException
+     */
+    public function testConstructorOnlyTakesHandler()
+    {
+        new WhatFailureGroupHandler(array(new TestHandler(), "foo"));
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::__construct
+     * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+     */
+    public function testHandle()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new WhatFailureGroupHandler($testHandlers);
+        $handler->handle($this->getRecord(Logger::DEBUG));
+        $handler->handle($this->getRecord(Logger::INFO));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch
+     */
+    public function testHandleBatch()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new WhatFailureGroupHandler($testHandlers);
+        $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::isHandling
+     */
+    public function testIsHandling()
+    {
+        $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING));
+        $handler = new WhatFailureGroupHandler($testHandlers);
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR)));
+        $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING)));
+        $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG)));
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+     */
+    public function testHandleUsesProcessors()
+    {
+        $test = new TestHandler();
+        $handler = new WhatFailureGroupHandler(array($test));
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch
+     */
+    public function testHandleBatchUsesProcessors()
+    {
+        $testHandlers = array(new TestHandler(), new TestHandler());
+        $handler = new WhatFailureGroupHandler($testHandlers);
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO)));
+        foreach ($testHandlers as $test) {
+            $this->assertTrue($test->hasDebugRecords());
+            $this->assertTrue($test->hasInfoRecords());
+            $this->assertTrue(count($test->getRecords()) === 2);
+            $records = $test->getRecords();
+            $this->assertTrue($records[0]['extra']['foo']);
+            $this->assertTrue($records[1]['extra']['foo']);
+        }
+    }
+
+    /**
+     * @covers Monolog\Handler\WhatFailureGroupHandler::handle
+     */
+    public function testHandleException()
+    {
+        $test = new TestHandler();
+        $exception = new ExceptionTestHandler();
+        $handler = new WhatFailureGroupHandler(array($exception, $test, $exception));
+        $handler->pushProcessor(function ($record) {
+            $record['extra']['foo'] = true;
+
+            return $record;
+        });
+        $handler->handle($this->getRecord(Logger::WARNING));
+        $this->assertTrue($test->hasWarningRecords());
+        $records = $test->getRecords();
+        $this->assertTrue($records[0]['extra']['foo']);
+    }
+}
+
+class ExceptionTestHandler extends TestHandler
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function handle(array $record)
+    {
+        parent::handle($record);
+
+        throw new \Exception("ExceptionTestHandler::handle");
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php

@@ -0,0 +1,69 @@
+<?php
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Handler;
+
+use Monolog\TestCase;
+
+class ZendMonitorHandlerTest extends TestCase
+{
+    protected $zendMonitorHandler;
+
+    public function setUp()
+    {
+        if (!function_exists('zend_monitor_custom_event')) {
+            $this->markTestSkipped('ZendServer is not installed');
+        }
+    }
+
+    /**
+     * @covers  Monolog\Handler\ZendMonitorHandler::write
+     */
+    public function testWrite()
+    {
+        $record = $this->getRecord();
+        $formatterResult = array(
+            'message' => $record['message'],
+        );
+
+        $zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler')
+            ->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter'))
+            ->getMock();
+
+        $formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter')
+            ->disableOriginalConstructor()
+            ->getMock();
+
+        $formatterMock->expects($this->once())
+            ->method('format')
+            ->will($this->returnValue($formatterResult));
+
+        $zendMonitor->expects($this->once())
+            ->method('getDefaultFormatter')
+            ->will($this->returnValue($formatterMock));
+
+        $levelMap = $zendMonitor->getLevelMap();
+
+        $zendMonitor->expects($this->once())
+            ->method('writeZendMonitorCustomEvent')
+            ->with($levelMap[$record['level']], $record['message'], $formatterResult);
+
+        $zendMonitor->handle($record);
+    }
+
+    /**
+     * @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter
+     */
+    public function testGetDefaultFormatterReturnsNormalizerFormatter()
+    {
+        $zendMonitor = new ZendMonitorHandler();
+        $this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/LoggerTest.php

@@ -0,0 +1,690 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Processor\WebProcessor;
+use Monolog\Handler\TestHandler;
+
+class LoggerTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @covers Monolog\Logger::getName
+     */
+    public function testGetName()
+    {
+        $logger = new Logger('foo');
+        $this->assertEquals('foo', $logger->getName());
+    }
+
+    /**
+     * @covers Monolog\Logger::getLevelName
+     */
+    public function testGetLevelName()
+    {
+        $this->assertEquals('ERROR', Logger::getLevelName(Logger::ERROR));
+    }
+
+    /**
+     * @covers Monolog\Logger::withName
+     */
+    public function testWithName()
+    {
+        $first = new Logger('first', array($handler = new TestHandler()));
+        $second = $first->withName('second');
+
+        $this->assertSame('first', $first->getName());
+        $this->assertSame('second', $second->getName());
+        $this->assertSame($handler, $second->popHandler());
+    }
+
+    /**
+     * @covers Monolog\Logger::toMonologLevel
+     */
+    public function testConvertPSR3ToMonologLevel()
+    {
+        $this->assertEquals(Logger::toMonologLevel('debug'), 100);
+        $this->assertEquals(Logger::toMonologLevel('info'), 200);
+        $this->assertEquals(Logger::toMonologLevel('notice'), 250);
+        $this->assertEquals(Logger::toMonologLevel('warning'), 300);
+        $this->assertEquals(Logger::toMonologLevel('error'), 400);
+        $this->assertEquals(Logger::toMonologLevel('critical'), 500);
+        $this->assertEquals(Logger::toMonologLevel('alert'), 550);
+        $this->assertEquals(Logger::toMonologLevel('emergency'), 600);
+    }
+
+    /**
+     * @covers Monolog\Logger::getLevelName
+     * @expectedException InvalidArgumentException
+     */
+    public function testGetLevelNameThrows()
+    {
+        Logger::getLevelName(5);
+    }
+
+    /**
+     * @covers Monolog\Logger::__construct
+     */
+    public function testChannel()
+    {
+        $logger = new Logger('foo');
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->addWarning('test');
+        list($record) = $handler->getRecords();
+        $this->assertEquals('foo', $record['channel']);
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testLog()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'));
+        $handler->expects($this->once())
+            ->method('handle');
+        $logger->pushHandler($handler);
+
+        $this->assertTrue($logger->addWarning('test'));
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testLogNotHandled()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR));
+        $handler->expects($this->never())
+            ->method('handle');
+        $logger->pushHandler($handler);
+
+        $this->assertFalse($logger->addWarning('test'));
+    }
+
+    public function testHandlersInCtor()
+    {
+        $handler1 = new TestHandler;
+        $handler2 = new TestHandler;
+        $logger = new Logger(__METHOD__, array($handler1, $handler2));
+
+        $this->assertEquals($handler1, $logger->popHandler());
+        $this->assertEquals($handler2, $logger->popHandler());
+    }
+
+    public function testProcessorsInCtor()
+    {
+        $processor1 = new WebProcessor;
+        $processor2 = new WebProcessor;
+        $logger = new Logger(__METHOD__, array(), array($processor1, $processor2));
+
+        $this->assertEquals($processor1, $logger->popProcessor());
+        $this->assertEquals($processor2, $logger->popProcessor());
+    }
+
+    /**
+     * @covers Monolog\Logger::pushHandler
+     * @covers Monolog\Logger::popHandler
+     * @expectedException LogicException
+     */
+    public function testPushPopHandler()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler1 = new TestHandler;
+        $handler2 = new TestHandler;
+
+        $logger->pushHandler($handler1);
+        $logger->pushHandler($handler2);
+
+        $this->assertEquals($handler2, $logger->popHandler());
+        $this->assertEquals($handler1, $logger->popHandler());
+        $logger->popHandler();
+    }
+
+    /**
+     * @covers Monolog\Logger::setHandlers
+     */
+    public function testSetHandlers()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler1 = new TestHandler;
+        $handler2 = new TestHandler;
+
+        $logger->pushHandler($handler1);
+        $logger->setHandlers(array($handler2));
+
+        // handler1 has been removed
+        $this->assertEquals(array($handler2), $logger->getHandlers());
+
+        $logger->setHandlers(array(
+            "AMapKey" => $handler1,
+            "Woop" => $handler2,
+        ));
+
+        // Keys have been scrubbed
+        $this->assertEquals(array($handler1, $handler2), $logger->getHandlers());
+    }
+
+    /**
+     * @covers Monolog\Logger::pushProcessor
+     * @covers Monolog\Logger::popProcessor
+     * @expectedException LogicException
+     */
+    public function testPushPopProcessor()
+    {
+        $logger = new Logger(__METHOD__);
+        $processor1 = new WebProcessor;
+        $processor2 = new WebProcessor;
+
+        $logger->pushProcessor($processor1);
+        $logger->pushProcessor($processor2);
+
+        $this->assertEquals($processor2, $logger->popProcessor());
+        $this->assertEquals($processor1, $logger->popProcessor());
+        $logger->popProcessor();
+    }
+
+    /**
+     * @covers Monolog\Logger::pushProcessor
+     * @expectedException InvalidArgumentException
+     */
+    public function testPushProcessorWithNonCallable()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $logger->pushProcessor(new \stdClass());
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testProcessorsAreExecuted()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->pushProcessor(function ($record) {
+            $record['extra']['win'] = true;
+
+            return $record;
+        });
+        $logger->addError('test');
+        list($record) = $handler->getRecords();
+        $this->assertTrue($record['extra']['win']);
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testProcessorsAreCalledOnlyOnce()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler->expects($this->any())
+            ->method('handle')
+            ->will($this->returnValue(true))
+        ;
+        $logger->pushHandler($handler);
+
+        $processor = $this->getMockBuilder('Monolog\Processor\WebProcessor')
+            ->disableOriginalConstructor()
+            ->setMethods(array('__invoke'))
+            ->getMock()
+        ;
+        $processor->expects($this->once())
+            ->method('__invoke')
+            ->will($this->returnArgument(0))
+        ;
+        $logger->pushProcessor($processor);
+
+        $logger->addError('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testProcessorsNotCalledWhenNotHandled()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler->expects($this->once())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler);
+        $that = $this;
+        $logger->pushProcessor(function ($record) use ($that) {
+            $that->fail('The processor should not be called');
+        });
+        $logger->addAlert('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testHandlersNotCalledBeforeFirstHandling()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->never())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+        $handler1->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler1);
+
+        $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler2->expects($this->once())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler2->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler2);
+
+        $handler3 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler3->expects($this->once())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+        $handler3->expects($this->never())
+            ->method('handle')
+        ;
+        $logger->pushHandler($handler3);
+
+        $logger->debug('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testHandlersNotCalledBeforeFirstHandlingWithAssocArray()
+    {
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->never())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+        $handler1->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+
+        $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler2->expects($this->once())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler2->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+
+        $handler3 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler3->expects($this->once())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+        $handler3->expects($this->never())
+            ->method('handle')
+        ;
+
+        $logger = new Logger(__METHOD__, array('last' => $handler3, 'second' => $handler2, 'first' => $handler1));
+
+        $logger->debug('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testBubblingWhenTheHandlerReturnsFalse()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler1->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler1);
+
+        $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler2->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler2->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(false))
+        ;
+        $logger->pushHandler($handler2);
+
+        $logger->debug('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testNotBubblingWhenTheHandlerReturnsTrue()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler1->expects($this->never())
+            ->method('handle')
+        ;
+        $logger->pushHandler($handler1);
+
+        $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler2->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler2->expects($this->once())
+            ->method('handle')
+            ->will($this->returnValue(true))
+        ;
+        $logger->pushHandler($handler2);
+
+        $logger->debug('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::isHandling
+     */
+    public function testIsHandling()
+    {
+        $logger = new Logger(__METHOD__);
+
+        $handler1 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler1->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(false))
+        ;
+
+        $logger->pushHandler($handler1);
+        $this->assertFalse($logger->isHandling(Logger::DEBUG));
+
+        $handler2 = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler2->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+
+        $logger->pushHandler($handler2);
+        $this->assertTrue($logger->isHandling(Logger::DEBUG));
+    }
+
+    /**
+     * @dataProvider logMethodProvider
+     * @covers Monolog\Logger::addDebug
+     * @covers Monolog\Logger::addInfo
+     * @covers Monolog\Logger::addNotice
+     * @covers Monolog\Logger::addWarning
+     * @covers Monolog\Logger::addError
+     * @covers Monolog\Logger::addCritical
+     * @covers Monolog\Logger::addAlert
+     * @covers Monolog\Logger::addEmergency
+     * @covers Monolog\Logger::debug
+     * @covers Monolog\Logger::info
+     * @covers Monolog\Logger::notice
+     * @covers Monolog\Logger::warn
+     * @covers Monolog\Logger::err
+     * @covers Monolog\Logger::crit
+     * @covers Monolog\Logger::alert
+     * @covers Monolog\Logger::emerg
+     */
+    public function testLogMethods($method, $expectedLevel)
+    {
+        $logger = new Logger('foo');
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->{$method}('test');
+        list($record) = $handler->getRecords();
+        $this->assertEquals($expectedLevel, $record['level']);
+    }
+
+    public function logMethodProvider()
+    {
+        return array(
+            // monolog methods
+            array('addDebug',     Logger::DEBUG),
+            array('addInfo',      Logger::INFO),
+            array('addNotice',    Logger::NOTICE),
+            array('addWarning',   Logger::WARNING),
+            array('addError',     Logger::ERROR),
+            array('addCritical',  Logger::CRITICAL),
+            array('addAlert',     Logger::ALERT),
+            array('addEmergency', Logger::EMERGENCY),
+
+            // ZF/Sf2 compat methods
+            array('debug',  Logger::DEBUG),
+            array('info',   Logger::INFO),
+            array('notice', Logger::NOTICE),
+            array('warn',   Logger::WARNING),
+            array('err',    Logger::ERROR),
+            array('crit',   Logger::CRITICAL),
+            array('alert',  Logger::ALERT),
+            array('emerg',  Logger::EMERGENCY),
+        );
+    }
+
+    /**
+     * @dataProvider setTimezoneProvider
+     * @covers Monolog\Logger::setTimezone
+     */
+    public function testSetTimezone($tz)
+    {
+        Logger::setTimezone($tz);
+        $logger = new Logger('foo');
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->info('test');
+        list($record) = $handler->getRecords();
+        $this->assertEquals($tz, $record['datetime']->getTimezone());
+    }
+
+    public function setTimezoneProvider()
+    {
+        return array_map(
+            function ($tz) { return array(new \DateTimeZone($tz)); },
+            \DateTimeZone::listIdentifiers()
+        );
+    }
+
+    /**
+     * @dataProvider useMicrosecondTimestampsProvider
+     * @covers Monolog\Logger::useMicrosecondTimestamps
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testUseMicrosecondTimestamps($micro, $assert)
+    {
+        $logger = new Logger('foo');
+        $logger->useMicrosecondTimestamps($micro);
+        $handler = new TestHandler;
+        $logger->pushHandler($handler);
+        $logger->info('test');
+        list($record) = $handler->getRecords();
+        $this->{$assert}('000000', $record['datetime']->format('u'));
+    }
+
+    public function useMicrosecondTimestampsProvider()
+    {
+        return array(
+            // this has a very small chance of a false negative (1/10^6)
+            'with microseconds' => array(true, 'assertNotSame'),
+            'without microseconds' => array(false, PHP_VERSION_ID >= 70100 ? 'assertNotSame' : 'assertSame'),
+        );
+    }
+
+    /**
+     * @covers Monolog\Logger::setExceptionHandler
+     */
+    public function testSetExceptionHandler()
+    {
+        $logger = new Logger(__METHOD__);
+        $this->assertNull($logger->getExceptionHandler());
+        $callback = function ($ex) {
+        };
+        $logger->setExceptionHandler($callback);
+        $this->assertEquals($callback, $logger->getExceptionHandler());
+    }
+
+    /**
+     * @covers Monolog\Logger::setExceptionHandler
+     * @expectedException InvalidArgumentException
+     */
+    public function testBadExceptionHandlerType()
+    {
+        $logger = new Logger(__METHOD__);
+        $logger->setExceptionHandler(false);
+    }
+
+    /**
+     * @covers Monolog\Logger::handleException
+     * @expectedException Exception
+     */
+    public function testDefaultHandleException()
+    {
+        $logger = new Logger(__METHOD__);
+        $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler->expects($this->any())
+            ->method('handle')
+            ->will($this->throwException(new \Exception('Some handler exception')))
+        ;
+        $logger->pushHandler($handler);
+        $logger->info('test');
+    }
+
+    /**
+     * @covers Monolog\Logger::handleException
+     * @covers Monolog\Logger::addRecord
+     */
+    public function testCustomHandleException()
+    {
+        $logger = new Logger(__METHOD__);
+        $that = $this;
+        $logger->setExceptionHandler(function ($e, $record) use ($that) {
+            $that->assertEquals($e->getMessage(), 'Some handler exception');
+            $that->assertTrue(is_array($record));
+            $that->assertEquals($record['message'], 'test');
+        });
+        $handler = $this->getMock('Monolog\Handler\HandlerInterface');
+        $handler->expects($this->any())
+            ->method('isHandling')
+            ->will($this->returnValue(true))
+        ;
+        $handler->expects($this->any())
+            ->method('handle')
+            ->will($this->throwException(new \Exception('Some handler exception')))
+        ;
+        $logger->pushHandler($handler);
+        $logger->info('test');
+    }
+
+    public function testReset()
+    {
+        $logger = new Logger('app');
+
+        $testHandler = new Handler\TestHandler();
+        $bufferHandler = new Handler\BufferHandler($testHandler);
+        $groupHandler = new Handler\GroupHandler(array($bufferHandler));
+        $fingersCrossedHandler = new Handler\FingersCrossedHandler($groupHandler);
+
+        $logger->pushHandler($fingersCrossedHandler);
+
+        $processorUid1 = new Processor\UidProcessor(10);
+        $uid1 = $processorUid1->getUid();
+        $groupHandler->pushProcessor($processorUid1);
+
+        $processorUid2 = new Processor\UidProcessor(5);
+        $uid2 = $processorUid2->getUid();
+        $logger->pushProcessor($processorUid2);
+
+        $getProperty = function ($object, $property) {
+            $reflectionProperty = new \ReflectionProperty(get_class($object), $property);
+            $reflectionProperty->setAccessible(true);
+
+            return $reflectionProperty->getValue($object);
+        };
+        $that = $this;
+        $assertBufferOfBufferHandlerEmpty = function () use ($getProperty, $bufferHandler, $that) {
+            $that->assertEmpty($getProperty($bufferHandler, 'buffer'));
+        };
+        $assertBuffersEmpty = function() use ($assertBufferOfBufferHandlerEmpty, $getProperty, $fingersCrossedHandler, $that) {
+            $assertBufferOfBufferHandlerEmpty();
+            $that->assertEmpty($getProperty($fingersCrossedHandler, 'buffer'));
+        };
+
+        $logger->debug('debug');
+        $logger->reset();
+        $assertBuffersEmpty();
+        $this->assertFalse($testHandler->hasDebugRecords());
+        $this->assertFalse($testHandler->hasErrorRecords());
+        $this->assertNotSame($uid1, $uid1 = $processorUid1->getUid());
+        $this->assertNotSame($uid2, $uid2 = $processorUid2->getUid());
+
+        $logger->debug('debug');
+        $logger->error('error');
+        $logger->reset();
+        $assertBuffersEmpty();
+        $this->assertTrue($testHandler->hasDebugRecords());
+        $this->assertTrue($testHandler->hasErrorRecords());
+        $this->assertNotSame($uid1, $uid1 = $processorUid1->getUid());
+        $this->assertNotSame($uid2, $uid2 = $processorUid2->getUid());
+
+        $logger->info('info');
+        $this->assertNotEmpty($getProperty($fingersCrossedHandler, 'buffer'));
+        $assertBufferOfBufferHandlerEmpty();
+        $this->assertFalse($testHandler->hasInfoRecords());
+
+        $logger->reset();
+        $assertBuffersEmpty();
+        $this->assertFalse($testHandler->hasInfoRecords());
+        $this->assertNotSame($uid1, $uid1 = $processorUid1->getUid());
+        $this->assertNotSame($uid2, $uid2 = $processorUid2->getUid());
+
+        $logger->notice('notice');
+        $logger->emergency('emergency');
+        $logger->reset();
+        $assertBuffersEmpty();
+        $this->assertFalse($testHandler->hasInfoRecords());
+        $this->assertTrue($testHandler->hasNoticeRecords());
+        $this->assertTrue($testHandler->hasEmergencyRecords());
+        $this->assertNotSame($uid1, $processorUid1->getUid());
+        $this->assertNotSame($uid2, $processorUid2->getUid());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php

@@ -0,0 +1,29 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class GitProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\GitProcessor::__invoke
+     */
+    public function testProcessor()
+    {
+        $processor = new GitProcessor();
+        $record = $processor($this->getRecord());
+
+        $this->assertArrayHasKey('git', $record['extra']);
+        $this->assertTrue(!is_array($record['extra']['git']['branch']));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php

@@ -0,0 +1,123 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Acme;
+
+class Tester
+{
+    public function test($handler, $record)
+    {
+        $handler->handle($record);
+    }
+}
+
+function tester($handler, $record)
+{
+    $handler->handle($record);
+}
+
+namespace Monolog\Processor;
+
+use Monolog\Logger;
+use Monolog\TestCase;
+use Monolog\Handler\TestHandler;
+
+class IntrospectionProcessorTest extends TestCase
+{
+    public function getHandler()
+    {
+        $processor = new IntrospectionProcessor();
+        $handler = new TestHandler();
+        $handler->pushProcessor($processor);
+
+        return $handler;
+    }
+
+    public function testProcessorFromClass()
+    {
+        $handler = $this->getHandler();
+        $tester = new \Acme\Tester;
+        $tester->test($handler, $this->getRecord());
+        list($record) = $handler->getRecords();
+        $this->assertEquals(__FILE__, $record['extra']['file']);
+        $this->assertEquals(18, $record['extra']['line']);
+        $this->assertEquals('Acme\Tester', $record['extra']['class']);
+        $this->assertEquals('test', $record['extra']['function']);
+    }
+
+    public function testProcessorFromFunc()
+    {
+        $handler = $this->getHandler();
+        \Acme\tester($handler, $this->getRecord());
+        list($record) = $handler->getRecords();
+        $this->assertEquals(__FILE__, $record['extra']['file']);
+        $this->assertEquals(24, $record['extra']['line']);
+        $this->assertEquals(null, $record['extra']['class']);
+        $this->assertEquals('Acme\tester', $record['extra']['function']);
+    }
+
+    public function testLevelTooLow()
+    {
+        $input = array(
+            'level' => Logger::DEBUG,
+            'extra' => array(),
+        );
+
+        $expected = $input;
+
+        $processor = new IntrospectionProcessor(Logger::CRITICAL);
+        $actual = $processor($input);
+
+        $this->assertEquals($expected, $actual);
+    }
+
+    public function testLevelEqual()
+    {
+        $input = array(
+            'level' => Logger::CRITICAL,
+            'extra' => array(),
+        );
+
+        $expected = $input;
+        $expected['extra'] = array(
+            'file' => null,
+            'line' => null,
+            'class' => 'ReflectionMethod',
+            'function' => 'invokeArgs',
+        );
+
+        $processor = new IntrospectionProcessor(Logger::CRITICAL);
+        $actual = $processor($input);
+
+        $this->assertEquals($expected, $actual);
+    }
+
+    public function testLevelHigher()
+    {
+        $input = array(
+            'level' => Logger::EMERGENCY,
+            'extra' => array(),
+        );
+
+        $expected = $input;
+        $expected['extra'] = array(
+            'file' => null,
+            'line' => null,
+            'class' => 'ReflectionMethod',
+            'function' => 'invokeArgs',
+        );
+
+        $processor = new IntrospectionProcessor(Logger::CRITICAL);
+        $actual = $processor($input);
+
+        $this->assertEquals($expected, $actual);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php

@@ -0,0 +1,42 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class MemoryPeakUsageProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke
+     * @covers Monolog\Processor\MemoryProcessor::formatBytes
+     */
+    public function testProcessor()
+    {
+        $processor = new MemoryPeakUsageProcessor();
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('memory_peak_usage', $record['extra']);
+        $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_peak_usage']);
+    }
+
+    /**
+     * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke
+     * @covers Monolog\Processor\MemoryProcessor::formatBytes
+     */
+    public function testProcessorWithoutFormatting()
+    {
+        $processor = new MemoryPeakUsageProcessor(true, false);
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('memory_peak_usage', $record['extra']);
+        $this->assertInternalType('int', $record['extra']['memory_peak_usage']);
+        $this->assertGreaterThan(0, $record['extra']['memory_peak_usage']);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php

@@ -0,0 +1,42 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class MemoryUsageProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\MemoryUsageProcessor::__invoke
+     * @covers Monolog\Processor\MemoryProcessor::formatBytes
+     */
+    public function testProcessor()
+    {
+        $processor = new MemoryUsageProcessor();
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('memory_usage', $record['extra']);
+        $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_usage']);
+    }
+
+    /**
+     * @covers Monolog\Processor\MemoryUsageProcessor::__invoke
+     * @covers Monolog\Processor\MemoryProcessor::formatBytes
+     */
+    public function testProcessorWithoutFormatting()
+    {
+        $processor = new MemoryUsageProcessor(true, false);
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('memory_usage', $record['extra']);
+        $this->assertInternalType('int', $record['extra']['memory_usage']);
+        $this->assertGreaterThan(0, $record['extra']['memory_usage']);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MercurialProcessorTest.php

@@ -0,0 +1,41 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jonathan A. Schweder <jonathanschweder@gmail.com>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class MercurialProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\MercurialProcessor::__invoke
+     */
+    public function testProcessor()
+    {
+        if (defined('PHP_WINDOWS_VERSION_BUILD')) {
+            exec("where hg 2>NUL", $output, $result);
+        } else {
+            exec("which hg 2>/dev/null >/dev/null", $output, $result);
+        }
+        if ($result != 0) {
+            $this->markTestSkipped('hg is missing');
+            return;
+        }
+
+        `hg init`;
+        $processor = new MercurialProcessor();
+        $record = $processor($this->getRecord());
+
+        $this->assertArrayHasKey('hg', $record['extra']);
+        $this->assertTrue(!is_array($record['extra']['hg']['branch']));
+        $this->assertTrue(!is_array($record['extra']['hg']['revision']));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php

@@ -0,0 +1,30 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class ProcessIdProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\ProcessIdProcessor::__invoke
+     */
+    public function testProcessor()
+    {
+        $processor = new ProcessIdProcessor();
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('process_id', $record['extra']);
+        $this->assertInternalType('int', $record['extra']['process_id']);
+        $this->assertGreaterThan(0, $record['extra']['process_id']);
+        $this->assertEquals(getmypid(), $record['extra']['process_id']);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php

@@ -0,0 +1,43 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+class PsrLogMessageProcessorTest extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @dataProvider getPairs
+     */
+    public function testReplacement($val, $expected)
+    {
+        $proc = new PsrLogMessageProcessor;
+
+        $message = $proc(array(
+            'message' => '{foo}',
+            'context' => array('foo' => $val),
+        ));
+        $this->assertEquals($expected, $message['message']);
+    }
+
+    public function getPairs()
+    {
+        return array(
+            array('foo',    'foo'),
+            array('3',      '3'),
+            array(3,        '3'),
+            array(null,     ''),
+            array(true,     '1'),
+            array(false,    ''),
+            array(new \stdClass, '[object stdClass]'),
+            array(array(), '[array]'),
+        );
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php

@@ -0,0 +1,49 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class TagProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\TagProcessor::__invoke
+     */
+    public function testProcessor()
+    {
+        $tags = array(1, 2, 3);
+        $processor = new TagProcessor($tags);
+        $record = $processor($this->getRecord());
+
+        $this->assertEquals($tags, $record['extra']['tags']);
+    }
+
+    /**
+     * @covers Monolog\Processor\TagProcessor::__invoke
+     */
+    public function testProcessorTagModification()
+    {
+        $tags = array(1, 2, 3);
+        $processor = new TagProcessor($tags);
+
+        $record = $processor($this->getRecord());
+        $this->assertEquals($tags, $record['extra']['tags']);
+
+        $processor->setTags(array('a', 'b'));
+        $record = $processor($this->getRecord());
+        $this->assertEquals(array('a', 'b'), $record['extra']['tags']);
+
+        $processor->addTags(array('a', 'c', 'foo' => 'bar'));
+        $record = $processor($this->getRecord());
+        $this->assertEquals(array('a', 'b', 'a', 'c', 'foo' => 'bar'), $record['extra']['tags']);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php

@@ -0,0 +1,33 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class UidProcessorTest extends TestCase
+{
+    /**
+     * @covers Monolog\Processor\UidProcessor::__invoke
+     */
+    public function testProcessor()
+    {
+        $processor = new UidProcessor();
+        $record = $processor($this->getRecord());
+        $this->assertArrayHasKey('uid', $record['extra']);
+    }
+
+    public function testGetUid()
+    {
+        $processor = new UidProcessor(10);
+        $this->assertEquals(10, strlen($processor->getUid()));
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php

@@ -0,0 +1,113 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog\Processor;
+
+use Monolog\TestCase;
+
+class WebProcessorTest extends TestCase
+{
+    public function testProcessor()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'HTTP_REFERER'   => 'D',
+            'SERVER_NAME'    => 'F',
+            'UNIQUE_ID'      => 'G',
+        );
+
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertEquals($server['REQUEST_URI'], $record['extra']['url']);
+        $this->assertEquals($server['REMOTE_ADDR'], $record['extra']['ip']);
+        $this->assertEquals($server['REQUEST_METHOD'], $record['extra']['http_method']);
+        $this->assertEquals($server['HTTP_REFERER'], $record['extra']['referrer']);
+        $this->assertEquals($server['SERVER_NAME'], $record['extra']['server']);
+        $this->assertEquals($server['UNIQUE_ID'], $record['extra']['unique_id']);
+    }
+
+    public function testProcessorDoNothingIfNoRequestUri()
+    {
+        $server = array(
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+        );
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertEmpty($record['extra']);
+    }
+
+    public function testProcessorReturnNullIfNoHttpReferer()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'SERVER_NAME'    => 'F',
+        );
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertNull($record['extra']['referrer']);
+    }
+
+    public function testProcessorDoesNotAddUniqueIdIfNotPresent()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'SERVER_NAME'    => 'F',
+        );
+        $processor = new WebProcessor($server);
+        $record = $processor($this->getRecord());
+        $this->assertFalse(isset($record['extra']['unique_id']));
+    }
+
+    public function testProcessorAddsOnlyRequestedExtraFields()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'SERVER_NAME'    => 'F',
+        );
+
+        $processor = new WebProcessor($server, array('url', 'http_method'));
+        $record = $processor($this->getRecord());
+
+        $this->assertSame(array('url' => 'A', 'http_method' => 'C'), $record['extra']);
+    }
+
+    public function testProcessorConfiguringOfExtraFields()
+    {
+        $server = array(
+            'REQUEST_URI'    => 'A',
+            'REMOTE_ADDR'    => 'B',
+            'REQUEST_METHOD' => 'C',
+            'SERVER_NAME'    => 'F',
+        );
+
+        $processor = new WebProcessor($server, array('url' => 'REMOTE_ADDR'));
+        $record = $processor($this->getRecord());
+
+        $this->assertSame(array('url' => 'B'), $record['extra']);
+    }
+
+    /**
+     * @expectedException UnexpectedValueException
+     */
+    public function testInvalidData()
+    {
+        new WebProcessor(new \stdClass);
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php

@@ -0,0 +1,47 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\TestHandler;
+use Monolog\Formatter\LineFormatter;
+use Monolog\Processor\PsrLogMessageProcessor;
+use Psr\Log\Test\LoggerInterfaceTest;
+
+class PsrLogCompatTest extends LoggerInterfaceTest
+{
+    private $handler;
+
+    public function getLogger()
+    {
+        $logger = new Logger('foo');
+        $logger->pushHandler($handler = new TestHandler);
+        $logger->pushProcessor(new PsrLogMessageProcessor);
+        $handler->setFormatter(new LineFormatter('%level_name% %message%'));
+
+        $this->handler = $handler;
+
+        return $logger;
+    }
+
+    public function getLogs()
+    {
+        $convert = function ($record) {
+            $lower = function ($match) {
+                return strtolower($match[0]);
+            };
+
+            return preg_replace_callback('{^[A-Z]+}', $lower, $record['formatted']);
+        };
+
+        return array_map($convert, $this->handler->getRecords());
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/RegistryTest.php

@@ -0,0 +1,153 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+class RegistryTest extends \PHPUnit_Framework_TestCase
+{
+    protected function setUp()
+    {
+        Registry::clear();
+    }
+
+    /**
+     * @dataProvider hasLoggerProvider
+     * @covers Monolog\Registry::hasLogger
+     */
+    public function testHasLogger(array $loggersToAdd, array $loggersToCheck, array $expectedResult)
+    {
+        foreach ($loggersToAdd as $loggerToAdd) {
+            Registry::addLogger($loggerToAdd);
+        }
+        foreach ($loggersToCheck as $index => $loggerToCheck) {
+            $this->assertSame($expectedResult[$index], Registry::hasLogger($loggerToCheck));
+        }
+    }
+
+    public function hasLoggerProvider()
+    {
+        $logger1 = new Logger('test1');
+        $logger2 = new Logger('test2');
+        $logger3 = new Logger('test3');
+
+        return array(
+            // only instances
+            array(
+                array($logger1),
+                array($logger1, $logger2),
+                array(true, false),
+            ),
+            // only names
+            array(
+                array($logger1),
+                array('test1', 'test2'),
+                array(true, false),
+            ),
+            // mixed case
+            array(
+                array($logger1, $logger2),
+                array('test1', $logger2, 'test3', $logger3),
+                array(true, true, false, false),
+            ),
+        );
+    }
+
+    /**
+     * @covers Monolog\Registry::clear
+     */
+    public function testClearClears()
+    {
+        Registry::addLogger(new Logger('test1'), 'log');
+        Registry::clear();
+
+        $this->setExpectedException('\InvalidArgumentException');
+        Registry::getInstance('log');
+    }
+
+    /**
+     * @dataProvider removedLoggerProvider
+     * @covers Monolog\Registry::addLogger
+     * @covers Monolog\Registry::removeLogger
+     */
+    public function testRemovesLogger($loggerToAdd, $remove)
+    {
+        Registry::addLogger($loggerToAdd);
+        Registry::removeLogger($remove);
+
+        $this->setExpectedException('\InvalidArgumentException');
+        Registry::getInstance($loggerToAdd->getName());
+    }
+
+    public function removedLoggerProvider()
+    {
+        $logger1 = new Logger('test1');
+
+        return array(
+            array($logger1, $logger1),
+            array($logger1, 'test1'),
+        );
+    }
+
+    /**
+     * @covers Monolog\Registry::addLogger
+     * @covers Monolog\Registry::getInstance
+     * @covers Monolog\Registry::__callStatic
+     */
+    public function testGetsSameLogger()
+    {
+        $logger1 = new Logger('test1');
+        $logger2 = new Logger('test2');
+
+        Registry::addLogger($logger1, 'test1');
+        Registry::addLogger($logger2);
+
+        $this->assertSame($logger1, Registry::getInstance('test1'));
+        $this->assertSame($logger2, Registry::test2());
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     * @covers Monolog\Registry::getInstance
+     */
+    public function testFailsOnNonExistantLogger()
+    {
+        Registry::getInstance('test1');
+    }
+
+    /**
+     * @covers Monolog\Registry::addLogger
+     */
+    public function testReplacesLogger()
+    {
+        $log1 = new Logger('test1');
+        $log2 = new Logger('test2');
+
+        Registry::addLogger($log1, 'log');
+
+        Registry::addLogger($log2, 'log', true);
+
+        $this->assertSame($log2, Registry::getInstance('log'));
+    }
+
+    /**
+     * @expectedException \InvalidArgumentException
+     * @covers Monolog\Registry::addLogger
+     */
+    public function testFailsOnUnspecifiedReplacement()
+    {
+        $log1 = new Logger('test1');
+        $log2 = new Logger('test2');
+
+        Registry::addLogger($log1, 'log');
+
+        Registry::addLogger($log2, 'log');
+    }
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/SignalHandlerTest.php

@@ -0,0 +1,287 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+use Monolog\Handler\StreamHandler;
+use Monolog\Handler\TestHandler;
+use Psr\Log\LogLevel;
+
+/**
+ * @author Robert Gust-Bardon <robert@gust-bardon.org>
+ * @covers Monolog\SignalHandler
+ */
+class SignalHandlerTest extends TestCase
+{
+
+    private $asyncSignalHandling;
+    private $blockedSignals;
+    private $signalHandlers;
+
+    protected function setUp()
+    {
+        $this->signalHandlers = array();
+        if (extension_loaded('pcntl')) {
+            if (function_exists('pcntl_async_signals')) {
+                $this->asyncSignalHandling = pcntl_async_signals();
+            }
+            if (function_exists('pcntl_sigprocmask')) {
+                pcntl_sigprocmask(SIG_BLOCK, array(), $this->blockedSignals);
+            }
+        }
+    }
+
+    protected function tearDown()
+    {
+        if ($this->asyncSignalHandling !== null) {
+            pcntl_async_signals($this->asyncSignalHandling);
+        }
+        if ($this->blockedSignals !== null) {
+            pcntl_sigprocmask(SIG_SETMASK, $this->blockedSignals);
+        }
+        if ($this->signalHandlers) {
+            pcntl_signal_dispatch();
+            foreach ($this->signalHandlers as $signo => $handler) {
+                pcntl_signal($signo, $handler);
+            }
+        }
+    }
+
+    private function setSignalHandler($signo, $handler = SIG_DFL) {
+        if (function_exists('pcntl_signal_get_handler')) {
+            $this->signalHandlers[$signo] = pcntl_signal_get_handler($signo);
+        } else {
+            $this->signalHandlers[$signo] = SIG_DFL;
+        }
+        $this->assertTrue(pcntl_signal($signo, $handler));
+    }
+
+    public function testHandleSignal()
+    {
+        $logger = new Logger('test', array($handler = new TestHandler));
+        $errHandler = new SignalHandler($logger);
+        $signo = 2;  // SIGINT.
+        $siginfo = array('signo' => $signo, 'errno' => 0, 'code' => 0);
+        $errHandler->handleSignal($signo, $siginfo);
+        $this->assertCount(1, $handler->getRecords());
+        $this->assertTrue($handler->hasCriticalRecords());
+        $records = $handler->getRecords();
+        $this->assertSame($siginfo, $records[0]['context']);
+    }
+
+    /**
+     * @depends testHandleSignal
+     * @requires extension pcntl
+     * @requires extension posix
+     * @requires function pcntl_signal
+     * @requires function pcntl_signal_dispatch
+     * @requires function posix_getpid
+     * @requires function posix_kill
+     */
+    public function testRegisterSignalHandler()
+    {
+        // SIGCONT and SIGURG should be ignored by default.
+        if (!defined('SIGCONT') || !defined('SIGURG')) {
+            $this->markTestSkipped('This test requires the SIGCONT and SIGURG pcntl constants.');
+        }
+
+        $this->setSignalHandler(SIGCONT, SIG_IGN);
+        $this->setSignalHandler(SIGURG, SIG_IGN);
+
+        $logger = new Logger('test', array($handler = new TestHandler));
+        $errHandler = new SignalHandler($logger);
+        $pid = posix_getpid();
+
+        $this->assertTrue(posix_kill($pid, SIGURG));
+        $this->assertTrue(pcntl_signal_dispatch());
+        $this->assertCount(0, $handler->getRecords());
+
+        $errHandler->registerSignalHandler(SIGURG, LogLevel::INFO, false, false, false);
+
+        $this->assertTrue(posix_kill($pid, SIGCONT));
+        $this->assertTrue(pcntl_signal_dispatch());
+        $this->assertCount(0, $handler->getRecords());
+
+        $this->assertTrue(posix_kill($pid, SIGURG));
+        $this->assertTrue(pcntl_signal_dispatch());
+        $this->assertCount(1, $handler->getRecords());
+        $this->assertTrue($handler->hasInfoThatContains('SIGURG'));
+    }
+
+    /**
+     * @dataProvider defaultPreviousProvider
+     * @depends testRegisterSignalHandler
+     * @requires function pcntl_fork
+     * @requires function pcntl_sigprocmask
+     * @requires function pcntl_waitpid
+     */
+    public function testRegisterDefaultPreviousSignalHandler($signo, $callPrevious, $expected)
+    {
+        $this->setSignalHandler($signo, SIG_DFL);
+
+        $path = tempnam(sys_get_temp_dir(), 'monolog-');
+        $this->assertNotFalse($path);
+
+        $pid = pcntl_fork();
+        if ($pid === 0) {  // Child.
+            $streamHandler = new StreamHandler($path);
+            $streamHandler->setFormatter($this->getIdentityFormatter());
+            $logger = new Logger('test', array($streamHandler));
+            $errHandler = new SignalHandler($logger);
+            $errHandler->registerSignalHandler($signo, LogLevel::INFO, $callPrevious, false, false);
+            pcntl_sigprocmask(SIG_SETMASK, array(SIGCONT));
+            posix_kill(posix_getpid(), $signo);
+            pcntl_signal_dispatch();
+            // If $callPrevious is true, SIGINT should terminate by this line.
+            pcntl_sigprocmask(SIG_BLOCK, array(), $oldset);
+            file_put_contents($path, implode(' ', $oldset), FILE_APPEND);
+            posix_kill(posix_getpid(), $signo);
+            pcntl_signal_dispatch();
+            exit();
+        }
+
+        $this->assertNotSame(-1, $pid);
+        $this->assertNotSame(-1, pcntl_waitpid($pid, $status));
+        $this->assertNotSame(-1, $status);
+        $this->assertSame($expected, file_get_contents($path));
+    }
+
+    public function defaultPreviousProvider()
+    {
+        if (!defined('SIGCONT') || !defined('SIGINT') || !defined('SIGURG')) {
+            return array();
+        }
+
+        return array(
+            array(SIGINT, false, 'Program received signal SIGINT'.SIGCONT.'Program received signal SIGINT'),
+            array(SIGINT, true, 'Program received signal SIGINT'),
+            array(SIGURG, false, 'Program received signal SIGURG'.SIGCONT.'Program received signal SIGURG'),
+            array(SIGURG, true, 'Program received signal SIGURG'.SIGCONT.'Program received signal SIGURG'),
+        );
+    }
+
+    /**
+     * @dataProvider callablePreviousProvider
+     * @depends testRegisterSignalHandler
+     * @requires function pcntl_signal_get_handler
+     */
+    public function testRegisterCallablePreviousSignalHandler($callPrevious)
+    {
+        $this->setSignalHandler(SIGURG, SIG_IGN);
+
+        $logger = new Logger('test', array($handler = new TestHandler));
+        $errHandler = new SignalHandler($logger);
+        $previousCalled = 0;
+        pcntl_signal(SIGURG, function ($signo, array $siginfo = null) use (&$previousCalled) {
+            ++$previousCalled;
+        });
+        $errHandler->registerSignalHandler(SIGURG, LogLevel::INFO, $callPrevious, false, false);
+        $this->assertTrue(posix_kill(posix_getpid(), SIGURG));
+        $this->assertTrue(pcntl_signal_dispatch());
+        $this->assertCount(1, $handler->getRecords());
+        $this->assertTrue($handler->hasInfoThatContains('SIGURG'));
+        $this->assertSame($callPrevious ? 1 : 0, $previousCalled);
+    }
+
+    public function callablePreviousProvider()
+    {
+        return array(
+            array(false),
+            array(true),
+        );
+    }
+
+    /**
+     * @dataProvider restartSyscallsProvider
+     * @depends testRegisterDefaultPreviousSignalHandler
+     * @requires function pcntl_fork
+     * @requires function pcntl_waitpid
+     */
+    public function testRegisterSyscallRestartingSignalHandler($restartSyscalls)
+    {
+        $this->setSignalHandler(SIGURG, SIG_IGN);
+
+        $parentPid = posix_getpid();
+        $microtime = microtime(true);
+
+        $pid = pcntl_fork();
+        if ($pid === 0) {  // Child.
+            usleep(100000);
+            posix_kill($parentPid, SIGURG);
+            usleep(100000);
+            exit();
+        }
+
+        $this->assertNotSame(-1, $pid);
+        $logger = new Logger('test', array($handler = new TestHandler));
+        $errHandler = new SignalHandler($logger);
+        $errHandler->registerSignalHandler(SIGURG, LogLevel::INFO, false, $restartSyscalls, false);
+        if ($restartSyscalls) {
+            // pcntl_wait is expected to be restarted after the signal handler.
+            $this->assertNotSame(-1, pcntl_waitpid($pid, $status));
+        } else {
+            // pcntl_wait is expected to be interrupted when the signal handler is invoked.
+            $this->assertSame(-1, pcntl_waitpid($pid, $status));
+        }
+        $this->assertSame($restartSyscalls, microtime(true) - $microtime > 0.15);
+        $this->assertTrue(pcntl_signal_dispatch());
+        $this->assertCount(1, $handler->getRecords());
+        if ($restartSyscalls) {
+            // The child has already exited.
+            $this->assertSame(-1, pcntl_waitpid($pid, $status));
+        } else {
+            // The child has not exited yet.
+            $this->assertNotSame(-1, pcntl_waitpid($pid, $status));
+        }
+    }
+
+    public function restartSyscallsProvider()
+    {
+        return array(
+            array(false),
+            array(true),
+            array(false),
+            array(true),
+        );
+    }
+
+    /**
+     * @dataProvider asyncProvider
+     * @depends testRegisterDefaultPreviousSignalHandler
+     * @requires function pcntl_async_signals
+     */
+    public function testRegisterAsyncSignalHandler($initialAsync, $desiredAsync, $expectedBefore, $expectedAfter)
+    {
+        $this->setSignalHandler(SIGURG, SIG_IGN);
+        pcntl_async_signals($initialAsync);
+
+        $logger = new Logger('test', array($handler = new TestHandler));
+        $errHandler = new SignalHandler($logger);
+        $errHandler->registerSignalHandler(SIGURG, LogLevel::INFO, false, false, $desiredAsync);
+        $this->assertTrue(posix_kill(posix_getpid(), SIGURG));
+        $this->assertCount($expectedBefore, $handler->getRecords());
+        $this->assertTrue(pcntl_signal_dispatch());
+        $this->assertCount($expectedAfter, $handler->getRecords());
+    }
+
+    public function asyncProvider()
+    {
+        return array(
+            array(false, false, 0, 1),
+            array(false, null, 0, 1),
+            array(false, true, 1, 1),
+            array(true, false, 0, 1),
+            array(true, null, 1, 1),
+            array(true, true, 1, 1),
+        );
+    }
+
+}

addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/TestCase.php

@@ -0,0 +1,58 @@
+<?php
+
+/*
+ * This file is part of the Monolog package.
+ *
+ * (c) Jordi Boggiano <j.boggiano@seld.be>
+ *
+ * For the full copyright and license information, please view the LICENSE
+ * file that was distributed with this source code.
+ */
+
+namespace Monolog;
+
+class TestCase extends \PHPUnit_Framework_TestCase
+{
+    /**
+     * @return array Record
+     */
+    protected function getRecord($level = Logger::WARNING, $message = 'test', $context = array())
+    {
+        return array(
+            'message' => $message,
+            'context' => $context,
+            'level' => $level,
+            'level_name' => Logger::getLevelName($level),
+            'channel' => 'test',
+            'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true))),
+            'extra' => array(),
+        );
+    }
+
+    /**
+     * @return array
+     */
+    protected function getMultipleRecords()
+    {
+        return array(
+            $this->getRecord(Logger::DEBUG, 'debug message 1'),
+            $this->getRecord(Logger::DEBUG, 'debug message 2'),
+            $this->getRecord(Logger::INFO, 'information'),
+            $this->getRecord(Logger::WARNING, 'warning'),
+            $this->getRecord(Logger::ERROR, 'error'),
+        );
+    }
+
+    /**
+     * @return Monolog\Formatter\FormatterInterface
+     */
+    protected function getIdentityFormatter()
+    {
+        $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface');
+        $formatter->expects($this->any())
+            ->method('format')
+            ->will($this->returnCallback(function ($record) { return $record['message']; }));
+
+        return $formatter;
+    }
+}

addons/weliam_smartcity/vendor/psr/cache/CHANGELOG.md

@@ -0,0 +1,16 @@
+# Changelog
+
+All notable changes to this project will be documented in this file, in reverse chronological order by release.
+
+## 1.0.1 - 2016-08-06
+
+### Fixed
+
+- Make spacing consistent in phpdoc annotations php-fig/cache#9 - chalasr
+- Fix grammar in phpdoc annotations php-fig/cache#10 - chalasr
+- Be more specific in docblocks that `getItems()` and `deleteItems()` take an array of strings (`string[]`) compared to just `array` php-fig/cache#8 - GrahamCampbell
+- For `expiresAt()` and `expiresAfter()` in CacheItemInterface fix docblock to specify null as a valid parameters as well as an implementation of DateTimeInterface php-fig/cache#7 - GrahamCampbell
+
+## 1.0.0 - 2015-12-11
+
+Initial stable release; reflects accepted PSR-6 specification

addons/weliam_smartcity/vendor/psr/cache/LICENSE.txt

@@ -0,0 +1,19 @@
+Copyright (c) 2015 PHP Framework Interoperability Group
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

addons/weliam_smartcity/vendor/psr/cache/README.md

@@ -0,0 +1,9 @@
+PSR Cache
+=========
+
+This repository holds all interfaces defined by
+[PSR-6](http://www.php-fig.org/psr/psr-6/).
+
+Note that this is not a Cache implementation of its own. It is merely an
+interface that describes a Cache implementation. See the specification for more 
+details.

addons/weliam_smartcity/vendor/psr/cache/composer.json

@@ -0,0 +1,25 @@
+{
+    "name": "psr/cache",
+    "description": "Common interface for caching libraries",
+    "keywords": ["psr", "psr-6", "cache"],
+    "license": "MIT",
+    "authors": [
+        {
+            "name": "PHP-FIG",
+            "homepage": "http://www.php-fig.org/"
+        }
+    ],
+    "require": {
+        "php": ">=5.3.0"
+    },
+    "autoload": {
+        "psr-4": {
+            "Psr\\Cache\\": "src/"
+        }
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-master": "1.0.x-dev"
+        }
+    }
+}

addons/weliam_smartcity/vendor/psr/cache/src/CacheException.php

@@ -0,0 +1,10 @@
+<?php
+
+namespace Psr\Cache;
+
+/**
+ * Exception interface for all exceptions thrown by an Implementing Library.
+ */
+interface CacheException
+{
+}

addons/weliam_smartcity/vendor/psr/cache/src/CacheItemInterface.php

@@ -0,0 +1,105 @@
+<?php
+
+namespace Psr\Cache;
+
+/**
+ * CacheItemInterface defines an interface for interacting with objects inside a cache.
+ *
+ * Each Item object MUST be associated with a specific key, which can be set
+ * according to the implementing system and is typically passed by the
+ * Cache\CacheItemPoolInterface object.
+ *
+ * The Cache\CacheItemInterface object encapsulates the storage and retrieval of
+ * cache items. Each Cache\CacheItemInterface is generated by a
+ * Cache\CacheItemPoolInterface object, which is responsible for any required
+ * setup as well as associating the object with a unique Key.
+ * Cache\CacheItemInterface objects MUST be able to store and retrieve any type
+ * of PHP value defined in the Data section of the specification.
+ *
+ * Calling Libraries MUST NOT instantiate Item objects themselves. They may only
+ * be requested from a Pool object via the getItem() method.  Calling Libraries
+ * SHOULD NOT assume that an Item created by one Implementing Library is
+ * compatible with a Pool from another Implementing Library.
+ */
+interface CacheItemInterface
+{
+    /**
+     * Returns the key for the current cache item.
+     *
+     * The key is loaded by the Implementing Library, but should be available to
+     * the higher level callers when needed.
+     *
+     * @return string
+     *   The key string for this cache item.
+     */
+    public function getKey();
+
+    /**
+     * Retrieves the value of the item from the cache associated with this object's key.
+     *
+     * The value returned must be identical to the value originally stored by set().
+     *
+     * If isHit() returns false, this method MUST return null. Note that null
+     * is a legitimate cached value, so the isHit() method SHOULD be used to
+     * differentiate between "null value was found" and "no value was found."
+     *
+     * @return mixed
+     *   The value corresponding to this cache item's key, or null if not found.
+     */
+    public function get();
+
+    /**
+     * Confirms if the cache item lookup resulted in a cache hit.
+     *
+     * Note: This method MUST NOT have a race condition between calling isHit()
+     * and calling get().
+     *
+     * @return bool
+     *   True if the request resulted in a cache hit. False otherwise.
+     */
+    public function isHit();
+
+    /**
+     * Sets the value represented by this cache item.
+     *
+     * The $value argument may be any item that can be serialized by PHP,
+     * although the method of serialization is left up to the Implementing
+     * Library.
+     *
+     * @param mixed $value
+     *   The serializable value to be stored.
+     *
+     * @return static
+     *   The invoked object.
+     */
+    public function set($value);
+
+    /**
+     * Sets the expiration time for this cache item.
+     *
+     * @param \DateTimeInterface|null $expiration
+     *   The point in time after which the item MUST be considered expired.
+     *   If null is passed explicitly, a default value MAY be used. If none is set,
+     *   the value should be stored permanently or for as long as the
+     *   implementation allows.
+     *
+     * @return static
+     *   The called object.
+     */
+    public function expiresAt($expiration);
+
+    /**
+     * Sets the expiration time for this cache item.
+     *
+     * @param int|\DateInterval|null $time
+     *   The period of time from the present after which the item MUST be considered
+     *   expired. An integer parameter is understood to be the time in seconds until
+     *   expiration. If null is passed explicitly, a default value MAY be used.
+     *   If none is set, the value should be stored permanently or for as long as the
+     *   implementation allows.
+     *
+     * @return static
+     *   The called object.
+     */
+    public function expiresAfter($time);
+}

addons/weliam_smartcity/vendor/psr/cache/src/CacheItemPoolInterface.php

@@ -0,0 +1,138 @@
+<?php
+
+namespace Psr\Cache;
+
+/**
+ * CacheItemPoolInterface generates CacheItemInterface objects.
+ *
+ * The primary purpose of Cache\CacheItemPoolInterface is to accept a key from
+ * the Calling Library and return the associated Cache\CacheItemInterface object.
+ * It is also the primary point of interaction with the entire cache collection.
+ * All configuration and initialization of the Pool is left up to an
+ * Implementing Library.
+ */
+interface CacheItemPoolInterface
+{
+    /**
+     * Returns a Cache Item representing the specified key.
+     *
+     * This method must always return a CacheItemInterface object, even in case of
+     * a cache miss. It MUST NOT return null.
+     *
+     * @param string $key
+     *   The key for which to return the corresponding Cache Item.
+     *
+     * @throws InvalidArgumentException
+     *   If the $key string is not a legal value a \Psr\Cache\InvalidArgumentException
+     *   MUST be thrown.
+     *
+     * @return CacheItemInterface
+     *   The corresponding Cache Item.
+     */
+    public function getItem($key);
+
+    /**
+     * Returns a traversable set of cache items.
+     *
+     * @param string[] $keys
+     *   An indexed array of keys of items to retrieve.
+     *
+     * @throws InvalidArgumentException
+     *   If any of the keys in $keys are not a legal value a \Psr\Cache\InvalidArgumentException
+     *   MUST be thrown.
+     *
+     * @return array|\Traversable
+     *   A traversable collection of Cache Items keyed by the cache keys of
+     *   each item. A Cache item will be returned for each key, even if that
+     *   key is not found. However, if no keys are specified then an empty
+     *   traversable MUST be returned instead.
+     */
+    public function getItems(array $keys = array());
+
+    /**
+     * Confirms if the cache contains specified cache item.
+     *
+     * Note: This method MAY avoid retrieving the cached value for performance reasons.
+     * This could result in a race condition with CacheItemInterface::get(). To avoid
+     * such situation use CacheItemInterface::isHit() instead.
+     *
+     * @param string $key
+     *   The key for which to check existence.
+     *
+     * @throws InvalidArgumentException
+     *   If the $key string is not a legal value a \Psr\Cache\InvalidArgumentException
+     *   MUST be thrown.
+     *
+     * @return bool
+     *   True if item exists in the cache, false otherwise.
+     */
+    public function hasItem($key);
+
+    /**
+     * Deletes all items in the pool.
+     *
+     * @return bool
+     *   True if the pool was successfully cleared. False if there was an error.
+     */
+    public function clear();
+
+    /**
+     * Removes the item from the pool.
+     *
+     * @param string $key
+     *   The key to delete.
+     *
+     * @throws InvalidArgumentException
+     *   If the $key string is not a legal value a \Psr\Cache\InvalidArgumentException
+     *   MUST be thrown.
+     *
+     * @return bool
+     *   True if the item was successfully removed. False if there was an error.
+     */
+    public function deleteItem($key);
+
+    /**
+     * Removes multiple items from the pool.
+     *
+     * @param string[] $keys
+     *   An array of keys that should be removed from the pool.
+
+     * @throws InvalidArgumentException
+     *   If any of the keys in $keys are not a legal value a \Psr\Cache\InvalidArgumentException
+     *   MUST be thrown.
+     *
+     * @return bool
+     *   True if the items were successfully removed. False if there was an error.
+     */
+    public function deleteItems(array $keys);
+
+    /**
+     * Persists a cache item immediately.
+     *
+     * @param CacheItemInterface $item
+     *   The cache item to save.
+     *
+     * @return bool
+     *   True if the item was successfully persisted. False if there was an error.
+     */
+    public function save(CacheItemInterface $item);
+
+    /**
+     * Sets a cache item to be persisted later.
+     *
+     * @param CacheItemInterface $item
+     *   The cache item to save.
+     *
+     * @return bool
+     *   False if the item could not be queued or if a commit was attempted and failed. True otherwise.
+     */
+    public function saveDeferred(CacheItemInterface $item);
+
+    /**
+     * Persists any deferred cache items.
+     *
+     * @return bool
+     *   True if all not-yet-saved items were successfully saved or there were none. False otherwise.
+     */
+    public function commit();
+}

addons/weliam_smartcity/vendor/psr/cache/src/InvalidArgumentException.php

@@ -0,0 +1,13 @@
+<?php
+
+namespace Psr\Cache;
+
+/**
+ * Exception interface for invalid cache arguments.
+ *
+ * Any time an invalid argument is passed into a method it must throw an
+ * exception class which implements Psr\Cache\InvalidArgumentException.
+ */
+interface InvalidArgumentException extends CacheException
+{
+}

addons/weliam_smartcity/vendor/psr/container/.gitignore

@@ -0,0 +1,3 @@
+composer.lock
+composer.phar
+/vendor/

addons/weliam_smartcity/vendor/psr/container/LICENSE

@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2013-2016 container-interop
+Copyright (c) 2016 PHP Framework Interoperability Group
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
+COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.

addons/weliam_smartcity/vendor/psr/container/README.md

@@ -0,0 +1,5 @@
+# PSR Container
+
+This repository holds all interfaces/classes/traits related to [PSR-11](https://github.com/container-interop/fig-standards/blob/master/proposed/container.md).
+
+Note that this is not a container implementation of its own. See the specification for more details.

addons/weliam_smartcity/vendor/psr/container/composer.json

@@ -0,0 +1,27 @@
+{
+    "name": "psr/container",
+    "type": "library",
+    "description": "Common Container Interface (PHP FIG PSR-11)",
+    "keywords": ["psr", "psr-11", "container", "container-interop", "container-interface"],
+    "homepage": "https://github.com/php-fig/container",
+    "license": "MIT",
+    "authors": [
+        {
+            "name": "PHP-FIG",
+            "homepage": "http://www.php-fig.org/"
+        }
+    ],
+    "require": {
+        "php": ">=5.3.0"
+    },
+    "autoload": {
+        "psr-4": {
+            "Psr\\Container\\": "src/"
+        }
+    },
+    "extra": {
+        "branch-alias": {
+            "dev-master": "1.0.x-dev"
+        }
+    }
+}

addons/weliam_smartcity/vendor/psr/container/src/ContainerExceptionInterface.php

@@ -0,0 +1,13 @@
+<?php
+/**
+ * @license http://www.opensource.org/licenses/mit-license.php MIT (see the LICENSE file)
+ */
+
+namespace Psr\Container;
+
+/**
+ * Base interface representing a generic exception in a container.
+ */
+interface ContainerExceptionInterface
+{
+}

addons/weliam_smartcity/vendor/psr/container/src/ContainerInterface.php

@@ -0,0 +1,37 @@
+<?php
+/**
+ * @license http://www.opensource.org/licenses/mit-license.php MIT (see the LICENSE file)
+ */
+
+namespace Psr\Container;
+
+/**
+ * Describes the interface of a container that exposes methods to read its entries.
+ */
+interface ContainerInterface
+{
+    /**
+     * Finds an entry of the container by its identifier and returns it.
+     *
+     * @param string $id Identifier of the entry to look for.
+     *
+     * @throws NotFoundExceptionInterface  No entry was found for **this** identifier.
+     * @throws ContainerExceptionInterface Error while retrieving the entry.
+     *
+     * @return mixed Entry.
+     */
+    public function get($id);
+
+    /**
+     * Returns true if the container can return an entry for the given identifier.
+     * Returns false otherwise.
+     *
+     * `has($id)` returning true does not mean that `get($id)` will not throw an exception.
+     * It does however mean that `get($id)` will not throw a `NotFoundExceptionInterface`.
+     *
+     * @param string $id Identifier of the entry to look for.
+     *
+     * @return bool
+     */
+    public function has($id);
+}

addons/weliam_smartcity/vendor/psr/container/src/NotFoundExceptionInterface.php

@@ -0,0 +1,13 @@
+<?php
+/**
+ * @license http://www.opensource.org/licenses/mit-license.php MIT (see the LICENSE file)
+ */
+
+namespace Psr\Container;
+
+/**
+ * No entry was found in the container.
+ */
+interface NotFoundExceptionInterface extends ContainerExceptionInterface
+{
+}

addons/weliam_smartcity/vendor/psr/http-message/CHANGELOG.md

@@ -0,0 +1,36 @@
+# Changelog
+
+All notable changes to this project will be documented in this file, in reverse chronological order by release.
+
+## 1.0.1 - 2016-08-06
+
+### Added
+
+- Nothing.
+
+### Deprecated
+
+- Nothing.
+
+### Removed
+
+- Nothing.
+
+### Fixed
+
+- Updated all `@return self` annotation references in interfaces to use
+  `@return static`, which more closelly follows the semantics of the
+  specification.
+- Updated the `MessageInterface::getHeaders()` return annotation to use the
+  value `string[][]`, indicating the format is a nested array of strings.
+- Updated the `@link` annotation for `RequestInterface::withRequestTarget()`
+  to point to the correct section of RFC 7230.
+- Updated the `ServerRequestInterface::withUploadedFiles()` parameter annotation
+  to add the parameter name (`$uploadedFiles`).
+- Updated a `@throws` annotation for the `UploadedFileInterface::moveTo()`
+  method to correctly reference the method parameter (it was referencing an
+  incorrect parameter name previously).
+
+## 1.0.0 - 2016-05-18
+
+Initial stable release; reflects accepted PSR-7 specification.

addons/weliam_smartcity/vendor/psr/http-message/LICENSE

@@ -0,0 +1,19 @@
+Copyright (c) 2014 PHP Framework Interoperability Group
+
+Permission is hereby granted, free of charge, to any person obtaining a copy 
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights 
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell 
+copies of the Software, and to permit persons to whom the Software is 
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in 
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.

addons/weliam_smartcity/vendor/psr/http-message/README.md

@@ -0,0 +1,13 @@
+PSR Http Message
+================
+
+This repository holds all interfaces/classes/traits related to
+[PSR-7](http://www.php-fig.org/psr/psr-7/).
+
+Note that this is not a HTTP message implementation of its own. It is merely an
+interface that describes a HTTP message. See the specification for more details.
+
+Usage
+-----
+
+We'll certainly need some stuff in here.