diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php new file mode 100644 index 0000000..a9a3f30 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/ErrorHandlerTest.php @@ -0,0 +1,31 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Handler\TestHandler; + +class ErrorHandlerTest extends \PHPUnit_Framework_TestCase +{ + public function testHandleError() + { + $logger = new Logger('test', array($handler = new TestHandler)); + $errHandler = new ErrorHandler($logger); + + $errHandler->registerErrorHandler(array(E_USER_NOTICE => Logger::EMERGENCY), false); + trigger_error('Foo', E_USER_ERROR); + $this->assertCount(1, $handler->getRecords()); + $this->assertTrue($handler->hasErrorRecords()); + trigger_error('Foo', E_USER_NOTICE); + $this->assertCount(2, $handler->getRecords()); + $this->assertTrue($handler->hasEmergencyRecords()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php new file mode 100644 index 0000000..71c4204 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ChromePHPFormatterTest.php @@ -0,0 +1,158 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class ChromePHPFormatterTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Formatter\ChromePHPFormatter::format + */ + public function testDefaultFormat() + { + $formatter = new ChromePHPFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1'), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertEquals( + array( + 'meh', + array( + 'message' => 'log', + 'context' => array('from' => 'logger'), + 'extra' => array('ip' => '127.0.0.1'), + ), + 'unknown', + 'error', + ), + $message + ); + } + + /** + * @covers Monolog\Formatter\ChromePHPFormatter::format + */ + public function testFormatWithFileAndLine() + { + $formatter = new ChromePHPFormatter(); + $record = array( + 'level' => Logger::CRITICAL, + 'level_name' => 'CRITICAL', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertEquals( + array( + 'meh', + array( + 'message' => 'log', + 'context' => array('from' => 'logger'), + 'extra' => array('ip' => '127.0.0.1'), + ), + 'test : 14', + 'error', + ), + $message + ); + } + + /** + * @covers Monolog\Formatter\ChromePHPFormatter::format + */ + public function testFormatWithoutContext() + { + $formatter = new ChromePHPFormatter(); + $record = array( + 'level' => Logger::DEBUG, + 'level_name' => 'DEBUG', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertEquals( + array( + 'meh', + 'log', + 'unknown', + 'log', + ), + $message + ); + } + + /** + * @covers Monolog\Formatter\ChromePHPFormatter::formatBatch + */ + public function testBatchFormatThrowException() + { + $formatter = new ChromePHPFormatter(); + $records = array( + array( + 'level' => Logger::INFO, + 'level_name' => 'INFO', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ), + array( + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'foo', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log2', + ), + ); + + $this->assertEquals( + array( + array( + 'meh', + 'log', + 'unknown', + 'info', + ), + array( + 'foo', + 'log2', + 'unknown', + 'warn', + ), + ), + $formatter->formatBatch($records) + ); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php new file mode 100644 index 0000000..90cc48d --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ElasticaFormatterTest.php @@ -0,0 +1,79 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class ElasticaFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + if (!class_exists("Elastica\Document")) { + $this->markTestSkipped("ruflin/elastica not installed"); + } + } + + /** + * @covers Monolog\Formatter\ElasticaFormatter::__construct + * @covers Monolog\Formatter\ElasticaFormatter::format + * @covers Monolog\Formatter\ElasticaFormatter::getDocument + */ + public function testFormat() + { + // test log message + $msg = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + // expected values + $expected = $msg; + $expected['datetime'] = '1970-01-01T00:00:00.000000+00:00'; + $expected['context'] = array( + 'class' => '[object] (stdClass: {})', + 'foo' => 7, + 0 => 'bar', + ); + + // format log message + $formatter = new ElasticaFormatter('my_index', 'doc_type'); + $doc = $formatter->format($msg); + $this->assertInstanceOf('Elastica\Document', $doc); + + // Document parameters + $params = $doc->getParams(); + $this->assertEquals('my_index', $params['_index']); + $this->assertEquals('doc_type', $params['_type']); + + // Document data values + $data = $doc->getData(); + foreach (array_keys($expected) as $key) { + $this->assertEquals($expected[$key], $data[$key]); + } + } + + /** + * @covers Monolog\Formatter\ElasticaFormatter::getIndex + * @covers Monolog\Formatter\ElasticaFormatter::getType + */ + public function testGetters() + { + $formatter = new ElasticaFormatter('my_index', 'doc_type'); + $this->assertEquals('my_index', $formatter->getIndex()); + $this->assertEquals('doc_type', $formatter->getType()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php new file mode 100644 index 0000000..1b2fd97 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/FlowdockFormatterTest.php @@ -0,0 +1,55 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; +use Monolog\TestCase; + +class FlowdockFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\FlowdockFormatter::format + */ + public function testFormat() + { + $formatter = new FlowdockFormatter('test_source', 'source@test.com'); + $record = $this->getRecord(); + + $expected = array( + 'source' => 'test_source', + 'from_address' => 'source@test.com', + 'subject' => 'in test_source: WARNING - test', + 'content' => 'test', + 'tags' => array('#logs', '#warning', '#test'), + 'project' => 'test_source', + ); + $formatted = $formatter->format($record); + + $this->assertEquals($expected, $formatted['flowdock']); + } + + /** + * @ covers Monolog\Formatter\FlowdockFormatter::formatBatch + */ + public function testFormatBatch() + { + $formatter = new FlowdockFormatter('test_source', 'source@test.com'); + $records = array( + $this->getRecord(Logger::WARNING), + $this->getRecord(Logger::DEBUG), + ); + $formatted = $formatter->formatBatch($records); + + $this->assertArrayHasKey('flowdock', $formatted[0]); + $this->assertArrayHasKey('flowdock', $formatted[1]); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/FluentdFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/FluentdFormatterTest.php new file mode 100644 index 0000000..fd36dbc --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/FluentdFormatterTest.php @@ -0,0 +1,62 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; +use Monolog\TestCase; + +class FluentdFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\FluentdFormatter::__construct + * @covers Monolog\Formatter\FluentdFormatter::isUsingLevelsInTag + */ + public function testConstruct() + { + $formatter = new FluentdFormatter(); + $this->assertEquals(false, $formatter->isUsingLevelsInTag()); + $formatter = new FluentdFormatter(false); + $this->assertEquals(false, $formatter->isUsingLevelsInTag()); + $formatter = new FluentdFormatter(true); + $this->assertEquals(true, $formatter->isUsingLevelsInTag()); + } + + /** + * @covers Monolog\Formatter\FluentdFormatter::format + */ + public function testFormat() + { + $record = $this->getRecord(Logger::WARNING); + $record['datetime'] = new \DateTime("@0"); + + $formatter = new FluentdFormatter(); + $this->assertEquals( + '["test",0,{"message":"test","context":[],"extra":[],"level":300,"level_name":"WARNING"}]', + $formatter->format($record) + ); + } + + /** + * @covers Monolog\Formatter\FluentdFormatter::format + */ + public function testFormatWithTag() + { + $record = $this->getRecord(Logger::ERROR); + $record['datetime'] = new \DateTime("@0"); + + $formatter = new FluentdFormatter(true); + $this->assertEquals( + '["test.error",0,{"message":"test","context":[],"extra":[]}]', + $formatter->format($record) + ); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php new file mode 100644 index 0000000..4a24761 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/GelfMessageFormatterTest.php @@ -0,0 +1,258 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class GelfMessageFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + if (!class_exists('\Gelf\Message')) { + $this->markTestSkipped("graylog2/gelf-php or mlehner/gelf-php is not installed"); + } + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testDefaultFormatter() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + $this->assertEquals(0, $message->getTimestamp()); + $this->assertEquals('log', $message->getShortMessage()); + $this->assertEquals('meh', $message->getFacility()); + $this->assertEquals(null, $message->getLine()); + $this->assertEquals(null, $message->getFile()); + $this->assertEquals($this->isLegacy() ? 3 : 'error', $message->getLevel()); + $this->assertNotEmpty($message->getHost()); + + $formatter = new GelfMessageFormatter('mysystem'); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + $this->assertEquals('mysystem', $message->getHost()); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithFileAndLine() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + $this->assertEquals('test', $message->getFile()); + $this->assertEquals(14, $message->getLine()); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + * @expectedException InvalidArgumentException + */ + public function testFormatInvalidFails() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + ); + + $formatter->format($record); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithContext() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_ctxt_from', $message_array); + $this->assertEquals('logger', $message_array['_ctxt_from']); + + // Test with extraPrefix + $formatter = new GelfMessageFormatter(null, null, 'CTX'); + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_CTXfrom', $message_array); + $this->assertEquals('logger', $message_array['_CTXfrom']); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithContextContainingException() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger', 'exception' => array( + 'class' => '\Exception', + 'file' => '/some/file/in/dir.php:56', + 'trace' => array('/some/file/1.php:23', '/some/file/2.php:3'), + )), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $this->assertEquals("/some/file/in/dir.php", $message->getFile()); + $this->assertEquals("56", $message->getLine()); + } + + /** + * @covers Monolog\Formatter\GelfMessageFormatter::format + */ + public function testFormatWithExtra() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log', + ); + + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_key', $message_array); + $this->assertEquals('pair', $message_array['_key']); + + // Test with extraPrefix + $formatter = new GelfMessageFormatter(null, 'EXT'); + $message = $formatter->format($record); + + $this->assertInstanceOf('Gelf\Message', $message); + + $message_array = $message->toArray(); + + $this->assertArrayHasKey('_EXTkey', $message_array); + $this->assertEquals('pair', $message_array['_EXTkey']); + } + + public function testFormatWithLargeData() + { + $formatter = new GelfMessageFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('exception' => str_repeat(' ', 32767)), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => str_repeat(' ', 32767)), + 'message' => 'log' + ); + $message = $formatter->format($record); + $messageArray = $message->toArray(); + + // 200 for padding + metadata + $length = 200; + + foreach ($messageArray as $key => $value) { + if (!in_array($key, array('level', 'timestamp'))) { + $length += strlen($value); + } + } + + $this->assertLessThanOrEqual(65792, $length, 'The message length is no longer than the maximum allowed length'); + } + + public function testFormatWithUnlimitedLength() + { + $formatter = new GelfMessageFormatter('LONG_SYSTEM_NAME', null, 'ctxt_', PHP_INT_MAX); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('exception' => str_repeat(' ', 32767 * 2)), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => str_repeat(' ', 32767 * 2)), + 'message' => 'log' + ); + $message = $formatter->format($record); + $messageArray = $message->toArray(); + + // 200 for padding + metadata + $length = 200; + + foreach ($messageArray as $key => $value) { + if (!in_array($key, array('level', 'timestamp'))) { + $length += strlen($value); + } + } + + $this->assertGreaterThanOrEqual(131289, $length, 'The message should not be truncated'); + } + + private function isLegacy() + { + return interface_exists('\Gelf\IMessagePublisher'); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php new file mode 100644 index 0000000..24b06cc --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/JsonFormatterTest.php @@ -0,0 +1,219 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; +use Monolog\TestCase; + +class JsonFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\JsonFormatter::__construct + * @covers Monolog\Formatter\JsonFormatter::getBatchMode + * @covers Monolog\Formatter\JsonFormatter::isAppendingNewlines + */ + public function testConstruct() + { + $formatter = new JsonFormatter(); + $this->assertEquals(JsonFormatter::BATCH_MODE_JSON, $formatter->getBatchMode()); + $this->assertEquals(true, $formatter->isAppendingNewlines()); + $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES, false); + $this->assertEquals(JsonFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode()); + $this->assertEquals(false, $formatter->isAppendingNewlines()); + } + + /** + * @covers Monolog\Formatter\JsonFormatter::format + */ + public function testFormat() + { + $formatter = new JsonFormatter(); + $record = $this->getRecord(); + $this->assertEquals(json_encode($record)."\n", $formatter->format($record)); + + $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_JSON, false); + $record = $this->getRecord(); + $this->assertEquals(json_encode($record), $formatter->format($record)); + } + + /** + * @covers Monolog\Formatter\JsonFormatter::formatBatch + * @covers Monolog\Formatter\JsonFormatter::formatBatchJson + */ + public function testFormatBatch() + { + $formatter = new JsonFormatter(); + $records = array( + $this->getRecord(Logger::WARNING), + $this->getRecord(Logger::DEBUG), + ); + $this->assertEquals(json_encode($records), $formatter->formatBatch($records)); + } + + /** + * @covers Monolog\Formatter\JsonFormatter::formatBatch + * @covers Monolog\Formatter\JsonFormatter::formatBatchNewlines + */ + public function testFormatBatchNewlines() + { + $formatter = new JsonFormatter(JsonFormatter::BATCH_MODE_NEWLINES); + $records = $expected = array( + $this->getRecord(Logger::WARNING), + $this->getRecord(Logger::DEBUG), + ); + array_walk($expected, function (&$value, $key) { + $value = json_encode($value); + }); + $this->assertEquals(implode("\n", $expected), $formatter->formatBatch($records)); + } + + public function testDefFormatWithException() + { + $formatter = new JsonFormatter(); + $exception = new \RuntimeException('Foo'); + $formattedException = $this->formatException($exception); + + $message = $this->formatRecordWithExceptionInContext($formatter, $exception); + + $this->assertContextContainsFormattedException($formattedException, $message); + } + + public function testDefFormatWithPreviousException() + { + $formatter = new JsonFormatter(); + $exception = new \RuntimeException('Foo', 0, new \LogicException('Wut?')); + $formattedPrevException = $this->formatException($exception->getPrevious()); + $formattedException = $this->formatException($exception, $formattedPrevException); + + $message = $this->formatRecordWithExceptionInContext($formatter, $exception); + + $this->assertContextContainsFormattedException($formattedException, $message); + } + + public function testDefFormatWithThrowable() + { + if (!class_exists('Error') || !is_subclass_of('Error', 'Throwable')) { + $this->markTestSkipped('Requires PHP >=7'); + } + + $formatter = new JsonFormatter(); + $throwable = new \Error('Foo'); + $formattedThrowable = $this->formatException($throwable); + + $message = $this->formatRecordWithExceptionInContext($formatter, $throwable); + + $this->assertContextContainsFormattedException($formattedThrowable, $message); + } + + /** + * @param string $expected + * @param string $actual + * + * @internal param string $exception + */ + private function assertContextContainsFormattedException($expected, $actual) + { + $this->assertEquals( + '{"level_name":"CRITICAL","channel":"core","context":{"exception":'.$expected.'},"datetime":null,"extra":[],"message":"foobar"}'."\n", + $actual + ); + } + + /** + * @param JsonFormatter $formatter + * @param \Exception|\Throwable $exception + * + * @return string + */ + private function formatRecordWithExceptionInContext(JsonFormatter $formatter, $exception) + { + $message = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'core', + 'context' => array('exception' => $exception), + 'datetime' => null, + 'extra' => array(), + 'message' => 'foobar', + )); + return $message; + } + + /** + * @param \Exception|\Throwable $exception + * + * @return string + */ + private function formatExceptionFilePathWithLine($exception) + { + $options = 0; + if (version_compare(PHP_VERSION, '5.4.0', '>=')) { + $options = JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE; + } + $path = substr(json_encode($exception->getFile(), $options), 1, -1); + return $path . ':' . $exception->getLine(); + } + + /** + * @param \Exception|\Throwable $exception + * + * @param null|string $previous + * + * @return string + */ + private function formatException($exception, $previous = null) + { + $formattedException = + '{"class":"' . get_class($exception) . + '","message":"' . $exception->getMessage() . + '","code":' . $exception->getCode() . + ',"file":"' . $this->formatExceptionFilePathWithLine($exception) . + ($previous ? '","previous":' . $previous : '"') . + '}'; + return $formattedException; + } + + public function testNormalizeHandleLargeArraysWithExactly1000Items() + { + $formatter = new NormalizerFormatter(); + $largeArray = range(1, 1000); + + $res = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array($largeArray), + 'datetime' => new \DateTime, + 'extra' => array(), + )); + + $this->assertCount(1000, $res['context'][0]); + $this->assertArrayNotHasKey('...', $res['context'][0]); + } + + public function testNormalizeHandleLargeArrays() + { + $formatter = new NormalizerFormatter(); + $largeArray = range(1, 2000); + + $res = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array($largeArray), + 'datetime' => new \DateTime, + 'extra' => array(), + )); + + $this->assertCount(1001, $res['context'][0]); + $this->assertEquals('Over 1000 items (2000 total), aborting normalization', $res['context'][0]['...']); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php new file mode 100644 index 0000000..310d93c --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LineFormatterTest.php @@ -0,0 +1,222 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * @covers Monolog\Formatter\LineFormatter + */ +class LineFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function testDefFormatWithString() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'context' => array(), + 'message' => 'foo', + 'datetime' => new \DateTime, + 'extra' => array(), + )); + $this->assertEquals('['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message); + } + + public function testDefFormatWithArrayContext() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'message' => 'foo', + 'datetime' => new \DateTime, + 'extra' => array(), + 'context' => array( + 'foo' => 'bar', + 'baz' => 'qux', + 'bool' => false, + 'null' => null, + ), + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foo {"foo":"bar","baz":"qux","bool":false,"null":null} []'."\n", $message); + } + + public function testDefFormatExtras() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array('ip' => '127.0.0.1'), + 'message' => 'log', + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] {"ip":"127.0.0.1"}'."\n", $message); + } + + public function testFormatExtras() + { + $formatter = new LineFormatter("[%datetime%] %channel%.%level_name%: %message% %context% %extra.file% %extra%\n", 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array('ip' => '127.0.0.1', 'file' => 'test'), + 'message' => 'log', + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log [] test {"ip":"127.0.0.1"}'."\n", $message); + } + + public function testContextAndExtraOptionallyNotShownIfEmpty() + { + $formatter = new LineFormatter(null, 'Y-m-d', false, true); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + 'message' => 'log', + )); + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: log '."\n", $message); + } + + public function testContextAndExtraReplacement() + { + $formatter = new LineFormatter('%context.foo% => %extra.foo%'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 'bar'), + 'datetime' => new \DateTime, + 'extra' => array('foo' => 'xbar'), + 'message' => 'log', + )); + $this->assertEquals('bar => xbar', $message); + } + + public function testDefFormatWithObject() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array('foo' => new TestFoo, 'bar' => new TestBar, 'baz' => array(), 'res' => fopen('php://memory', 'rb')), + 'message' => 'foobar', + )); + + $this->assertEquals('['.date('Y-m-d').'] meh.ERROR: foobar [] {"foo":"[object] (Monolog\\\\Formatter\\\\TestFoo: {\\"foo\\":\\"foo\\"})","bar":"[object] (Monolog\\\\Formatter\\\\TestBar: bar)","baz":[],"res":"[resource] (stream)"}'."\n", $message); + } + + public function testDefFormatWithException() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'core', + 'context' => array('exception' => new \RuntimeException('Foo')), + 'datetime' => new \DateTime, + 'extra' => array(), + 'message' => 'foobar', + )); + + $path = str_replace('\\/', '/', json_encode(__FILE__)); + + $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__ - 8).')"} []'."\n", $message); + } + + public function testDefFormatWithPreviousException() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $previous = new \LogicException('Wut?'); + $message = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'core', + 'context' => array('exception' => new \RuntimeException('Foo', 0, $previous)), + 'datetime' => new \DateTime, + 'extra' => array(), + 'message' => 'foobar', + )); + + $path = str_replace('\\/', '/', json_encode(__FILE__)); + + $this->assertEquals('['.date('Y-m-d').'] core.CRITICAL: foobar {"exception":"[object] (RuntimeException(code: 0): Foo at '.substr($path, 1, -1).':'.(__LINE__ - 8).', LogicException(code: 0): Wut? at '.substr($path, 1, -1).':'.(__LINE__ - 12).')"} []'."\n", $message); + } + + public function testBatchFormat() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->formatBatch(array( + array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'message' => 'foo', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + )); + $this->assertEquals('['.date('Y-m-d').'] test.CRITICAL: bar [] []'."\n".'['.date('Y-m-d').'] log.WARNING: foo [] []'."\n", $message); + } + + public function testFormatShouldStripInlineLineBreaks() + { + $formatter = new LineFormatter(null, 'Y-m-d'); + $message = $formatter->format( + array( + 'message' => "foo\nbar", + 'context' => array(), + 'extra' => array(), + ) + ); + + $this->assertRegExp('/foo bar/', $message); + } + + public function testFormatShouldNotStripInlineLineBreaksWhenFlagIsSet() + { + $formatter = new LineFormatter(null, 'Y-m-d', true); + $message = $formatter->format( + array( + 'message' => "foo\nbar", + 'context' => array(), + 'extra' => array(), + ) + ); + + $this->assertRegExp('/foo\nbar/', $message); + } +} + +class TestFoo +{ + public $foo = 'foo'; +} + +class TestBar +{ + public function __toString() + { + return 'bar'; + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php new file mode 100644 index 0000000..6d59b3f --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LogglyFormatterTest.php @@ -0,0 +1,40 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\TestCase; + +class LogglyFormatterTest extends TestCase +{ + /** + * @covers Monolog\Formatter\LogglyFormatter::__construct + */ + public function testConstruct() + { + $formatter = new LogglyFormatter(); + $this->assertEquals(LogglyFormatter::BATCH_MODE_NEWLINES, $formatter->getBatchMode()); + $formatter = new LogglyFormatter(LogglyFormatter::BATCH_MODE_JSON); + $this->assertEquals(LogglyFormatter::BATCH_MODE_JSON, $formatter->getBatchMode()); + } + + /** + * @covers Monolog\Formatter\LogglyFormatter::format + */ + public function testFormat() + { + $formatter = new LogglyFormatter(); + $record = $this->getRecord(); + $formatted_decoded = json_decode($formatter->format($record), true); + $this->assertArrayHasKey("timestamp", $formatted_decoded); + $this->assertEquals(new \DateTime($formatted_decoded["timestamp"]), $record["datetime"]); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php new file mode 100644 index 0000000..9f6b1cc --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/LogstashFormatterTest.php @@ -0,0 +1,333 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class LogstashFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function tearDown() + { + \PHPUnit_Framework_Error_Warning::$enabled = true; + + return parent::tearDown(); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testDefaultFormatter() + { + $formatter = new LogstashFormatter('test', 'hostname'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']); + $this->assertEquals('log', $message['@message']); + $this->assertEquals('meh', $message['@fields']['channel']); + $this->assertContains('meh', $message['@tags']); + $this->assertEquals(Logger::ERROR, $message['@fields']['level']); + $this->assertEquals('test', $message['@type']); + $this->assertEquals('hostname', $message['@source']); + + $formatter = new LogstashFormatter('mysystem'); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('mysystem', $message['@type']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithFileAndLine() + { + $formatter = new LogstashFormatter('test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('test', $message['@fields']['file']); + $this->assertEquals(14, $message['@fields']['line']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithContext() + { + $formatter = new LogstashFormatter('test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('ctxt_from', $message_array); + $this->assertEquals('logger', $message_array['ctxt_from']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, null, 'CTX'); + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('CTXfrom', $message_array); + $this->assertEquals('logger', $message_array['CTXfrom']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithExtra() + { + $formatter = new LogstashFormatter('test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('key', $message_array); + $this->assertEquals('pair', $message_array['key']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, 'EXT'); + $message = json_decode($formatter->format($record), true); + + $message_array = $message['@fields']; + + $this->assertArrayHasKey('EXTkey', $message_array); + $this->assertEquals('pair', $message_array['EXTkey']); + } + + public function testFormatWithApplicationName() + { + $formatter = new LogstashFormatter('app', 'test'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('@type', $message); + $this->assertEquals('app', $message['@type']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testDefaultFormatterV1() + { + $formatter = new LogstashFormatter('test', 'hostname', null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']); + $this->assertEquals("1", $message['@version']); + $this->assertEquals('log', $message['message']); + $this->assertEquals('meh', $message['channel']); + $this->assertEquals('ERROR', $message['level']); + $this->assertEquals('test', $message['type']); + $this->assertEquals('hostname', $message['host']); + + $formatter = new LogstashFormatter('mysystem', null, null, 'ctxt_', LogstashFormatter::V1); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('mysystem', $message['type']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithFileAndLineV1() + { + $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals('test', $message['file']); + $this->assertEquals(14, $message['line']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithContextV1() + { + $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('ctxt_from', $message); + $this->assertEquals('logger', $message['ctxt_from']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, null, 'CTX', LogstashFormatter::V1); + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('CTXfrom', $message); + $this->assertEquals('logger', $message['CTXfrom']); + } + + /** + * @covers Monolog\Formatter\LogstashFormatter::format + */ + public function testFormatWithExtraV1() + { + $formatter = new LogstashFormatter('test', null, null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('key', $message); + $this->assertEquals('pair', $message['key']); + + // Test with extraPrefix + $formatter = new LogstashFormatter('test', null, 'EXT', 'ctxt_', LogstashFormatter::V1); + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('EXTkey', $message); + $this->assertEquals('pair', $message['EXTkey']); + } + + public function testFormatWithApplicationNameV1() + { + $formatter = new LogstashFormatter('app', 'test', null, 'ctxt_', LogstashFormatter::V1); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('key' => 'pair'), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertArrayHasKey('type', $message); + $this->assertEquals('app', $message['type']); + } + + public function testFormatWithLatin9Data() + { + if (version_compare(PHP_VERSION, '5.5.0', '<')) { + // Ignore the warning that will be emitted by PHP <5.5.0 + \PHPUnit_Framework_Error_Warning::$enabled = false; + } + $formatter = new LogstashFormatter('test', 'hostname'); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => '¯\_(ツ)_/¯', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array( + 'user_agent' => "\xD6WN; FBCR/OrangeEspa\xF1a; Vers\xE3o/4.0; F\xE4rist", + ), + 'message' => 'log', + ); + + $message = json_decode($formatter->format($record), true); + + $this->assertEquals("1970-01-01T00:00:00.000000+00:00", $message['@timestamp']); + $this->assertEquals('log', $message['@message']); + $this->assertEquals('¯\_(ツ)_/¯', $message['@fields']['channel']); + $this->assertContains('¯\_(ツ)_/¯', $message['@tags']); + $this->assertEquals(Logger::ERROR, $message['@fields']['level']); + $this->assertEquals('test', $message['@type']); + $this->assertEquals('hostname', $message['@source']); + if (version_compare(PHP_VERSION, '5.5.0', '>=')) { + $this->assertEquals('ÖWN; FBCR/OrangeEspaña; Versão/4.0; Färist', $message['@fields']['user_agent']); + } else { + // PHP <5.5 does not return false for an element encoding failure, + // instead it emits a warning (possibly) and nulls the value. + $this->assertEquals(null, $message['@fields']['user_agent']); + } + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php new file mode 100644 index 0000000..52e699e --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/MongoDBFormatterTest.php @@ -0,0 +1,262 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +/** + * @author Florian Plattner + */ +class MongoDBFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function setUp() + { + if (!class_exists('MongoDate')) { + $this->markTestSkipped('mongo extension not installed'); + } + } + + public function constructArgumentProvider() + { + return array( + array(1, true, 1, true), + array(0, false, 0, false), + ); + } + + /** + * @param $traceDepth + * @param $traceAsString + * @param $expectedTraceDepth + * @param $expectedTraceAsString + * + * @dataProvider constructArgumentProvider + */ + public function testConstruct($traceDepth, $traceAsString, $expectedTraceDepth, $expectedTraceAsString) + { + $formatter = new MongoDBFormatter($traceDepth, $traceAsString); + + $reflTrace = new \ReflectionProperty($formatter, 'exceptionTraceAsString'); + $reflTrace->setAccessible(true); + $this->assertEquals($expectedTraceAsString, $reflTrace->getValue($formatter)); + + $reflDepth = new\ReflectionProperty($formatter, 'maxNestingLevel'); + $reflDepth->setAccessible(true); + $this->assertEquals($expectedTraceDepth, $reflDepth->getValue($formatter)); + } + + public function testSimpleFormat() + { + $record = array( + 'message' => 'some log message', + 'context' => array(), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(); + $formattedRecord = $formatter->format($record); + + $this->assertCount(7, $formattedRecord); + $this->assertEquals('some log message', $formattedRecord['message']); + $this->assertEquals(array(), $formattedRecord['context']); + $this->assertEquals(Logger::WARNING, $formattedRecord['level']); + $this->assertEquals(Logger::getLevelName(Logger::WARNING), $formattedRecord['level_name']); + $this->assertEquals('test', $formattedRecord['channel']); + $this->assertInstanceOf('\MongoDate', $formattedRecord['datetime']); + $this->assertEquals('0.00000000 1391212800', $formattedRecord['datetime']->__toString()); + $this->assertEquals(array(), $formattedRecord['extra']); + } + + public function testRecursiveFormat() + { + $someObject = new \stdClass(); + $someObject->foo = 'something'; + $someObject->bar = 'stuff'; + + $record = array( + 'message' => 'some log message', + 'context' => array( + 'stuff' => new \DateTime('2014-02-01 02:31:33'), + 'some_object' => $someObject, + 'context_string' => 'some string', + 'context_int' => 123456, + 'except' => new \Exception('exception message', 987), + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(); + $formattedRecord = $formatter->format($record); + + $this->assertCount(5, $formattedRecord['context']); + $this->assertInstanceOf('\MongoDate', $formattedRecord['context']['stuff']); + $this->assertEquals('0.00000000 1391221893', $formattedRecord['context']['stuff']->__toString()); + $this->assertEquals( + array( + 'foo' => 'something', + 'bar' => 'stuff', + 'class' => 'stdClass', + ), + $formattedRecord['context']['some_object'] + ); + $this->assertEquals('some string', $formattedRecord['context']['context_string']); + $this->assertEquals(123456, $formattedRecord['context']['context_int']); + + $this->assertCount(5, $formattedRecord['context']['except']); + $this->assertEquals('exception message', $formattedRecord['context']['except']['message']); + $this->assertEquals(987, $formattedRecord['context']['except']['code']); + $this->assertInternalType('string', $formattedRecord['context']['except']['file']); + $this->assertInternalType('integer', $formattedRecord['context']['except']['code']); + $this->assertInternalType('string', $formattedRecord['context']['except']['trace']); + $this->assertEquals('Exception', $formattedRecord['context']['except']['class']); + } + + public function testFormatDepthArray() + { + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => array( + 'property' => 'anything', + 'nest3' => array( + 'nest4' => 'value', + 'property' => 'nothing', + ), + ), + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(2); + $formattedResult = $formatter->format($record); + + $this->assertEquals( + array( + 'nest2' => array( + 'property' => 'anything', + 'nest3' => '[...]', + ), + ), + $formattedResult['context'] + ); + } + + public function testFormatDepthArrayInfiniteNesting() + { + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => array( + 'property' => 'something', + 'nest3' => array( + 'property' => 'anything', + 'nest4' => array( + 'property' => 'nothing', + ), + ), + ), + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(0); + $formattedResult = $formatter->format($record); + + $this->assertEquals( + array( + 'nest2' => array( + 'property' => 'something', + 'nest3' => array( + 'property' => 'anything', + 'nest4' => array( + 'property' => 'nothing', + ), + ), + ), + ), + $formattedResult['context'] + ); + } + + public function testFormatDepthObjects() + { + $someObject = new \stdClass(); + $someObject->property = 'anything'; + $someObject->nest3 = new \stdClass(); + $someObject->nest3->property = 'nothing'; + $someObject->nest3->nest4 = 'invisible'; + + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => $someObject, + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(2, true); + $formattedResult = $formatter->format($record); + + $this->assertEquals( + array( + 'nest2' => array( + 'property' => 'anything', + 'nest3' => '[...]', + 'class' => 'stdClass', + ), + ), + $formattedResult['context'] + ); + } + + public function testFormatDepthException() + { + $record = array( + 'message' => 'some log message', + 'context' => array( + 'nest2' => new \Exception('exception message', 987), + ), + 'level' => Logger::WARNING, + 'level_name' => Logger::getLevelName(Logger::WARNING), + 'channel' => 'test', + 'datetime' => new \DateTime('2014-02-01 00:00:00'), + 'extra' => array(), + ); + + $formatter = new MongoDBFormatter(2, false); + $formattedRecord = $formatter->format($record); + + $this->assertEquals('exception message', $formattedRecord['context']['nest2']['message']); + $this->assertEquals(987, $formattedRecord['context']['nest2']['code']); + $this->assertEquals('[...]', $formattedRecord['context']['nest2']['trace']); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php new file mode 100644 index 0000000..bafd1c7 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/NormalizerFormatterTest.php @@ -0,0 +1,481 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +/** + * @covers Monolog\Formatter\NormalizerFormatter + */ +class NormalizerFormatterTest extends \PHPUnit_Framework_TestCase +{ + public function tearDown() + { + \PHPUnit_Framework_Error_Warning::$enabled = true; + + return parent::tearDown(); + } + + public function testFormat() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $formatted = $formatter->format(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'message' => 'foo', + 'datetime' => new \DateTime, + 'extra' => array('foo' => new TestFooNorm, 'bar' => new TestBarNorm, 'baz' => array(), 'res' => fopen('php://memory', 'rb')), + 'context' => array( + 'foo' => 'bar', + 'baz' => 'qux', + 'inf' => INF, + '-inf' => -INF, + 'nan' => acos(4), + ), + )); + + $this->assertEquals(array( + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'message' => 'foo', + 'datetime' => date('Y-m-d'), + 'extra' => array( + 'foo' => '[object] (Monolog\\Formatter\\TestFooNorm: {"foo":"foo"})', + 'bar' => '[object] (Monolog\\Formatter\\TestBarNorm: bar)', + 'baz' => array(), + 'res' => '[resource] (stream)', + ), + 'context' => array( + 'foo' => 'bar', + 'baz' => 'qux', + 'inf' => 'INF', + '-inf' => '-INF', + 'nan' => 'NaN', + ), + ), $formatted); + } + + public function testFormatExceptions() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $e = new \LogicException('bar'); + $e2 = new \RuntimeException('foo', 0, $e); + $formatted = $formatter->format(array( + 'exception' => $e2, + )); + + $this->assertGreaterThan(5, count($formatted['exception']['trace'])); + $this->assertTrue(isset($formatted['exception']['previous'])); + unset($formatted['exception']['trace'], $formatted['exception']['previous']); + + $this->assertEquals(array( + 'exception' => array( + 'class' => get_class($e2), + 'message' => $e2->getMessage(), + 'code' => $e2->getCode(), + 'file' => $e2->getFile().':'.$e2->getLine(), + ), + ), $formatted); + } + + public function testFormatSoapFaultException() + { + if (!class_exists('SoapFault')) { + $this->markTestSkipped('Requires the soap extension'); + } + + $formatter = new NormalizerFormatter('Y-m-d'); + $e = new \SoapFault('foo', 'bar', 'hello', 'world'); + $formatted = $formatter->format(array( + 'exception' => $e, + )); + + unset($formatted['exception']['trace']); + + $this->assertEquals(array( + 'exception' => array( + 'class' => 'SoapFault', + 'message' => 'bar', + 'code' => 0, + 'file' => $e->getFile().':'.$e->getLine(), + 'faultcode' => 'foo', + 'faultactor' => 'hello', + 'detail' => 'world', + ), + ), $formatted); + } + + public function testFormatToStringExceptionHandle() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $this->setExpectedException('RuntimeException', 'Could not convert to string'); + $formatter->format(array( + 'myObject' => new TestToStringError(), + )); + } + + public function testBatchFormat() + { + $formatter = new NormalizerFormatter('Y-m-d'); + $formatted = $formatter->formatBatch(array( + array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'message' => 'foo', + 'context' => array(), + 'datetime' => new \DateTime, + 'extra' => array(), + ), + )); + $this->assertEquals(array( + array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array(), + 'datetime' => date('Y-m-d'), + 'extra' => array(), + ), + array( + 'level_name' => 'WARNING', + 'channel' => 'log', + 'message' => 'foo', + 'context' => array(), + 'datetime' => date('Y-m-d'), + 'extra' => array(), + ), + ), $formatted); + } + + /** + * Test issue #137 + */ + public function testIgnoresRecursiveObjectReferences() + { + // set up the recursion + $foo = new \stdClass(); + $bar = new \stdClass(); + + $foo->bar = $bar; + $bar->foo = $foo; + + // set an error handler to assert that the error is not raised anymore + $that = $this; + set_error_handler(function ($level, $message, $file, $line, $context) use ($that) { + if (error_reporting() & $level) { + restore_error_handler(); + $that->fail("$message should not be raised"); + } + }); + + $formatter = new NormalizerFormatter(); + $reflMethod = new \ReflectionMethod($formatter, 'toJson'); + $reflMethod->setAccessible(true); + $res = $reflMethod->invoke($formatter, array($foo, $bar), true); + + restore_error_handler(); + + $this->assertEquals(@json_encode(array($foo, $bar)), $res); + } + + public function testCanNormalizeReferences() + { + $formatter = new NormalizerFormatter(); + $x = array('foo' => 'bar'); + $y = array('x' => &$x); + $x['y'] = &$y; + $formatter->format($y); + } + + public function testIgnoresInvalidTypes() + { + // set up the recursion + $resource = fopen(__FILE__, 'r'); + + // set an error handler to assert that the error is not raised anymore + $that = $this; + set_error_handler(function ($level, $message, $file, $line, $context) use ($that) { + if (error_reporting() & $level) { + restore_error_handler(); + $that->fail("$message should not be raised"); + } + }); + + $formatter = new NormalizerFormatter(); + $reflMethod = new \ReflectionMethod($formatter, 'toJson'); + $reflMethod->setAccessible(true); + $res = $reflMethod->invoke($formatter, array($resource), true); + + restore_error_handler(); + + $this->assertEquals(@json_encode(array($resource)), $res); + } + + public function testNormalizeHandleLargeArraysWithExactly1000Items() + { + $formatter = new NormalizerFormatter(); + $largeArray = range(1, 1000); + + $res = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array($largeArray), + 'datetime' => new \DateTime, + 'extra' => array(), + )); + + $this->assertCount(1000, $res['context'][0]); + $this->assertArrayNotHasKey('...', $res['context'][0]); + } + + public function testNormalizeHandleLargeArrays() + { + $formatter = new NormalizerFormatter(); + $largeArray = range(1, 2000); + + $res = $formatter->format(array( + 'level_name' => 'CRITICAL', + 'channel' => 'test', + 'message' => 'bar', + 'context' => array($largeArray), + 'datetime' => new \DateTime, + 'extra' => array(), + )); + + $this->assertCount(1001, $res['context'][0]); + $this->assertEquals('Over 1000 items (2000 total), aborting normalization', $res['context'][0]['...']); + } + + /** + * @expectedException RuntimeException + */ + public function testThrowsOnInvalidEncoding() + { + if (version_compare(PHP_VERSION, '5.5.0', '<')) { + // Ignore the warning that will be emitted by PHP <5.5.0 + \PHPUnit_Framework_Error_Warning::$enabled = false; + } + $formatter = new NormalizerFormatter(); + $reflMethod = new \ReflectionMethod($formatter, 'toJson'); + $reflMethod->setAccessible(true); + + // send an invalid unicode sequence as a object that can't be cleaned + $record = new \stdClass; + $record->message = "\xB1\x31"; + $res = $reflMethod->invoke($formatter, $record); + if (PHP_VERSION_ID < 50500 && $res === '{"message":null}') { + throw new \RuntimeException('PHP 5.3/5.4 throw a warning and null the value instead of returning false entirely'); + } + } + + public function testConvertsInvalidEncodingAsLatin9() + { + if (version_compare(PHP_VERSION, '5.5.0', '<')) { + // Ignore the warning that will be emitted by PHP <5.5.0 + \PHPUnit_Framework_Error_Warning::$enabled = false; + } + $formatter = new NormalizerFormatter(); + $reflMethod = new \ReflectionMethod($formatter, 'toJson'); + $reflMethod->setAccessible(true); + + $res = $reflMethod->invoke($formatter, array('message' => "\xA4\xA6\xA8\xB4\xB8\xBC\xBD\xBE")); + + if (version_compare(PHP_VERSION, '5.5.0', '>=')) { + $this->assertSame('{"message":"€ŠšŽžŒœŸ"}', $res); + } else { + // PHP <5.5 does not return false for an element encoding failure, + // instead it emits a warning (possibly) and nulls the value. + $this->assertSame('{"message":null}', $res); + } + } + + /** + * @param mixed $in Input + * @param mixed $expect Expected output + * @covers Monolog\Formatter\NormalizerFormatter::detectAndCleanUtf8 + * @dataProvider providesDetectAndCleanUtf8 + */ + public function testDetectAndCleanUtf8($in, $expect) + { + $formatter = new NormalizerFormatter(); + $formatter->detectAndCleanUtf8($in); + $this->assertSame($expect, $in); + } + + public function providesDetectAndCleanUtf8() + { + $obj = new \stdClass; + + return array( + 'null' => array(null, null), + 'int' => array(123, 123), + 'float' => array(123.45, 123.45), + 'bool false' => array(false, false), + 'bool true' => array(true, true), + 'ascii string' => array('abcdef', 'abcdef'), + 'latin9 string' => array("\xB1\x31\xA4\xA6\xA8\xB4\xB8\xBC\xBD\xBE\xFF", '±1€ŠšŽžŒœŸÿ'), + 'unicode string' => array('¤¦¨´¸¼½¾€ŠšŽžŒœŸ', '¤¦¨´¸¼½¾€ŠšŽžŒœŸ'), + 'empty array' => array(array(), array()), + 'array' => array(array('abcdef'), array('abcdef')), + 'object' => array($obj, $obj), + ); + } + + /** + * @param int $code + * @param string $msg + * @dataProvider providesHandleJsonErrorFailure + */ + public function testHandleJsonErrorFailure($code, $msg) + { + $formatter = new NormalizerFormatter(); + $reflMethod = new \ReflectionMethod($formatter, 'handleJsonError'); + $reflMethod->setAccessible(true); + + $this->setExpectedException('RuntimeException', $msg); + $reflMethod->invoke($formatter, $code, 'faked'); + } + + public function providesHandleJsonErrorFailure() + { + return array( + 'depth' => array(JSON_ERROR_DEPTH, 'Maximum stack depth exceeded'), + 'state' => array(JSON_ERROR_STATE_MISMATCH, 'Underflow or the modes mismatch'), + 'ctrl' => array(JSON_ERROR_CTRL_CHAR, 'Unexpected control character found'), + 'default' => array(-1, 'Unknown error'), + ); + } + + public function testExceptionTraceWithArgs() + { + if (defined('HHVM_VERSION')) { + $this->markTestSkipped('Not supported in HHVM since it detects errors differently'); + } + + // This happens i.e. in React promises or Guzzle streams where stream wrappers are registered + // and no file or line are included in the trace because it's treated as internal function + set_error_handler(function ($errno, $errstr, $errfile, $errline) { + throw new \ErrorException($errstr, 0, $errno, $errfile, $errline); + }); + + try { + // This will contain $resource and $wrappedResource as arguments in the trace item + $resource = fopen('php://memory', 'rw+'); + fwrite($resource, 'test_resource'); + $wrappedResource = new TestFooNorm; + $wrappedResource->foo = $resource; + // Just do something stupid with a resource/wrapped resource as argument + array_keys($wrappedResource); + } catch (\Exception $e) { + restore_error_handler(); + } + + $formatter = new NormalizerFormatter(); + $record = array('context' => array('exception' => $e)); + $result = $formatter->format($record); + + $this->assertRegExp( + '%"resource":"\[resource\] \(stream\)"%', + $result['context']['exception']['trace'][0] + ); + + if (version_compare(PHP_VERSION, '5.5.0', '>=')) { + $pattern = '%"wrappedResource":"\[object\] \(Monolog\\\\\\\\Formatter\\\\\\\\TestFooNorm: \)"%'; + } else { + $pattern = '%\\\\"foo\\\\":null%'; + } + + // Tests that the wrapped resource is ignored while encoding, only works for PHP <= 5.4 + $this->assertRegExp( + $pattern, + $result['context']['exception']['trace'][0] + ); + } + + public function testExceptionTraceDoesNotLeakCallUserFuncArgs() + { + try { + $arg = new TestInfoLeak; + call_user_func(array($this, 'throwHelper'), $arg, $dt = new \DateTime()); + } catch (\Exception $e) { + } + + $formatter = new NormalizerFormatter(); + $record = array('context' => array('exception' => $e)); + $result = $formatter->format($record); + + $this->assertSame( + '{"function":"throwHelper","class":"Monolog\\\\Formatter\\\\NormalizerFormatterTest","type":"->","args":["[object] (Monolog\\\\Formatter\\\\TestInfoLeak)","'.$dt->format('Y-m-d H:i:s').'"]}', + $result['context']['exception']['trace'][0] + ); + } + + private function throwHelper($arg) + { + throw new \RuntimeException('Thrown'); + } +} + +class TestFooNorm +{ + public $foo = 'foo'; +} + +class TestBarNorm +{ + public function __toString() + { + return 'bar'; + } +} + +class TestStreamFoo +{ + public $foo; + public $resource; + + public function __construct($resource) + { + $this->resource = $resource; + $this->foo = 'BAR'; + } + + public function __toString() + { + fseek($this->resource, 0); + + return $this->foo . ' - ' . (string) stream_get_contents($this->resource); + } +} + +class TestToStringError +{ + public function __toString() + { + throw new \RuntimeException('Could not convert to string'); + } +} + +class TestInfoLeak +{ + public function __toString() + { + return 'Sensitive information'; + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php new file mode 100644 index 0000000..b1c8fd4 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/ScalarFormatterTest.php @@ -0,0 +1,110 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +class ScalarFormatterTest extends \PHPUnit_Framework_TestCase +{ + private $formatter; + + public function setUp() + { + $this->formatter = new ScalarFormatter(); + } + + public function buildTrace(\Exception $e) + { + $data = array(); + $trace = $e->getTrace(); + foreach ($trace as $frame) { + if (isset($frame['file'])) { + $data[] = $frame['file'].':'.$frame['line']; + } else { + $data[] = json_encode($frame); + } + } + + return $data; + } + + public function encodeJson($data) + { + if (version_compare(PHP_VERSION, '5.4.0', '>=')) { + return json_encode($data, JSON_UNESCAPED_SLASHES | JSON_UNESCAPED_UNICODE); + } + + return json_encode($data); + } + + public function testFormat() + { + $exception = new \Exception('foo'); + $formatted = $this->formatter->format(array( + 'foo' => 'string', + 'bar' => 1, + 'baz' => false, + 'bam' => array(1, 2, 3), + 'bat' => array('foo' => 'bar'), + 'bap' => \DateTime::createFromFormat(\DateTime::ISO8601, '1970-01-01T00:00:00+0000'), + 'ban' => $exception, + )); + + $this->assertSame(array( + 'foo' => 'string', + 'bar' => 1, + 'baz' => false, + 'bam' => $this->encodeJson(array(1, 2, 3)), + 'bat' => $this->encodeJson(array('foo' => 'bar')), + 'bap' => '1970-01-01 00:00:00', + 'ban' => $this->encodeJson(array( + 'class' => get_class($exception), + 'message' => $exception->getMessage(), + 'code' => $exception->getCode(), + 'file' => $exception->getFile() . ':' . $exception->getLine(), + 'trace' => $this->buildTrace($exception), + )), + ), $formatted); + } + + public function testFormatWithErrorContext() + { + $context = array('file' => 'foo', 'line' => 1); + $formatted = $this->formatter->format(array( + 'context' => $context, + )); + + $this->assertSame(array( + 'context' => $this->encodeJson($context), + ), $formatted); + } + + public function testFormatWithExceptionContext() + { + $exception = new \Exception('foo'); + $formatted = $this->formatter->format(array( + 'context' => array( + 'exception' => $exception, + ), + )); + + $this->assertSame(array( + 'context' => $this->encodeJson(array( + 'exception' => array( + 'class' => get_class($exception), + 'message' => $exception->getMessage(), + 'code' => $exception->getCode(), + 'file' => $exception->getFile() . ':' . $exception->getLine(), + 'trace' => $this->buildTrace($exception), + ), + )), + ), $formatted); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php new file mode 100644 index 0000000..52f15a3 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Formatter/WildfireFormatterTest.php @@ -0,0 +1,142 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Formatter; + +use Monolog\Logger; + +class WildfireFormatterTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testDefaultFormat() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1'), + 'message' => 'log', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '125|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},' + .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|', + $message + ); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testFormatWithFileAndLine() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('from' => 'logger'), + 'datetime' => new \DateTime("@0"), + 'extra' => array('ip' => '127.0.0.1', 'file' => 'test', 'line' => 14), + 'message' => 'log', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '129|[{"Type":"ERROR","File":"test","Line":14,"Label":"meh"},' + .'{"message":"log","context":{"from":"logger"},"extra":{"ip":"127.0.0.1"}}]|', + $message + ); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testFormatWithoutContext() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '58|[{"Type":"ERROR","File":"","Line":"","Label":"meh"},"log"]|', + $message + ); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::formatBatch + * @expectedException BadMethodCallException + */ + public function testBatchFormatThrowException() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array(), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $wildfire->formatBatch(array($record)); + } + + /** + * @covers Monolog\Formatter\WildfireFormatter::format + */ + public function testTableFormat() + { + $wildfire = new WildfireFormatter(); + $record = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'table-channel', + 'context' => array( + WildfireFormatter::TABLE => array( + array('col1', 'col2', 'col3'), + array('val1', 'val2', 'val3'), + array('foo1', 'foo2', 'foo3'), + array('bar1', 'bar2', 'bar3'), + ), + ), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'table-message', + ); + + $message = $wildfire->format($record); + + $this->assertEquals( + '171|[{"Type":"TABLE","File":"","Line":"","Label":"table-channel: table-message"},[["col1","col2","col3"],["val1","val2","val3"],["foo1","foo2","foo3"],["bar1","bar2","bar3"]]]|', + $message + ); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php new file mode 100644 index 0000000..568eb9d --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AbstractHandlerTest.php @@ -0,0 +1,115 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; +use Monolog\Processor\WebProcessor; + +class AbstractHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\AbstractHandler::__construct + * @covers Monolog\Handler\AbstractHandler::getLevel + * @covers Monolog\Handler\AbstractHandler::setLevel + * @covers Monolog\Handler\AbstractHandler::getBubble + * @covers Monolog\Handler\AbstractHandler::setBubble + * @covers Monolog\Handler\AbstractHandler::getFormatter + * @covers Monolog\Handler\AbstractHandler::setFormatter + */ + public function testConstructAndGetSet() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false)); + $this->assertEquals(Logger::WARNING, $handler->getLevel()); + $this->assertEquals(false, $handler->getBubble()); + + $handler->setLevel(Logger::ERROR); + $handler->setBubble(true); + $handler->setFormatter($formatter = new LineFormatter); + $this->assertEquals(Logger::ERROR, $handler->getLevel()); + $this->assertEquals(true, $handler->getBubble()); + $this->assertSame($formatter, $handler->getFormatter()); + } + + /** + * @covers Monolog\Handler\AbstractHandler::handleBatch + */ + public function testHandleBatch() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + $handler->expects($this->exactly(2)) + ->method('handle'); + $handler->handleBatch(array($this->getRecord(), $this->getRecord())); + } + + /** + * @covers Monolog\Handler\AbstractHandler::isHandling + */ + public function testIsHandling() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array(Logger::WARNING, false)); + $this->assertTrue($handler->isHandling($this->getRecord())); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractHandler::__construct + */ + public function testHandlesPsrStyleLevels() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler', array('warning', false)); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + $handler->setLevel('debug'); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractHandler::getFormatter + * @covers Monolog\Handler\AbstractHandler::getDefaultFormatter + */ + public function testGetFormatterInitializesDefault() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + $this->assertInstanceOf('Monolog\Formatter\LineFormatter', $handler->getFormatter()); + } + + /** + * @covers Monolog\Handler\AbstractHandler::pushProcessor + * @covers Monolog\Handler\AbstractHandler::popProcessor + * @expectedException LogicException + */ + public function testPushPopProcessor() + { + $logger = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + $processor1 = new WebProcessor; + $processor2 = new WebProcessor; + + $logger->pushProcessor($processor1); + $logger->pushProcessor($processor2); + + $this->assertEquals($processor2, $logger->popProcessor()); + $this->assertEquals($processor1, $logger->popProcessor()); + $logger->popProcessor(); + } + + /** + * @covers Monolog\Handler\AbstractHandler::pushProcessor + * @expectedException InvalidArgumentException + */ + public function testPushProcessorWithNonCallable() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractHandler'); + + $handler->pushProcessor(new \stdClass()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php new file mode 100644 index 0000000..24d4f63 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AbstractProcessingHandlerTest.php @@ -0,0 +1,80 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Processor\WebProcessor; + +class AbstractProcessingHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleLowerLevelMessage() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, true)); + $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleBubbling() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, true)); + $this->assertFalse($handler->handle($this->getRecord())); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleNotBubbling() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::DEBUG, false)); + $this->assertTrue($handler->handle($this->getRecord())); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::handle + */ + public function testHandleIsFalseWhenNotHandled() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler', array(Logger::WARNING, false)); + $this->assertTrue($handler->handle($this->getRecord())); + $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\AbstractProcessingHandler::processRecord + */ + public function testProcessRecord() + { + $handler = $this->getMockForAbstractClass('Monolog\Handler\AbstractProcessingHandler'); + $handler->pushProcessor(new WebProcessor(array( + 'REQUEST_URI' => '', + 'REQUEST_METHOD' => '', + 'REMOTE_ADDR' => '', + 'SERVER_NAME' => '', + 'UNIQUE_ID' => '', + ))); + $handledRecord = null; + $handler->expects($this->once()) + ->method('write') + ->will($this->returnCallback(function ($record) use (&$handledRecord) { + $handledRecord = $record; + })) + ; + $handler->handle($this->getRecord()); + $this->assertEquals(6, count($handledRecord['extra'])); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php new file mode 100644 index 0000000..8e0e723 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/AmqpHandlerTest.php @@ -0,0 +1,136 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use PhpAmqpLib\Message\AMQPMessage; +use PhpAmqpLib\Connection\AMQPConnection; + +/** + * @covers Monolog\Handler\RotatingFileHandler + */ +class AmqpHandlerTest extends TestCase +{ + public function testHandleAmqpExt() + { + if (!class_exists('AMQPConnection') || !class_exists('AMQPExchange')) { + $this->markTestSkipped("amqp-php not installed"); + } + + if (!class_exists('AMQPChannel')) { + $this->markTestSkipped("Please update AMQP to version >= 1.0"); + } + + $messages = array(); + + $exchange = $this->getMock('AMQPExchange', array('publish', 'setName'), array(), '', false); + $exchange->expects($this->once()) + ->method('setName') + ->with('log') + ; + $exchange->expects($this->any()) + ->method('publish') + ->will($this->returnCallback(function ($message, $routing_key, $flags = 0, $attributes = array()) use (&$messages) { + $messages[] = array($message, $routing_key, $flags, $attributes); + })) + ; + + $handler = new AmqpHandler($exchange, 'log'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + array( + 'message' => 'test', + 'context' => array( + 'data' => array(), + 'foo' => 34, + ), + 'level' => 300, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'extra' => array(), + ), + 'warn.test', + 0, + array( + 'delivery_mode' => 2, + 'content_type' => 'application/json', + ), + ); + + $handler->handle($record); + + $this->assertCount(1, $messages); + $messages[0][0] = json_decode($messages[0][0], true); + unset($messages[0][0]['datetime']); + $this->assertEquals($expected, $messages[0]); + } + + public function testHandlePhpAmqpLib() + { + if (!class_exists('PhpAmqpLib\Connection\AMQPConnection')) { + $this->markTestSkipped("php-amqplib not installed"); + } + + $messages = array(); + + $exchange = $this->getMock('PhpAmqpLib\Channel\AMQPChannel', array('basic_publish', '__destruct'), array(), '', false); + + $exchange->expects($this->any()) + ->method('basic_publish') + ->will($this->returnCallback(function (AMQPMessage $msg, $exchange = "", $routing_key = "", $mandatory = false, $immediate = false, $ticket = null) use (&$messages) { + $messages[] = array($msg, $exchange, $routing_key, $mandatory, $immediate, $ticket); + })) + ; + + $handler = new AmqpHandler($exchange, 'log'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + array( + 'message' => 'test', + 'context' => array( + 'data' => array(), + 'foo' => 34, + ), + 'level' => 300, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'extra' => array(), + ), + 'log', + 'warn.test', + false, + false, + null, + array( + 'delivery_mode' => 2, + 'content_type' => 'application/json', + ), + ); + + $handler->handle($record); + + $this->assertCount(1, $messages); + + /* @var $msg AMQPMessage */ + $msg = $messages[0][0]; + $messages[0][0] = json_decode($msg->body, true); + $messages[0][] = $msg->get_properties(); + unset($messages[0][0]['datetime']); + + $this->assertEquals($expected, $messages[0]); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php new file mode 100644 index 0000000..ffe45da --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/BrowserConsoleHandlerTest.php @@ -0,0 +1,130 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\BrowserConsoleHandlerTest + */ +class BrowserConsoleHandlerTest extends TestCase +{ + protected function setUp() + { + BrowserConsoleHandler::resetStatic(); + } + + protected function generateScript() + { + $reflMethod = new \ReflectionMethod('Monolog\Handler\BrowserConsoleHandler', 'generateScript'); + $reflMethod->setAccessible(true); + + return $reflMethod->invoke(null); + } + + public function testStyling() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, 'foo[[bar]]{color: red}')); + + $expected = <<assertEquals($expected, $this->generateScript()); + } + + public function testEscaping() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, "[foo] [[\"bar\n[baz]\"]]{color: red}")); + + $expected = <<assertEquals($expected, $this->generateScript()); + } + + public function testAutolabel() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}')); + $handler->handle($this->getRecord(Logger::DEBUG, '[[bar]]{macro: autolabel}')); + $handler->handle($this->getRecord(Logger::DEBUG, '[[foo]]{macro: autolabel}')); + + $expected = <<assertEquals($expected, $this->generateScript()); + } + + public function testContext() + { + $handler = new BrowserConsoleHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + + $handler->handle($this->getRecord(Logger::DEBUG, 'test', array('foo' => 'bar'))); + + $expected = <<assertEquals($expected, $this->generateScript()); + } + + public function testConcurrentHandlers() + { + $handler1 = new BrowserConsoleHandler(); + $handler1->setFormatter($this->getIdentityFormatter()); + + $handler2 = new BrowserConsoleHandler(); + $handler2->setFormatter($this->getIdentityFormatter()); + + $handler1->handle($this->getRecord(Logger::DEBUG, 'test1')); + $handler2->handle($this->getRecord(Logger::DEBUG, 'test2')); + $handler1->handle($this->getRecord(Logger::DEBUG, 'test3')); + $handler2->handle($this->getRecord(Logger::DEBUG, 'test4')); + + $expected = <<assertEquals($expected, $this->generateScript()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php new file mode 100644 index 0000000..da8b3c3 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/BufferHandlerTest.php @@ -0,0 +1,158 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class BufferHandlerTest extends TestCase +{ + private $shutdownCheckHandler; + + /** + * @covers Monolog\Handler\BufferHandler::__construct + * @covers Monolog\Handler\BufferHandler::handle + * @covers Monolog\Handler\BufferHandler::close + */ + public function testHandleBuffers() + { + $test = new TestHandler(); + $handler = new BufferHandler($test); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + $handler->close(); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + + /** + * @covers Monolog\Handler\BufferHandler::close + * @covers Monolog\Handler\BufferHandler::flush + */ + public function testPropagatesRecordsAtEndOfRequest() + { + $test = new TestHandler(); + $handler = new BufferHandler($test); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->shutdownCheckHandler = $test; + register_shutdown_function(array($this, 'checkPropagation')); + } + + public function checkPropagation() + { + if (!$this->shutdownCheckHandler->hasWarningRecords() || !$this->shutdownCheckHandler->hasDebugRecords()) { + echo '!!! BufferHandlerTest::testPropagatesRecordsAtEndOfRequest failed to verify that the messages have been propagated' . PHP_EOL; + exit(1); + } + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleBufferLimit() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 2); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertFalse($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleBufferLimitWithFlushOnOverflow() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 3, Logger::DEBUG, true, true); + + // send two records + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertCount(0, $test->getRecords()); + + // overflow + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasDebugRecords()); + $this->assertCount(3, $test->getRecords()); + + // should buffer again + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertCount(3, $test->getRecords()); + + $handler->close(); + $this->assertCount(5, $test->getRecords()); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleLevel() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 0, Logger::INFO); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertFalse($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::flush + */ + public function testFlush() + { + $test = new TestHandler(); + $handler = new BufferHandler($test, 0); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->flush(); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\BufferHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new BufferHandler($test); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->flush(); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php new file mode 100644 index 0000000..421cc49 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ChromePHPHandlerTest.php @@ -0,0 +1,156 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\ChromePHPHandler + */ +class ChromePHPHandlerTest extends TestCase +{ + protected function setUp() + { + TestChromePHPHandler::resetStatic(); + $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; Chrome/1.0'; + } + + /** + * @dataProvider agentsProvider + */ + public function testHeaders($agent) + { + $_SERVER['HTTP_USER_AGENT'] = $agent; + + $handler = new TestChromePHPHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( + 'version' => ChromePHPHandler::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array( + 'test', + 'test', + ), + 'request_uri' => '', + )))), + ); + + $this->assertEquals($expected, $handler->getHeaders()); + } + + public static function agentsProvider() + { + return array( + array('Monolog Test; Chrome/1.0'), + array('Mozilla/5.0 (X11; Ubuntu; Linux x86_64; rv:52.0) Gecko/20100101 Firefox/52.0'), + array('Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) Ubuntu Chromium/56.0.2924.76 Chrome/56.0.2924.76 Safari/537.36'), + array('Mozilla/5.0 (X11; Linux x86_64) AppleWebKit/537.36 (KHTML, like Gecko) HeadlessChrome Safari/537.36'), + ); + } + + public function testHeadersOverflow() + { + $handler = new TestChromePHPHandler(); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 150 * 1024))); + + // overflow chrome headers limit + $handler->handle($this->getRecord(Logger::WARNING, str_repeat('a', 100 * 1024))); + + $expected = array( + 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( + 'version' => ChromePHPHandler::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array( + array( + 'test', + 'test', + 'unknown', + 'log', + ), + array( + 'test', + str_repeat('a', 150 * 1024), + 'unknown', + 'warn', + ), + array( + 'monolog', + 'Incomplete logs, chrome header size limit reached', + 'unknown', + 'warn', + ), + ), + 'request_uri' => '', + )))), + ); + + $this->assertEquals($expected, $handler->getHeaders()); + } + + public function testConcurrentHandlers() + { + $handler = new TestChromePHPHandler(); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $handler2 = new TestChromePHPHandler(); + $handler2->setFormatter($this->getIdentityFormatter()); + $handler2->handle($this->getRecord(Logger::DEBUG)); + $handler2->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-ChromeLogger-Data' => base64_encode(utf8_encode(json_encode(array( + 'version' => ChromePHPHandler::VERSION, + 'columns' => array('label', 'log', 'backtrace', 'type'), + 'rows' => array( + 'test', + 'test', + 'test', + 'test', + ), + 'request_uri' => '', + )))), + ); + + $this->assertEquals($expected, $handler2->getHeaders()); + } +} + +class TestChromePHPHandler extends ChromePHPHandler +{ + protected $headers = array(); + + public static function resetStatic() + { + self::$initialized = false; + self::$overflowed = false; + self::$sendHeaders = true; + self::$json['rows'] = array(); + } + + protected function sendHeader($header, $content) + { + $this->headers[$header] = $content; + } + + public function getHeaders() + { + return $this->headers; + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php new file mode 100644 index 0000000..9fc4b38 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/CouchDBHandlerTest.php @@ -0,0 +1,31 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class CouchDBHandlerTest extends TestCase +{ + public function testHandle() + { + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new CouchDBHandler(); + + try { + $handler->handle($record); + } catch (\RuntimeException $e) { + $this->markTestSkipped('Could not connect to couchdb server on http://localhost:5984'); + } + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DeduplicationHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DeduplicationHandlerTest.php new file mode 100644 index 0000000..e2aff86 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DeduplicationHandlerTest.php @@ -0,0 +1,165 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class DeduplicationHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\DeduplicationHandler::flush + */ + public function testFlushPassthruIfAllRecordsUnderTrigger() + { + $test = new TestHandler(); + @unlink(sys_get_temp_dir().'/monolog_dedup.log'); + $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0); + + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + + $handler->flush(); + + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\DeduplicationHandler::flush + * @covers Monolog\Handler\DeduplicationHandler::appendRecord + */ + public function testFlushPassthruIfEmptyLog() + { + $test = new TestHandler(); + @unlink(sys_get_temp_dir().'/monolog_dedup.log'); + $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0); + + $handler->handle($this->getRecord(Logger::ERROR, 'Foo:bar')); + $handler->handle($this->getRecord(Logger::CRITICAL, "Foo\nbar")); + + $handler->flush(); + + $this->assertTrue($test->hasErrorRecords()); + $this->assertTrue($test->hasCriticalRecords()); + $this->assertFalse($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\DeduplicationHandler::flush + * @covers Monolog\Handler\DeduplicationHandler::appendRecord + * @covers Monolog\Handler\DeduplicationHandler::isDuplicate + * @depends testFlushPassthruIfEmptyLog + */ + public function testFlushSkipsIfLogExists() + { + $test = new TestHandler(); + $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0); + + $handler->handle($this->getRecord(Logger::ERROR, 'Foo:bar')); + $handler->handle($this->getRecord(Logger::CRITICAL, "Foo\nbar")); + + $handler->flush(); + + $this->assertFalse($test->hasErrorRecords()); + $this->assertFalse($test->hasCriticalRecords()); + $this->assertFalse($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\DeduplicationHandler::flush + * @covers Monolog\Handler\DeduplicationHandler::appendRecord + * @covers Monolog\Handler\DeduplicationHandler::isDuplicate + * @depends testFlushPassthruIfEmptyLog + */ + public function testFlushPassthruIfLogTooOld() + { + $test = new TestHandler(); + $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0); + + $record = $this->getRecord(Logger::ERROR); + $record['datetime']->modify('+62seconds'); + $handler->handle($record); + $record = $this->getRecord(Logger::CRITICAL); + $record['datetime']->modify('+62seconds'); + $handler->handle($record); + + $handler->flush(); + + $this->assertTrue($test->hasErrorRecords()); + $this->assertTrue($test->hasCriticalRecords()); + $this->assertFalse($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\DeduplicationHandler::flush + * @covers Monolog\Handler\DeduplicationHandler::appendRecord + * @covers Monolog\Handler\DeduplicationHandler::isDuplicate + * @covers Monolog\Handler\DeduplicationHandler::collectLogs + */ + public function testGcOldLogs() + { + $test = new TestHandler(); + @unlink(sys_get_temp_dir().'/monolog_dedup.log'); + $handler = new DeduplicationHandler($test, sys_get_temp_dir().'/monolog_dedup.log', 0); + + // handle two records from yesterday, and one recent + $record = $this->getRecord(Logger::ERROR); + $record['datetime']->modify('-1day -10seconds'); + $handler->handle($record); + $record2 = $this->getRecord(Logger::CRITICAL); + $record2['datetime']->modify('-1day -10seconds'); + $handler->handle($record2); + $record3 = $this->getRecord(Logger::CRITICAL); + $record3['datetime']->modify('-30seconds'); + $handler->handle($record3); + + // log is written as none of them are duplicate + $handler->flush(); + $this->assertSame( + $record['datetime']->getTimestamp() . ":ERROR:test\n" . + $record2['datetime']->getTimestamp() . ":CRITICAL:test\n" . + $record3['datetime']->getTimestamp() . ":CRITICAL:test\n", + file_get_contents(sys_get_temp_dir() . '/monolog_dedup.log') + ); + $this->assertTrue($test->hasErrorRecords()); + $this->assertTrue($test->hasCriticalRecords()); + $this->assertFalse($test->hasWarningRecords()); + + // clear test handler + $test->clear(); + $this->assertFalse($test->hasErrorRecords()); + $this->assertFalse($test->hasCriticalRecords()); + + // log new records, duplicate log gets GC'd at the end of this flush call + $handler->handle($record = $this->getRecord(Logger::ERROR)); + $handler->handle($record2 = $this->getRecord(Logger::CRITICAL)); + $handler->flush(); + + // log should now contain the new errors and the previous one that was recent enough + $this->assertSame( + $record3['datetime']->getTimestamp() . ":CRITICAL:test\n" . + $record['datetime']->getTimestamp() . ":ERROR:test\n" . + $record2['datetime']->getTimestamp() . ":CRITICAL:test\n", + file_get_contents(sys_get_temp_dir() . '/monolog_dedup.log') + ); + $this->assertTrue($test->hasErrorRecords()); + $this->assertTrue($test->hasCriticalRecords()); + $this->assertFalse($test->hasWarningRecords()); + } + + public static function tearDownAfterClass() + { + @unlink(sys_get_temp_dir().'/monolog_dedup.log'); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php new file mode 100644 index 0000000..d67da90 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DoctrineCouchDBHandlerTest.php @@ -0,0 +1,52 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class DoctrineCouchDBHandlerTest extends TestCase +{ + protected function setup() + { + if (!class_exists('Doctrine\CouchDB\CouchDBClient')) { + $this->markTestSkipped('The "doctrine/couchdb" package is not installed'); + } + } + + public function testHandle() + { + $client = $this->getMockBuilder('Doctrine\\CouchDB\\CouchDBClient') + ->setMethods(array('postDocument')) + ->disableOriginalConstructor() + ->getMock(); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + 'message' => 'test', + 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), + 'extra' => array(), + ); + + $client->expects($this->once()) + ->method('postDocument') + ->with($expected); + + $handler = new DoctrineCouchDBHandler($client); + $handler->handle($record); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php new file mode 100644 index 0000000..2e6c348 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/DynamoDbHandlerTest.php @@ -0,0 +1,82 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +class DynamoDbHandlerTest extends TestCase +{ + private $client; + + public function setUp() + { + if (!class_exists('Aws\DynamoDb\DynamoDbClient')) { + $this->markTestSkipped('aws/aws-sdk-php not installed'); + } + + $this->client = $this->getMockBuilder('Aws\DynamoDb\DynamoDbClient') + ->setMethods(array('formatAttributes', '__call')) + ->disableOriginalConstructor()->getMock(); + } + + public function testConstruct() + { + $this->assertInstanceOf('Monolog\Handler\DynamoDbHandler', new DynamoDbHandler($this->client, 'foo')); + } + + public function testInterface() + { + $this->assertInstanceOf('Monolog\Handler\HandlerInterface', new DynamoDbHandler($this->client, 'foo')); + } + + public function testGetFormatter() + { + $handler = new DynamoDbHandler($this->client, 'foo'); + $this->assertInstanceOf('Monolog\Formatter\ScalarFormatter', $handler->getFormatter()); + } + + public function testHandle() + { + $record = $this->getRecord(); + $formatter = $this->getMock('Monolog\Formatter\FormatterInterface'); + $formatted = array('foo' => 1, 'bar' => 2); + $handler = new DynamoDbHandler($this->client, 'foo'); + $handler->setFormatter($formatter); + + $isV3 = defined('Aws\Sdk::VERSION') && version_compare(\Aws\Sdk::VERSION, '3.0', '>='); + if ($isV3) { + $expFormatted = array('foo' => array('N' => 1), 'bar' => array('N' => 2)); + } else { + $expFormatted = $formatted; + } + + $formatter + ->expects($this->once()) + ->method('format') + ->with($record) + ->will($this->returnValue($formatted)); + $this->client + ->expects($isV3 ? $this->never() : $this->once()) + ->method('formatAttributes') + ->with($this->isType('array')) + ->will($this->returnValue($formatted)); + $this->client + ->expects($this->once()) + ->method('__call') + ->with('putItem', array(array( + 'TableName' => 'foo', + 'Item' => $expFormatted, + ))); + + $handler->handle($record); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php new file mode 100644 index 0000000..1687074 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ElasticSearchHandlerTest.php @@ -0,0 +1,239 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\ElasticaFormatter; +use Monolog\Formatter\NormalizerFormatter; +use Monolog\TestCase; +use Monolog\Logger; +use Elastica\Client; +use Elastica\Request; +use Elastica\Response; + +class ElasticSearchHandlerTest extends TestCase +{ + /** + * @var Client mock + */ + protected $client; + + /** + * @var array Default handler options + */ + protected $options = array( + 'index' => 'my_index', + 'type' => 'doc_type', + ); + + public function setUp() + { + // Elastica lib required + if (!class_exists("Elastica\Client")) { + $this->markTestSkipped("ruflin/elastica not installed"); + } + + // base mock Elastica Client object + $this->client = $this->getMockBuilder('Elastica\Client') + ->setMethods(array('addDocuments')) + ->disableOriginalConstructor() + ->getMock(); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::write + * @covers Monolog\Handler\ElasticSearchHandler::handleBatch + * @covers Monolog\Handler\ElasticSearchHandler::bulkSend + * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter + */ + public function testHandle() + { + // log message + $msg = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + // format expected result + $formatter = new ElasticaFormatter($this->options['index'], $this->options['type']); + $expected = array($formatter->format($msg)); + + // setup ES client mock + $this->client->expects($this->any()) + ->method('addDocuments') + ->with($expected); + + // perform tests + $handler = new ElasticSearchHandler($this->client, $this->options); + $handler->handle($msg); + $handler->handleBatch(array($msg)); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::setFormatter + */ + public function testSetFormatter() + { + $handler = new ElasticSearchHandler($this->client); + $formatter = new ElasticaFormatter('index_new', 'type_new'); + $handler->setFormatter($formatter); + $this->assertInstanceOf('Monolog\Formatter\ElasticaFormatter', $handler->getFormatter()); + $this->assertEquals('index_new', $handler->getFormatter()->getIndex()); + $this->assertEquals('type_new', $handler->getFormatter()->getType()); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::setFormatter + * @expectedException InvalidArgumentException + * @expectedExceptionMessage ElasticSearchHandler is only compatible with ElasticaFormatter + */ + public function testSetFormatterInvalid() + { + $handler = new ElasticSearchHandler($this->client); + $formatter = new NormalizerFormatter(); + $handler->setFormatter($formatter); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::__construct + * @covers Monolog\Handler\ElasticSearchHandler::getOptions + */ + public function testOptions() + { + $expected = array( + 'index' => $this->options['index'], + 'type' => $this->options['type'], + 'ignore_error' => false, + ); + $handler = new ElasticSearchHandler($this->client, $this->options); + $this->assertEquals($expected, $handler->getOptions()); + } + + /** + * @covers Monolog\Handler\ElasticSearchHandler::bulkSend + * @dataProvider providerTestConnectionErrors + */ + public function testConnectionErrors($ignore, $expectedError) + { + $clientOpts = array('host' => '127.0.0.1', 'port' => 1); + $client = new Client($clientOpts); + $handlerOpts = array('ignore_error' => $ignore); + $handler = new ElasticSearchHandler($client, $handlerOpts); + + if ($expectedError) { + $this->setExpectedException($expectedError[0], $expectedError[1]); + $handler->handle($this->getRecord()); + } else { + $this->assertFalse($handler->handle($this->getRecord())); + } + } + + /** + * @return array + */ + public function providerTestConnectionErrors() + { + return array( + array(false, array('RuntimeException', 'Error sending messages to Elasticsearch')), + array(true, false), + ); + } + + /** + * Integration test using localhost Elastic Search server + * + * @covers Monolog\Handler\ElasticSearchHandler::__construct + * @covers Monolog\Handler\ElasticSearchHandler::handleBatch + * @covers Monolog\Handler\ElasticSearchHandler::bulkSend + * @covers Monolog\Handler\ElasticSearchHandler::getDefaultFormatter + */ + public function testHandleIntegration() + { + $msg = array( + 'level' => Logger::ERROR, + 'level_name' => 'ERROR', + 'channel' => 'meh', + 'context' => array('foo' => 7, 'bar', 'class' => new \stdClass), + 'datetime' => new \DateTime("@0"), + 'extra' => array(), + 'message' => 'log', + ); + + $expected = $msg; + $expected['datetime'] = $msg['datetime']->format(\DateTime::ISO8601); + $expected['context'] = array( + 'class' => '[object] (stdClass: {})', + 'foo' => 7, + 0 => 'bar', + ); + + $client = new Client(); + $handler = new ElasticSearchHandler($client, $this->options); + try { + $handler->handleBatch(array($msg)); + } catch (\RuntimeException $e) { + $this->markTestSkipped("Cannot connect to Elastic Search server on localhost"); + } + + // check document id from ES server response + $documentId = $this->getCreatedDocId($client->getLastResponse()); + $this->assertNotEmpty($documentId, 'No elastic document id received'); + + // retrieve document source from ES and validate + $document = $this->getDocSourceFromElastic( + $client, + $this->options['index'], + $this->options['type'], + $documentId + ); + $this->assertEquals($expected, $document); + + // remove test index from ES + $client->request("/{$this->options['index']}", Request::DELETE); + } + + /** + * Return last created document id from ES response + * @param Response $response Elastica Response object + * @return string|null + */ + protected function getCreatedDocId(Response $response) + { + $data = $response->getData(); + if (!empty($data['items'][0]['create']['_id'])) { + return $data['items'][0]['create']['_id']; + } + } + + /** + * Retrieve document by id from Elasticsearch + * @param Client $client Elastica client + * @param string $index + * @param string $type + * @param string $documentId + * @return array + */ + protected function getDocSourceFromElastic(Client $client, $index, $type, $documentId) + { + $resp = $client->request("/{$index}/{$type}/{$documentId}", Request::GET); + $data = $resp->getData(); + if (!empty($data['_source'])) { + return $data['_source']; + } + + return array(); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php new file mode 100644 index 0000000..99785cb --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ErrorLogHandlerTest.php @@ -0,0 +1,66 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +function error_log() +{ + $GLOBALS['error_log'][] = func_get_args(); +} + +class ErrorLogHandlerTest extends TestCase +{ + protected function setUp() + { + $GLOBALS['error_log'] = array(); + } + + /** + * @covers Monolog\Handler\ErrorLogHandler::__construct + * @expectedException InvalidArgumentException + * @expectedExceptionMessage The given message type "42" is not supported + */ + public function testShouldNotAcceptAnInvalidTypeOnContructor() + { + new ErrorLogHandler(42); + } + + /** + * @covers Monolog\Handler\ErrorLogHandler::write + */ + public function testShouldLogMessagesUsingErrorLogFuncion() + { + $type = ErrorLogHandler::OPERATING_SYSTEM; + $handler = new ErrorLogHandler($type); + $handler->setFormatter(new LineFormatter('%channel%.%level_name%: %message% %context% %extra%', null, true)); + $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); + + $this->assertSame("test.ERROR: Foo\nBar\r\n\r\nBaz [] []", $GLOBALS['error_log'][0][0]); + $this->assertSame($GLOBALS['error_log'][0][1], $type); + + $handler = new ErrorLogHandler($type, Logger::DEBUG, true, true); + $handler->setFormatter(new LineFormatter(null, null, true)); + $handler->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); + + $this->assertStringMatchesFormat('[%s] test.ERROR: Foo', $GLOBALS['error_log'][1][0]); + $this->assertSame($GLOBALS['error_log'][1][1], $type); + + $this->assertStringMatchesFormat('Bar', $GLOBALS['error_log'][2][0]); + $this->assertSame($GLOBALS['error_log'][2][1], $type); + + $this->assertStringMatchesFormat('Baz [] []', $GLOBALS['error_log'][3][0]); + $this->assertSame($GLOBALS['error_log'][3][1], $type); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php new file mode 100644 index 0000000..31b7686 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FilterHandlerTest.php @@ -0,0 +1,170 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\TestCase; + +class FilterHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\FilterHandler::isHandling + */ + public function testIsHandling() + { + $test = new TestHandler(); + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::INFO))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::NOTICE))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::WARNING))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::ERROR))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::CRITICAL))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::ALERT))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::EMERGENCY))); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + * @covers Monolog\Handler\FilterHandler::setAcceptedLevels + * @covers Monolog\Handler\FilterHandler::isHandling + */ + public function testHandleProcessOnlyNeededLevels() + { + $test = new TestHandler(); + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE); + + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::NOTICE)); + $this->assertTrue($test->hasNoticeRecords()); + + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertFalse($test->hasWarningRecords()); + $handler->handle($this->getRecord(Logger::ERROR)); + $this->assertFalse($test->hasErrorRecords()); + $handler->handle($this->getRecord(Logger::CRITICAL)); + $this->assertFalse($test->hasCriticalRecords()); + $handler->handle($this->getRecord(Logger::ALERT)); + $this->assertFalse($test->hasAlertRecords()); + $handler->handle($this->getRecord(Logger::EMERGENCY)); + $this->assertFalse($test->hasEmergencyRecords()); + + $test = new TestHandler(); + $handler = new FilterHandler($test, array(Logger::INFO, Logger::ERROR)); + + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::NOTICE)); + $this->assertFalse($test->hasNoticeRecords()); + $handler->handle($this->getRecord(Logger::ERROR)); + $this->assertTrue($test->hasErrorRecords()); + $handler->handle($this->getRecord(Logger::CRITICAL)); + $this->assertFalse($test->hasCriticalRecords()); + } + + /** + * @covers Monolog\Handler\FilterHandler::setAcceptedLevels + * @covers Monolog\Handler\FilterHandler::getAcceptedLevels + */ + public function testAcceptedLevelApi() + { + $test = new TestHandler(); + $handler = new FilterHandler($test); + + $levels = array(Logger::INFO, Logger::ERROR); + $handler->setAcceptedLevels($levels); + $this->assertSame($levels, $handler->getAcceptedLevels()); + + $handler->setAcceptedLevels(array('info', 'error')); + $this->assertSame($levels, $handler->getAcceptedLevels()); + + $levels = array(Logger::CRITICAL, Logger::ALERT, Logger::EMERGENCY); + $handler->setAcceptedLevels(Logger::CRITICAL, Logger::EMERGENCY); + $this->assertSame($levels, $handler->getAcceptedLevels()); + + $handler->setAcceptedLevels('critical', 'emergency'); + $this->assertSame($levels, $handler->getAcceptedLevels()); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new FilterHandler($test, Logger::DEBUG, Logger::EMERGENCY); + $handler->pushProcessor( + function ($record) { + $record['extra']['foo'] = true; + + return $record; + } + ); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + */ + public function testHandleRespectsBubble() + { + $test = new TestHandler(); + + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, false); + $this->assertTrue($handler->handle($this->getRecord(Logger::INFO))); + $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING))); + + $handler = new FilterHandler($test, Logger::INFO, Logger::NOTICE, true); + $this->assertFalse($handler->handle($this->getRecord(Logger::INFO))); + $this->assertFalse($handler->handle($this->getRecord(Logger::WARNING))); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + */ + public function testHandleWithCallback() + { + $test = new TestHandler(); + $handler = new FilterHandler( + function ($record, $handler) use ($test) { + return $test; + }, Logger::INFO, Logger::NOTICE, false + ); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FilterHandler::handle + * @expectedException \RuntimeException + */ + public function testHandleWithBadCallbackThrowsException() + { + $handler = new FilterHandler( + function ($record, $handler) { + return 'foo'; + } + ); + $handler->handle($this->getRecord(Logger::WARNING)); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php new file mode 100644 index 0000000..0ec3653 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FingersCrossedHandlerTest.php @@ -0,0 +1,279 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy; +use Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy; +use Psr\Log\LogLevel; + +class FingersCrossedHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::activate + */ + public function testHandleBuffers() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->close(); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 3); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::activate + */ + public function testHandleStopsBufferingAfterTrigger() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::activate + * @covers Monolog\Handler\FingersCrossedHandler::reset + */ + public function testHandleResetBufferingAfterReset() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->reset(); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::activate + */ + public function testHandleResetBufferingAfterBeingTriggeredWhenStopBufferingIsDisabled() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::WARNING, 0, false, false); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::activate + */ + public function testHandleBufferLimit() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::WARNING, 2); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertFalse($test->hasDebugRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::activate + */ + public function testHandleWithCallback() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler(function ($record, $handler) use ($test) { + return $test; + }); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertFalse($test->hasDebugRecords()); + $this->assertFalse($test->hasInfoRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 3); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::activate + * @expectedException RuntimeException + */ + public function testHandleWithBadCallbackThrowsException() + { + $handler = new FingersCrossedHandler(function ($record, $handler) { + return 'foo'; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::isHandling + */ + public function testIsHandlingAlways() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::ERROR); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated + */ + public function testErrorLevelActivationStrategy() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING)); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ErrorLevelActivationStrategy::isHandlerActivated + */ + public function testErrorLevelActivationStrategyWithPsrLevel() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning')); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::__construct + * @covers Monolog\Handler\FingersCrossedHandler::activate + */ + public function testOverrideActivationStrategy() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy('warning')); + $handler->handle($this->getRecord(Logger::DEBUG)); + $this->assertFalse($test->hasDebugRecords()); + $handler->activate(); + $this->assertTrue($test->hasDebugRecords()); + $handler->handle($this->getRecord(Logger::INFO)); + $this->assertTrue($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated + */ + public function testChannelLevelActivationStrategy() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy(Logger::ERROR, array('othertest' => Logger::DEBUG))); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertFalse($test->hasWarningRecords()); + $record = $this->getRecord(Logger::DEBUG); + $record['channel'] = 'othertest'; + $handler->handle($record); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::__construct + * @covers Monolog\Handler\FingersCrossed\ChannelLevelActivationStrategy::isHandlerActivated + */ + public function testChannelLevelActivationStrategyWithPsrLevels() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ChannelLevelActivationStrategy('error', array('othertest' => 'debug'))); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertFalse($test->hasWarningRecords()); + $record = $this->getRecord(Logger::DEBUG); + $record['channel'] = 'othertest'; + $handler->handle($record); + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasWarningRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::handle + * @covers Monolog\Handler\FingersCrossedHandler::activate + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, Logger::INFO); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::close + */ + public function testPassthruOnClose() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, Logger::INFO); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertFalse($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + } + + /** + * @covers Monolog\Handler\FingersCrossedHandler::close + */ + public function testPsrLevelPassthruOnClose() + { + $test = new TestHandler(); + $handler = new FingersCrossedHandler($test, new ErrorLevelActivationStrategy(Logger::WARNING), 0, true, true, LogLevel::INFO); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + $handler->close(); + $this->assertFalse($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php new file mode 100644 index 0000000..7a404e6 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FirePHPHandlerTest.php @@ -0,0 +1,96 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\FirePHPHandler + */ +class FirePHPHandlerTest extends TestCase +{ + public function setUp() + { + TestFirePHPHandler::resetStatic(); + $_SERVER['HTTP_USER_AGENT'] = 'Monolog Test; FirePHP/1.0'; + } + + public function testHeaders() + { + $handler = new TestFirePHPHandler; + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2', + 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1', + 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3', + 'X-Wf-1-1-1-1' => 'test', + 'X-Wf-1-1-1-2' => 'test', + ); + + $this->assertEquals($expected, $handler->getHeaders()); + } + + public function testConcurrentHandlers() + { + $handler = new TestFirePHPHandler; + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::WARNING)); + + $handler2 = new TestFirePHPHandler; + $handler2->setFormatter($this->getIdentityFormatter()); + $handler2->handle($this->getRecord(Logger::DEBUG)); + $handler2->handle($this->getRecord(Logger::WARNING)); + + $expected = array( + 'X-Wf-Protocol-1' => 'http://meta.wildfirehq.org/Protocol/JsonStream/0.2', + 'X-Wf-1-Structure-1' => 'http://meta.firephp.org/Wildfire/Structure/FirePHP/FirebugConsole/0.1', + 'X-Wf-1-Plugin-1' => 'http://meta.firephp.org/Wildfire/Plugin/FirePHP/Library-FirePHPCore/0.3', + 'X-Wf-1-1-1-1' => 'test', + 'X-Wf-1-1-1-2' => 'test', + ); + + $expected2 = array( + 'X-Wf-1-1-1-3' => 'test', + 'X-Wf-1-1-1-4' => 'test', + ); + + $this->assertEquals($expected, $handler->getHeaders()); + $this->assertEquals($expected2, $handler2->getHeaders()); + } +} + +class TestFirePHPHandler extends FirePHPHandler +{ + protected $headers = array(); + + public static function resetStatic() + { + self::$initialized = false; + self::$sendHeaders = true; + self::$messageIndex = 1; + } + + protected function sendHeader($header, $content) + { + $this->headers[$header] = $content; + } + + public function getHeaders() + { + return $this->headers; + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/Fixtures/.gitkeep b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/Fixtures/.gitkeep new file mode 100644 index 0000000..e69de29 diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php new file mode 100644 index 0000000..91cdd31 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FleepHookHandlerTest.php @@ -0,0 +1,85 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\LineFormatter; +use Monolog\Logger; +use Monolog\TestCase; + +/** + * @coversDefaultClass \Monolog\Handler\FleepHookHandler + */ +class FleepHookHandlerTest extends TestCase +{ + /** + * Default token to use in tests + */ + const TOKEN = '123abc'; + + /** + * @var FleepHookHandler + */ + private $handler; + + public function setUp() + { + parent::setUp(); + + if (!extension_loaded('openssl')) { + $this->markTestSkipped('This test requires openssl extension to run'); + } + + // Create instances of the handler and logger for convenience + $this->handler = new FleepHookHandler(self::TOKEN); + } + + /** + * @covers ::__construct + */ + public function testConstructorSetsExpectedDefaults() + { + $this->assertEquals(Logger::DEBUG, $this->handler->getLevel()); + $this->assertEquals(true, $this->handler->getBubble()); + } + + /** + * @covers ::getDefaultFormatter + */ + public function testHandlerUsesLineFormatterWhichIgnoresEmptyArrays() + { + $record = array( + 'message' => 'msg', + 'context' => array(), + 'level' => Logger::DEBUG, + 'level_name' => Logger::getLevelName(Logger::DEBUG), + 'channel' => 'channel', + 'datetime' => new \DateTime(), + 'extra' => array(), + ); + + $expectedFormatter = new LineFormatter(null, null, true, true); + $expected = $expectedFormatter->format($record); + + $handlerFormatter = $this->handler->getFormatter(); + $actual = $handlerFormatter->format($record); + + $this->assertEquals($expected, $actual, 'Empty context and extra arrays should not be rendered'); + } + + /** + * @covers ::__construct + */ + public function testConnectionStringisConstructedCorrectly() + { + $this->assertEquals('ssl://' . FleepHookHandler::FLEEP_HOST . ':443', $this->handler->getConnectionString()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php new file mode 100644 index 0000000..4b120d5 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/FlowdockHandlerTest.php @@ -0,0 +1,88 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\FlowdockFormatter; +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Dominik Liebler + * @see https://www.hipchat.com/docs/api + */ +class FlowdockHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $res; + + /** + * @var FlowdockHandler + */ + private $handler; + + public function setUp() + { + if (!extension_loaded('openssl')) { + $this->markTestSkipped('This test requires openssl to run'); + } + } + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v1\/messages\/team_inbox\/.* HTTP\/1.1\\r\\nHost: api.flowdock.com\\r\\nContent-Type: application\/json\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + /** + * @depends testWriteHeader + */ + public function testWriteContent($content) + { + $this->assertRegexp('/"source":"test_source"/', $content); + $this->assertRegexp('/"from_address":"source@test\.com"/', $content); + } + + private function createHandler($token = 'myToken') + { + $constructorArgs = array($token, Logger::DEBUG); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\FlowdockHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter(new FlowdockFormatter('test_source', 'source@test.com')); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php new file mode 100644 index 0000000..9d007b1 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerLegacyTest.php @@ -0,0 +1,95 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Gelf\Message; +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\GelfMessageFormatter; + +class GelfHandlerLegacyTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Gelf\MessagePublisher') || !class_exists('Gelf\Message')) { + $this->markTestSkipped("mlehner/gelf-php not installed"); + } + + require_once __DIR__ . '/GelfMockMessagePublisher.php'; + } + + /** + * @covers Monolog\Handler\GelfHandler::__construct + */ + public function testConstruct() + { + $handler = new GelfHandler($this->getMessagePublisher()); + $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler); + } + + protected function getHandler($messagePublisher) + { + $handler = new GelfHandler($messagePublisher); + + return $handler; + } + + protected function getMessagePublisher() + { + return new GelfMockMessagePublisher('localhost'); + } + + public function testDebug() + { + $messagePublisher = $this->getMessagePublisher(); + $handler = $this->getHandler($messagePublisher); + + $record = $this->getRecord(Logger::DEBUG, "A test debug message"); + $handler->handle($record); + + $this->assertEquals(7, $messagePublisher->lastMessage->getLevel()); + $this->assertEquals('test', $messagePublisher->lastMessage->getFacility()); + $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage()); + $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage()); + } + + public function testWarning() + { + $messagePublisher = $this->getMessagePublisher(); + $handler = $this->getHandler($messagePublisher); + + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $handler->handle($record); + + $this->assertEquals(4, $messagePublisher->lastMessage->getLevel()); + $this->assertEquals('test', $messagePublisher->lastMessage->getFacility()); + $this->assertEquals($record['message'], $messagePublisher->lastMessage->getShortMessage()); + $this->assertEquals(null, $messagePublisher->lastMessage->getFullMessage()); + } + + public function testInjectedGelfMessageFormatter() + { + $messagePublisher = $this->getMessagePublisher(); + $handler = $this->getHandler($messagePublisher); + + $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX')); + + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $record['extra']['blarg'] = 'yep'; + $record['context']['from'] = 'logger'; + $handler->handle($record); + + $this->assertEquals('mysystem', $messagePublisher->lastMessage->getHost()); + $this->assertArrayHasKey('_EXTblarg', $messagePublisher->lastMessage->toArray()); + $this->assertArrayHasKey('_CTXfrom', $messagePublisher->lastMessage->toArray()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php new file mode 100644 index 0000000..8cdd64f --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfHandlerTest.php @@ -0,0 +1,117 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Gelf\Message; +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\GelfMessageFormatter; + +class GelfHandlerTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Gelf\Publisher') || !class_exists('Gelf\Message')) { + $this->markTestSkipped("graylog2/gelf-php not installed"); + } + } + + /** + * @covers Monolog\Handler\GelfHandler::__construct + */ + public function testConstruct() + { + $handler = new GelfHandler($this->getMessagePublisher()); + $this->assertInstanceOf('Monolog\Handler\GelfHandler', $handler); + } + + protected function getHandler($messagePublisher) + { + $handler = new GelfHandler($messagePublisher); + + return $handler; + } + + protected function getMessagePublisher() + { + return $this->getMock('Gelf\Publisher', array('publish'), array(), '', false); + } + + public function testDebug() + { + $record = $this->getRecord(Logger::DEBUG, "A test debug message"); + $expectedMessage = new Message(); + $expectedMessage + ->setLevel(7) + ->setFacility("test") + ->setShortMessage($record['message']) + ->setTimestamp($record['datetime']) + ; + + $messagePublisher = $this->getMessagePublisher(); + $messagePublisher->expects($this->once()) + ->method('publish') + ->with($expectedMessage); + + $handler = $this->getHandler($messagePublisher); + + $handler->handle($record); + } + + public function testWarning() + { + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $expectedMessage = new Message(); + $expectedMessage + ->setLevel(4) + ->setFacility("test") + ->setShortMessage($record['message']) + ->setTimestamp($record['datetime']) + ; + + $messagePublisher = $this->getMessagePublisher(); + $messagePublisher->expects($this->once()) + ->method('publish') + ->with($expectedMessage); + + $handler = $this->getHandler($messagePublisher); + + $handler->handle($record); + } + + public function testInjectedGelfMessageFormatter() + { + $record = $this->getRecord(Logger::WARNING, "A test warning message"); + $record['extra']['blarg'] = 'yep'; + $record['context']['from'] = 'logger'; + + $expectedMessage = new Message(); + $expectedMessage + ->setLevel(4) + ->setFacility("test") + ->setHost("mysystem") + ->setShortMessage($record['message']) + ->setTimestamp($record['datetime']) + ->setAdditional("EXTblarg", 'yep') + ->setAdditional("CTXfrom", 'logger') + ; + + $messagePublisher = $this->getMessagePublisher(); + $messagePublisher->expects($this->once()) + ->method('publish') + ->with($expectedMessage); + + $handler = $this->getHandler($messagePublisher); + $handler->setFormatter(new GelfMessageFormatter('mysystem', 'EXT', 'CTX')); + $handler->handle($record); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php new file mode 100644 index 0000000..873d92f --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GelfMockMessagePublisher.php @@ -0,0 +1,25 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Gelf\MessagePublisher; +use Gelf\Message; + +class GelfMockMessagePublisher extends MessagePublisher +{ + public function publish(Message $message) + { + $this->lastMessage = $message; + } + + public $lastMessage = null; +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php new file mode 100644 index 0000000..a1b8617 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/GroupHandlerTest.php @@ -0,0 +1,112 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class GroupHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\GroupHandler::__construct + * @expectedException InvalidArgumentException + */ + public function testConstructorOnlyTakesHandler() + { + new GroupHandler(array(new TestHandler(), "foo")); + } + + /** + * @covers Monolog\Handler\GroupHandler::__construct + * @covers Monolog\Handler\GroupHandler::handle + */ + public function testHandle() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new GroupHandler($testHandlers); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\GroupHandler::handleBatch + */ + public function testHandleBatch() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new GroupHandler($testHandlers); + $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\GroupHandler::isHandling + */ + public function testIsHandling() + { + $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING)); + $handler = new GroupHandler($testHandlers); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\GroupHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new GroupHandler(array($test)); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\GroupHandler::handle + */ + public function testHandleBatchUsesProcessors() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new GroupHandler($testHandlers); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + $this->assertTrue($records[1]['extra']['foo']); + } + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/HandlerWrapperTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/HandlerWrapperTest.php new file mode 100644 index 0000000..d8d0452 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/HandlerWrapperTest.php @@ -0,0 +1,130 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +/** + * @author Alexey Karapetov + */ +class HandlerWrapperTest extends TestCase +{ + /** + * @var HandlerWrapper + */ + private $wrapper; + + private $handler; + + public function setUp() + { + parent::setUp(); + $this->handler = $this->getMock('Monolog\\Handler\\HandlerInterface'); + $this->wrapper = new HandlerWrapper($this->handler); + } + + /** + * @return array + */ + public function trueFalseDataProvider() + { + return array( + array(true), + array(false), + ); + } + + /** + * @param $result + * @dataProvider trueFalseDataProvider + */ + public function testIsHandling($result) + { + $record = $this->getRecord(); + $this->handler->expects($this->once()) + ->method('isHandling') + ->with($record) + ->willReturn($result); + + $this->assertEquals($result, $this->wrapper->isHandling($record)); + } + + /** + * @param $result + * @dataProvider trueFalseDataProvider + */ + public function testHandle($result) + { + $record = $this->getRecord(); + $this->handler->expects($this->once()) + ->method('handle') + ->with($record) + ->willReturn($result); + + $this->assertEquals($result, $this->wrapper->handle($record)); + } + + /** + * @param $result + * @dataProvider trueFalseDataProvider + */ + public function testHandleBatch($result) + { + $records = $this->getMultipleRecords(); + $this->handler->expects($this->once()) + ->method('handleBatch') + ->with($records) + ->willReturn($result); + + $this->assertEquals($result, $this->wrapper->handleBatch($records)); + } + + public function testPushProcessor() + { + $processor = function () {}; + $this->handler->expects($this->once()) + ->method('pushProcessor') + ->with($processor); + + $this->assertEquals($this->wrapper, $this->wrapper->pushProcessor($processor)); + } + + public function testPopProcessor() + { + $processor = function () {}; + $this->handler->expects($this->once()) + ->method('popProcessor') + ->willReturn($processor); + + $this->assertEquals($processor, $this->wrapper->popProcessor()); + } + + public function testSetFormatter() + { + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $this->handler->expects($this->once()) + ->method('setFormatter') + ->with($formatter); + + $this->assertEquals($this->wrapper, $this->wrapper->setFormatter($formatter)); + } + + public function testGetFormatter() + { + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $this->handler->expects($this->once()) + ->method('getFormatter') + ->willReturn($formatter); + + $this->assertEquals($formatter, $this->wrapper->getFormatter()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php new file mode 100644 index 0000000..52dc9da --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/HipChatHandlerTest.php @@ -0,0 +1,279 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Rafael Dohms + * @see https://www.hipchat.com/docs/api + */ +class HipChatHandlerTest extends TestCase +{ + private $res; + /** @var HipChatHandler */ + private $handler; + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: api.hipchat.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + public function testWriteCustomHostHeader() + { + $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v1\/rooms\/message\?format=json&auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + public function testWriteV2() + { + $this->createHandler('myToken', 'room1', 'Monolog', false, 'hipchat.foo.bar', 'v2'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + public function testWriteV2Notify() + { + $this->createHandler('myToken', 'room1', 'Monolog', true, 'hipchat.foo.bar', 'v2'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v2\/room\/room1\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + public function testRoomSpaces() + { + $this->createHandler('myToken', 'room name', 'Monolog', false, 'hipchat.foo.bar', 'v2'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/v2\/room\/room%20name\/notification\?auth_token=.* HTTP\/1.1\\r\\nHost: hipchat.foo.bar\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + /** + * @depends testWriteHeader + */ + public function testWriteContent($content) + { + $this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content); + } + + public function testWriteContentV1WithoutName() + { + $this->createHandler('myToken', 'room1', null, false, 'hipchat.foo.bar', 'v1'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/notify=0&message=test1&message_format=text&color=red&room_id=room1&from=$/', $content); + + return $content; + } + + /** + * @depends testWriteCustomHostHeader + */ + public function testWriteContentNotify($content) + { + $this->assertRegexp('/notify=1&message=test1&message_format=text&color=red&room_id=room1&from=Monolog$/', $content); + } + + /** + * @depends testWriteV2 + */ + public function testWriteContentV2($content) + { + $this->assertRegexp('/notify=false&message=test1&message_format=text&color=red&from=Monolog$/', $content); + } + + /** + * @depends testWriteV2Notify + */ + public function testWriteContentV2Notify($content) + { + $this->assertRegexp('/notify=true&message=test1&message_format=text&color=red&from=Monolog$/', $content); + } + + public function testWriteContentV2WithoutName() + { + $this->createHandler('myToken', 'room1', null, false, 'hipchat.foo.bar', 'v2'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/notify=false&message=test1&message_format=text&color=red$/', $content); + + return $content; + } + + public function testWriteWithComplexMessage() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content); + } + + public function testWriteTruncatesLongMessage() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, str_repeat('abcde', 2000))); + fseek($this->res, 0); + $content = fread($this->res, 12000); + + $this->assertRegexp('/message='.str_repeat('abcde', 1900).'\+%5Btruncated%5D/', $content); + } + + /** + * @dataProvider provideLevelColors + */ + public function testWriteWithErrorLevelsAndColors($level, $expectedColor) + { + $this->createHandler(); + $this->handler->handle($this->getRecord($level, 'Backup of database "example" finished in 16 minutes.')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/color='.$expectedColor.'/', $content); + } + + public function provideLevelColors() + { + return array( + array(Logger::DEBUG, 'gray'), + array(Logger::INFO, 'green'), + array(Logger::WARNING, 'yellow'), + array(Logger::ERROR, 'red'), + array(Logger::CRITICAL, 'red'), + array(Logger::ALERT, 'red'), + array(Logger::EMERGENCY,'red'), + array(Logger::NOTICE, 'green'), + ); + } + + /** + * @dataProvider provideBatchRecords + */ + public function testHandleBatch($records, $expectedColor) + { + $this->createHandler(); + + $this->handler->handleBatch($records); + + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/color='.$expectedColor.'/', $content); + } + + public function provideBatchRecords() + { + return array( + array( + array( + array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()), + array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), + array('level' => Logger::CRITICAL, 'message' => 'Everything is broken!', 'level_name' => 'critical', 'datetime' => new \DateTime()), + ), + 'red', + ), + array( + array( + array('level' => Logger::WARNING, 'message' => 'Oh bugger!', 'level_name' => 'warning', 'datetime' => new \DateTime()), + array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), + ), + 'yellow', + ), + array( + array( + array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()), + array('level' => Logger::NOTICE, 'message' => 'Something noticeable happened.', 'level_name' => 'notice', 'datetime' => new \DateTime()), + ), + 'green', + ), + array( + array( + array('level' => Logger::DEBUG, 'message' => 'Just debugging.', 'level_name' => 'debug', 'datetime' => new \DateTime()), + ), + 'gray', + ), + ); + } + + private function createHandler($token = 'myToken', $room = 'room1', $name = 'Monolog', $notify = false, $host = 'api.hipchat.com', $version = 'v1') + { + $constructorArgs = array($token, $room, $name, $notify, Logger::DEBUG, true, true, 'text', $host, $version); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\HipChatHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter($this->getIdentityFormatter()); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testCreateWithTooLongName() + { + $hipChatHandler = new HipChatHandler('token', 'room', 'SixteenCharsHere'); + } + + public function testCreateWithTooLongNameV2() + { + // creating a handler with too long of a name but using the v2 api doesn't matter. + $hipChatHandler = new HipChatHandler('token', 'room', 'SixteenCharsHere', false, Logger::CRITICAL, true, true, 'test', 'api.hipchat.com', 'v2'); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/InsightOpsHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/InsightOpsHandlerTest.php new file mode 100644 index 0000000..97c18b5 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/InsightOpsHandlerTest.php @@ -0,0 +1,80 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + + namespace Monolog\Handler; + + use Monolog\TestCase; + use Monolog\Logger; + +/** + * @author Robert Kaufmann III + * @author Gabriel Machado + */ +class InsightOpsHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $resource; + + /** + * @var LogEntriesHandler + */ + private $handler; + + public function testWriteContent() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test')); + + fseek($this->resource, 0); + $content = fread($this->resource, 1024); + + $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content); + } + + public function testWriteBatchContent() + { + $this->createHandler(); + $this->handler->handleBatch($this->getMultipleRecords()); + + fseek($this->resource, 0); + $content = fread($this->resource, 1024); + + $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content); + } + + private function createHandler() + { + $useSSL = extension_loaded('openssl'); + $args = array('testToken', 'us', $useSSL, Logger::DEBUG, true); + $this->resource = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\InsightOpsHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $args + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->resource)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php new file mode 100644 index 0000000..b2deb40 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/LogEntriesHandlerTest.php @@ -0,0 +1,84 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Robert Kaufmann III + */ +class LogEntriesHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $res; + + /** + * @var LogEntriesHandler + */ + private $handler; + + public function testWriteContent() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Critical write test')); + + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] test.CRITICAL: Critical write test/', $content); + } + + public function testWriteBatchContent() + { + $records = array( + $this->getRecord(), + $this->getRecord(), + $this->getRecord(), + ); + $this->createHandler(); + $this->handler->handleBatch($records); + + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/(testToken \[\d{4}-\d{2}-\d{2} \d{2}:\d{2}:\d{2}\] .* \[\] \[\]\n){3}/', $content); + } + + private function createHandler() + { + $useSSL = extension_loaded('openssl'); + $args = array('testToken', $useSSL, Logger::DEBUG, true); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\LogEntriesHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $args + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php new file mode 100644 index 0000000..6754f3d --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MailHandlerTest.php @@ -0,0 +1,75 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\TestCase; + +class MailHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\MailHandler::handleBatch + */ + public function testHandleBatch() + { + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->once()) + ->method('formatBatch'); // Each record is formatted + + $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); + $handler->expects($this->once()) + ->method('send'); + $handler->expects($this->never()) + ->method('write'); // write is for individual records + + $handler->setFormatter($formatter); + + $handler->handleBatch($this->getMultipleRecords()); + } + + /** + * @covers Monolog\Handler\MailHandler::handleBatch + */ + public function testHandleBatchNotSendsMailIfMessagesAreBelowLevel() + { + $records = array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information'), + ); + + $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); + $handler->expects($this->never()) + ->method('send'); + $handler->setLevel(Logger::ERROR); + + $handler->handleBatch($records); + } + + /** + * @covers Monolog\Handler\MailHandler::write + */ + public function testHandle() + { + $handler = $this->getMockForAbstractClass('Monolog\\Handler\\MailHandler'); + + $record = $this->getRecord(); + $records = array($record); + $records[0]['formatted'] = '['.$record['datetime']->format('Y-m-d H:i:s').'] test.WARNING: test [] []'."\n"; + + $handler->expects($this->once()) + ->method('send') + ->with($records[0]['formatted'], $records); + + $handler->handle($record); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php new file mode 100644 index 0000000..a083322 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MockRavenClient.php @@ -0,0 +1,27 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Raven_Client; + +class MockRavenClient extends Raven_Client +{ + public function capture($data, $stack, $vars = null) + { + $data = array_merge($this->get_user_data(), $data); + $this->lastData = $data; + $this->lastStack = $stack; + } + + public $lastData; + public $lastStack; +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php new file mode 100644 index 0000000..0fdef63 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/MongoDBHandlerTest.php @@ -0,0 +1,65 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class MongoDBHandlerTest extends TestCase +{ + /** + * @expectedException InvalidArgumentException + */ + public function testConstructorShouldThrowExceptionForInvalidMongo() + { + new MongoDBHandler(new \stdClass(), 'DB', 'Collection'); + } + + public function testHandle() + { + $mongo = $this->getMock('Mongo', array('selectCollection'), array(), '', false); + $collection = $this->getMock('stdClass', array('save')); + + $mongo->expects($this->once()) + ->method('selectCollection') + ->with('DB', 'Collection') + ->will($this->returnValue($collection)); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $expected = array( + 'message' => 'test', + 'context' => array('data' => '[object] (stdClass: {})', 'foo' => 34), + 'level' => Logger::WARNING, + 'level_name' => 'WARNING', + 'channel' => 'test', + 'datetime' => $record['datetime']->format('Y-m-d H:i:s'), + 'extra' => array(), + ); + + $collection->expects($this->once()) + ->method('save') + ->with($expected); + + $handler = new MongoDBHandler($mongo, 'DB', 'Collection'); + $handler->handle($record); + } +} + +if (!class_exists('Mongo')) { + class Mongo + { + public function selectCollection() + { + } + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php new file mode 100644 index 0000000..ddf545d --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NativeMailerHandlerTest.php @@ -0,0 +1,111 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use InvalidArgumentException; + +function mail($to, $subject, $message, $additional_headers = null, $additional_parameters = null) +{ + $GLOBALS['mail'][] = func_get_args(); +} + +class NativeMailerHandlerTest extends TestCase +{ + protected function setUp() + { + $GLOBALS['mail'] = array(); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testConstructorHeaderInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', "receiver@example.org\r\nFrom: faked@attacker.org"); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterHeaderInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->addHeader("Content-Type: text/html\r\nFrom: faked@attacker.org"); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterArrayHeaderInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->addHeader(array("Content-Type: text/html\r\nFrom: faked@attacker.org")); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterContentTypeInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->setContentType("text/html\r\nFrom: faked@attacker.org"); + } + + /** + * @expectedException InvalidArgumentException + */ + public function testSetterEncodingInjection() + { + $mailer = new NativeMailerHandler('spammer@example.org', 'dear victim', 'receiver@example.org'); + $mailer->setEncoding("utf-8\r\nFrom: faked@attacker.org"); + } + + public function testSend() + { + $to = 'spammer@example.org'; + $subject = 'dear victim'; + $from = 'receiver@example.org'; + + $mailer = new NativeMailerHandler($to, $subject, $from); + $mailer->handleBatch(array()); + + // batch is empty, nothing sent + $this->assertEmpty($GLOBALS['mail']); + + // non-empty batch + $mailer->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); + $this->assertNotEmpty($GLOBALS['mail']); + $this->assertInternalType('array', $GLOBALS['mail']); + $this->assertArrayHasKey('0', $GLOBALS['mail']); + $params = $GLOBALS['mail'][0]; + $this->assertCount(5, $params); + $this->assertSame($to, $params[0]); + $this->assertSame($subject, $params[1]); + $this->assertStringEndsWith(" test.ERROR: Foo Bar Baz [] []\n", $params[2]); + $this->assertSame("From: $from\r\nContent-type: text/plain; charset=utf-8\r\n", $params[3]); + $this->assertSame('', $params[4]); + } + + public function testMessageSubjectFormatting() + { + $mailer = new NativeMailerHandler('to@example.org', 'Alert: %level_name% %message%', 'from@example.org'); + $mailer->handle($this->getRecord(Logger::ERROR, "Foo\nBar\r\n\r\nBaz")); + $this->assertNotEmpty($GLOBALS['mail']); + $this->assertInternalType('array', $GLOBALS['mail']); + $this->assertArrayHasKey('0', $GLOBALS['mail']); + $params = $GLOBALS['mail'][0]; + $this->assertCount(5, $params); + $this->assertSame('Alert: ERROR Foo Bar Baz', $params[1]); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php new file mode 100644 index 0000000..4d3a615 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NewRelicHandlerTest.php @@ -0,0 +1,200 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Formatter\LineFormatter; +use Monolog\TestCase; +use Monolog\Logger; + +class NewRelicHandlerTest extends TestCase +{ + public static $appname; + public static $customParameters; + public static $transactionName; + + public function setUp() + { + self::$appname = null; + self::$customParameters = array(); + self::$transactionName = null; + } + + /** + * @expectedException Monolog\Handler\MissingExtensionException + */ + public function testThehandlerThrowsAnExceptionIfTheNRExtensionIsNotLoaded() + { + $handler = new StubNewRelicHandlerWithoutExtension(); + $handler->handle($this->getRecord(Logger::ERROR)); + } + + public function testThehandlerCanHandleTheRecord() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR)); + } + + public function testThehandlerCanAddContextParamsToTheNewRelicTrace() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('a' => 'b'))); + $this->assertEquals(array('context_a' => 'b'), self::$customParameters); + } + + public function testThehandlerCanAddExplodedContextParamsToTheNewRelicTrace() + { + $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true); + $handler->handle($this->getRecord( + Logger::ERROR, + 'log message', + array('a' => array('key1' => 'value1', 'key2' => 'value2')) + )); + $this->assertEquals( + array('context_a_key1' => 'value1', 'context_a_key2' => 'value2'), + self::$customParameters + ); + } + + public function testThehandlerCanAddExtraParamsToTheNewRelicTrace() + { + $record = $this->getRecord(Logger::ERROR, 'log message'); + $record['extra'] = array('c' => 'd'); + + $handler = new StubNewRelicHandler(); + $handler->handle($record); + + $this->assertEquals(array('extra_c' => 'd'), self::$customParameters); + } + + public function testThehandlerCanAddExplodedExtraParamsToTheNewRelicTrace() + { + $record = $this->getRecord(Logger::ERROR, 'log message'); + $record['extra'] = array('c' => array('key1' => 'value1', 'key2' => 'value2')); + + $handler = new StubNewRelicHandler(Logger::ERROR, true, self::$appname, true); + $handler->handle($record); + + $this->assertEquals( + array('extra_c_key1' => 'value1', 'extra_c_key2' => 'value2'), + self::$customParameters + ); + } + + public function testThehandlerCanAddExtraContextAndParamsToTheNewRelicTrace() + { + $record = $this->getRecord(Logger::ERROR, 'log message', array('a' => 'b')); + $record['extra'] = array('c' => 'd'); + + $handler = new StubNewRelicHandler(); + $handler->handle($record); + + $expected = array( + 'context_a' => 'b', + 'extra_c' => 'd', + ); + + $this->assertEquals($expected, self::$customParameters); + } + + public function testThehandlerCanHandleTheRecordsFormattedUsingTheLineFormatter() + { + $handler = new StubNewRelicHandler(); + $handler->setFormatter(new LineFormatter()); + $handler->handle($this->getRecord(Logger::ERROR)); + } + + public function testTheAppNameIsNullByDefault() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals(null, self::$appname); + } + + public function testTheAppNameCanBeInjectedFromtheConstructor() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals('myAppName', self::$appname); + } + + public function testTheAppNameCanBeOverriddenFromEachLog() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, 'myAppName'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('appname' => 'logAppName'))); + + $this->assertEquals('logAppName', self::$appname); + } + + public function testTheTransactionNameIsNullByDefault() + { + $handler = new StubNewRelicHandler(); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals(null, self::$transactionName); + } + + public function testTheTransactionNameCanBeInjectedFromTheConstructor() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message')); + + $this->assertEquals('myTransaction', self::$transactionName); + } + + public function testTheTransactionNameCanBeOverriddenFromEachLog() + { + $handler = new StubNewRelicHandler(Logger::DEBUG, false, null, false, 'myTransaction'); + $handler->handle($this->getRecord(Logger::ERROR, 'log message', array('transaction_name' => 'logTransactName'))); + + $this->assertEquals('logTransactName', self::$transactionName); + } +} + +class StubNewRelicHandlerWithoutExtension extends NewRelicHandler +{ + protected function isNewRelicEnabled() + { + return false; + } +} + +class StubNewRelicHandler extends NewRelicHandler +{ + protected function isNewRelicEnabled() + { + return true; + } +} + +function newrelic_notice_error() +{ + return true; +} + +function newrelic_set_appname($appname) +{ + return NewRelicHandlerTest::$appname = $appname; +} + +function newrelic_name_transaction($transactionName) +{ + return NewRelicHandlerTest::$transactionName = $transactionName; +} + +function newrelic_add_custom_parameter($key, $value) +{ + NewRelicHandlerTest::$customParameters[$key] = $value; + + return true; +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php new file mode 100644 index 0000000..292df78 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/NullHandlerTest.php @@ -0,0 +1,33 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\NullHandler::handle + */ +class NullHandlerTest extends TestCase +{ + public function testHandle() + { + $handler = new NullHandler(); + $this->assertTrue($handler->handle($this->getRecord())); + } + + public function testHandleLowerLevelRecord() + { + $handler = new NullHandler(Logger::WARNING); + $this->assertFalse($handler->handle($this->getRecord(Logger::DEBUG))); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php new file mode 100644 index 0000000..152573e --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PHPConsoleHandlerTest.php @@ -0,0 +1,273 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Exception; +use Monolog\ErrorHandler; +use Monolog\Logger; +use Monolog\TestCase; +use PhpConsole\Connector; +use PhpConsole\Dispatcher\Debug as DebugDispatcher; +use PhpConsole\Dispatcher\Errors as ErrorDispatcher; +use PhpConsole\Handler; +use PHPUnit_Framework_MockObject_MockObject; + +/** + * @covers Monolog\Handler\PHPConsoleHandler + * @author Sergey Barbushin https://www.linkedin.com/in/barbushin + */ +class PHPConsoleHandlerTest extends TestCase +{ + /** @var Connector|PHPUnit_Framework_MockObject_MockObject */ + protected $connector; + /** @var DebugDispatcher|PHPUnit_Framework_MockObject_MockObject */ + protected $debugDispatcher; + /** @var ErrorDispatcher|PHPUnit_Framework_MockObject_MockObject */ + protected $errorDispatcher; + + protected function setUp() + { + if (!class_exists('PhpConsole\Connector')) { + $this->markTestSkipped('PHP Console library not found. See https://github.com/barbushin/php-console#installation'); + } + $this->connector = $this->initConnectorMock(); + + $this->debugDispatcher = $this->initDebugDispatcherMock($this->connector); + $this->connector->setDebugDispatcher($this->debugDispatcher); + + $this->errorDispatcher = $this->initErrorDispatcherMock($this->connector); + $this->connector->setErrorsDispatcher($this->errorDispatcher); + } + + protected function initDebugDispatcherMock(Connector $connector) + { + return $this->getMockBuilder('PhpConsole\Dispatcher\Debug') + ->disableOriginalConstructor() + ->setMethods(array('dispatchDebug')) + ->setConstructorArgs(array($connector, $connector->getDumper())) + ->getMock(); + } + + protected function initErrorDispatcherMock(Connector $connector) + { + return $this->getMockBuilder('PhpConsole\Dispatcher\Errors') + ->disableOriginalConstructor() + ->setMethods(array('dispatchError', 'dispatchException')) + ->setConstructorArgs(array($connector, $connector->getDumper())) + ->getMock(); + } + + protected function initConnectorMock() + { + $connector = $this->getMockBuilder('PhpConsole\Connector') + ->disableOriginalConstructor() + ->setMethods(array( + 'sendMessage', + 'onShutDown', + 'isActiveClient', + 'setSourcesBasePath', + 'setServerEncoding', + 'setPassword', + 'enableSslOnlyMode', + 'setAllowedIpMasks', + 'setHeadersLimit', + 'startEvalRequestsListener', + )) + ->getMock(); + + $connector->expects($this->any()) + ->method('isActiveClient') + ->will($this->returnValue(true)); + + return $connector; + } + + protected function getHandlerDefaultOption($name) + { + $handler = new PHPConsoleHandler(array(), $this->connector); + $options = $handler->getOptions(); + + return $options[$name]; + } + + protected function initLogger($handlerOptions = array(), $level = Logger::DEBUG) + { + return new Logger('test', array( + new PHPConsoleHandler($handlerOptions, $this->connector, $level), + )); + } + + public function testInitWithDefaultConnector() + { + $handler = new PHPConsoleHandler(); + $this->assertEquals(spl_object_hash(Connector::getInstance()), spl_object_hash($handler->getConnector())); + } + + public function testInitWithCustomConnector() + { + $handler = new PHPConsoleHandler(array(), $this->connector); + $this->assertEquals(spl_object_hash($this->connector), spl_object_hash($handler->getConnector())); + } + + public function testDebug() + { + $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with($this->equalTo('test')); + $this->initLogger()->addDebug('test'); + } + + public function testDebugContextInMessage() + { + $message = 'test'; + $tag = 'tag'; + $context = array($tag, 'custom' => mt_rand()); + $expectedMessage = $message . ' ' . json_encode(array_slice($context, 1)); + $this->debugDispatcher->expects($this->once())->method('dispatchDebug')->with( + $this->equalTo($expectedMessage), + $this->equalTo($tag) + ); + $this->initLogger()->addDebug($message, $context); + } + + public function testDebugTags($tagsContextKeys = null) + { + $expectedTags = mt_rand(); + $logger = $this->initLogger($tagsContextKeys ? array('debugTagsKeysInContext' => $tagsContextKeys) : array()); + if (!$tagsContextKeys) { + $tagsContextKeys = $this->getHandlerDefaultOption('debugTagsKeysInContext'); + } + foreach ($tagsContextKeys as $key) { + $debugDispatcher = $this->initDebugDispatcherMock($this->connector); + $debugDispatcher->expects($this->once())->method('dispatchDebug')->with( + $this->anything(), + $this->equalTo($expectedTags) + ); + $this->connector->setDebugDispatcher($debugDispatcher); + $logger->addDebug('test', array($key => $expectedTags)); + } + } + + public function testError($classesPartialsTraceIgnore = null) + { + $code = E_USER_NOTICE; + $message = 'message'; + $file = __FILE__; + $line = __LINE__; + $this->errorDispatcher->expects($this->once())->method('dispatchError')->with( + $this->equalTo($code), + $this->equalTo($message), + $this->equalTo($file), + $this->equalTo($line), + $classesPartialsTraceIgnore ?: $this->equalTo($this->getHandlerDefaultOption('classesPartialsTraceIgnore')) + ); + $errorHandler = ErrorHandler::register($this->initLogger($classesPartialsTraceIgnore ? array('classesPartialsTraceIgnore' => $classesPartialsTraceIgnore) : array()), false); + $errorHandler->registerErrorHandler(array(), false, E_USER_WARNING); + $errorHandler->handleError($code, $message, $file, $line); + } + + public function testException() + { + $e = new Exception(); + $this->errorDispatcher->expects($this->once())->method('dispatchException')->with( + $this->equalTo($e) + ); + $handler = $this->initLogger(); + $handler->log( + \Psr\Log\LogLevel::ERROR, + sprintf('Uncaught Exception %s: "%s" at %s line %s', get_class($e), $e->getMessage(), $e->getFile(), $e->getLine()), + array('exception' => $e) + ); + } + + /** + * @expectedException Exception + */ + public function testWrongOptionsThrowsException() + { + new PHPConsoleHandler(array('xxx' => 1)); + } + + public function testOptionEnabled() + { + $this->debugDispatcher->expects($this->never())->method('dispatchDebug'); + $this->initLogger(array('enabled' => false))->addDebug('test'); + } + + public function testOptionClassesPartialsTraceIgnore() + { + $this->testError(array('Class', 'Namespace\\')); + } + + public function testOptionDebugTagsKeysInContext() + { + $this->testDebugTags(array('key1', 'key2')); + } + + public function testOptionUseOwnErrorsAndExceptionsHandler() + { + $this->initLogger(array('useOwnErrorsHandler' => true, 'useOwnExceptionsHandler' => true)); + $this->assertEquals(array(Handler::getInstance(), 'handleError'), set_error_handler(function () { + })); + $this->assertEquals(array(Handler::getInstance(), 'handleException'), set_exception_handler(function () { + })); + } + + public static function provideConnectorMethodsOptionsSets() + { + return array( + array('sourcesBasePath', 'setSourcesBasePath', __DIR__), + array('serverEncoding', 'setServerEncoding', 'cp1251'), + array('password', 'setPassword', '******'), + array('enableSslOnlyMode', 'enableSslOnlyMode', true, false), + array('ipMasks', 'setAllowedIpMasks', array('127.0.0.*')), + array('headersLimit', 'setHeadersLimit', 2500), + array('enableEvalListener', 'startEvalRequestsListener', true, false), + ); + } + + /** + * @dataProvider provideConnectorMethodsOptionsSets + */ + public function testOptionCallsConnectorMethod($option, $method, $value, $isArgument = true) + { + $expectCall = $this->connector->expects($this->once())->method($method); + if ($isArgument) { + $expectCall->with($value); + } + new PHPConsoleHandler(array($option => $value), $this->connector); + } + + public function testOptionDetectDumpTraceAndSource() + { + new PHPConsoleHandler(array('detectDumpTraceAndSource' => true), $this->connector); + $this->assertTrue($this->connector->getDebugDispatcher()->detectTraceAndSource); + } + + public static function provideDumperOptionsValues() + { + return array( + array('dumperLevelLimit', 'levelLimit', 1001), + array('dumperItemsCountLimit', 'itemsCountLimit', 1002), + array('dumperItemSizeLimit', 'itemSizeLimit', 1003), + array('dumperDumpSizeLimit', 'dumpSizeLimit', 1004), + array('dumperDetectCallbacks', 'detectCallbacks', true), + ); + } + + /** + * @dataProvider provideDumperOptionsValues + */ + public function testDumperOptions($option, $dumperProperty, $value) + { + new PHPConsoleHandler(array($option => $value), $this->connector); + $this->assertEquals($value, $this->connector->getDumper()->$dumperProperty); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php new file mode 100644 index 0000000..64eaab1 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PsrHandlerTest.php @@ -0,0 +1,50 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\PsrHandler::handle + */ +class PsrHandlerTest extends TestCase +{ + public function logLevelProvider() + { + $levels = array(); + $monologLogger = new Logger(''); + + foreach ($monologLogger->getLevels() as $levelName => $level) { + $levels[] = array($levelName, $level); + } + + return $levels; + } + + /** + * @dataProvider logLevelProvider + */ + public function testHandlesAllLevels($levelName, $level) + { + $message = 'Hello, world! ' . $level; + $context = array('foo' => 'bar', 'level' => $level); + + $psrLogger = $this->getMock('Psr\Log\NullLogger'); + $psrLogger->expects($this->once()) + ->method('log') + ->with(strtolower($levelName), $message, $context); + + $handler = new PsrHandler($psrLogger); + $handler->handle(array('level' => $level, 'level_name' => $levelName, 'message' => $message, 'context' => $context)); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php new file mode 100644 index 0000000..56df474 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/PushoverHandlerTest.php @@ -0,0 +1,141 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * Almost all examples (expected header, titles, messages) taken from + * https://www.pushover.net/api + * @author Sebastian Göttschkes + * @see https://www.pushover.net/api + */ +class PushoverHandlerTest extends TestCase +{ + private $res; + private $handler; + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/1\/messages.json HTTP\/1.1\\r\\nHost: api.pushover.net\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + + return $content; + } + + /** + * @depends testWriteHeader + */ + public function testWriteContent($content) + { + $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}$/', $content); + } + + public function testWriteWithComplexTitle() + { + $this->createHandler('myToken', 'myUser', 'Backup finished - SQL1'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/title=Backup\+finished\+-\+SQL1/', $content); + } + + public function testWriteWithComplexMessage() + { + $this->createHandler(); + $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'Backup of database "example" finished in 16 minutes.')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/message=Backup\+of\+database\+%22example%22\+finished\+in\+16\+minutes\./', $content); + } + + public function testWriteWithTooLongMessage() + { + $message = str_pad('test', 520, 'a'); + $this->createHandler(); + $this->handler->setHighPriorityLevel(Logger::EMERGENCY); // skip priority notifications + $this->handler->handle($this->getRecord(Logger::CRITICAL, $message)); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $expectedMessage = substr($message, 0, 505); + + $this->assertRegexp('/message=' . $expectedMessage . '&title/', $content); + } + + public function testWriteWithHighPriority() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=1$/', $content); + } + + public function testWriteWithEmergencyPriority() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&user=myUser&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content); + } + + public function testWriteToMultipleUsers() + { + $this->createHandler('myToken', array('userA', 'userB')); + $this->handler->handle($this->getRecord(Logger::EMERGENCY, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/token=myToken&user=userA&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200POST/', $content); + $this->assertRegexp('/token=myToken&user=userB&message=test1&title=Monolog×tamp=\d{10}&priority=2&retry=30&expire=25200$/', $content); + } + + private function createHandler($token = 'myToken', $user = 'myUser', $title = 'Monolog') + { + $constructorArgs = array($token, $user, $title); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\PushoverHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter($this->getIdentityFormatter()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php new file mode 100644 index 0000000..26d212b --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RavenHandlerTest.php @@ -0,0 +1,255 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +class RavenHandlerTest extends TestCase +{ + public function setUp() + { + if (!class_exists('Raven_Client')) { + $this->markTestSkipped('raven/raven not installed'); + } + + require_once __DIR__ . '/MockRavenClient.php'; + } + + /** + * @covers Monolog\Handler\RavenHandler::__construct + */ + public function testConstruct() + { + $handler = new RavenHandler($this->getRavenClient()); + $this->assertInstanceOf('Monolog\Handler\RavenHandler', $handler); + } + + protected function getHandler($ravenClient) + { + $handler = new RavenHandler($ravenClient); + + return $handler; + } + + protected function getRavenClient() + { + $dsn = 'http://43f6017361224d098402974103bfc53d:a6a0538fc2934ba2bed32e08741b2cd3@marca.python.live.cheggnet.com:9000/1'; + + return new MockRavenClient($dsn); + } + + public function testDebug() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $record = $this->getRecord(Logger::DEBUG, 'A test debug message'); + $handler->handle($record); + + $this->assertEquals($ravenClient::DEBUG, $ravenClient->lastData['level']); + $this->assertContains($record['message'], $ravenClient->lastData['message']); + } + + public function testWarning() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $record = $this->getRecord(Logger::WARNING, 'A test warning message'); + $handler->handle($record); + + $this->assertEquals($ravenClient::WARNING, $ravenClient->lastData['level']); + $this->assertContains($record['message'], $ravenClient->lastData['message']); + } + + public function testTag() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $tags = array(1, 2, 'foo'); + $record = $this->getRecord(Logger::INFO, 'test', array('tags' => $tags)); + $handler->handle($record); + + $this->assertEquals($tags, $ravenClient->lastData['tags']); + } + + public function testExtraParameters() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $checksum = '098f6bcd4621d373cade4e832627b4f6'; + $release = '05a671c66aefea124cc08b76ea6d30bb'; + $eventId = '31423'; + $record = $this->getRecord(Logger::INFO, 'test', array('checksum' => $checksum, 'release' => $release, 'event_id' => $eventId)); + $handler->handle($record); + + $this->assertEquals($checksum, $ravenClient->lastData['checksum']); + $this->assertEquals($release, $ravenClient->lastData['release']); + $this->assertEquals($eventId, $ravenClient->lastData['event_id']); + } + + public function testFingerprint() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $fingerprint = array('{{ default }}', 'other value'); + $record = $this->getRecord(Logger::INFO, 'test', array('fingerprint' => $fingerprint)); + $handler->handle($record); + + $this->assertEquals($fingerprint, $ravenClient->lastData['fingerprint']); + } + + public function testUserContext() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $recordWithNoContext = $this->getRecord(Logger::INFO, 'test with default user context'); + // set user context 'externally' + + $user = array( + 'id' => '123', + 'email' => 'test@test.com', + ); + + $recordWithContext = $this->getRecord(Logger::INFO, 'test', array('user' => $user)); + + $ravenClient->user_context(array('id' => 'test_user_id')); + // handle context + $handler->handle($recordWithContext); + $this->assertEquals($user, $ravenClient->lastData['user']); + + // check to see if its reset + $handler->handle($recordWithNoContext); + $this->assertInternalType('array', $ravenClient->context->user); + $this->assertSame('test_user_id', $ravenClient->context->user['id']); + + // handle with null context + $ravenClient->user_context(null); + $handler->handle($recordWithContext); + $this->assertEquals($user, $ravenClient->lastData['user']); + + // check to see if its reset + $handler->handle($recordWithNoContext); + $this->assertNull($ravenClient->context->user); + } + + public function testException() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + try { + $this->methodThatThrowsAnException(); + } catch (\Exception $e) { + $record = $this->getRecord(Logger::ERROR, $e->getMessage(), array('exception' => $e)); + $handler->handle($record); + } + + $this->assertEquals($record['message'], $ravenClient->lastData['message']); + } + + public function testHandleBatch() + { + $records = $this->getMultipleRecords(); + $records[] = $this->getRecord(Logger::WARNING, 'warning'); + $records[] = $this->getRecord(Logger::WARNING, 'warning'); + + $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $logFormatter->expects($this->once())->method('formatBatch'); + + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) { + return $record['level'] == 400; + })); + + $handler = $this->getHandler($this->getRavenClient()); + $handler->setBatchFormatter($logFormatter); + $handler->setFormatter($formatter); + $handler->handleBatch($records); + } + + public function testHandleBatchDoNothingIfRecordsAreBelowLevel() + { + $records = array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information'), + ); + + $handler = $this->getMock('Monolog\Handler\RavenHandler', null, array($this->getRavenClient())); + $handler->expects($this->never())->method('handle'); + $handler->setLevel(Logger::ERROR); + $handler->handleBatch($records); + } + + public function testHandleBatchPicksProperMessage() + { + $records = array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information 1'), + $this->getRecord(Logger::ERROR, 'error 1'), + $this->getRecord(Logger::WARNING, 'warning'), + $this->getRecord(Logger::ERROR, 'error 2'), + $this->getRecord(Logger::INFO, 'information 2'), + ); + + $logFormatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $logFormatter->expects($this->once())->method('formatBatch'); + + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->once())->method('format')->with($this->callback(function ($record) use ($records) { + return $record['message'] == 'error 1'; + })); + + $handler = $this->getHandler($this->getRavenClient()); + $handler->setBatchFormatter($logFormatter); + $handler->setFormatter($formatter); + $handler->handleBatch($records); + } + + public function testGetSetBatchFormatter() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + + $handler->setBatchFormatter($formatter = new LineFormatter()); + $this->assertSame($formatter, $handler->getBatchFormatter()); + } + + public function testRelease() + { + $ravenClient = $this->getRavenClient(); + $handler = $this->getHandler($ravenClient); + $release = 'v42.42.42'; + $handler->setRelease($release); + $record = $this->getRecord(Logger::INFO, 'test'); + $handler->handle($record); + $this->assertEquals($release, $ravenClient->lastData['release']); + + $localRelease = 'v41.41.41'; + $record = $this->getRecord(Logger::INFO, 'test', array('release' => $localRelease)); + $handler->handle($record); + $this->assertEquals($localRelease, $ravenClient->lastData['release']); + } + + private function methodThatThrowsAnException() + { + throw new \Exception('This is an exception'); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php new file mode 100644 index 0000000..689d527 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RedisHandlerTest.php @@ -0,0 +1,127 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; + +class RedisHandlerTest extends TestCase +{ + /** + * @expectedException InvalidArgumentException + */ + public function testConstructorShouldThrowExceptionForInvalidRedis() + { + new RedisHandler(new \stdClass(), 'key'); + } + + public function testConstructorShouldWorkWithPredis() + { + $redis = $this->getMock('Predis\Client'); + $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key')); + } + + public function testConstructorShouldWorkWithRedis() + { + $redis = $this->getMock('Redis'); + $this->assertInstanceof('Monolog\Handler\RedisHandler', new RedisHandler($redis, 'key')); + } + + public function testPredisHandle() + { + $redis = $this->getMock('Predis\Client', array('rpush')); + + // Predis\Client uses rpush + $redis->expects($this->once()) + ->method('rpush') + ->with('key', 'test'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new RedisHandler($redis, 'key'); + $handler->setFormatter(new LineFormatter("%message%")); + $handler->handle($record); + } + + public function testRedisHandle() + { + $redis = $this->getMock('Redis', array('rpush')); + + // Redis uses rPush + $redis->expects($this->once()) + ->method('rPush') + ->with('key', 'test'); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new RedisHandler($redis, 'key'); + $handler->setFormatter(new LineFormatter("%message%")); + $handler->handle($record); + } + + public function testRedisHandleCapped() + { + $redis = $this->getMock('Redis', array('multi', 'rpush', 'ltrim', 'exec')); + + // Redis uses multi + $redis->expects($this->once()) + ->method('multi') + ->will($this->returnSelf()); + + $redis->expects($this->once()) + ->method('rpush') + ->will($this->returnSelf()); + + $redis->expects($this->once()) + ->method('ltrim') + ->will($this->returnSelf()); + + $redis->expects($this->once()) + ->method('exec') + ->will($this->returnSelf()); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new RedisHandler($redis, 'key', Logger::DEBUG, true, 10); + $handler->setFormatter(new LineFormatter("%message%")); + $handler->handle($record); + } + + public function testPredisHandleCapped() + { + $redis = $this->getMock('Predis\Client', array('transaction')); + + $redisTransaction = $this->getMock('Predis\Client', array('rpush', 'ltrim')); + + $redisTransaction->expects($this->once()) + ->method('rpush') + ->will($this->returnSelf()); + + $redisTransaction->expects($this->once()) + ->method('ltrim') + ->will($this->returnSelf()); + + // Redis uses multi + $redis->expects($this->once()) + ->method('transaction') + ->will($this->returnCallback(function ($cb) use ($redisTransaction) { + $cb($redisTransaction); + })); + + $record = $this->getRecord(Logger::WARNING, 'test', array('data' => new \stdClass, 'foo' => 34)); + + $handler = new RedisHandler($redis, 'key', Logger::DEBUG, true, 10); + $handler->setFormatter(new LineFormatter("%message%")); + $handler->handle($record); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RollbarHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RollbarHandlerTest.php new file mode 100644 index 0000000..f302e91 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RollbarHandlerTest.php @@ -0,0 +1,84 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Exception; +use Monolog\TestCase; +use Monolog\Logger; +use PHPUnit_Framework_MockObject_MockObject as MockObject; + +/** + * @author Erik Johansson + * @see https://rollbar.com/docs/notifier/rollbar-php/ + * + * @coversDefaultClass Monolog\Handler\RollbarHandler + */ +class RollbarHandlerTest extends TestCase +{ + /** + * @var MockObject + */ + private $rollbarNotifier; + + /** + * @var array + */ + public $reportedExceptionArguments = null; + + protected function setUp() + { + parent::setUp(); + + $this->setupRollbarNotifierMock(); + } + + /** + * When reporting exceptions to Rollbar the + * level has to be set in the payload data + */ + public function testExceptionLogLevel() + { + $handler = $this->createHandler(); + + $handler->handle($this->createExceptionRecord(Logger::DEBUG)); + + $this->assertEquals('debug', $this->reportedExceptionArguments['payload']['level']); + } + + private function setupRollbarNotifierMock() + { + $this->rollbarNotifier = $this->getMockBuilder('RollbarNotifier') + ->setMethods(array('report_message', 'report_exception', 'flush')) + ->getMock(); + + $that = $this; + + $this->rollbarNotifier + ->expects($this->any()) + ->method('report_exception') + ->willReturnCallback(function ($exception, $context, $payload) use ($that) { + $that->reportedExceptionArguments = compact('exception', 'context', 'payload'); + }); + } + + private function createHandler() + { + return new RollbarHandler($this->rollbarNotifier, Logger::DEBUG); + } + + private function createExceptionRecord($level = Logger::DEBUG, $message = 'test', $exception = null) + { + return $this->getRecord($level, $message, array( + 'exception' => $exception ?: new Exception() + )); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php new file mode 100644 index 0000000..c6f5fac --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/RotatingFileHandlerTest.php @@ -0,0 +1,245 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use PHPUnit_Framework_Error_Deprecated; + +/** + * @covers Monolog\Handler\RotatingFileHandler + */ +class RotatingFileHandlerTest extends TestCase +{ + /** + * This var should be private but then the anonymous function + * in the `setUp` method won't be able to set it. `$this` cant't + * be used in the anonymous function in `setUp` because PHP 5.3 + * does not support it. + */ + public $lastError; + + public function setUp() + { + $dir = __DIR__.'/Fixtures'; + chmod($dir, 0777); + if (!is_writable($dir)) { + $this->markTestSkipped($dir.' must be writable to test the RotatingFileHandler.'); + } + $this->lastError = null; + $self = $this; + // workaround with &$self used for PHP 5.3 + set_error_handler(function($code, $message) use (&$self) { + $self->lastError = array( + 'code' => $code, + 'message' => $message, + ); + }); + } + + private function assertErrorWasTriggered($code, $message) + { + if (empty($this->lastError)) { + $this->fail( + sprintf( + 'Failed asserting that error with code `%d` and message `%s` was triggered', + $code, + $message + ) + ); + } + $this->assertEquals($code, $this->lastError['code'], sprintf('Expected an error with code %d to be triggered, got `%s` instead', $code, $this->lastError['code'])); + $this->assertEquals($message, $this->lastError['message'], sprintf('Expected an error with message `%d` to be triggered, got `%s` instead', $message, $this->lastError['message'])); + } + + public function testRotationCreatesNewFile() + { + touch(__DIR__.'/Fixtures/foo-'.date('Y-m-d', time() - 86400).'.rot'); + + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot'); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord()); + + $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; + $this->assertTrue(file_exists($log)); + $this->assertEquals('test', file_get_contents($log)); + } + + /** + * @dataProvider rotationTests + */ + public function testRotation($createFile, $dateFormat, $timeCallback) + { + touch($old1 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-1)).'.rot'); + touch($old2 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-2)).'.rot'); + touch($old3 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-3)).'.rot'); + touch($old4 = __DIR__.'/Fixtures/foo-'.date($dateFormat, $timeCallback(-4)).'.rot'); + + $log = __DIR__.'/Fixtures/foo-'.date($dateFormat).'.rot'; + + if ($createFile) { + touch($log); + } + + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->setFilenameFormat('{filename}-{date}', $dateFormat); + $handler->handle($this->getRecord()); + + $handler->close(); + + $this->assertTrue(file_exists($log)); + $this->assertTrue(file_exists($old1)); + $this->assertEquals($createFile, file_exists($old2)); + $this->assertEquals($createFile, file_exists($old3)); + $this->assertEquals($createFile, file_exists($old4)); + $this->assertEquals('test', file_get_contents($log)); + } + + public function rotationTests() + { + $now = time(); + $dayCallback = function($ago) use ($now) { + return $now + 86400 * $ago; + }; + $monthCallback = function($ago) { + return gmmktime(0, 0, 0, date('n') + $ago, 1, date('Y')); + }; + $yearCallback = function($ago) { + return gmmktime(0, 0, 0, 1, 1, date('Y') + $ago); + }; + + return array( + 'Rotation is triggered when the file of the current day is not present' + => array(true, RotatingFileHandler::FILE_PER_DAY, $dayCallback), + 'Rotation is not triggered when the file of the current day is already present' + => array(false, RotatingFileHandler::FILE_PER_DAY, $dayCallback), + + 'Rotation is triggered when the file of the current month is not present' + => array(true, RotatingFileHandler::FILE_PER_MONTH, $monthCallback), + 'Rotation is not triggered when the file of the current month is already present' + => array(false, RotatingFileHandler::FILE_PER_MONTH, $monthCallback), + + 'Rotation is triggered when the file of the current year is not present' + => array(true, RotatingFileHandler::FILE_PER_YEAR, $yearCallback), + 'Rotation is not triggered when the file of the current year is already present' + => array(false, RotatingFileHandler::FILE_PER_YEAR, $yearCallback), + ); + } + + /** + * @dataProvider dateFormatProvider + */ + public function testAllowOnlyFixedDefinedDateFormats($dateFormat, $valid) + { + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2); + $handler->setFilenameFormat('{filename}-{date}', $dateFormat); + if (!$valid) { + $this->assertErrorWasTriggered( + E_USER_DEPRECATED, + 'Invalid date format - format must be one of RotatingFileHandler::FILE_PER_DAY ("Y-m-d"), '. + 'RotatingFileHandler::FILE_PER_MONTH ("Y-m") or RotatingFileHandler::FILE_PER_YEAR ("Y"), '. + 'or you can set one of the date formats using slashes, underscores and/or dots instead of dashes.' + ); + } + } + + public function dateFormatProvider() + { + return array( + array(RotatingFileHandler::FILE_PER_DAY, true), + array(RotatingFileHandler::FILE_PER_MONTH, true), + array(RotatingFileHandler::FILE_PER_YEAR, true), + array('m-d-Y', false), + array('Y-m-d-h-i', false) + ); + } + + /** + * @dataProvider filenameFormatProvider + */ + public function testDisallowFilenameFormatsWithoutDate($filenameFormat, $valid) + { + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2); + $handler->setFilenameFormat($filenameFormat, RotatingFileHandler::FILE_PER_DAY); + if (!$valid) { + $this->assertErrorWasTriggered( + E_USER_DEPRECATED, + 'Invalid filename format - format should contain at least `{date}`, because otherwise rotating is impossible.' + ); + } + } + + public function filenameFormatProvider() + { + return array( + array('{filename}', false), + array('{filename}-{date}', true), + array('{date}', true), + array('foobar-{date}', true), + array('foo-{date}-bar', true), + array('{date}-foobar', true), + array('foobar', false), + ); + } + + /** + * @dataProvider rotationWhenSimilarFilesExistTests + */ + public function testRotationWhenSimilarFileNamesExist($dateFormat) + { + touch($old1 = __DIR__.'/Fixtures/foo-foo-'.date($dateFormat).'.rot'); + touch($old2 = __DIR__.'/Fixtures/foo-bar-'.date($dateFormat).'.rot'); + + $log = __DIR__.'/Fixtures/foo-'.date($dateFormat).'.rot'; + + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot', 2); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->setFilenameFormat('{filename}-{date}', $dateFormat); + $handler->handle($this->getRecord()); + $handler->close(); + + $this->assertTrue(file_exists($log)); + } + + public function rotationWhenSimilarFilesExistTests() + { + + return array( + 'Rotation is triggered when the file of the current day is not present but similar exists' + => array(RotatingFileHandler::FILE_PER_DAY), + + 'Rotation is triggered when the file of the current month is not present but similar exists' + => array(RotatingFileHandler::FILE_PER_MONTH), + + 'Rotation is triggered when the file of the current year is not present but similar exists' + => array(RotatingFileHandler::FILE_PER_YEAR), + ); + } + + public function testReuseCurrentFile() + { + $log = __DIR__.'/Fixtures/foo-'.date('Y-m-d').'.rot'; + file_put_contents($log, "foo"); + $handler = new RotatingFileHandler(__DIR__.'/Fixtures/foo.rot'); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord()); + $this->assertEquals('footest', file_get_contents($log)); + } + + public function tearDown() + { + foreach (glob(__DIR__.'/Fixtures/*.rot') as $file) { + unlink($file); + } + restore_error_handler(); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php new file mode 100644 index 0000000..b354cee --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SamplingHandlerTest.php @@ -0,0 +1,33 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +/** + * @covers Monolog\Handler\SamplingHandler::handle + */ +class SamplingHandlerTest extends TestCase +{ + public function testHandle() + { + $testHandler = new TestHandler(); + $handler = new SamplingHandler($testHandler, 2); + for ($i = 0; $i < 10000; $i++) { + $handler->handle($this->getRecord()); + } + $count = count($testHandler->getRecords()); + // $count should be half of 10k, so between 4k and 6k + $this->assertLessThan(6000, $count); + $this->assertGreaterThan(4000, $count); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/Slack/SlackRecordTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/Slack/SlackRecordTest.php new file mode 100644 index 0000000..b9de736 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/Slack/SlackRecordTest.php @@ -0,0 +1,395 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler\Slack; + +use Monolog\Logger; +use Monolog\TestCase; + +/** + * @coversDefaultClass Monolog\Handler\Slack\SlackRecord + */ +class SlackRecordTest extends TestCase +{ + private $jsonPrettyPrintFlag; + + protected function setUp() + { + $this->jsonPrettyPrintFlag = defined('JSON_PRETTY_PRINT') ? JSON_PRETTY_PRINT : 128; + } + + public function dataGetAttachmentColor() + { + return array( + array(Logger::DEBUG, SlackRecord::COLOR_DEFAULT), + array(Logger::INFO, SlackRecord::COLOR_GOOD), + array(Logger::NOTICE, SlackRecord::COLOR_GOOD), + array(Logger::WARNING, SlackRecord::COLOR_WARNING), + array(Logger::ERROR, SlackRecord::COLOR_DANGER), + array(Logger::CRITICAL, SlackRecord::COLOR_DANGER), + array(Logger::ALERT, SlackRecord::COLOR_DANGER), + array(Logger::EMERGENCY, SlackRecord::COLOR_DANGER), + ); + } + + /** + * @dataProvider dataGetAttachmentColor + * @param int $logLevel + * @param string $expectedColour RGB hex color or name of Slack color + * @covers ::getAttachmentColor + */ + public function testGetAttachmentColor($logLevel, $expectedColour) + { + $slackRecord = new SlackRecord(); + $this->assertSame( + $expectedColour, + $slackRecord->getAttachmentColor($logLevel) + ); + } + + public function testAddsChannel() + { + $channel = '#test'; + $record = new SlackRecord($channel); + $data = $record->getSlackData($this->getRecord()); + + $this->assertArrayHasKey('channel', $data); + $this->assertSame($channel, $data['channel']); + } + + public function testNoUsernameByDefault() + { + $record = new SlackRecord(); + $data = $record->getSlackData($this->getRecord()); + + $this->assertArrayNotHasKey('username', $data); + } + + /** + * @return array + */ + public function dataStringify() + { + $jsonPrettyPrintFlag = defined('JSON_PRETTY_PRINT') ? JSON_PRETTY_PRINT : 128; + + $multipleDimensions = array(array(1, 2)); + $numericKeys = array('library' => 'monolog'); + $singleDimension = array(1, 'Hello', 'Jordi'); + + return array( + array(array(), '[]'), + array($multipleDimensions, json_encode($multipleDimensions, $jsonPrettyPrintFlag)), + array($numericKeys, json_encode($numericKeys, $jsonPrettyPrintFlag)), + array($singleDimension, json_encode($singleDimension)) + ); + } + + /** + * @dataProvider dataStringify + */ + public function testStringify($fields, $expectedResult) + { + $slackRecord = new SlackRecord( + '#test', + 'test', + true, + null, + true, + true + ); + + $this->assertSame($expectedResult, $slackRecord->stringify($fields)); + } + + public function testAddsCustomUsername() + { + $username = 'Monolog bot'; + $record = new SlackRecord(null, $username); + $data = $record->getSlackData($this->getRecord()); + + $this->assertArrayHasKey('username', $data); + $this->assertSame($username, $data['username']); + } + + public function testNoIcon() + { + $record = new SlackRecord(); + $data = $record->getSlackData($this->getRecord()); + + $this->assertArrayNotHasKey('icon_emoji', $data); + } + + public function testAddsIcon() + { + $record = $this->getRecord(); + $slackRecord = new SlackRecord(null, null, false, 'ghost'); + $data = $slackRecord->getSlackData($record); + + $slackRecord2 = new SlackRecord(null, null, false, 'http://github.com/Seldaek/monolog'); + $data2 = $slackRecord2->getSlackData($record); + + $this->assertArrayHasKey('icon_emoji', $data); + $this->assertSame(':ghost:', $data['icon_emoji']); + $this->assertArrayHasKey('icon_url', $data2); + $this->assertSame('http://github.com/Seldaek/monolog', $data2['icon_url']); + } + + public function testAttachmentsNotPresentIfNoAttachment() + { + $record = new SlackRecord(null, null, false); + $data = $record->getSlackData($this->getRecord()); + + $this->assertArrayNotHasKey('attachments', $data); + } + + public function testAddsOneAttachment() + { + $record = new SlackRecord(); + $data = $record->getSlackData($this->getRecord()); + + $this->assertArrayHasKey('attachments', $data); + $this->assertArrayHasKey(0, $data['attachments']); + $this->assertInternalType('array', $data['attachments'][0]); + } + + public function testTextEqualsMessageIfNoAttachment() + { + $message = 'Test message'; + $record = new SlackRecord(null, null, false); + $data = $record->getSlackData($this->getRecord(Logger::WARNING, $message)); + + $this->assertArrayHasKey('text', $data); + $this->assertSame($message, $data['text']); + } + + public function testTextEqualsFormatterOutput() + { + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter + ->expects($this->any()) + ->method('format') + ->will($this->returnCallback(function ($record) { return $record['message'] . 'test'; })); + + $formatter2 = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter2 + ->expects($this->any()) + ->method('format') + ->will($this->returnCallback(function ($record) { return $record['message'] . 'test1'; })); + + $message = 'Test message'; + $record = new SlackRecord(null, null, false, null, false, false, array(), $formatter); + $data = $record->getSlackData($this->getRecord(Logger::WARNING, $message)); + + $this->assertArrayHasKey('text', $data); + $this->assertSame($message . 'test', $data['text']); + + $record->setFormatter($formatter2); + $data = $record->getSlackData($this->getRecord(Logger::WARNING, $message)); + + $this->assertArrayHasKey('text', $data); + $this->assertSame($message . 'test1', $data['text']); + } + + public function testAddsFallbackAndTextToAttachment() + { + $message = 'Test message'; + $record = new SlackRecord(null); + $data = $record->getSlackData($this->getRecord(Logger::WARNING, $message)); + + $this->assertSame($message, $data['attachments'][0]['text']); + $this->assertSame($message, $data['attachments'][0]['fallback']); + } + + public function testMapsLevelToColorAttachmentColor() + { + $record = new SlackRecord(null); + $errorLoggerRecord = $this->getRecord(Logger::ERROR); + $emergencyLoggerRecord = $this->getRecord(Logger::EMERGENCY); + $warningLoggerRecord = $this->getRecord(Logger::WARNING); + $infoLoggerRecord = $this->getRecord(Logger::INFO); + $debugLoggerRecord = $this->getRecord(Logger::DEBUG); + + $data = $record->getSlackData($errorLoggerRecord); + $this->assertSame(SlackRecord::COLOR_DANGER, $data['attachments'][0]['color']); + + $data = $record->getSlackData($emergencyLoggerRecord); + $this->assertSame(SlackRecord::COLOR_DANGER, $data['attachments'][0]['color']); + + $data = $record->getSlackData($warningLoggerRecord); + $this->assertSame(SlackRecord::COLOR_WARNING, $data['attachments'][0]['color']); + + $data = $record->getSlackData($infoLoggerRecord); + $this->assertSame(SlackRecord::COLOR_GOOD, $data['attachments'][0]['color']); + + $data = $record->getSlackData($debugLoggerRecord); + $this->assertSame(SlackRecord::COLOR_DEFAULT, $data['attachments'][0]['color']); + } + + public function testAddsShortAttachmentWithoutContextAndExtra() + { + $level = Logger::ERROR; + $levelName = Logger::getLevelName($level); + $record = new SlackRecord(null, null, true, null, true); + $data = $record->getSlackData($this->getRecord($level, 'test', array('test' => 1))); + + $attachment = $data['attachments'][0]; + $this->assertArrayHasKey('title', $attachment); + $this->assertArrayHasKey('fields', $attachment); + $this->assertSame($levelName, $attachment['title']); + $this->assertSame(array(), $attachment['fields']); + } + + public function testAddsShortAttachmentWithContextAndExtra() + { + $level = Logger::ERROR; + $levelName = Logger::getLevelName($level); + $context = array('test' => 1); + $extra = array('tags' => array('web')); + $record = new SlackRecord(null, null, true, null, true, true); + $loggerRecord = $this->getRecord($level, 'test', $context); + $loggerRecord['extra'] = $extra; + $data = $record->getSlackData($loggerRecord); + + $attachment = $data['attachments'][0]; + $this->assertArrayHasKey('title', $attachment); + $this->assertArrayHasKey('fields', $attachment); + $this->assertCount(2, $attachment['fields']); + $this->assertSame($levelName, $attachment['title']); + $this->assertSame( + array( + array( + 'title' => 'Extra', + 'value' => sprintf('```%s```', json_encode($extra, $this->jsonPrettyPrintFlag)), + 'short' => false + ), + array( + 'title' => 'Context', + 'value' => sprintf('```%s```', json_encode($context, $this->jsonPrettyPrintFlag)), + 'short' => false + ) + ), + $attachment['fields'] + ); + } + + public function testAddsLongAttachmentWithoutContextAndExtra() + { + $level = Logger::ERROR; + $levelName = Logger::getLevelName($level); + $record = new SlackRecord(null, null, true, null); + $data = $record->getSlackData($this->getRecord($level, 'test', array('test' => 1))); + + $attachment = $data['attachments'][0]; + $this->assertArrayHasKey('title', $attachment); + $this->assertArrayHasKey('fields', $attachment); + $this->assertCount(1, $attachment['fields']); + $this->assertSame('Message', $attachment['title']); + $this->assertSame( + array(array( + 'title' => 'Level', + 'value' => $levelName, + 'short' => false + )), + $attachment['fields'] + ); + } + + public function testAddsLongAttachmentWithContextAndExtra() + { + $level = Logger::ERROR; + $levelName = Logger::getLevelName($level); + $context = array('test' => 1); + $extra = array('tags' => array('web')); + $record = new SlackRecord(null, null, true, null, false, true); + $loggerRecord = $this->getRecord($level, 'test', $context); + $loggerRecord['extra'] = $extra; + $data = $record->getSlackData($loggerRecord); + + $expectedFields = array( + array( + 'title' => 'Level', + 'value' => $levelName, + 'short' => false, + ), + array( + 'title' => 'Tags', + 'value' => sprintf('```%s```', json_encode($extra['tags'])), + 'short' => false + ), + array( + 'title' => 'Test', + 'value' => $context['test'], + 'short' => false + ) + ); + + $attachment = $data['attachments'][0]; + $this->assertArrayHasKey('title', $attachment); + $this->assertArrayHasKey('fields', $attachment); + $this->assertCount(3, $attachment['fields']); + $this->assertSame('Message', $attachment['title']); + $this->assertSame( + $expectedFields, + $attachment['fields'] + ); + } + + public function testAddsTimestampToAttachment() + { + $record = $this->getRecord(); + $slackRecord = new SlackRecord(); + $data = $slackRecord->getSlackData($this->getRecord()); + + $attachment = $data['attachments'][0]; + $this->assertArrayHasKey('ts', $attachment); + $this->assertSame($record['datetime']->getTimestamp(), $attachment['ts']); + } + + public function testContextHasException() + { + $record = $this->getRecord(Logger::CRITICAL, 'This is a critical message.', array('exception' => new \Exception())); + $slackRecord = new SlackRecord(null, null, true, null, false, true); + $data = $slackRecord->getSlackData($record); + $this->assertInternalType('string', $data['attachments'][0]['fields'][1]['value']); + } + + public function testExcludeExtraAndContextFields() + { + $record = $this->getRecord( + Logger::WARNING, + 'test', + array('info' => array('library' => 'monolog', 'author' => 'Jordi')) + ); + $record['extra'] = array('tags' => array('web', 'cli')); + + $slackRecord = new SlackRecord(null, null, true, null, false, true, array('context.info.library', 'extra.tags.1')); + $data = $slackRecord->getSlackData($record); + $attachment = $data['attachments'][0]; + + $expected = array( + array( + 'title' => 'Info', + 'value' => sprintf('```%s```', json_encode(array('author' => 'Jordi'), $this->jsonPrettyPrintFlag)), + 'short' => false + ), + array( + 'title' => 'Tags', + 'value' => sprintf('```%s```', json_encode(array('web'))), + 'short' => false + ), + ); + + foreach ($expected as $field) { + $this->assertNotFalse(array_search($field, $attachment['fields'])); + break; + } + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php new file mode 100644 index 0000000..b12b01f --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackHandlerTest.php @@ -0,0 +1,155 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; +use Monolog\Handler\Slack\SlackRecord; + +/** + * @author Greg Kedzierski + * @see https://api.slack.com/ + */ +class SlackHandlerTest extends TestCase +{ + /** + * @var resource + */ + private $res; + + /** + * @var SlackHandler + */ + private $handler; + + public function setUp() + { + if (!extension_loaded('openssl')) { + $this->markTestSkipped('This test requires openssl to run'); + } + } + + public function testWriteHeader() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/POST \/api\/chat.postMessage HTTP\/1.1\\r\\nHost: slack.com\\r\\nContent-Type: application\/x-www-form-urlencoded\\r\\nContent-Length: \d{2,4}\\r\\n\\r\\n/', $content); + } + + public function testWriteContent() + { + $this->createHandler(); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegExp('/username=Monolog/', $content); + $this->assertRegExp('/channel=channel1/', $content); + $this->assertRegExp('/token=myToken/', $content); + $this->assertRegExp('/attachments/', $content); + } + + public function testWriteContentUsesFormatterIfProvided() + { + $this->createHandler('myToken', 'channel1', 'Monolog', false); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->createHandler('myToken', 'channel1', 'Monolog', false); + $this->handler->setFormatter(new LineFormatter('foo--%message%')); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test2')); + fseek($this->res, 0); + $content2 = fread($this->res, 1024); + + $this->assertRegexp('/text=test1/', $content); + $this->assertRegexp('/text=foo--test2/', $content2); + } + + public function testWriteContentWithEmoji() + { + $this->createHandler('myToken', 'channel1', 'Monolog', true, 'alien'); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/icon_emoji=%3Aalien%3A/', $content); + } + + /** + * @dataProvider provideLevelColors + */ + public function testWriteContentWithColors($level, $expectedColor) + { + $this->createHandler(); + $this->handler->handle($this->getRecord($level, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/%22color%22%3A%22'.$expectedColor.'/', $content); + } + + public function testWriteContentWithPlainTextMessage() + { + $this->createHandler('myToken', 'channel1', 'Monolog', false); + $this->handler->handle($this->getRecord(Logger::CRITICAL, 'test1')); + fseek($this->res, 0); + $content = fread($this->res, 1024); + + $this->assertRegexp('/text=test1/', $content); + } + + public function provideLevelColors() + { + return array( + array(Logger::DEBUG, urlencode(SlackRecord::COLOR_DEFAULT)), + array(Logger::INFO, SlackRecord::COLOR_GOOD), + array(Logger::NOTICE, SlackRecord::COLOR_GOOD), + array(Logger::WARNING, SlackRecord::COLOR_WARNING), + array(Logger::ERROR, SlackRecord::COLOR_DANGER), + array(Logger::CRITICAL, SlackRecord::COLOR_DANGER), + array(Logger::ALERT, SlackRecord::COLOR_DANGER), + array(Logger::EMERGENCY,SlackRecord::COLOR_DANGER), + ); + } + + private function createHandler($token = 'myToken', $channel = 'channel1', $username = 'Monolog', $useAttachment = true, $iconEmoji = null, $useShortAttachment = false, $includeExtra = false) + { + $constructorArgs = array($token, $channel, $username, $useAttachment, $iconEmoji, Logger::DEBUG, true, $useShortAttachment, $includeExtra); + $this->res = fopen('php://memory', 'a'); + $this->handler = $this->getMock( + '\Monolog\Handler\SlackHandler', + array('fsockopen', 'streamSetTimeout', 'closeSocket'), + $constructorArgs + ); + + $reflectionProperty = new \ReflectionProperty('\Monolog\Handler\SocketHandler', 'connectionString'); + $reflectionProperty->setAccessible(true); + $reflectionProperty->setValue($this->handler, 'localhost:1234'); + + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + $this->handler->expects($this->any()) + ->method('closeSocket') + ->will($this->returnValue(true)); + + $this->handler->setFormatter($this->getIdentityFormatter()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackWebhookHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackWebhookHandlerTest.php new file mode 100644 index 0000000..c9229e2 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackWebhookHandlerTest.php @@ -0,0 +1,107 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; +use Monolog\Formatter\LineFormatter; +use Monolog\Handler\Slack\SlackRecord; + +/** + * @author Haralan Dobrev + * @see https://api.slack.com/incoming-webhooks + * @coversDefaultClass Monolog\Handler\SlackWebhookHandler + */ +class SlackWebhookHandlerTest extends TestCase +{ + const WEBHOOK_URL = 'https://hooks.slack.com/services/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E'; + + /** + * @covers ::__construct + * @covers ::getSlackRecord + */ + public function testConstructorMinimal() + { + $handler = new SlackWebhookHandler(self::WEBHOOK_URL); + $record = $this->getRecord(); + $slackRecord = $handler->getSlackRecord(); + $this->assertInstanceOf('Monolog\Handler\Slack\SlackRecord', $slackRecord); + $this->assertEquals(array( + 'attachments' => array( + array( + 'fallback' => 'test', + 'text' => 'test', + 'color' => SlackRecord::COLOR_WARNING, + 'fields' => array( + array( + 'title' => 'Level', + 'value' => 'WARNING', + 'short' => false, + ), + ), + 'title' => 'Message', + 'mrkdwn_in' => array('fields'), + 'ts' => $record['datetime']->getTimestamp(), + ), + ), + ), $slackRecord->getSlackData($record)); + } + + /** + * @covers ::__construct + * @covers ::getSlackRecord + */ + public function testConstructorFull() + { + $handler = new SlackWebhookHandler( + self::WEBHOOK_URL, + 'test-channel', + 'test-username', + false, + ':ghost:', + false, + false, + Logger::DEBUG, + false + ); + + $slackRecord = $handler->getSlackRecord(); + $this->assertInstanceOf('Monolog\Handler\Slack\SlackRecord', $slackRecord); + $this->assertEquals(array( + 'username' => 'test-username', + 'text' => 'test', + 'channel' => 'test-channel', + 'icon_emoji' => ':ghost:', + ), $slackRecord->getSlackData($this->getRecord())); + } + + /** + * @covers ::getFormatter + */ + public function testGetFormatter() + { + $handler = new SlackWebhookHandler(self::WEBHOOK_URL); + $formatter = $handler->getFormatter(); + $this->assertInstanceOf('Monolog\Formatter\FormatterInterface', $formatter); + } + + /** + * @covers ::setFormatter + */ + public function testSetFormatter() + { + $handler = new SlackWebhookHandler(self::WEBHOOK_URL); + $formatter = new LineFormatter(); + $handler->setFormatter($formatter); + $this->assertSame($formatter, $handler->getFormatter()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackbotHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackbotHandlerTest.php new file mode 100644 index 0000000..b1b02bd --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SlackbotHandlerTest.php @@ -0,0 +1,47 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Haralan Dobrev + * @see https://slack.com/apps/A0F81R8ET-slackbot + * @coversDefaultClass Monolog\Handler\SlackbotHandler + */ +class SlackbotHandlerTest extends TestCase +{ + /** + * @covers ::__construct + */ + public function testConstructorMinimal() + { + $handler = new SlackbotHandler('test-team', 'test-token', 'test-channel'); + $this->assertInstanceOf('Monolog\Handler\AbstractProcessingHandler', $handler); + } + + /** + * @covers ::__construct + */ + public function testConstructorFull() + { + $handler = new SlackbotHandler( + 'test-team', + 'test-token', + 'test-channel', + Logger::DEBUG, + false + ); + $this->assertInstanceOf('Monolog\Handler\AbstractProcessingHandler', $handler); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php new file mode 100644 index 0000000..1da987c --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SocketHandlerTest.php @@ -0,0 +1,335 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @author Pablo de Leon Belloc + */ +class SocketHandlerTest extends TestCase +{ + /** + * @var Monolog\Handler\SocketHandler + */ + private $handler; + + /** + * @var resource + */ + private $res; + + /** + * @expectedException UnexpectedValueException + */ + public function testInvalidHostname() + { + $this->createHandler('garbage://here'); + $this->writeRecord('data'); + } + + /** + * @expectedException \InvalidArgumentException + */ + public function testBadConnectionTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setConnectionTimeout(-1); + } + + public function testSetConnectionTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setConnectionTimeout(10.1); + $this->assertEquals(10.1, $this->handler->getConnectionTimeout()); + } + + /** + * @expectedException \InvalidArgumentException + */ + public function testBadTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setTimeout(-1); + } + + public function testSetTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setTimeout(10.25); + $this->assertEquals(10.25, $this->handler->getTimeout()); + } + + public function testSetWritingTimeout() + { + $this->createHandler('localhost:1234'); + $this->handler->setWritingTimeout(10.25); + $this->assertEquals(10.25, $this->handler->getWritingTimeout()); + } + + public function testSetChunkSize() + { + $this->createHandler('localhost:1234'); + $this->handler->setChunkSize(1025); + $this->assertEquals(1025, $this->handler->getChunkSize()); + } + + public function testSetConnectionString() + { + $this->createHandler('tcp://localhost:9090'); + $this->assertEquals('tcp://localhost:9090', $this->handler->getConnectionString()); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownOnFsockopenError() + { + $this->setMockHandler(array('fsockopen')); + $this->handler->expects($this->once()) + ->method('fsockopen') + ->will($this->returnValue(false)); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownOnPfsockopenError() + { + $this->setMockHandler(array('pfsockopen')); + $this->handler->expects($this->once()) + ->method('pfsockopen') + ->will($this->returnValue(false)); + $this->handler->setPersistent(true); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownIfCannotSetTimeout() + { + $this->setMockHandler(array('streamSetTimeout')); + $this->handler->expects($this->once()) + ->method('streamSetTimeout') + ->will($this->returnValue(false)); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testExceptionIsThrownIfCannotSetChunkSize() + { + $this->setMockHandler(array('streamSetChunkSize')); + $this->handler->setChunkSize(8192); + $this->handler->expects($this->once()) + ->method('streamSetChunkSize') + ->will($this->returnValue(false)); + $this->writeRecord('Hello world'); + } + + /** + * @expectedException RuntimeException + */ + public function testWriteFailsOnIfFwriteReturnsFalse() + { + $this->setMockHandler(array('fwrite')); + + $callback = function ($arg) { + $map = array( + 'Hello world' => 6, + 'world' => false, + ); + + return $map[$arg]; + }; + + $this->handler->expects($this->exactly(2)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + + $this->writeRecord('Hello world'); + } + + /** + * @expectedException RuntimeException + */ + public function testWriteFailsIfStreamTimesOut() + { + $this->setMockHandler(array('fwrite', 'streamGetMetadata')); + + $callback = function ($arg) { + $map = array( + 'Hello world' => 6, + 'world' => 5, + ); + + return $map[$arg]; + }; + + $this->handler->expects($this->exactly(1)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + $this->handler->expects($this->exactly(1)) + ->method('streamGetMetadata') + ->will($this->returnValue(array('timed_out' => true))); + + $this->writeRecord('Hello world'); + } + + /** + * @expectedException RuntimeException + */ + public function testWriteFailsOnIncompleteWrite() + { + $this->setMockHandler(array('fwrite', 'streamGetMetadata')); + + $res = $this->res; + $callback = function ($string) use ($res) { + fclose($res); + + return strlen('Hello'); + }; + + $this->handler->expects($this->exactly(1)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + $this->handler->expects($this->exactly(1)) + ->method('streamGetMetadata') + ->will($this->returnValue(array('timed_out' => false))); + + $this->writeRecord('Hello world'); + } + + public function testWriteWithMemoryFile() + { + $this->setMockHandler(); + $this->writeRecord('test1'); + $this->writeRecord('test2'); + $this->writeRecord('test3'); + fseek($this->res, 0); + $this->assertEquals('test1test2test3', fread($this->res, 1024)); + } + + public function testWriteWithMock() + { + $this->setMockHandler(array('fwrite')); + + $callback = function ($arg) { + $map = array( + 'Hello world' => 6, + 'world' => 5, + ); + + return $map[$arg]; + }; + + $this->handler->expects($this->exactly(2)) + ->method('fwrite') + ->will($this->returnCallback($callback)); + + $this->writeRecord('Hello world'); + } + + public function testClose() + { + $this->setMockHandler(); + $this->writeRecord('Hello world'); + $this->assertInternalType('resource', $this->res); + $this->handler->close(); + $this->assertFalse(is_resource($this->res), "Expected resource to be closed after closing handler"); + } + + public function testCloseDoesNotClosePersistentSocket() + { + $this->setMockHandler(); + $this->handler->setPersistent(true); + $this->writeRecord('Hello world'); + $this->assertTrue(is_resource($this->res)); + $this->handler->close(); + $this->assertTrue(is_resource($this->res)); + } + + /** + * @expectedException \RuntimeException + */ + public function testAvoidInfiniteLoopWhenNoDataIsWrittenForAWritingTimeoutSeconds() + { + $this->setMockHandler(array('fwrite', 'streamGetMetadata')); + + $this->handler->expects($this->any()) + ->method('fwrite') + ->will($this->returnValue(0)); + + $this->handler->expects($this->any()) + ->method('streamGetMetadata') + ->will($this->returnValue(array('timed_out' => false))); + + $this->handler->setWritingTimeout(1); + + $this->writeRecord('Hello world'); + } + + private function createHandler($connectionString) + { + $this->handler = new SocketHandler($connectionString); + $this->handler->setFormatter($this->getIdentityFormatter()); + } + + private function writeRecord($string) + { + $this->handler->handle($this->getRecord(Logger::WARNING, $string)); + } + + private function setMockHandler(array $methods = array()) + { + $this->res = fopen('php://memory', 'a'); + + $defaultMethods = array('fsockopen', 'pfsockopen', 'streamSetTimeout'); + $newMethods = array_diff($methods, $defaultMethods); + + $finalMethods = array_merge($defaultMethods, $newMethods); + + $this->handler = $this->getMock( + '\Monolog\Handler\SocketHandler', $finalMethods, array('localhost:1234') + ); + + if (!in_array('fsockopen', $methods)) { + $this->handler->expects($this->any()) + ->method('fsockopen') + ->will($this->returnValue($this->res)); + } + + if (!in_array('pfsockopen', $methods)) { + $this->handler->expects($this->any()) + ->method('pfsockopen') + ->will($this->returnValue($this->res)); + } + + if (!in_array('streamSetTimeout', $methods)) { + $this->handler->expects($this->any()) + ->method('streamSetTimeout') + ->will($this->returnValue(true)); + } + + if (!in_array('streamSetChunkSize', $methods)) { + $this->handler->expects($this->any()) + ->method('streamSetChunkSize') + ->will($this->returnValue(8192)); + } + + $this->handler->setFormatter($this->getIdentityFormatter()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php new file mode 100644 index 0000000..487030f --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/StreamHandlerTest.php @@ -0,0 +1,184 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class StreamHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWrite() + { + $handle = fopen('php://memory', 'a+'); + $handler = new StreamHandler($handle); + $handler->setFormatter($this->getIdentityFormatter()); + $handler->handle($this->getRecord(Logger::WARNING, 'test')); + $handler->handle($this->getRecord(Logger::WARNING, 'test2')); + $handler->handle($this->getRecord(Logger::WARNING, 'test3')); + fseek($handle, 0); + $this->assertEquals('testtest2test3', fread($handle, 100)); + } + + /** + * @covers Monolog\Handler\StreamHandler::close + */ + public function testCloseKeepsExternalHandlersOpen() + { + $handle = fopen('php://memory', 'a+'); + $handler = new StreamHandler($handle); + $this->assertTrue(is_resource($handle)); + $handler->close(); + $this->assertTrue(is_resource($handle)); + } + + /** + * @covers Monolog\Handler\StreamHandler::close + */ + public function testClose() + { + $handler = new StreamHandler('php://memory'); + $handler->handle($this->getRecord(Logger::WARNING, 'test')); + $streamProp = new \ReflectionProperty('Monolog\Handler\StreamHandler', 'stream'); + $streamProp->setAccessible(true); + $handle = $streamProp->getValue($handler); + + $this->assertTrue(is_resource($handle)); + $handler->close(); + $this->assertFalse(is_resource($handle)); + } + + /** + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteCreatesTheStreamResource() + { + $handler = new StreamHandler('php://memory'); + $handler->handle($this->getRecord()); + } + + /** + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteLocking() + { + $temp = sys_get_temp_dir() . DIRECTORY_SEPARATOR . 'monolog_locked_log'; + $handler = new StreamHandler($temp, Logger::DEBUG, true, null, true); + $handler->handle($this->getRecord()); + } + + /** + * @expectedException LogicException + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteMissingResource() + { + $handler = new StreamHandler(null); + $handler->handle($this->getRecord()); + } + + public function invalidArgumentProvider() + { + return array( + array(1), + array(array()), + array(array('bogus://url')), + ); + } + + /** + * @dataProvider invalidArgumentProvider + * @expectedException InvalidArgumentException + * @covers Monolog\Handler\StreamHandler::__construct + */ + public function testWriteInvalidArgument($invalidArgument) + { + $handler = new StreamHandler($invalidArgument); + } + + /** + * @expectedException UnexpectedValueException + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteInvalidResource() + { + $handler = new StreamHandler('bogus://url'); + $handler->handle($this->getRecord()); + } + + /** + * @expectedException UnexpectedValueException + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteNonExistingResource() + { + $handler = new StreamHandler('ftp://foo/bar/baz/'.rand(0, 10000)); + $handler->handle($this->getRecord()); + } + + /** + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteNonExistingPath() + { + $handler = new StreamHandler(sys_get_temp_dir().'/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000)); + $handler->handle($this->getRecord()); + } + + /** + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteNonExistingFileResource() + { + $handler = new StreamHandler('file://'.sys_get_temp_dir().'/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000)); + $handler->handle($this->getRecord()); + } + + /** + * @expectedException Exception + * @expectedExceptionMessageRegExp /There is no existing directory at/ + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteNonExistingAndNotCreatablePath() + { + if (defined('PHP_WINDOWS_VERSION_BUILD')) { + $this->markTestSkipped('Permissions checks can not run on windows'); + } + $handler = new StreamHandler('/foo/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000)); + $handler->handle($this->getRecord()); + } + + /** + * @expectedException Exception + * @expectedExceptionMessageRegExp /There is no existing directory at/ + * @covers Monolog\Handler\StreamHandler::__construct + * @covers Monolog\Handler\StreamHandler::write + */ + public function testWriteNonExistingAndNotCreatableFileResource() + { + if (defined('PHP_WINDOWS_VERSION_BUILD')) { + $this->markTestSkipped('Permissions checks can not run on windows'); + } + $handler = new StreamHandler('file:///foo/bar/'.rand(0, 10000).DIRECTORY_SEPARATOR.rand(0, 10000)); + $handler->handle($this->getRecord()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php new file mode 100644 index 0000000..1d62940 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SwiftMailerHandlerTest.php @@ -0,0 +1,113 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; +use Monolog\TestCase; + +class SwiftMailerHandlerTest extends TestCase +{ + /** @var \Swift_Mailer|\PHPUnit_Framework_MockObject_MockObject */ + private $mailer; + + public function setUp() + { + $this->mailer = $this + ->getMockBuilder('Swift_Mailer') + ->disableOriginalConstructor() + ->getMock(); + } + + public function testMessageCreationIsLazyWhenUsingCallback() + { + $this->mailer->expects($this->never()) + ->method('send'); + + $callback = function () { + throw new \RuntimeException('Swift_Message creation callback should not have been called in this test'); + }; + $handler = new SwiftMailerHandler($this->mailer, $callback); + + $records = array( + $this->getRecord(Logger::DEBUG), + $this->getRecord(Logger::INFO), + ); + $handler->handleBatch($records); + } + + public function testMessageCanBeCustomizedGivenLoggedData() + { + // Wire Mailer to expect a specific Swift_Message with a customized Subject + $expectedMessage = new \Swift_Message(); + $this->mailer->expects($this->once()) + ->method('send') + ->with($this->callback(function ($value) use ($expectedMessage) { + return $value instanceof \Swift_Message + && $value->getSubject() === 'Emergency' + && $value === $expectedMessage; + })); + + // Callback dynamically changes subject based on number of logged records + $callback = function ($content, array $records) use ($expectedMessage) { + $subject = count($records) > 0 ? 'Emergency' : 'Normal'; + $expectedMessage->setSubject($subject); + + return $expectedMessage; + }; + $handler = new SwiftMailerHandler($this->mailer, $callback); + + // Logging 1 record makes this an Emergency + $records = array( + $this->getRecord(Logger::EMERGENCY), + ); + $handler->handleBatch($records); + } + + public function testMessageSubjectFormatting() + { + // Wire Mailer to expect a specific Swift_Message with a customized Subject + $messageTemplate = new \Swift_Message(); + $messageTemplate->setSubject('Alert: %level_name% %message%'); + $receivedMessage = null; + + $this->mailer->expects($this->once()) + ->method('send') + ->with($this->callback(function ($value) use (&$receivedMessage) { + $receivedMessage = $value; + return true; + })); + + $handler = new SwiftMailerHandler($this->mailer, $messageTemplate); + + $records = array( + $this->getRecord(Logger::EMERGENCY), + ); + $handler->handleBatch($records); + + $this->assertEquals('Alert: EMERGENCY test', $receivedMessage->getSubject()); + } + + public function testMessageHaveUniqueId() + { + $messageTemplate = new \Swift_Message(); + $handler = new SwiftMailerHandler($this->mailer, $messageTemplate); + + $method = new \ReflectionMethod('Monolog\Handler\SwiftMailerHandler', 'buildMessage'); + $method->setAccessible(true); + $method->invokeArgs($handler, array($messageTemplate, array())); + + $builtMessage1 = $method->invoke($handler, $messageTemplate, array()); + $builtMessage2 = $method->invoke($handler, $messageTemplate, array()); + + $this->assertFalse($builtMessage1->getId() === $builtMessage2->getId(), 'Two different messages have the same id'); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php new file mode 100644 index 0000000..8f9e46b --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SyslogHandlerTest.php @@ -0,0 +1,44 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\Logger; + +class SyslogHandlerTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Handler\SyslogHandler::__construct + */ + public function testConstruct() + { + $handler = new SyslogHandler('test'); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + + $handler = new SyslogHandler('test', LOG_USER); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + + $handler = new SyslogHandler('test', 'user'); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + + $handler = new SyslogHandler('test', LOG_USER, Logger::DEBUG, true, LOG_PERROR); + $this->assertInstanceOf('Monolog\Handler\SyslogHandler', $handler); + } + + /** + * @covers Monolog\Handler\SyslogHandler::__construct + */ + public function testConstructInvalidFacility() + { + $this->setExpectedException('UnexpectedValueException'); + $handler = new SyslogHandler('test', 'unknown'); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php new file mode 100644 index 0000000..7ee8a98 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/SyslogUdpHandlerTest.php @@ -0,0 +1,76 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +/** + * @requires extension sockets + */ +class SyslogUdpHandlerTest extends TestCase +{ + /** + * @expectedException UnexpectedValueException + */ + public function testWeValidateFacilities() + { + $handler = new SyslogUdpHandler("ip", null, "invalidFacility"); + } + + public function testWeSplitIntoLines() + { + $time = '2014-01-07T12:34'; + $pid = getmypid(); + $host = gethostname(); + + $handler = $this->getMockBuilder('\Monolog\Handler\SyslogUdpHandler') + ->setConstructorArgs(array("127.0.0.1", 514, "authpriv")) + ->setMethods(array('getDateTime')) + ->getMock(); + + $handler->method('getDateTime') + ->willReturn($time); + + $handler->setFormatter(new \Monolog\Formatter\ChromePHPFormatter()); + + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol')); + $socket->expects($this->at(0)) + ->method('write') + ->with("lol", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 $time $host php $pid - - "); + $socket->expects($this->at(1)) + ->method('write') + ->with("hej", "<".(LOG_AUTHPRIV + LOG_WARNING).">1 $time $host php $pid - - "); + + $handler->setSocket($socket); + + $handler->handle($this->getRecordWithMessage("hej\nlol")); + } + + public function testSplitWorksOnEmptyMsg() + { + $handler = new SyslogUdpHandler("127.0.0.1", 514, "authpriv"); + $handler->setFormatter($this->getIdentityFormatter()); + + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('write'), array('lol', 'lol')); + $socket->expects($this->never()) + ->method('write'); + + $handler->setSocket($socket); + + $handler->handle($this->getRecordWithMessage(null)); + } + + protected function getRecordWithMessage($msg) + { + return array('message' => $msg, 'level' => \Monolog\Logger::WARNING, 'context' => null, 'extra' => array(), 'channel' => 'lol'); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php new file mode 100644 index 0000000..a7c4fc9 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/TestHandlerTest.php @@ -0,0 +1,116 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +/** + * @covers Monolog\Handler\TestHandler + */ +class TestHandlerTest extends TestCase +{ + /** + * @dataProvider methodProvider + */ + public function testHandler($method, $level) + { + $handler = new TestHandler; + $record = $this->getRecord($level, 'test'.$method); + $this->assertFalse($handler->hasRecords($level)); + $this->assertFalse($handler->hasRecord($record, $level)); + $this->assertFalse($handler->{'has'.$method}($record), 'has'.$method); + $this->assertFalse($handler->{'has'.$method.'ThatContains'}('test'), 'has'.$method.'ThatContains'); + $this->assertFalse($handler->{'has'.$method.'ThatPasses'}(function ($rec) { + return true; + }), 'has'.$method.'ThatPasses'); + $this->assertFalse($handler->{'has'.$method.'ThatMatches'}('/test\w+/')); + $this->assertFalse($handler->{'has'.$method.'Records'}(), 'has'.$method.'Records'); + $handler->handle($record); + + $this->assertFalse($handler->{'has'.$method}('bar'), 'has'.$method); + $this->assertTrue($handler->hasRecords($level)); + $this->assertTrue($handler->hasRecord($record, $level)); + $this->assertTrue($handler->{'has'.$method}($record), 'has'.$method); + $this->assertTrue($handler->{'has'.$method}('test'.$method), 'has'.$method); + $this->assertTrue($handler->{'has'.$method.'ThatContains'}('test'), 'has'.$method.'ThatContains'); + $this->assertTrue($handler->{'has'.$method.'ThatPasses'}(function ($rec) { + return true; + }), 'has'.$method.'ThatPasses'); + $this->assertTrue($handler->{'has'.$method.'ThatMatches'}('/test\w+/')); + $this->assertTrue($handler->{'has'.$method.'Records'}(), 'has'.$method.'Records'); + + $records = $handler->getRecords(); + unset($records[0]['formatted']); + $this->assertEquals(array($record), $records); + } + + public function testHandlerAssertEmptyContext() { + $handler = new TestHandler; + $record = $this->getRecord(Logger::WARNING, 'test', array()); + $this->assertFalse($handler->hasWarning(array( + 'message' => 'test', + 'context' => array(), + ))); + + $handler->handle($record); + + $this->assertTrue($handler->hasWarning(array( + 'message' => 'test', + 'context' => array(), + ))); + $this->assertFalse($handler->hasWarning(array( + 'message' => 'test', + 'context' => array( + 'foo' => 'bar' + ), + ))); + } + + public function testHandlerAssertNonEmptyContext() { + $handler = new TestHandler; + $record = $this->getRecord(Logger::WARNING, 'test', array('foo' => 'bar')); + $this->assertFalse($handler->hasWarning(array( + 'message' => 'test', + 'context' => array( + 'foo' => 'bar' + ), + ))); + + $handler->handle($record); + + $this->assertTrue($handler->hasWarning(array( + 'message' => 'test', + 'context' => array( + 'foo' => 'bar' + ), + ))); + $this->assertFalse($handler->hasWarning(array( + 'message' => 'test', + 'context' => array(), + ))); + } + + public function methodProvider() + { + return array( + array('Emergency', Logger::EMERGENCY), + array('Alert' , Logger::ALERT), + array('Critical' , Logger::CRITICAL), + array('Error' , Logger::ERROR), + array('Warning' , Logger::WARNING), + array('Info' , Logger::INFO), + array('Notice' , Logger::NOTICE), + array('Debug' , Logger::DEBUG), + ); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php new file mode 100644 index 0000000..fa524d0 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/UdpSocketTest.php @@ -0,0 +1,64 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Handler\SyslogUdp\UdpSocket; + +/** + * @requires extension sockets + */ +class UdpSocketTest extends TestCase +{ + public function testWeDoNotTruncateShortMessages() + { + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol')); + + $socket->expects($this->at(0)) + ->method('send') + ->with("HEADER: The quick brown fox jumps over the lazy dog"); + + $socket->write("The quick brown fox jumps over the lazy dog", "HEADER: "); + } + + public function testLongMessagesAreTruncated() + { + $socket = $this->getMock('\Monolog\Handler\SyslogUdp\UdpSocket', array('send'), array('lol', 'lol')); + + $truncatedString = str_repeat("derp", 16254).'d'; + + $socket->expects($this->exactly(1)) + ->method('send') + ->with("HEADER" . $truncatedString); + + $longString = str_repeat("derp", 20000); + + $socket->write($longString, "HEADER"); + } + + public function testDoubleCloseDoesNotError() + { + $socket = new UdpSocket('127.0.0.1', 514); + $socket->close(); + $socket->close(); + } + + /** + * @expectedException LogicException + */ + public function testWriteAfterCloseErrors() + { + $socket = new UdpSocket('127.0.0.1', 514); + $socket->close(); + $socket->write('foo', "HEADER"); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php new file mode 100644 index 0000000..0594a23 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/WhatFailureGroupHandlerTest.php @@ -0,0 +1,144 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; +use Monolog\Logger; + +class WhatFailureGroupHandlerTest extends TestCase +{ + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::__construct + * @expectedException InvalidArgumentException + */ + public function testConstructorOnlyTakesHandler() + { + new WhatFailureGroupHandler(array(new TestHandler(), "foo")); + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::__construct + * @covers Monolog\Handler\WhatFailureGroupHandler::handle + */ + public function testHandle() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new WhatFailureGroupHandler($testHandlers); + $handler->handle($this->getRecord(Logger::DEBUG)); + $handler->handle($this->getRecord(Logger::INFO)); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch + */ + public function testHandleBatch() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new WhatFailureGroupHandler($testHandlers); + $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + } + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::isHandling + */ + public function testIsHandling() + { + $testHandlers = array(new TestHandler(Logger::ERROR), new TestHandler(Logger::WARNING)); + $handler = new WhatFailureGroupHandler($testHandlers); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::ERROR))); + $this->assertTrue($handler->isHandling($this->getRecord(Logger::WARNING))); + $this->assertFalse($handler->isHandling($this->getRecord(Logger::DEBUG))); + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handle + */ + public function testHandleUsesProcessors() + { + $test = new TestHandler(); + $handler = new WhatFailureGroupHandler(array($test)); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handleBatch + */ + public function testHandleBatchUsesProcessors() + { + $testHandlers = array(new TestHandler(), new TestHandler()); + $handler = new WhatFailureGroupHandler($testHandlers); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handleBatch(array($this->getRecord(Logger::DEBUG), $this->getRecord(Logger::INFO))); + foreach ($testHandlers as $test) { + $this->assertTrue($test->hasDebugRecords()); + $this->assertTrue($test->hasInfoRecords()); + $this->assertTrue(count($test->getRecords()) === 2); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + $this->assertTrue($records[1]['extra']['foo']); + } + } + + /** + * @covers Monolog\Handler\WhatFailureGroupHandler::handle + */ + public function testHandleException() + { + $test = new TestHandler(); + $exception = new ExceptionTestHandler(); + $handler = new WhatFailureGroupHandler(array($exception, $test, $exception)); + $handler->pushProcessor(function ($record) { + $record['extra']['foo'] = true; + + return $record; + }); + $handler->handle($this->getRecord(Logger::WARNING)); + $this->assertTrue($test->hasWarningRecords()); + $records = $test->getRecords(); + $this->assertTrue($records[0]['extra']['foo']); + } +} + +class ExceptionTestHandler extends TestHandler +{ + /** + * {@inheritdoc} + */ + public function handle(array $record) + { + parent::handle($record); + + throw new \Exception("ExceptionTestHandler::handle"); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php new file mode 100644 index 0000000..69b001e --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Handler/ZendMonitorHandlerTest.php @@ -0,0 +1,69 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Handler; + +use Monolog\TestCase; + +class ZendMonitorHandlerTest extends TestCase +{ + protected $zendMonitorHandler; + + public function setUp() + { + if (!function_exists('zend_monitor_custom_event')) { + $this->markTestSkipped('ZendServer is not installed'); + } + } + + /** + * @covers Monolog\Handler\ZendMonitorHandler::write + */ + public function testWrite() + { + $record = $this->getRecord(); + $formatterResult = array( + 'message' => $record['message'], + ); + + $zendMonitor = $this->getMockBuilder('Monolog\Handler\ZendMonitorHandler') + ->setMethods(array('writeZendMonitorCustomEvent', 'getDefaultFormatter')) + ->getMock(); + + $formatterMock = $this->getMockBuilder('Monolog\Formatter\NormalizerFormatter') + ->disableOriginalConstructor() + ->getMock(); + + $formatterMock->expects($this->once()) + ->method('format') + ->will($this->returnValue($formatterResult)); + + $zendMonitor->expects($this->once()) + ->method('getDefaultFormatter') + ->will($this->returnValue($formatterMock)); + + $levelMap = $zendMonitor->getLevelMap(); + + $zendMonitor->expects($this->once()) + ->method('writeZendMonitorCustomEvent') + ->with($levelMap[$record['level']], $record['message'], $formatterResult); + + $zendMonitor->handle($record); + } + + /** + * @covers Monolog\Handler\ZendMonitorHandler::getDefaultFormatter + */ + public function testGetDefaultFormatterReturnsNormalizerFormatter() + { + $zendMonitor = new ZendMonitorHandler(); + $this->assertInstanceOf('Monolog\Formatter\NormalizerFormatter', $zendMonitor->getDefaultFormatter()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/LoggerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/LoggerTest.php new file mode 100644 index 0000000..442e87d --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/LoggerTest.php @@ -0,0 +1,690 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Processor\WebProcessor; +use Monolog\Handler\TestHandler; + +class LoggerTest extends \PHPUnit_Framework_TestCase +{ + /** + * @covers Monolog\Logger::getName + */ + public function testGetName() + { + $logger = new Logger('foo'); + $this->assertEquals('foo', $logger->getName()); + } + + /** + * @covers Monolog\Logger::getLevelName + */ + public function testGetLevelName() + { + $this->assertEquals('ERROR', Logger::getLevelName(Logger::ERROR)); + } + + /** + * @covers Monolog\Logger::withName + */ + public function testWithName() + { + $first = new Logger('first', array($handler = new TestHandler())); + $second = $first->withName('second'); + + $this->assertSame('first', $first->getName()); + $this->assertSame('second', $second->getName()); + $this->assertSame($handler, $second->popHandler()); + } + + /** + * @covers Monolog\Logger::toMonologLevel + */ + public function testConvertPSR3ToMonologLevel() + { + $this->assertEquals(Logger::toMonologLevel('debug'), 100); + $this->assertEquals(Logger::toMonologLevel('info'), 200); + $this->assertEquals(Logger::toMonologLevel('notice'), 250); + $this->assertEquals(Logger::toMonologLevel('warning'), 300); + $this->assertEquals(Logger::toMonologLevel('error'), 400); + $this->assertEquals(Logger::toMonologLevel('critical'), 500); + $this->assertEquals(Logger::toMonologLevel('alert'), 550); + $this->assertEquals(Logger::toMonologLevel('emergency'), 600); + } + + /** + * @covers Monolog\Logger::getLevelName + * @expectedException InvalidArgumentException + */ + public function testGetLevelNameThrows() + { + Logger::getLevelName(5); + } + + /** + * @covers Monolog\Logger::__construct + */ + public function testChannel() + { + $logger = new Logger('foo'); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->addWarning('test'); + list($record) = $handler->getRecords(); + $this->assertEquals('foo', $record['channel']); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testLog() + { + $logger = new Logger(__METHOD__); + + $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle')); + $handler->expects($this->once()) + ->method('handle'); + $logger->pushHandler($handler); + + $this->assertTrue($logger->addWarning('test')); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testLogNotHandled() + { + $logger = new Logger(__METHOD__); + + $handler = $this->getMock('Monolog\Handler\NullHandler', array('handle'), array(Logger::ERROR)); + $handler->expects($this->never()) + ->method('handle'); + $logger->pushHandler($handler); + + $this->assertFalse($logger->addWarning('test')); + } + + public function testHandlersInCtor() + { + $handler1 = new TestHandler; + $handler2 = new TestHandler; + $logger = new Logger(__METHOD__, array($handler1, $handler2)); + + $this->assertEquals($handler1, $logger->popHandler()); + $this->assertEquals($handler2, $logger->popHandler()); + } + + public function testProcessorsInCtor() + { + $processor1 = new WebProcessor; + $processor2 = new WebProcessor; + $logger = new Logger(__METHOD__, array(), array($processor1, $processor2)); + + $this->assertEquals($processor1, $logger->popProcessor()); + $this->assertEquals($processor2, $logger->popProcessor()); + } + + /** + * @covers Monolog\Logger::pushHandler + * @covers Monolog\Logger::popHandler + * @expectedException LogicException + */ + public function testPushPopHandler() + { + $logger = new Logger(__METHOD__); + $handler1 = new TestHandler; + $handler2 = new TestHandler; + + $logger->pushHandler($handler1); + $logger->pushHandler($handler2); + + $this->assertEquals($handler2, $logger->popHandler()); + $this->assertEquals($handler1, $logger->popHandler()); + $logger->popHandler(); + } + + /** + * @covers Monolog\Logger::setHandlers + */ + public function testSetHandlers() + { + $logger = new Logger(__METHOD__); + $handler1 = new TestHandler; + $handler2 = new TestHandler; + + $logger->pushHandler($handler1); + $logger->setHandlers(array($handler2)); + + // handler1 has been removed + $this->assertEquals(array($handler2), $logger->getHandlers()); + + $logger->setHandlers(array( + "AMapKey" => $handler1, + "Woop" => $handler2, + )); + + // Keys have been scrubbed + $this->assertEquals(array($handler1, $handler2), $logger->getHandlers()); + } + + /** + * @covers Monolog\Logger::pushProcessor + * @covers Monolog\Logger::popProcessor + * @expectedException LogicException + */ + public function testPushPopProcessor() + { + $logger = new Logger(__METHOD__); + $processor1 = new WebProcessor; + $processor2 = new WebProcessor; + + $logger->pushProcessor($processor1); + $logger->pushProcessor($processor2); + + $this->assertEquals($processor2, $logger->popProcessor()); + $this->assertEquals($processor1, $logger->popProcessor()); + $logger->popProcessor(); + } + + /** + * @covers Monolog\Logger::pushProcessor + * @expectedException InvalidArgumentException + */ + public function testPushProcessorWithNonCallable() + { + $logger = new Logger(__METHOD__); + + $logger->pushProcessor(new \stdClass()); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testProcessorsAreExecuted() + { + $logger = new Logger(__METHOD__); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->pushProcessor(function ($record) { + $record['extra']['win'] = true; + + return $record; + }); + $logger->addError('test'); + list($record) = $handler->getRecords(); + $this->assertTrue($record['extra']['win']); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testProcessorsAreCalledOnlyOnce() + { + $logger = new Logger(__METHOD__); + $handler = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler->expects($this->any()) + ->method('handle') + ->will($this->returnValue(true)) + ; + $logger->pushHandler($handler); + + $processor = $this->getMockBuilder('Monolog\Processor\WebProcessor') + ->disableOriginalConstructor() + ->setMethods(array('__invoke')) + ->getMock() + ; + $processor->expects($this->once()) + ->method('__invoke') + ->will($this->returnArgument(0)) + ; + $logger->pushProcessor($processor); + + $logger->addError('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testProcessorsNotCalledWhenNotHandled() + { + $logger = new Logger(__METHOD__); + $handler = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler); + $that = $this; + $logger->pushProcessor(function ($record) use ($that) { + $that->fail('The processor should not be called'); + }); + $logger->addAlert('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testHandlersNotCalledBeforeFirstHandling() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->never()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $handler1->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler1); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler2); + + $handler3 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler3->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $handler3->expects($this->never()) + ->method('handle') + ; + $logger->pushHandler($handler3); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testHandlersNotCalledBeforeFirstHandlingWithAssocArray() + { + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->never()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $handler1->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + + $handler3 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler3->expects($this->once()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + $handler3->expects($this->never()) + ->method('handle') + ; + + $logger = new Logger(__METHOD__, array('last' => $handler3, 'second' => $handler2, 'first' => $handler1)); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testBubblingWhenTheHandlerReturnsFalse() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler1->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler1); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(false)) + ; + $logger->pushHandler($handler2); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::addRecord + */ + public function testNotBubblingWhenTheHandlerReturnsTrue() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler1->expects($this->never()) + ->method('handle') + ; + $logger->pushHandler($handler1); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler2->expects($this->once()) + ->method('handle') + ->will($this->returnValue(true)) + ; + $logger->pushHandler($handler2); + + $logger->debug('test'); + } + + /** + * @covers Monolog\Logger::isHandling + */ + public function testIsHandling() + { + $logger = new Logger(__METHOD__); + + $handler1 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler1->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(false)) + ; + + $logger->pushHandler($handler1); + $this->assertFalse($logger->isHandling(Logger::DEBUG)); + + $handler2 = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler2->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + + $logger->pushHandler($handler2); + $this->assertTrue($logger->isHandling(Logger::DEBUG)); + } + + /** + * @dataProvider logMethodProvider + * @covers Monolog\Logger::addDebug + * @covers Monolog\Logger::addInfo + * @covers Monolog\Logger::addNotice + * @covers Monolog\Logger::addWarning + * @covers Monolog\Logger::addError + * @covers Monolog\Logger::addCritical + * @covers Monolog\Logger::addAlert + * @covers Monolog\Logger::addEmergency + * @covers Monolog\Logger::debug + * @covers Monolog\Logger::info + * @covers Monolog\Logger::notice + * @covers Monolog\Logger::warn + * @covers Monolog\Logger::err + * @covers Monolog\Logger::crit + * @covers Monolog\Logger::alert + * @covers Monolog\Logger::emerg + */ + public function testLogMethods($method, $expectedLevel) + { + $logger = new Logger('foo'); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->{$method}('test'); + list($record) = $handler->getRecords(); + $this->assertEquals($expectedLevel, $record['level']); + } + + public function logMethodProvider() + { + return array( + // monolog methods + array('addDebug', Logger::DEBUG), + array('addInfo', Logger::INFO), + array('addNotice', Logger::NOTICE), + array('addWarning', Logger::WARNING), + array('addError', Logger::ERROR), + array('addCritical', Logger::CRITICAL), + array('addAlert', Logger::ALERT), + array('addEmergency', Logger::EMERGENCY), + + // ZF/Sf2 compat methods + array('debug', Logger::DEBUG), + array('info', Logger::INFO), + array('notice', Logger::NOTICE), + array('warn', Logger::WARNING), + array('err', Logger::ERROR), + array('crit', Logger::CRITICAL), + array('alert', Logger::ALERT), + array('emerg', Logger::EMERGENCY), + ); + } + + /** + * @dataProvider setTimezoneProvider + * @covers Monolog\Logger::setTimezone + */ + public function testSetTimezone($tz) + { + Logger::setTimezone($tz); + $logger = new Logger('foo'); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->info('test'); + list($record) = $handler->getRecords(); + $this->assertEquals($tz, $record['datetime']->getTimezone()); + } + + public function setTimezoneProvider() + { + return array_map( + function ($tz) { return array(new \DateTimeZone($tz)); }, + \DateTimeZone::listIdentifiers() + ); + } + + /** + * @dataProvider useMicrosecondTimestampsProvider + * @covers Monolog\Logger::useMicrosecondTimestamps + * @covers Monolog\Logger::addRecord + */ + public function testUseMicrosecondTimestamps($micro, $assert) + { + $logger = new Logger('foo'); + $logger->useMicrosecondTimestamps($micro); + $handler = new TestHandler; + $logger->pushHandler($handler); + $logger->info('test'); + list($record) = $handler->getRecords(); + $this->{$assert}('000000', $record['datetime']->format('u')); + } + + public function useMicrosecondTimestampsProvider() + { + return array( + // this has a very small chance of a false negative (1/10^6) + 'with microseconds' => array(true, 'assertNotSame'), + 'without microseconds' => array(false, PHP_VERSION_ID >= 70100 ? 'assertNotSame' : 'assertSame'), + ); + } + + /** + * @covers Monolog\Logger::setExceptionHandler + */ + public function testSetExceptionHandler() + { + $logger = new Logger(__METHOD__); + $this->assertNull($logger->getExceptionHandler()); + $callback = function ($ex) { + }; + $logger->setExceptionHandler($callback); + $this->assertEquals($callback, $logger->getExceptionHandler()); + } + + /** + * @covers Monolog\Logger::setExceptionHandler + * @expectedException InvalidArgumentException + */ + public function testBadExceptionHandlerType() + { + $logger = new Logger(__METHOD__); + $logger->setExceptionHandler(false); + } + + /** + * @covers Monolog\Logger::handleException + * @expectedException Exception + */ + public function testDefaultHandleException() + { + $logger = new Logger(__METHOD__); + $handler = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler->expects($this->any()) + ->method('handle') + ->will($this->throwException(new \Exception('Some handler exception'))) + ; + $logger->pushHandler($handler); + $logger->info('test'); + } + + /** + * @covers Monolog\Logger::handleException + * @covers Monolog\Logger::addRecord + */ + public function testCustomHandleException() + { + $logger = new Logger(__METHOD__); + $that = $this; + $logger->setExceptionHandler(function ($e, $record) use ($that) { + $that->assertEquals($e->getMessage(), 'Some handler exception'); + $that->assertTrue(is_array($record)); + $that->assertEquals($record['message'], 'test'); + }); + $handler = $this->getMock('Monolog\Handler\HandlerInterface'); + $handler->expects($this->any()) + ->method('isHandling') + ->will($this->returnValue(true)) + ; + $handler->expects($this->any()) + ->method('handle') + ->will($this->throwException(new \Exception('Some handler exception'))) + ; + $logger->pushHandler($handler); + $logger->info('test'); + } + + public function testReset() + { + $logger = new Logger('app'); + + $testHandler = new Handler\TestHandler(); + $bufferHandler = new Handler\BufferHandler($testHandler); + $groupHandler = new Handler\GroupHandler(array($bufferHandler)); + $fingersCrossedHandler = new Handler\FingersCrossedHandler($groupHandler); + + $logger->pushHandler($fingersCrossedHandler); + + $processorUid1 = new Processor\UidProcessor(10); + $uid1 = $processorUid1->getUid(); + $groupHandler->pushProcessor($processorUid1); + + $processorUid2 = new Processor\UidProcessor(5); + $uid2 = $processorUid2->getUid(); + $logger->pushProcessor($processorUid2); + + $getProperty = function ($object, $property) { + $reflectionProperty = new \ReflectionProperty(get_class($object), $property); + $reflectionProperty->setAccessible(true); + + return $reflectionProperty->getValue($object); + }; + $that = $this; + $assertBufferOfBufferHandlerEmpty = function () use ($getProperty, $bufferHandler, $that) { + $that->assertEmpty($getProperty($bufferHandler, 'buffer')); + }; + $assertBuffersEmpty = function() use ($assertBufferOfBufferHandlerEmpty, $getProperty, $fingersCrossedHandler, $that) { + $assertBufferOfBufferHandlerEmpty(); + $that->assertEmpty($getProperty($fingersCrossedHandler, 'buffer')); + }; + + $logger->debug('debug'); + $logger->reset(); + $assertBuffersEmpty(); + $this->assertFalse($testHandler->hasDebugRecords()); + $this->assertFalse($testHandler->hasErrorRecords()); + $this->assertNotSame($uid1, $uid1 = $processorUid1->getUid()); + $this->assertNotSame($uid2, $uid2 = $processorUid2->getUid()); + + $logger->debug('debug'); + $logger->error('error'); + $logger->reset(); + $assertBuffersEmpty(); + $this->assertTrue($testHandler->hasDebugRecords()); + $this->assertTrue($testHandler->hasErrorRecords()); + $this->assertNotSame($uid1, $uid1 = $processorUid1->getUid()); + $this->assertNotSame($uid2, $uid2 = $processorUid2->getUid()); + + $logger->info('info'); + $this->assertNotEmpty($getProperty($fingersCrossedHandler, 'buffer')); + $assertBufferOfBufferHandlerEmpty(); + $this->assertFalse($testHandler->hasInfoRecords()); + + $logger->reset(); + $assertBuffersEmpty(); + $this->assertFalse($testHandler->hasInfoRecords()); + $this->assertNotSame($uid1, $uid1 = $processorUid1->getUid()); + $this->assertNotSame($uid2, $uid2 = $processorUid2->getUid()); + + $logger->notice('notice'); + $logger->emergency('emergency'); + $logger->reset(); + $assertBuffersEmpty(); + $this->assertFalse($testHandler->hasInfoRecords()); + $this->assertTrue($testHandler->hasNoticeRecords()); + $this->assertTrue($testHandler->hasEmergencyRecords()); + $this->assertNotSame($uid1, $processorUid1->getUid()); + $this->assertNotSame($uid2, $processorUid2->getUid()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php new file mode 100644 index 0000000..5adb505 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/GitProcessorTest.php @@ -0,0 +1,29 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class GitProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\GitProcessor::__invoke + */ + public function testProcessor() + { + $processor = new GitProcessor(); + $record = $processor($this->getRecord()); + + $this->assertArrayHasKey('git', $record['extra']); + $this->assertTrue(!is_array($record['extra']['git']['branch'])); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php new file mode 100644 index 0000000..0dd411d --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/IntrospectionProcessorTest.php @@ -0,0 +1,123 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Acme; + +class Tester +{ + public function test($handler, $record) + { + $handler->handle($record); + } +} + +function tester($handler, $record) +{ + $handler->handle($record); +} + +namespace Monolog\Processor; + +use Monolog\Logger; +use Monolog\TestCase; +use Monolog\Handler\TestHandler; + +class IntrospectionProcessorTest extends TestCase +{ + public function getHandler() + { + $processor = new IntrospectionProcessor(); + $handler = new TestHandler(); + $handler->pushProcessor($processor); + + return $handler; + } + + public function testProcessorFromClass() + { + $handler = $this->getHandler(); + $tester = new \Acme\Tester; + $tester->test($handler, $this->getRecord()); + list($record) = $handler->getRecords(); + $this->assertEquals(__FILE__, $record['extra']['file']); + $this->assertEquals(18, $record['extra']['line']); + $this->assertEquals('Acme\Tester', $record['extra']['class']); + $this->assertEquals('test', $record['extra']['function']); + } + + public function testProcessorFromFunc() + { + $handler = $this->getHandler(); + \Acme\tester($handler, $this->getRecord()); + list($record) = $handler->getRecords(); + $this->assertEquals(__FILE__, $record['extra']['file']); + $this->assertEquals(24, $record['extra']['line']); + $this->assertEquals(null, $record['extra']['class']); + $this->assertEquals('Acme\tester', $record['extra']['function']); + } + + public function testLevelTooLow() + { + $input = array( + 'level' => Logger::DEBUG, + 'extra' => array(), + ); + + $expected = $input; + + $processor = new IntrospectionProcessor(Logger::CRITICAL); + $actual = $processor($input); + + $this->assertEquals($expected, $actual); + } + + public function testLevelEqual() + { + $input = array( + 'level' => Logger::CRITICAL, + 'extra' => array(), + ); + + $expected = $input; + $expected['extra'] = array( + 'file' => null, + 'line' => null, + 'class' => 'ReflectionMethod', + 'function' => 'invokeArgs', + ); + + $processor = new IntrospectionProcessor(Logger::CRITICAL); + $actual = $processor($input); + + $this->assertEquals($expected, $actual); + } + + public function testLevelHigher() + { + $input = array( + 'level' => Logger::EMERGENCY, + 'extra' => array(), + ); + + $expected = $input; + $expected['extra'] = array( + 'file' => null, + 'line' => null, + 'class' => 'ReflectionMethod', + 'function' => 'invokeArgs', + ); + + $processor = new IntrospectionProcessor(Logger::CRITICAL); + $actual = $processor($input); + + $this->assertEquals($expected, $actual); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php new file mode 100644 index 0000000..eb66614 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MemoryPeakUsageProcessorTest.php @@ -0,0 +1,42 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class MemoryPeakUsageProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessor() + { + $processor = new MemoryPeakUsageProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_peak_usage', $record['extra']); + $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_peak_usage']); + } + + /** + * @covers Monolog\Processor\MemoryPeakUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessorWithoutFormatting() + { + $processor = new MemoryPeakUsageProcessor(true, false); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_peak_usage', $record['extra']); + $this->assertInternalType('int', $record['extra']['memory_peak_usage']); + $this->assertGreaterThan(0, $record['extra']['memory_peak_usage']); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php new file mode 100644 index 0000000..4692dbf --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MemoryUsageProcessorTest.php @@ -0,0 +1,42 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class MemoryUsageProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\MemoryUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessor() + { + $processor = new MemoryUsageProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_usage', $record['extra']); + $this->assertRegExp('#[0-9.]+ (M|K)?B$#', $record['extra']['memory_usage']); + } + + /** + * @covers Monolog\Processor\MemoryUsageProcessor::__invoke + * @covers Monolog\Processor\MemoryProcessor::formatBytes + */ + public function testProcessorWithoutFormatting() + { + $processor = new MemoryUsageProcessor(true, false); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('memory_usage', $record['extra']); + $this->assertInternalType('int', $record['extra']['memory_usage']); + $this->assertGreaterThan(0, $record['extra']['memory_usage']); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MercurialProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MercurialProcessorTest.php new file mode 100644 index 0000000..11f2b35 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/MercurialProcessorTest.php @@ -0,0 +1,41 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class MercurialProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\MercurialProcessor::__invoke + */ + public function testProcessor() + { + if (defined('PHP_WINDOWS_VERSION_BUILD')) { + exec("where hg 2>NUL", $output, $result); + } else { + exec("which hg 2>/dev/null >/dev/null", $output, $result); + } + if ($result != 0) { + $this->markTestSkipped('hg is missing'); + return; + } + + `hg init`; + $processor = new MercurialProcessor(); + $record = $processor($this->getRecord()); + + $this->assertArrayHasKey('hg', $record['extra']); + $this->assertTrue(!is_array($record['extra']['hg']['branch'])); + $this->assertTrue(!is_array($record['extra']['hg']['revision'])); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php new file mode 100644 index 0000000..458d2a3 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/ProcessIdProcessorTest.php @@ -0,0 +1,30 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class ProcessIdProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\ProcessIdProcessor::__invoke + */ + public function testProcessor() + { + $processor = new ProcessIdProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('process_id', $record['extra']); + $this->assertInternalType('int', $record['extra']['process_id']); + $this->assertGreaterThan(0, $record['extra']['process_id']); + $this->assertEquals(getmypid(), $record['extra']['process_id']); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php new file mode 100644 index 0000000..029a0c0 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/PsrLogMessageProcessorTest.php @@ -0,0 +1,43 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +class PsrLogMessageProcessorTest extends \PHPUnit_Framework_TestCase +{ + /** + * @dataProvider getPairs + */ + public function testReplacement($val, $expected) + { + $proc = new PsrLogMessageProcessor; + + $message = $proc(array( + 'message' => '{foo}', + 'context' => array('foo' => $val), + )); + $this->assertEquals($expected, $message['message']); + } + + public function getPairs() + { + return array( + array('foo', 'foo'), + array('3', '3'), + array(3, '3'), + array(null, ''), + array(true, '1'), + array(false, ''), + array(new \stdClass, '[object stdClass]'), + array(array(), '[array]'), + ); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php new file mode 100644 index 0000000..0d860c6 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/TagProcessorTest.php @@ -0,0 +1,49 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class TagProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\TagProcessor::__invoke + */ + public function testProcessor() + { + $tags = array(1, 2, 3); + $processor = new TagProcessor($tags); + $record = $processor($this->getRecord()); + + $this->assertEquals($tags, $record['extra']['tags']); + } + + /** + * @covers Monolog\Processor\TagProcessor::__invoke + */ + public function testProcessorTagModification() + { + $tags = array(1, 2, 3); + $processor = new TagProcessor($tags); + + $record = $processor($this->getRecord()); + $this->assertEquals($tags, $record['extra']['tags']); + + $processor->setTags(array('a', 'b')); + $record = $processor($this->getRecord()); + $this->assertEquals(array('a', 'b'), $record['extra']['tags']); + + $processor->addTags(array('a', 'c', 'foo' => 'bar')); + $record = $processor($this->getRecord()); + $this->assertEquals(array('a', 'b', 'a', 'c', 'foo' => 'bar'), $record['extra']['tags']); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php new file mode 100644 index 0000000..5d13058 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/UidProcessorTest.php @@ -0,0 +1,33 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class UidProcessorTest extends TestCase +{ + /** + * @covers Monolog\Processor\UidProcessor::__invoke + */ + public function testProcessor() + { + $processor = new UidProcessor(); + $record = $processor($this->getRecord()); + $this->assertArrayHasKey('uid', $record['extra']); + } + + public function testGetUid() + { + $processor = new UidProcessor(10); + $this->assertEquals(10, strlen($processor->getUid())); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php new file mode 100644 index 0000000..4105baf --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/Processor/WebProcessorTest.php @@ -0,0 +1,113 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog\Processor; + +use Monolog\TestCase; + +class WebProcessorTest extends TestCase +{ + public function testProcessor() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'HTTP_REFERER' => 'D', + 'SERVER_NAME' => 'F', + 'UNIQUE_ID' => 'G', + ); + + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertEquals($server['REQUEST_URI'], $record['extra']['url']); + $this->assertEquals($server['REMOTE_ADDR'], $record['extra']['ip']); + $this->assertEquals($server['REQUEST_METHOD'], $record['extra']['http_method']); + $this->assertEquals($server['HTTP_REFERER'], $record['extra']['referrer']); + $this->assertEquals($server['SERVER_NAME'], $record['extra']['server']); + $this->assertEquals($server['UNIQUE_ID'], $record['extra']['unique_id']); + } + + public function testProcessorDoNothingIfNoRequestUri() + { + $server = array( + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + ); + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertEmpty($record['extra']); + } + + public function testProcessorReturnNullIfNoHttpReferer() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertNull($record['extra']['referrer']); + } + + public function testProcessorDoesNotAddUniqueIdIfNotPresent() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + $processor = new WebProcessor($server); + $record = $processor($this->getRecord()); + $this->assertFalse(isset($record['extra']['unique_id'])); + } + + public function testProcessorAddsOnlyRequestedExtraFields() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + + $processor = new WebProcessor($server, array('url', 'http_method')); + $record = $processor($this->getRecord()); + + $this->assertSame(array('url' => 'A', 'http_method' => 'C'), $record['extra']); + } + + public function testProcessorConfiguringOfExtraFields() + { + $server = array( + 'REQUEST_URI' => 'A', + 'REMOTE_ADDR' => 'B', + 'REQUEST_METHOD' => 'C', + 'SERVER_NAME' => 'F', + ); + + $processor = new WebProcessor($server, array('url' => 'REMOTE_ADDR')); + $record = $processor($this->getRecord()); + + $this->assertSame(array('url' => 'B'), $record['extra']); + } + + /** + * @expectedException UnexpectedValueException + */ + public function testInvalidData() + { + new WebProcessor(new \stdClass); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php new file mode 100644 index 0000000..ab89944 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/PsrLogCompatTest.php @@ -0,0 +1,47 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Handler\TestHandler; +use Monolog\Formatter\LineFormatter; +use Monolog\Processor\PsrLogMessageProcessor; +use Psr\Log\Test\LoggerInterfaceTest; + +class PsrLogCompatTest extends LoggerInterfaceTest +{ + private $handler; + + public function getLogger() + { + $logger = new Logger('foo'); + $logger->pushHandler($handler = new TestHandler); + $logger->pushProcessor(new PsrLogMessageProcessor); + $handler->setFormatter(new LineFormatter('%level_name% %message%')); + + $this->handler = $handler; + + return $logger; + } + + public function getLogs() + { + $convert = function ($record) { + $lower = function ($match) { + return strtolower($match[0]); + }; + + return preg_replace_callback('{^[A-Z]+}', $lower, $record['formatted']); + }; + + return array_map($convert, $this->handler->getRecords()); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/RegistryTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/RegistryTest.php new file mode 100644 index 0000000..15fdfbd --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/RegistryTest.php @@ -0,0 +1,153 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +class RegistryTest extends \PHPUnit_Framework_TestCase +{ + protected function setUp() + { + Registry::clear(); + } + + /** + * @dataProvider hasLoggerProvider + * @covers Monolog\Registry::hasLogger + */ + public function testHasLogger(array $loggersToAdd, array $loggersToCheck, array $expectedResult) + { + foreach ($loggersToAdd as $loggerToAdd) { + Registry::addLogger($loggerToAdd); + } + foreach ($loggersToCheck as $index => $loggerToCheck) { + $this->assertSame($expectedResult[$index], Registry::hasLogger($loggerToCheck)); + } + } + + public function hasLoggerProvider() + { + $logger1 = new Logger('test1'); + $logger2 = new Logger('test2'); + $logger3 = new Logger('test3'); + + return array( + // only instances + array( + array($logger1), + array($logger1, $logger2), + array(true, false), + ), + // only names + array( + array($logger1), + array('test1', 'test2'), + array(true, false), + ), + // mixed case + array( + array($logger1, $logger2), + array('test1', $logger2, 'test3', $logger3), + array(true, true, false, false), + ), + ); + } + + /** + * @covers Monolog\Registry::clear + */ + public function testClearClears() + { + Registry::addLogger(new Logger('test1'), 'log'); + Registry::clear(); + + $this->setExpectedException('\InvalidArgumentException'); + Registry::getInstance('log'); + } + + /** + * @dataProvider removedLoggerProvider + * @covers Monolog\Registry::addLogger + * @covers Monolog\Registry::removeLogger + */ + public function testRemovesLogger($loggerToAdd, $remove) + { + Registry::addLogger($loggerToAdd); + Registry::removeLogger($remove); + + $this->setExpectedException('\InvalidArgumentException'); + Registry::getInstance($loggerToAdd->getName()); + } + + public function removedLoggerProvider() + { + $logger1 = new Logger('test1'); + + return array( + array($logger1, $logger1), + array($logger1, 'test1'), + ); + } + + /** + * @covers Monolog\Registry::addLogger + * @covers Monolog\Registry::getInstance + * @covers Monolog\Registry::__callStatic + */ + public function testGetsSameLogger() + { + $logger1 = new Logger('test1'); + $logger2 = new Logger('test2'); + + Registry::addLogger($logger1, 'test1'); + Registry::addLogger($logger2); + + $this->assertSame($logger1, Registry::getInstance('test1')); + $this->assertSame($logger2, Registry::test2()); + } + + /** + * @expectedException \InvalidArgumentException + * @covers Monolog\Registry::getInstance + */ + public function testFailsOnNonExistantLogger() + { + Registry::getInstance('test1'); + } + + /** + * @covers Monolog\Registry::addLogger + */ + public function testReplacesLogger() + { + $log1 = new Logger('test1'); + $log2 = new Logger('test2'); + + Registry::addLogger($log1, 'log'); + + Registry::addLogger($log2, 'log', true); + + $this->assertSame($log2, Registry::getInstance('log')); + } + + /** + * @expectedException \InvalidArgumentException + * @covers Monolog\Registry::addLogger + */ + public function testFailsOnUnspecifiedReplacement() + { + $log1 = new Logger('test1'); + $log2 = new Logger('test2'); + + Registry::addLogger($log1, 'log'); + + Registry::addLogger($log2, 'log'); + } +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/SignalHandlerTest.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/SignalHandlerTest.php new file mode 100644 index 0000000..9fa0792 --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/SignalHandlerTest.php @@ -0,0 +1,287 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +use Monolog\Handler\StreamHandler; +use Monolog\Handler\TestHandler; +use Psr\Log\LogLevel; + +/** + * @author Robert Gust-Bardon + * @covers Monolog\SignalHandler + */ +class SignalHandlerTest extends TestCase +{ + + private $asyncSignalHandling; + private $blockedSignals; + private $signalHandlers; + + protected function setUp() + { + $this->signalHandlers = array(); + if (extension_loaded('pcntl')) { + if (function_exists('pcntl_async_signals')) { + $this->asyncSignalHandling = pcntl_async_signals(); + } + if (function_exists('pcntl_sigprocmask')) { + pcntl_sigprocmask(SIG_BLOCK, array(), $this->blockedSignals); + } + } + } + + protected function tearDown() + { + if ($this->asyncSignalHandling !== null) { + pcntl_async_signals($this->asyncSignalHandling); + } + if ($this->blockedSignals !== null) { + pcntl_sigprocmask(SIG_SETMASK, $this->blockedSignals); + } + if ($this->signalHandlers) { + pcntl_signal_dispatch(); + foreach ($this->signalHandlers as $signo => $handler) { + pcntl_signal($signo, $handler); + } + } + } + + private function setSignalHandler($signo, $handler = SIG_DFL) { + if (function_exists('pcntl_signal_get_handler')) { + $this->signalHandlers[$signo] = pcntl_signal_get_handler($signo); + } else { + $this->signalHandlers[$signo] = SIG_DFL; + } + $this->assertTrue(pcntl_signal($signo, $handler)); + } + + public function testHandleSignal() + { + $logger = new Logger('test', array($handler = new TestHandler)); + $errHandler = new SignalHandler($logger); + $signo = 2; // SIGINT. + $siginfo = array('signo' => $signo, 'errno' => 0, 'code' => 0); + $errHandler->handleSignal($signo, $siginfo); + $this->assertCount(1, $handler->getRecords()); + $this->assertTrue($handler->hasCriticalRecords()); + $records = $handler->getRecords(); + $this->assertSame($siginfo, $records[0]['context']); + } + + /** + * @depends testHandleSignal + * @requires extension pcntl + * @requires extension posix + * @requires function pcntl_signal + * @requires function pcntl_signal_dispatch + * @requires function posix_getpid + * @requires function posix_kill + */ + public function testRegisterSignalHandler() + { + // SIGCONT and SIGURG should be ignored by default. + if (!defined('SIGCONT') || !defined('SIGURG')) { + $this->markTestSkipped('This test requires the SIGCONT and SIGURG pcntl constants.'); + } + + $this->setSignalHandler(SIGCONT, SIG_IGN); + $this->setSignalHandler(SIGURG, SIG_IGN); + + $logger = new Logger('test', array($handler = new TestHandler)); + $errHandler = new SignalHandler($logger); + $pid = posix_getpid(); + + $this->assertTrue(posix_kill($pid, SIGURG)); + $this->assertTrue(pcntl_signal_dispatch()); + $this->assertCount(0, $handler->getRecords()); + + $errHandler->registerSignalHandler(SIGURG, LogLevel::INFO, false, false, false); + + $this->assertTrue(posix_kill($pid, SIGCONT)); + $this->assertTrue(pcntl_signal_dispatch()); + $this->assertCount(0, $handler->getRecords()); + + $this->assertTrue(posix_kill($pid, SIGURG)); + $this->assertTrue(pcntl_signal_dispatch()); + $this->assertCount(1, $handler->getRecords()); + $this->assertTrue($handler->hasInfoThatContains('SIGURG')); + } + + /** + * @dataProvider defaultPreviousProvider + * @depends testRegisterSignalHandler + * @requires function pcntl_fork + * @requires function pcntl_sigprocmask + * @requires function pcntl_waitpid + */ + public function testRegisterDefaultPreviousSignalHandler($signo, $callPrevious, $expected) + { + $this->setSignalHandler($signo, SIG_DFL); + + $path = tempnam(sys_get_temp_dir(), 'monolog-'); + $this->assertNotFalse($path); + + $pid = pcntl_fork(); + if ($pid === 0) { // Child. + $streamHandler = new StreamHandler($path); + $streamHandler->setFormatter($this->getIdentityFormatter()); + $logger = new Logger('test', array($streamHandler)); + $errHandler = new SignalHandler($logger); + $errHandler->registerSignalHandler($signo, LogLevel::INFO, $callPrevious, false, false); + pcntl_sigprocmask(SIG_SETMASK, array(SIGCONT)); + posix_kill(posix_getpid(), $signo); + pcntl_signal_dispatch(); + // If $callPrevious is true, SIGINT should terminate by this line. + pcntl_sigprocmask(SIG_BLOCK, array(), $oldset); + file_put_contents($path, implode(' ', $oldset), FILE_APPEND); + posix_kill(posix_getpid(), $signo); + pcntl_signal_dispatch(); + exit(); + } + + $this->assertNotSame(-1, $pid); + $this->assertNotSame(-1, pcntl_waitpid($pid, $status)); + $this->assertNotSame(-1, $status); + $this->assertSame($expected, file_get_contents($path)); + } + + public function defaultPreviousProvider() + { + if (!defined('SIGCONT') || !defined('SIGINT') || !defined('SIGURG')) { + return array(); + } + + return array( + array(SIGINT, false, 'Program received signal SIGINT'.SIGCONT.'Program received signal SIGINT'), + array(SIGINT, true, 'Program received signal SIGINT'), + array(SIGURG, false, 'Program received signal SIGURG'.SIGCONT.'Program received signal SIGURG'), + array(SIGURG, true, 'Program received signal SIGURG'.SIGCONT.'Program received signal SIGURG'), + ); + } + + /** + * @dataProvider callablePreviousProvider + * @depends testRegisterSignalHandler + * @requires function pcntl_signal_get_handler + */ + public function testRegisterCallablePreviousSignalHandler($callPrevious) + { + $this->setSignalHandler(SIGURG, SIG_IGN); + + $logger = new Logger('test', array($handler = new TestHandler)); + $errHandler = new SignalHandler($logger); + $previousCalled = 0; + pcntl_signal(SIGURG, function ($signo, array $siginfo = null) use (&$previousCalled) { + ++$previousCalled; + }); + $errHandler->registerSignalHandler(SIGURG, LogLevel::INFO, $callPrevious, false, false); + $this->assertTrue(posix_kill(posix_getpid(), SIGURG)); + $this->assertTrue(pcntl_signal_dispatch()); + $this->assertCount(1, $handler->getRecords()); + $this->assertTrue($handler->hasInfoThatContains('SIGURG')); + $this->assertSame($callPrevious ? 1 : 0, $previousCalled); + } + + public function callablePreviousProvider() + { + return array( + array(false), + array(true), + ); + } + + /** + * @dataProvider restartSyscallsProvider + * @depends testRegisterDefaultPreviousSignalHandler + * @requires function pcntl_fork + * @requires function pcntl_waitpid + */ + public function testRegisterSyscallRestartingSignalHandler($restartSyscalls) + { + $this->setSignalHandler(SIGURG, SIG_IGN); + + $parentPid = posix_getpid(); + $microtime = microtime(true); + + $pid = pcntl_fork(); + if ($pid === 0) { // Child. + usleep(100000); + posix_kill($parentPid, SIGURG); + usleep(100000); + exit(); + } + + $this->assertNotSame(-1, $pid); + $logger = new Logger('test', array($handler = new TestHandler)); + $errHandler = new SignalHandler($logger); + $errHandler->registerSignalHandler(SIGURG, LogLevel::INFO, false, $restartSyscalls, false); + if ($restartSyscalls) { + // pcntl_wait is expected to be restarted after the signal handler. + $this->assertNotSame(-1, pcntl_waitpid($pid, $status)); + } else { + // pcntl_wait is expected to be interrupted when the signal handler is invoked. + $this->assertSame(-1, pcntl_waitpid($pid, $status)); + } + $this->assertSame($restartSyscalls, microtime(true) - $microtime > 0.15); + $this->assertTrue(pcntl_signal_dispatch()); + $this->assertCount(1, $handler->getRecords()); + if ($restartSyscalls) { + // The child has already exited. + $this->assertSame(-1, pcntl_waitpid($pid, $status)); + } else { + // The child has not exited yet. + $this->assertNotSame(-1, pcntl_waitpid($pid, $status)); + } + } + + public function restartSyscallsProvider() + { + return array( + array(false), + array(true), + array(false), + array(true), + ); + } + + /** + * @dataProvider asyncProvider + * @depends testRegisterDefaultPreviousSignalHandler + * @requires function pcntl_async_signals + */ + public function testRegisterAsyncSignalHandler($initialAsync, $desiredAsync, $expectedBefore, $expectedAfter) + { + $this->setSignalHandler(SIGURG, SIG_IGN); + pcntl_async_signals($initialAsync); + + $logger = new Logger('test', array($handler = new TestHandler)); + $errHandler = new SignalHandler($logger); + $errHandler->registerSignalHandler(SIGURG, LogLevel::INFO, false, false, $desiredAsync); + $this->assertTrue(posix_kill(posix_getpid(), SIGURG)); + $this->assertCount($expectedBefore, $handler->getRecords()); + $this->assertTrue(pcntl_signal_dispatch()); + $this->assertCount($expectedAfter, $handler->getRecords()); + } + + public function asyncProvider() + { + return array( + array(false, false, 0, 1), + array(false, null, 0, 1), + array(false, true, 1, 1), + array(true, false, 0, 1), + array(true, null, 1, 1), + array(true, true, 1, 1), + ); + } + +} diff --git a/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/TestCase.php b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/TestCase.php new file mode 100644 index 0000000..4eb7b4c --- /dev/null +++ b/addons/weliam_smartcity/vendor/monolog/monolog/tests/Monolog/TestCase.php @@ -0,0 +1,58 @@ + + * + * For the full copyright and license information, please view the LICENSE + * file that was distributed with this source code. + */ + +namespace Monolog; + +class TestCase extends \PHPUnit_Framework_TestCase +{ + /** + * @return array Record + */ + protected function getRecord($level = Logger::WARNING, $message = 'test', $context = array()) + { + return array( + 'message' => $message, + 'context' => $context, + 'level' => $level, + 'level_name' => Logger::getLevelName($level), + 'channel' => 'test', + 'datetime' => \DateTime::createFromFormat('U.u', sprintf('%.6F', microtime(true))), + 'extra' => array(), + ); + } + + /** + * @return array + */ + protected function getMultipleRecords() + { + return array( + $this->getRecord(Logger::DEBUG, 'debug message 1'), + $this->getRecord(Logger::DEBUG, 'debug message 2'), + $this->getRecord(Logger::INFO, 'information'), + $this->getRecord(Logger::WARNING, 'warning'), + $this->getRecord(Logger::ERROR, 'error'), + ); + } + + /** + * @return Monolog\Formatter\FormatterInterface + */ + protected function getIdentityFormatter() + { + $formatter = $this->getMock('Monolog\\Formatter\\FormatterInterface'); + $formatter->expects($this->any()) + ->method('format') + ->will($this->returnCallback(function ($record) { return $record['message']; })); + + return $formatter; + } +} diff --git a/addons/weliam_smartcity/vendor/psr/cache/CHANGELOG.md b/addons/weliam_smartcity/vendor/psr/cache/CHANGELOG.md new file mode 100644 index 0000000..58ddab0 --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/cache/CHANGELOG.md @@ -0,0 +1,16 @@ +# Changelog + +All notable changes to this project will be documented in this file, in reverse chronological order by release. + +## 1.0.1 - 2016-08-06 + +### Fixed + +- Make spacing consistent in phpdoc annotations php-fig/cache#9 - chalasr +- Fix grammar in phpdoc annotations php-fig/cache#10 - chalasr +- Be more specific in docblocks that `getItems()` and `deleteItems()` take an array of strings (`string[]`) compared to just `array` php-fig/cache#8 - GrahamCampbell +- For `expiresAt()` and `expiresAfter()` in CacheItemInterface fix docblock to specify null as a valid parameters as well as an implementation of DateTimeInterface php-fig/cache#7 - GrahamCampbell + +## 1.0.0 - 2015-12-11 + +Initial stable release; reflects accepted PSR-6 specification diff --git a/addons/weliam_smartcity/vendor/psr/cache/LICENSE.txt b/addons/weliam_smartcity/vendor/psr/cache/LICENSE.txt new file mode 100644 index 0000000..b1c2c97 --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/cache/LICENSE.txt @@ -0,0 +1,19 @@ +Copyright (c) 2015 PHP Framework Interoperability Group + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in +all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +THE SOFTWARE. diff --git a/addons/weliam_smartcity/vendor/psr/cache/README.md b/addons/weliam_smartcity/vendor/psr/cache/README.md new file mode 100644 index 0000000..c8706ce --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/cache/README.md @@ -0,0 +1,9 @@ +PSR Cache +========= + +This repository holds all interfaces defined by +[PSR-6](http://www.php-fig.org/psr/psr-6/). + +Note that this is not a Cache implementation of its own. It is merely an +interface that describes a Cache implementation. See the specification for more +details. diff --git a/addons/weliam_smartcity/vendor/psr/cache/composer.json b/addons/weliam_smartcity/vendor/psr/cache/composer.json new file mode 100644 index 0000000..e828fec --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/cache/composer.json @@ -0,0 +1,25 @@ +{ + "name": "psr/cache", + "description": "Common interface for caching libraries", + "keywords": ["psr", "psr-6", "cache"], + "license": "MIT", + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "require": { + "php": ">=5.3.0" + }, + "autoload": { + "psr-4": { + "Psr\\Cache\\": "src/" + } + }, + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + } +} diff --git a/addons/weliam_smartcity/vendor/psr/cache/src/CacheException.php b/addons/weliam_smartcity/vendor/psr/cache/src/CacheException.php new file mode 100644 index 0000000..e27f22f --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/cache/src/CacheException.php @@ -0,0 +1,10 @@ +=5.3.0" + }, + "autoload": { + "psr-4": { + "Psr\\Container\\": "src/" + } + }, + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + } +} diff --git a/addons/weliam_smartcity/vendor/psr/container/src/ContainerExceptionInterface.php b/addons/weliam_smartcity/vendor/psr/container/src/ContainerExceptionInterface.php new file mode 100644 index 0000000..d35c6b4 --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/container/src/ContainerExceptionInterface.php @@ -0,0 +1,13 @@ +=5.3.0" + }, + "autoload": { + "psr-4": { + "Psr\\Http\\Message\\": "src/" + } + }, + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + } +} diff --git a/addons/weliam_smartcity/vendor/psr/http-message/src/MessageInterface.php b/addons/weliam_smartcity/vendor/psr/http-message/src/MessageInterface.php new file mode 100644 index 0000000..dd46e5e --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/http-message/src/MessageInterface.php @@ -0,0 +1,187 @@ +getHeaders() as $name => $values) { + * echo $name . ": " . implode(", ", $values); + * } + * + * // Emit headers iteratively: + * foreach ($message->getHeaders() as $name => $values) { + * foreach ($values as $value) { + * header(sprintf('%s: %s', $name, $value), false); + * } + * } + * + * While header names are not case-sensitive, getHeaders() will preserve the + * exact case in which headers were originally specified. + * + * @return string[][] Returns an associative array of the message's headers. Each + * key MUST be a header name, and each value MUST be an array of strings + * for that header. + */ + public function getHeaders(); + + /** + * Checks if a header exists by the given case-insensitive name. + * + * @param string $name Case-insensitive header field name. + * @return bool Returns true if any header names match the given header + * name using a case-insensitive string comparison. Returns false if + * no matching header name is found in the message. + */ + public function hasHeader($name); + + /** + * Retrieves a message header value by the given case-insensitive name. + * + * This method returns an array of all the header values of the given + * case-insensitive header name. + * + * If the header does not appear in the message, this method MUST return an + * empty array. + * + * @param string $name Case-insensitive header field name. + * @return string[] An array of string values as provided for the given + * header. If the header does not appear in the message, this method MUST + * return an empty array. + */ + public function getHeader($name); + + /** + * Retrieves a comma-separated string of the values for a single header. + * + * This method returns all of the header values of the given + * case-insensitive header name as a string concatenated together using + * a comma. + * + * NOTE: Not all header values may be appropriately represented using + * comma concatenation. For such headers, use getHeader() instead + * and supply your own delimiter when concatenating. + * + * If the header does not appear in the message, this method MUST return + * an empty string. + * + * @param string $name Case-insensitive header field name. + * @return string A string of values as provided for the given header + * concatenated together using a comma. If the header does not appear in + * the message, this method MUST return an empty string. + */ + public function getHeaderLine($name); + + /** + * Return an instance with the provided value replacing the specified header. + * + * While header names are case-insensitive, the casing of the header will + * be preserved by this function, and returned from getHeaders(). + * + * This method MUST be implemented in such a way as to retain the + * immutability of the message, and MUST return an instance that has the + * new and/or updated header and value. + * + * @param string $name Case-insensitive header field name. + * @param string|string[] $value Header value(s). + * @return static + * @throws \InvalidArgumentException for invalid header names or values. + */ + public function withHeader($name, $value); + + /** + * Return an instance with the specified header appended with the given value. + * + * Existing values for the specified header will be maintained. The new + * value(s) will be appended to the existing list. If the header did not + * exist previously, it will be added. + * + * This method MUST be implemented in such a way as to retain the + * immutability of the message, and MUST return an instance that has the + * new header and/or value. + * + * @param string $name Case-insensitive header field name to add. + * @param string|string[] $value Header value(s). + * @return static + * @throws \InvalidArgumentException for invalid header names or values. + */ + public function withAddedHeader($name, $value); + + /** + * Return an instance without the specified header. + * + * Header resolution MUST be done without case-sensitivity. + * + * This method MUST be implemented in such a way as to retain the + * immutability of the message, and MUST return an instance that removes + * the named header. + * + * @param string $name Case-insensitive header field name to remove. + * @return static + */ + public function withoutHeader($name); + + /** + * Gets the body of the message. + * + * @return StreamInterface Returns the body as a stream. + */ + public function getBody(); + + /** + * Return an instance with the specified message body. + * + * The body MUST be a StreamInterface object. + * + * This method MUST be implemented in such a way as to retain the + * immutability of the message, and MUST return a new instance that has the + * new body stream. + * + * @param StreamInterface $body Body. + * @return static + * @throws \InvalidArgumentException When the body is not valid. + */ + public function withBody(StreamInterface $body); +} diff --git a/addons/weliam_smartcity/vendor/psr/http-message/src/RequestInterface.php b/addons/weliam_smartcity/vendor/psr/http-message/src/RequestInterface.php new file mode 100644 index 0000000..a96d4fd --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/http-message/src/RequestInterface.php @@ -0,0 +1,129 @@ +getQuery()` + * or from the `QUERY_STRING` server param. + * + * @return array + */ + public function getQueryParams(); + + /** + * Return an instance with the specified query string arguments. + * + * These values SHOULD remain immutable over the course of the incoming + * request. They MAY be injected during instantiation, such as from PHP's + * $_GET superglobal, or MAY be derived from some other value such as the + * URI. In cases where the arguments are parsed from the URI, the data + * MUST be compatible with what PHP's parse_str() would return for + * purposes of how duplicate query parameters are handled, and how nested + * sets are handled. + * + * Setting query string arguments MUST NOT change the URI stored by the + * request, nor the values in the server params. + * + * This method MUST be implemented in such a way as to retain the + * immutability of the message, and MUST return an instance that has the + * updated query string arguments. + * + * @param array $query Array of query string arguments, typically from + * $_GET. + * @return static + */ + public function withQueryParams(array $query); + + /** + * Retrieve normalized file upload data. + * + * This method returns upload metadata in a normalized tree, with each leaf + * an instance of Psr\Http\Message\UploadedFileInterface. + * + * These values MAY be prepared from $_FILES or the message body during + * instantiation, or MAY be injected via withUploadedFiles(). + * + * @return array An array tree of UploadedFileInterface instances; an empty + * array MUST be returned if no data is present. + */ + public function getUploadedFiles(); + + /** + * Create a new instance with the specified uploaded files. + * + * This method MUST be implemented in such a way as to retain the + * immutability of the message, and MUST return an instance that has the + * updated body parameters. + * + * @param array $uploadedFiles An array tree of UploadedFileInterface instances. + * @return static + * @throws \InvalidArgumentException if an invalid structure is provided. + */ + public function withUploadedFiles(array $uploadedFiles); + + /** + * Retrieve any parameters provided in the request body. + * + * If the request Content-Type is either application/x-www-form-urlencoded + * or multipart/form-data, and the request method is POST, this method MUST + * return the contents of $_POST. + * + * Otherwise, this method may return any results of deserializing + * the request body content; as parsing returns structured content, the + * potential types MUST be arrays or objects only. A null value indicates + * the absence of body content. + * + * @return null|array|object The deserialized body parameters, if any. + * These will typically be an array or object. + */ + public function getParsedBody(); + + /** + * Return an instance with the specified body parameters. + * + * These MAY be injected during instantiation. + * + * If the request Content-Type is either application/x-www-form-urlencoded + * or multipart/form-data, and the request method is POST, use this method + * ONLY to inject the contents of $_POST. + * + * The data IS NOT REQUIRED to come from $_POST, but MUST be the results of + * deserializing the request body content. Deserialization/parsing returns + * structured data, and, as such, this method ONLY accepts arrays or objects, + * or a null value if nothing was available to parse. + * + * As an example, if content negotiation determines that the request data + * is a JSON payload, this method could be used to create a request + * instance with the deserialized parameters. + * + * This method MUST be implemented in such a way as to retain the + * immutability of the message, and MUST return an instance that has the + * updated body parameters. + * + * @param null|array|object $data The deserialized body data. This will + * typically be in an array or object. + * @return static + * @throws \InvalidArgumentException if an unsupported argument type is + * provided. + */ + public function withParsedBody($data); + + /** + * Retrieve attributes derived from the request. + * + * The request "attributes" may be used to allow injection of any + * parameters derived from the request: e.g., the results of path + * match operations; the results of decrypting cookies; the results of + * deserializing non-form-encoded message bodies; etc. Attributes + * will be application and request specific, and CAN be mutable. + * + * @return array Attributes derived from the request. + */ + public function getAttributes(); + + /** + * Retrieve a single derived request attribute. + * + * Retrieves a single derived request attribute as described in + * getAttributes(). If the attribute has not been previously set, returns + * the default value as provided. + * + * This method obviates the need for a hasAttribute() method, as it allows + * specifying a default value to return if the attribute is not found. + * + * @see getAttributes() + * @param string $name The attribute name. + * @param mixed $default Default value to return if the attribute does not exist. + * @return mixed + */ + public function getAttribute($name, $default = null); + + /** + * Return an instance with the specified derived request attribute. + * + * This method allows setting a single derived request attribute as + * described in getAttributes(). + * + * This method MUST be implemented in such a way as to retain the + * immutability of the message, and MUST return an instance that has the + * updated attribute. + * + * @see getAttributes() + * @param string $name The attribute name. + * @param mixed $value The value of the attribute. + * @return static + */ + public function withAttribute($name, $value); + + /** + * Return an instance that removes the specified derived request attribute. + * + * This method allows removing a single derived request attribute as + * described in getAttributes(). + * + * This method MUST be implemented in such a way as to retain the + * immutability of the message, and MUST return an instance that removes + * the attribute. + * + * @see getAttributes() + * @param string $name The attribute name. + * @return static + */ + public function withoutAttribute($name); +} diff --git a/addons/weliam_smartcity/vendor/psr/http-message/src/StreamInterface.php b/addons/weliam_smartcity/vendor/psr/http-message/src/StreamInterface.php new file mode 100644 index 0000000..f68f391 --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/http-message/src/StreamInterface.php @@ -0,0 +1,158 @@ + + * [user-info@]host[:port] + * + * + * If the port component is not set or is the standard port for the current + * scheme, it SHOULD NOT be included. + * + * @see https://tools.ietf.org/html/rfc3986#section-3.2 + * @return string The URI authority, in "[user-info@]host[:port]" format. + */ + public function getAuthority(); + + /** + * Retrieve the user information component of the URI. + * + * If no user information is present, this method MUST return an empty + * string. + * + * If a user is present in the URI, this will return that value; + * additionally, if the password is also present, it will be appended to the + * user value, with a colon (":") separating the values. + * + * The trailing "@" character is not part of the user information and MUST + * NOT be added. + * + * @return string The URI user information, in "username[:password]" format. + */ + public function getUserInfo(); + + /** + * Retrieve the host component of the URI. + * + * If no host is present, this method MUST return an empty string. + * + * The value returned MUST be normalized to lowercase, per RFC 3986 + * Section 3.2.2. + * + * @see http://tools.ietf.org/html/rfc3986#section-3.2.2 + * @return string The URI host. + */ + public function getHost(); + + /** + * Retrieve the port component of the URI. + * + * If a port is present, and it is non-standard for the current scheme, + * this method MUST return it as an integer. If the port is the standard port + * used with the current scheme, this method SHOULD return null. + * + * If no port is present, and no scheme is present, this method MUST return + * a null value. + * + * If no port is present, but a scheme is present, this method MAY return + * the standard port for that scheme, but SHOULD return null. + * + * @return null|int The URI port. + */ + public function getPort(); + + /** + * Retrieve the path component of the URI. + * + * The path can either be empty or absolute (starting with a slash) or + * rootless (not starting with a slash). Implementations MUST support all + * three syntaxes. + * + * Normally, the empty path "" and absolute path "/" are considered equal as + * defined in RFC 7230 Section 2.7.3. But this method MUST NOT automatically + * do this normalization because in contexts with a trimmed base path, e.g. + * the front controller, this difference becomes significant. It's the task + * of the user to handle both "" and "/". + * + * The value returned MUST be percent-encoded, but MUST NOT double-encode + * any characters. To determine what characters to encode, please refer to + * RFC 3986, Sections 2 and 3.3. + * + * As an example, if the value should include a slash ("/") not intended as + * delimiter between path segments, that value MUST be passed in encoded + * form (e.g., "%2F") to the instance. + * + * @see https://tools.ietf.org/html/rfc3986#section-2 + * @see https://tools.ietf.org/html/rfc3986#section-3.3 + * @return string The URI path. + */ + public function getPath(); + + /** + * Retrieve the query string of the URI. + * + * If no query string is present, this method MUST return an empty string. + * + * The leading "?" character is not part of the query and MUST NOT be + * added. + * + * The value returned MUST be percent-encoded, but MUST NOT double-encode + * any characters. To determine what characters to encode, please refer to + * RFC 3986, Sections 2 and 3.4. + * + * As an example, if a value in a key/value pair of the query string should + * include an ampersand ("&") not intended as a delimiter between values, + * that value MUST be passed in encoded form (e.g., "%26") to the instance. + * + * @see https://tools.ietf.org/html/rfc3986#section-2 + * @see https://tools.ietf.org/html/rfc3986#section-3.4 + * @return string The URI query string. + */ + public function getQuery(); + + /** + * Retrieve the fragment component of the URI. + * + * If no fragment is present, this method MUST return an empty string. + * + * The leading "#" character is not part of the fragment and MUST NOT be + * added. + * + * The value returned MUST be percent-encoded, but MUST NOT double-encode + * any characters. To determine what characters to encode, please refer to + * RFC 3986, Sections 2 and 3.5. + * + * @see https://tools.ietf.org/html/rfc3986#section-2 + * @see https://tools.ietf.org/html/rfc3986#section-3.5 + * @return string The URI fragment. + */ + public function getFragment(); + + /** + * Return an instance with the specified scheme. + * + * This method MUST retain the state of the current instance, and return + * an instance that contains the specified scheme. + * + * Implementations MUST support the schemes "http" and "https" case + * insensitively, and MAY accommodate other schemes if required. + * + * An empty scheme is equivalent to removing the scheme. + * + * @param string $scheme The scheme to use with the new instance. + * @return static A new instance with the specified scheme. + * @throws \InvalidArgumentException for invalid or unsupported schemes. + */ + public function withScheme($scheme); + + /** + * Return an instance with the specified user information. + * + * This method MUST retain the state of the current instance, and return + * an instance that contains the specified user information. + * + * Password is optional, but the user information MUST include the + * user; an empty string for the user is equivalent to removing user + * information. + * + * @param string $user The user name to use for authority. + * @param null|string $password The password associated with $user. + * @return static A new instance with the specified user information. + */ + public function withUserInfo($user, $password = null); + + /** + * Return an instance with the specified host. + * + * This method MUST retain the state of the current instance, and return + * an instance that contains the specified host. + * + * An empty host value is equivalent to removing the host. + * + * @param string $host The hostname to use with the new instance. + * @return static A new instance with the specified host. + * @throws \InvalidArgumentException for invalid hostnames. + */ + public function withHost($host); + + /** + * Return an instance with the specified port. + * + * This method MUST retain the state of the current instance, and return + * an instance that contains the specified port. + * + * Implementations MUST raise an exception for ports outside the + * established TCP and UDP port ranges. + * + * A null value provided for the port is equivalent to removing the port + * information. + * + * @param null|int $port The port to use with the new instance; a null value + * removes the port information. + * @return static A new instance with the specified port. + * @throws \InvalidArgumentException for invalid ports. + */ + public function withPort($port); + + /** + * Return an instance with the specified path. + * + * This method MUST retain the state of the current instance, and return + * an instance that contains the specified path. + * + * The path can either be empty or absolute (starting with a slash) or + * rootless (not starting with a slash). Implementations MUST support all + * three syntaxes. + * + * If the path is intended to be domain-relative rather than path relative then + * it must begin with a slash ("/"). Paths not starting with a slash ("/") + * are assumed to be relative to some base path known to the application or + * consumer. + * + * Users can provide both encoded and decoded path characters. + * Implementations ensure the correct encoding as outlined in getPath(). + * + * @param string $path The path to use with the new instance. + * @return static A new instance with the specified path. + * @throws \InvalidArgumentException for invalid paths. + */ + public function withPath($path); + + /** + * Return an instance with the specified query string. + * + * This method MUST retain the state of the current instance, and return + * an instance that contains the specified query string. + * + * Users can provide both encoded and decoded query characters. + * Implementations ensure the correct encoding as outlined in getQuery(). + * + * An empty query string value is equivalent to removing the query string. + * + * @param string $query The query string to use with the new instance. + * @return static A new instance with the specified query string. + * @throws \InvalidArgumentException for invalid query strings. + */ + public function withQuery($query); + + /** + * Return an instance with the specified URI fragment. + * + * This method MUST retain the state of the current instance, and return + * an instance that contains the specified URI fragment. + * + * Users can provide both encoded and decoded fragment characters. + * Implementations ensure the correct encoding as outlined in getFragment(). + * + * An empty fragment value is equivalent to removing the fragment. + * + * @param string $fragment The fragment to use with the new instance. + * @return static A new instance with the specified fragment. + */ + public function withFragment($fragment); + + /** + * Return the string representation as a URI reference. + * + * Depending on which components of the URI are present, the resulting + * string is either a full URI or relative reference according to RFC 3986, + * Section 4.1. The method concatenates the various components of the URI, + * using the appropriate delimiters: + * + * - If a scheme is present, it MUST be suffixed by ":". + * - If an authority is present, it MUST be prefixed by "//". + * - The path can be concatenated without delimiters. But there are two + * cases where the path has to be adjusted to make the URI reference + * valid as PHP does not allow to throw an exception in __toString(): + * - If the path is rootless and an authority is present, the path MUST + * be prefixed by "/". + * - If the path is starting with more than one "/" and no authority is + * present, the starting slashes MUST be reduced to one. + * - If a query is present, it MUST be prefixed by "?". + * - If a fragment is present, it MUST be prefixed by "#". + * + * @see http://tools.ietf.org/html/rfc3986#section-4.1 + * @return string + */ + public function __toString(); +} diff --git a/addons/weliam_smartcity/vendor/psr/simple-cache/.editorconfig b/addons/weliam_smartcity/vendor/psr/simple-cache/.editorconfig new file mode 100644 index 0000000..48542cb --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/simple-cache/.editorconfig @@ -0,0 +1,12 @@ +; This file is for unifying the coding style for different editors and IDEs. +; More information at http://editorconfig.org + +root = true + +[*] +charset = utf-8 +indent_size = 4 +indent_style = space +end_of_line = lf +insert_final_newline = true +trim_trailing_whitespace = true diff --git a/addons/weliam_smartcity/vendor/psr/simple-cache/LICENSE.md b/addons/weliam_smartcity/vendor/psr/simple-cache/LICENSE.md new file mode 100644 index 0000000..e49a7c8 --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/simple-cache/LICENSE.md @@ -0,0 +1,21 @@ +# The MIT License (MIT) + +Copyright (c) 2016 PHP Framework Interoperability Group + +> Permission is hereby granted, free of charge, to any person obtaining a copy +> of this software and associated documentation files (the "Software"), to deal +> in the Software without restriction, including without limitation the rights +> to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +> copies of the Software, and to permit persons to whom the Software is +> furnished to do so, subject to the following conditions: +> +> The above copyright notice and this permission notice shall be included in +> all copies or substantial portions of the Software. +> +> THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +> IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +> FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +> AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +> LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +> OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +> THE SOFTWARE. diff --git a/addons/weliam_smartcity/vendor/psr/simple-cache/README.md b/addons/weliam_smartcity/vendor/psr/simple-cache/README.md new file mode 100644 index 0000000..43641d1 --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/simple-cache/README.md @@ -0,0 +1,8 @@ +PHP FIG Simple Cache PSR +======================== + +This repository holds all interfaces related to PSR-16. + +Note that this is not a cache implementation of its own. It is merely an interface that describes a cache implementation. See [the specification](https://github.com/php-fig/fig-standards/blob/master/accepted/PSR-16-simple-cache.md) for more details. + +You can find implementations of the specification by looking for packages providing the [psr/simple-cache-implementation](https://packagist.org/providers/psr/simple-cache-implementation) virtual package. diff --git a/addons/weliam_smartcity/vendor/psr/simple-cache/composer.json b/addons/weliam_smartcity/vendor/psr/simple-cache/composer.json new file mode 100644 index 0000000..2978fa5 --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/simple-cache/composer.json @@ -0,0 +1,25 @@ +{ + "name": "psr/simple-cache", + "description": "Common interfaces for simple caching", + "keywords": ["psr", "psr-16", "cache", "simple-cache", "caching"], + "license": "MIT", + "authors": [ + { + "name": "PHP-FIG", + "homepage": "http://www.php-fig.org/" + } + ], + "require": { + "php": ">=5.3.0" + }, + "autoload": { + "psr-4": { + "Psr\\SimpleCache\\": "src/" + } + }, + "extra": { + "branch-alias": { + "dev-master": "1.0.x-dev" + } + } +} diff --git a/addons/weliam_smartcity/vendor/psr/simple-cache/src/CacheException.php b/addons/weliam_smartcity/vendor/psr/simple-cache/src/CacheException.php new file mode 100644 index 0000000..eba5381 --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/simple-cache/src/CacheException.php @@ -0,0 +1,10 @@ + value pairs. Cache keys that do not exist or are stale will have $default as value. + * + * @throws \Psr\SimpleCache\InvalidArgumentException + * MUST be thrown if $keys is neither an array nor a Traversable, + * or if any of the $keys are not a legal value. + */ + public function getMultiple($keys, $default = null); + + /** + * Persists a set of key => value pairs in the cache, with an optional TTL. + * + * @param iterable $values A list of key => value pairs for a multiple-set operation. + * @param null|int|\DateInterval $ttl Optional. The TTL value of this item. If no value is sent and + * the driver supports TTL then the library may set a default value + * for it or let the driver take care of that. + * + * @return bool True on success and false on failure. + * + * @throws \Psr\SimpleCache\InvalidArgumentException + * MUST be thrown if $values is neither an array nor a Traversable, + * or if any of the $values are not a legal value. + */ + public function setMultiple($values, $ttl = null); + + /** + * Deletes multiple cache items in a single operation. + * + * @param iterable $keys A list of string-based keys to be deleted. + * + * @return bool True if the items were successfully removed. False if there was an error. + * + * @throws \Psr\SimpleCache\InvalidArgumentException + * MUST be thrown if $keys is neither an array nor a Traversable, + * or if any of the $keys are not a legal value. + */ + public function deleteMultiple($keys); + + /** + * Determines whether an item is present in the cache. + * + * NOTE: It is recommended that has() is only to be used for cache warming type purposes + * and not to be used within your live applications operations for get/set, as this method + * is subject to a race condition where your has() will return true and immediately after, + * another script can remove it making the state of your app out of date. + * + * @param string $key The cache item key. + * + * @return bool + * + * @throws \Psr\SimpleCache\InvalidArgumentException + * MUST be thrown if the $key string is not a legal value. + */ + public function has($key); +} diff --git a/addons/weliam_smartcity/vendor/psr/simple-cache/src/InvalidArgumentException.php b/addons/weliam_smartcity/vendor/psr/simple-cache/src/InvalidArgumentException.php new file mode 100644 index 0000000..6a9524a --- /dev/null +++ b/addons/weliam_smartcity/vendor/psr/simple-cache/src/InvalidArgumentException.php @@ -0,0 +1,13 @@ +